diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md index e9ecf43..23af682 100644 --- a/node_modules/body-parser/HISTORY.md +++ b/node_modules/body-parser/HISTORY.md @@ -1,3 +1,9 @@ +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + 1.8.2 / 2014-09-15 ================== diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md index 7b9b4ed..094a52e 100644 --- a/node_modules/body-parser/README.md +++ b/node_modules/body-parser/README.md @@ -4,7 +4,7 @@ [![NPM Downloads][downloads-image]][downloads-url] [![Build Status][travis-image]][travis-url] [![Test Coverage][coveralls-image]][coveralls-url] -[![Gittip][gittip-image]][gittip-url] +[![Gratipay][gratipay-image]][gratipay-url] Node.js body parsing middleware. @@ -29,24 +29,7 @@ $ npm install body-parser ## API ```js -var express = require('express') var bodyParser = require('body-parser') - -var app = express() - -// parse application/x-www-form-urlencoded -app.use(bodyParser.urlencoded({ extended: false })) - -// parse application/json -app.use(bodyParser.json()) - -// parse application/vnd.api+json as json -app.use(bodyParser.json({ type: 'application/vnd.api+json' })) - -app.use(function (req, res, next) { - console.log(req.body) // populated! - next() -}) ``` ### bodyParser.json(options) @@ -124,6 +107,75 @@ The `verify` argument, if supplied, is called as `verify(req, res, buf, encoding A new `body` object containing the parsed data is populated on the `request` object after the middleware. +## Examples + +### express/connect top-level generic + +This example demonstrates adding a generic JSON and urlencoded parser as a top-level middleware, which will parse the bodies of all incoming requests. This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### express route-specific + +This example demonstrates adding body parsers specifically to the routes that need them. In general, this is the most recommend way to use body-parser with express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + if (!req.body) return res.sendStatus(400) + res.send('welcome, ' + res.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + if (!req.body) return res.sendStatus(400) + // create user in req.body +}) +``` + +### change content-type for parsers + +All the parsers accept a `type` option which allows you to change the `Content-Type` that the middleware will parse. + +```js +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + ## License [MIT](LICENSE) @@ -136,5 +188,5 @@ A new `body` object containing the parsed data is populated on the `request` obj [coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master [downloads-image]: https://img.shields.io/npm/dm/body-parser.svg?style=flat [downloads-url]: https://npmjs.org/package/body-parser -[gittip-image]: https://img.shields.io/gittip/dougwilson.svg?style=flat -[gittip-url]: https://www.gittip.com/dougwilson/ +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg?style=flat +[gratipay-url]: https://www.gratipay.com/dougwilson/ diff --git a/node_modules/body-parser/node_modules/bytes/package.json b/node_modules/body-parser/node_modules/bytes/package.json index dabaa22..61a79a5 100644 --- a/node_modules/body-parser/node_modules/bytes/package.json +++ b/node_modules/body-parser/node_modules/bytes/package.json @@ -45,5 +45,6 @@ ], "directories": {}, "_shasum": "3569ede8ba34315fab99c3e92cb04c7220de1fa8", - "_resolved": "https://registry.npmjs.org/bytes/-/bytes-1.0.0.tgz" + "_resolved": "https://registry.npmjs.org/bytes/-/bytes-1.0.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/body-parser/node_modules/media-typer/package.json b/node_modules/body-parser/node_modules/media-typer/package.json index 88bb0a8..4bd1a51 100644 --- a/node_modules/body-parser/node_modules/media-typer/package.json +++ b/node_modules/body-parser/node_modules/media-typer/package.json @@ -53,5 +53,6 @@ "tarball": "http://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz" + "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/body-parser/node_modules/on-finished/node_modules/ee-first/package.json b/node_modules/body-parser/node_modules/on-finished/node_modules/ee-first/package.json index f19f55e..54d04e1 100644 --- a/node_modules/body-parser/node_modules/on-finished/node_modules/ee-first/package.json +++ b/node_modules/body-parser/node_modules/on-finished/node_modules/ee-first/package.json @@ -59,5 +59,6 @@ "tarball": "http://registry.npmjs.org/ee-first/-/ee-first-1.0.5.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.0.5.tgz" + "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.0.5.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/body-parser/node_modules/on-finished/package.json b/node_modules/body-parser/node_modules/on-finished/package.json index bf7dcd6..b842572 100644 --- a/node_modules/body-parser/node_modules/on-finished/package.json +++ b/node_modules/body-parser/node_modules/on-finished/package.json @@ -45,7 +45,7 @@ "homepage": "https://github.com/jshttp/on-finished", "_id": "on-finished@2.1.0", "_shasum": "0c539f09291e8ffadde0c8a25850fb2cedc7022d", - "_from": "on-finished@~2.1.0", + "_from": "on-finished@2.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -66,5 +66,6 @@ "tarball": "http://registry.npmjs.org/on-finished/-/on-finished-2.1.0.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.1.0.tgz" + "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.1.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/body-parser/node_modules/qs/CHANGELOG.md b/node_modules/body-parser/node_modules/qs/CHANGELOG.md index 2f20704..ed42edc 100644 --- a/node_modules/body-parser/node_modules/qs/CHANGELOG.md +++ b/node_modules/body-parser/node_modules/qs/CHANGELOG.md @@ -1,5 +1,5 @@ -## [**2.2.3**](https://github.com/hapijs/qs/issues?milestone=12&state=open) +## [**2.2.3**](https://github.com/hapijs/qs/issues?milestone=12&state=closed) - [**#37**](https://github.com/hapijs/qs/issues/37) parser discards first empty value in array - [**#36**](https://github.com/hapijs/qs/issues/36) Update to lab 4.x @@ -8,45 +8,22 @@ - [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty - [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? ---- - - - -## [**2.2.2**](https://github.com/hapijs/qs/issues?milestone=11&state=closed) -- [**#33**](https://github.com/hapijs/qs/issues/33) Error when plain object in a value -- [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty -- [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? - ---- - - - -## [**2.2.2**](https://github.com/hapijs/qs/issues?milestone=11&state=open) -- [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty -- [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? - ---- - - -# 2014-08-28 -95 commits against 24 issues, over a month [`32edf33`](https://github.com/hapijs/qs/commit/32edf33)⎆[`b1e7b53`](https://github.com/hapijs/qs/commit/b1e7b53) - ## [**2.2.1**](https://github.com/hapijs/qs/issues?milestone=10&state=closed) - [**#32**](https://github.com/hapijs/qs/issues/32) account for circular references properly, closes #31 - [**#31**](https://github.com/hapijs/qs/issues/31) qs.parse stackoverflow on circular objects ## [**2.2.0**](https://github.com/hapijs/qs/issues?milestone=9&state=closed) +- [**#26**](https://github.com/hapijs/qs/issues/26) Don't use Buffer global if it's not present - [**#30**](https://github.com/hapijs/qs/issues/30) Bug when merging non-object values into arrays - [**#29**](https://github.com/hapijs/qs/issues/29) Don't call Utils.clone at the top of Utils.merge -- [**#26**](https://github.com/hapijs/qs/issues/26) Don't use Buffer global if it's not present - [**#23**](https://github.com/hapijs/qs/issues/23) Ability to not limit parameters? ## [**2.1.0**](https://github.com/hapijs/qs/issues?milestone=8&state=closed) - [**#22**](https://github.com/hapijs/qs/issues/22) Enable using a RegExp as delimiter ## [**2.0.0**](https://github.com/hapijs/qs/issues?milestone=7&state=closed) -- [**#20**](https://github.com/hapijs/qs/issues/20) Configurable parametersLimit - [**#18**](https://github.com/hapijs/qs/issues/18) Why is there arrayLimit? +- [**#20**](https://github.com/hapijs/qs/issues/20) Configurable parametersLimit - [**#21**](https://github.com/hapijs/qs/issues/21) make all limits optional, for #18, for #20 ## [**1.2.2**](https://github.com/hapijs/qs/issues?milestone=6&state=closed) @@ -68,11 +45,3 @@ ## [**1.0.2**](https://github.com/hapijs/qs/issues?milestone=2&state=closed) - [**#5**](https://github.com/hapijs/qs/issues/5) array holes incorrectly copied into object on large index - -## Issues -- [**#25**](https://github.com/hapijs/qs/issues/25) Remove references to Buffer -- [**#11**](https://github.com/hapijs/qs/issues/11) Flattened keys in array does not parse correctly -- [**#8**](https://github.com/hapijs/qs/issues/8) Square brackets should be URI encoded -- [**#3**](https://github.com/hapijs/qs/issues/3) Update README.md -- [**#2**](https://github.com/hapijs/qs/issues/2) Add travis and rework package - diff --git a/node_modules/body-parser/node_modules/qs/lib/parse.js b/node_modules/body-parser/node_modules/qs/lib/parse.js index f2e0a0d..3627397 100755 --- a/node_modules/body-parser/node_modules/qs/lib/parse.js +++ b/node_modules/body-parser/node_modules/qs/lib/parse.js @@ -58,8 +58,10 @@ internals.parseObject = function (chain, val, options) { else { var cleanRoot = root[0] === '[' && root[root.length - 1] === ']' ? root.slice(1, root.length - 1) : root; var index = parseInt(cleanRoot, 10); + var indexString = '' + index; if (!isNaN(index) && root !== cleanRoot && + indexString === cleanRoot && index <= options.arrayLimit) { obj = []; diff --git a/node_modules/body-parser/node_modules/qs/package.json b/node_modules/body-parser/node_modules/qs/package.json index 488cb37..e30cd41 100755 --- a/node_modules/body-parser/node_modules/qs/package.json +++ b/node_modules/body-parser/node_modules/qs/package.json @@ -1,6 +1,6 @@ { "name": "qs", - "version": "2.2.3", + "version": "2.2.4", "description": "A querystring parser that supports nesting and arrays, with a depth limit", "homepage": "https://github.com/hapijs/qs", "main": "index.js", @@ -29,13 +29,13 @@ "url": "http://github.com/hapijs/qs/raw/master/LICENSE" } ], - "gitHead": "904528124a6eb879ebc5197376e9613069414f67", + "gitHead": "9775242fa57cbfa4db62e4b0aa4f82b23e2ce6af", "bugs": { "url": "https://github.com/hapijs/qs/issues" }, - "_id": "qs@2.2.3", - "_shasum": "6139c1f47960eff5655e56aab0ef9f6dd16d4eeb", - "_from": "qs@2.2.3", + "_id": "qs@2.2.4", + "_shasum": "2e9fbcd34b540e3421c924ecd01e90aa975319c8", + "_from": "qs@2.2.4", "_npmVersion": "1.4.23", "_npmUser": { "name": "nlf", @@ -52,9 +52,9 @@ } ], "dist": { - "shasum": "6139c1f47960eff5655e56aab0ef9f6dd16d4eeb", - "tarball": "http://registry.npmjs.org/qs/-/qs-2.2.3.tgz" + "shasum": "2e9fbcd34b540e3421c924ecd01e90aa975319c8", + "tarball": "http://registry.npmjs.org/qs/-/qs-2.2.4.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/qs/-/qs-2.2.3.tgz" + "_resolved": "https://registry.npmjs.org/qs/-/qs-2.2.4.tgz" } diff --git a/node_modules/body-parser/node_modules/qs/test/parse.js b/node_modules/body-parser/node_modules/qs/test/parse.js index 15a4888..22083f6 100755 --- a/node_modules/body-parser/node_modules/qs/test/parse.js +++ b/node_modules/body-parser/node_modules/qs/test/parse.js @@ -104,6 +104,12 @@ describe('#parse', function () { done(); }); + it('supports keys that begin with a number', function (done) { + + expect(Qs.parse('a[12b]=c')).to.deep.equal({ a: { '12b': 'c' } }); + done(); + }); + it('supports encoded = signs', function (done) { expect(Qs.parse('he%3Dllo=th%3Dere')).to.deep.equal({ 'he=llo': 'th=ere' }); diff --git a/node_modules/body-parser/node_modules/raw-body/package.json b/node_modules/body-parser/node_modules/raw-body/package.json index 51c1eb8..bb2130c 100644 --- a/node_modules/body-parser/node_modules/raw-body/package.json +++ b/node_modules/body-parser/node_modules/raw-body/package.json @@ -67,5 +67,6 @@ ], "directories": {}, "_shasum": "978230a156a5548f42eef14de22d0f4f610083d1", - "_resolved": "https://registry.npmjs.org/raw-body/-/raw-body-1.3.0.tgz" + "_resolved": "https://registry.npmjs.org/raw-body/-/raw-body-1.3.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json index b74c7e9..60876be 100644 --- a/node_modules/body-parser/package.json +++ b/node_modules/body-parser/package.json @@ -1,7 +1,7 @@ { "name": "body-parser", "description": "Node.js body parsing middleware", - "version": "1.8.2", + "version": "1.8.3", "contributors": [ { "name": "Douglas Christopher Wilson", @@ -24,7 +24,7 @@ "iconv-lite": "0.4.4", "media-typer": "0.3.0", "on-finished": "2.1.0", - "qs": "2.2.3", + "qs": "2.2.4", "raw-body": "1.3.0", "type-is": "~1.5.1" }, @@ -48,14 +48,14 @@ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/", "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/" }, - "gitHead": "caf6e06cf7b4e3d31717e75e31dc2efc873a1047", + "gitHead": "b4131a69a898ec4238679bc8bad7aa5359a7ecc7", "bugs": { "url": "https://github.com/expressjs/body-parser/issues" }, "homepage": "https://github.com/expressjs/body-parser", - "_id": "body-parser@1.8.2", - "_shasum": "cb55519e748f2ac89bd3c8e34cb759d391c4d67d", - "_from": "body-parser@1.8.2", + "_id": "body-parser@1.8.3", + "_shasum": "922b82e6448d654f2f5197574ceacefc04a6a8af", + "_from": "body-parser@1.8.3", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -88,9 +88,9 @@ } ], "dist": { - "shasum": "cb55519e748f2ac89bd3c8e34cb759d391c4d67d", - "tarball": "http://registry.npmjs.org/body-parser/-/body-parser-1.8.2.tgz" + "shasum": "922b82e6448d654f2f5197574ceacefc04a6a8af", + "tarball": "http://registry.npmjs.org/body-parser/-/body-parser-1.8.3.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.8.2.tgz" + "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.8.3.tgz" } diff --git a/node_modules/csurf/HISTORY.md b/node_modules/csurf/HISTORY.md new file mode 100644 index 0000000..9bddd32 --- /dev/null +++ b/node_modules/csurf/HISTORY.md @@ -0,0 +1,50 @@ +1.6.1 / 2014-09-05 +================== + + * bump cookie-signature + +1.6.0 / 2014-09-03 +================== + + * set `code` property on CSRF token errors + +1.5.0 / 2014-08-24 +================== + + * add `ignoreMethods` option + +1.4.1 / 2014-08-22 +================== + + * csrf-tokens -> csrf + +1.4.0 / 2014-07-30 +================== + + * Support changing `req.session` after `csurf` middleware + - Calling `res.csrfToken()` after `req.session.destroy()` will now work + +1.3.0 / 2014-07-03 +================== + + * add support for environments without `res.cookie` (connect@3) + +1.2.2 / 2014-06-18 +================== + + * bump csrf-tokens + +1.2.1 / 2014-06-09 +================== + + * refactor to use csrf-tokens + +1.2.0 / 2014-05-13 +================== + + * add support for double-submit cookie + +1.1.0 / 2014-04-06 +================== + + * add constant-time string compare diff --git a/node_modules/mysql/node_modules/bignumber.js/LICENCE b/node_modules/csurf/LICENSE similarity index 92% rename from node_modules/mysql/node_modules/bignumber.js/LICENCE rename to node_modules/csurf/LICENSE index c045569..f23dca8 100644 --- a/node_modules/mysql/node_modules/bignumber.js/LICENCE +++ b/node_modules/csurf/LICENSE @@ -1,23 +1,22 @@ -The MIT Expat Licence. - -Copyright (c) 2012 Michael Mclaughlin - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - +(The MIT License) + +Copyright (c) 2014 Jonathan Ong + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/csurf/README.md b/node_modules/csurf/README.md new file mode 100644 index 0000000..e2a807a --- /dev/null +++ b/node_modules/csurf/README.md @@ -0,0 +1,78 @@ +# csurf + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +Node.js [CSRF](https://en.wikipedia.org/wiki/Cross-site_request_forgery) protection middleware. + +Requires either a session middleware or [cookie-parser](https://github.com/expressjs/cookie-parser) to be initialized first. +- [session](https://github.com/expressjs/session) +- [cookie-session](https://github.com/expressjs/cookie-session) + +### Install + +```sh +$ npm install csurf +``` + +## API + +```js +var csrf = require('csurf') +``` + +### csrf(options) + +This middleware adds a `req.csrfToken()` function to make a token which should be added to requests which mutate state, within a hidden form field, query-string etc. This token is validated against the visitor's session or csrf cookie. + +#### Options + +- `value` a function accepting the request, returning the token. + - The default function checks four possible token locations: + - `_csrf` parameter in `req.body` generated by the `body-parser` middleware. + - `_csrf` parameter in `req.query` generated by `query()`. + - `x-csrf-token` and `x-xsrf-token` header fields. +- `cookie` set to a truthy value to enable cookie-based instead of session-based csrf secret storage. + - If `cookie` is an object, these options can be configured, otherwise defaults are used: + - `key` the name of the cookie to use (defaults to `_csrf`) to store the csrf secret + - any other [res.cookie](http://expressjs.com/4x/api.html#res.cookie) options can be set +- `ignoreMethods` An array of the methods CSRF token checking will disabled. + (default: `['GET', 'HEAD', 'OPTIONS']`) + +### req.csrfToken() + +Lazy-loads the token associated with the request. + +## Example + +```js +var express = require('express') +var csrf = require('csurf') + +var app = express() +app.use(csrf()) + +// error handler +app.use(function (err, req, res, next) { + if (err.code !== 'EBADCSRFTOKEN') return next(err) + + // handle CSRF token errors here + res.status(403) + res.send('session has expired or form tampered with') +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/csurf.svg?style=flat +[npm-url]: https://npmjs.org/package/csurf +[travis-image]: https://img.shields.io/travis/expressjs/csurf.svg?style=flat +[travis-url]: https://travis-ci.org/expressjs/csurf +[coveralls-image]: https://img.shields.io/coveralls/expressjs/csurf.svg?style=flat +[coveralls-url]: https://coveralls.io/r/expressjs/csurf?branch=master +[downloads-image]: https://img.shields.io/npm/dm/csurf.svg?style=flat +[downloads-url]: https://npmjs.org/package/csurf diff --git a/node_modules/csurf/index.js b/node_modules/csurf/index.js new file mode 100644 index 0000000..cda35cc --- /dev/null +++ b/node_modules/csurf/index.js @@ -0,0 +1,238 @@ +/*! + * csurf + * Copyright(c) 2011 Sencha Inc. + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Cookie = require('cookie'); +var csrfTokens = require('csrf'); +var sign = require('cookie-signature').sign; + +/** + * CSRF protection middleware. + * + * This middleware adds a `req.csrfToken()` function to make a token + * which should be added to requests which mutate + * state, within a hidden form field, query-string etc. This + * token is validated against the visitor's session. + * + * @param {Object} options + * @return {Function} middleware + * @api public + */ + +module.exports = function csurf(options) { + options = options || {}; + + // get value getter + var value = options.value || defaultValue + + // token repo + var tokens = csrfTokens(options); + + // default cookie key + if (options.cookie && !options.cookie.key) { + options.cookie.key = '_csrf' + } + + // ignored methods + var ignoreMethods = options.ignoreMethods === undefined + ? ['GET', 'HEAD', 'OPTIONS'] + : options.ignoreMethods + + if (!Array.isArray(ignoreMethods)) { + throw new TypeError('option ignoreMethods must be an array') + } + + // generate lookup + var ignoreMethod = getIgnoredMethods(ignoreMethods) + + return function csrf(req, res, next) { + var secret = getsecret(req, options.cookie) + var token + + // lazy-load token getter + req.csrfToken = function csrfToken() { + var sec = !options.cookie + ? getsecret(req, options.cookie) + : secret + + // use cached token if secret has not changed + if (token && sec === secret) { + return token + } + + // generate & set new secret + if (sec === undefined) { + sec = tokens.secretSync() + setsecret(req, res, sec, options.cookie) + } + + // update changed secret + secret = sec + + // create new token + token = tokens.create(secret) + + return token + } + + // generate & set secret + if (!secret) { + secret = tokens.secretSync() + setsecret(req, res, secret, options.cookie) + } + + // verify the incoming token + if (!ignoreMethod[req.method]) { + verifytoken(req, tokens, secret, value(req)) + } + + next() + } +}; + +/** + * Default value function, checking the `req.body` + * and `req.query` for the CSRF token. + * + * @param {IncomingMessage} req + * @return {String} + * @api private + */ + +function defaultValue(req) { + return (req.body && req.body._csrf) + || (req.query && req.query._csrf) + || (req.headers['x-csrf-token']) + || (req.headers['x-xsrf-token']); +} + +/** + * Get a lookup of ignored methods. + * + * @param {array} methods + * @returns {object} + * @api private + */ + +function getIgnoredMethods(methods) { + var obj = Object.create(null) + + for (var i = 0; i < methods.length; i++) { + var method = methods[i].toUpperCase() + obj[method] = true + } + + return obj +} + +/** + * Get the token secret from the request. + * + * @param {IncomingMessage} req + * @param {Object} [cookie] + * @api private + */ + +function getsecret(req, cookie) { + var secret + + if (cookie) { + // get secret from cookie + var bag = cookie.signed + ? 'signedCookies' + : 'cookies' + + secret = req[bag][cookie.key] + } else if (req.session) { + // get secret from session + secret = req.session.csrfSecret + } else { + throw new Error('misconfigured csrf') + } + + return secret +} + +/** + * Set a cookie on the HTTP response. + * + * @param {OutgoingMessage} res + * @param {string} name + * @param {string} val + * @param {Object} [options] + * @api private + */ + +function setcookie(res, name, val, options) { + var data = Cookie.serialize(name, val, options); + + var prev = res.getHeader('set-cookie') || []; + var header = Array.isArray(prev) ? prev.concat(data) + : Array.isArray(data) ? [prev].concat(data) + : [prev, data]; + + res.setHeader('set-cookie', header); +} + +/** + * Set the token secret on the request. + * + * @param {IncomingMessage} req + * @param {OutgoingMessage} res + * @param {string} val + * @param {Object} [cookie] + * @api private + */ + +function setsecret(req, res, val, cookie) { + if (cookie) { + // set secret on cookie + if (cookie.signed) { + var secret = req.secret + + if (!secret) { + throw new Error('cookieParser("secret") required for signed cookies') + } + + val = 's:' + sign(val, secret) + } + + setcookie(res, cookie.key, val, cookie); + } else if (req.session) { + // set secret on session + req.session.csrfSecret = val + } else { + /* istanbul ignore next: should never actually run */ + throw new Error('misconfigured csrf') + } +} + +/** + * Verify the token. + * + * @param {IncomingMessage} req + * @param {Object} tokens + * @param {string} secret + * @param {string} val + * @api private + */ + +function verifytoken(req, tokens, secret, val) { + // valid token + if (tokens.verify(secret, val)) { + return + } + + var err = new Error('invalid csrf token') + err.status = 403 + err.code = 'EBADCSRFTOKEN' + throw err +} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/.npmignore b/node_modules/csurf/node_modules/cookie-signature/.npmignore similarity index 69% rename from node_modules/express/node_modules/finalhandler/node_modules/debug/.npmignore rename to node_modules/csurf/node_modules/cookie-signature/.npmignore index 7e6163d..f1250e5 100644 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/.npmignore +++ b/node_modules/csurf/node_modules/cookie-signature/.npmignore @@ -1,6 +1,4 @@ support test examples -example *.sock -dist diff --git a/node_modules/csurf/node_modules/cookie-signature/History.md b/node_modules/csurf/node_modules/cookie-signature/History.md new file mode 100644 index 0000000..2bbc4b3 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie-signature/History.md @@ -0,0 +1,27 @@ +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/csurf/node_modules/cookie-signature/Makefile b/node_modules/csurf/node_modules/cookie-signature/Makefile new file mode 100644 index 0000000..4e9c8d3 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie-signature/Makefile @@ -0,0 +1,7 @@ + +test: + @./node_modules/.bin/mocha \ + --require should \ + --reporter spec + +.PHONY: test \ No newline at end of file diff --git a/node_modules/csurf/node_modules/cookie-signature/Readme.md b/node_modules/csurf/node_modules/cookie-signature/Readme.md new file mode 100644 index 0000000..2559e84 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/csurf/node_modules/cookie-signature/index.js b/node_modules/csurf/node_modules/cookie-signature/index.js new file mode 100644 index 0000000..b63bf84 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError('cookie required'); + if ('string' != typeof secret) throw new TypeError('secret required'); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError('cookie required'); + if ('string' != typeof secret) throw new TypeError('secret required'); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/node_modules/csurf/node_modules/cookie-signature/package.json b/node_modules/csurf/node_modules/cookie-signature/package.json new file mode 100644 index 0000000..741961f --- /dev/null +++ b/node_modules/csurf/node_modules/cookie-signature/package.json @@ -0,0 +1,56 @@ +{ + "name": "cookie-signature", + "version": "1.0.5", + "description": "Sign and unsign cookies", + "keywords": [ + "cookie", + "sign", + "unsign" + ], + "author": { + "name": "TJ Holowaychuk", + "email": "tj@learnboost.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/visionmedia/node-cookie-signature.git" + }, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "main": "index", + "gitHead": "73ed69b511b3ef47555d71b4ed1deea9e5ed6e1f", + "bugs": { + "url": "https://github.com/visionmedia/node-cookie-signature/issues" + }, + "homepage": "https://github.com/visionmedia/node-cookie-signature", + "_id": "cookie-signature@1.0.5", + "scripts": {}, + "_shasum": "a122e3f1503eca0f5355795b0711bb2368d450f9", + "_from": "cookie-signature@1.0.5", + "_npmVersion": "1.4.20", + "_npmUser": { + "name": "natevw", + "email": "natevw@yahoo.com" + }, + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "natevw", + "email": "natevw@yahoo.com" + } + ], + "dist": { + "shasum": "a122e3f1503eca0f5355795b0711bb2368d450f9", + "tarball": "http://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.5.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.5.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/cookie/.npmignore b/node_modules/csurf/node_modules/cookie/.npmignore new file mode 100644 index 0000000..efab07f --- /dev/null +++ b/node_modules/csurf/node_modules/cookie/.npmignore @@ -0,0 +1,2 @@ +test +.travis.yml diff --git a/node_modules/csurf/node_modules/cookie/LICENSE b/node_modules/csurf/node_modules/cookie/LICENSE new file mode 100644 index 0000000..249d9de --- /dev/null +++ b/node_modules/csurf/node_modules/cookie/LICENSE @@ -0,0 +1,9 @@ +// MIT License + +Copyright (C) Roman Shtylman + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/csurf/node_modules/cookie/README.md b/node_modules/csurf/node_modules/cookie/README.md new file mode 100644 index 0000000..3170b4b --- /dev/null +++ b/node_modules/csurf/node_modules/cookie/README.md @@ -0,0 +1,44 @@ +# cookie [![Build Status](https://secure.travis-ci.org/defunctzombie/node-cookie.png?branch=master)](http://travis-ci.org/defunctzombie/node-cookie) # + +cookie is a basic cookie parser and serializer. It doesn't make assumptions about how you are going to deal with your cookies. It basically just provides a way to read and write the HTTP cookie headers. + +See [RFC6265](http://tools.ietf.org/html/rfc6265) for details about the http header for cookies. + +## how? + +``` +npm install cookie +``` + +```javascript +var cookie = require('cookie'); + +var hdr = cookie.serialize('foo', 'bar'); +// hdr = 'foo=bar'; + +var cookies = cookie.parse('foo=bar; cat=meow; dog=ruff'); +// cookies = { foo: 'bar', cat: 'meow', dog: 'ruff' }; +``` + +## more + +The serialize function takes a third parameter, an object, to set cookie options. See the RFC for valid values. + +### path +> cookie path + +### expires +> absolute expiration date for the cookie (Date object) + +### maxAge +> relative max age of the cookie from when the client receives it (seconds) + +### domain +> domain for the cookie + +### secure +> true or false + +### httpOnly +> true or false + diff --git a/node_modules/csurf/node_modules/cookie/index.js b/node_modules/csurf/node_modules/cookie/index.js new file mode 100644 index 0000000..00d54a7 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie/index.js @@ -0,0 +1,75 @@ + +/// Serialize the a name value pair into a cookie string suitable for +/// http headers. An optional options object specified cookie parameters +/// +/// serialize('foo', 'bar', { httpOnly: true }) +/// => "foo=bar; httpOnly" +/// +/// @param {String} name +/// @param {String} val +/// @param {Object} options +/// @return {String} +var serialize = function(name, val, opt){ + opt = opt || {}; + var enc = opt.encode || encode; + var pairs = [name + '=' + enc(val)]; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + if (isNaN(maxAge)) throw new Error('maxAge should be a Number'); + pairs.push('Max-Age=' + maxAge); + } + + if (opt.domain) pairs.push('Domain=' + opt.domain); + if (opt.path) pairs.push('Path=' + opt.path); + if (opt.expires) pairs.push('Expires=' + opt.expires.toUTCString()); + if (opt.httpOnly) pairs.push('HttpOnly'); + if (opt.secure) pairs.push('Secure'); + + return pairs.join('; '); +}; + +/// Parse the given cookie header string into an object +/// The object has the various cookies as keys(names) => values +/// @param {String} str +/// @return {Object} +var parse = function(str, opt) { + opt = opt || {}; + var obj = {} + var pairs = str.split(/; */); + var dec = opt.decode || decode; + + pairs.forEach(function(pair) { + var eq_idx = pair.indexOf('=') + + // skip things that don't look like key=value + if (eq_idx < 0) { + return; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + try { + obj[key] = dec(val); + } catch (e) { + obj[key] = val; + } + } + }); + + return obj; +}; + +var encode = encodeURIComponent; +var decode = decodeURIComponent; + +module.exports.serialize = serialize; +module.exports.parse = parse; diff --git a/node_modules/csurf/node_modules/cookie/package.json b/node_modules/csurf/node_modules/cookie/package.json new file mode 100644 index 0000000..7dbb395 --- /dev/null +++ b/node_modules/csurf/node_modules/cookie/package.json @@ -0,0 +1,54 @@ +{ + "author": { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com" + }, + "name": "cookie", + "description": "cookie parsing and serialization", + "version": "0.1.2", + "repository": { + "type": "git", + "url": "git://github.com/shtylman/node-cookie.git" + }, + "keywords": [ + "cookie", + "cookies" + ], + "main": "index.js", + "scripts": { + "test": "mocha" + }, + "dependencies": {}, + "devDependencies": { + "mocha": "1.x.x" + }, + "optionalDependencies": {}, + "engines": { + "node": "*" + }, + "bugs": { + "url": "https://github.com/shtylman/node-cookie/issues" + }, + "homepage": "https://github.com/shtylman/node-cookie", + "_id": "cookie@0.1.2", + "dist": { + "shasum": "72fec3d24e48a3432073d90c12642005061004b1", + "tarball": "http://registry.npmjs.org/cookie/-/cookie-0.1.2.tgz" + }, + "_from": "cookie@0.1.2", + "_npmVersion": "1.4.6", + "_npmUser": { + "name": "shtylman", + "email": "shtylman@gmail.com" + }, + "maintainers": [ + { + "name": "shtylman", + "email": "shtylman@gmail.com" + } + ], + "directories": {}, + "_shasum": "72fec3d24e48a3432073d90c12642005061004b1", + "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.1.2.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/csrf/README.md b/node_modules/csurf/node_modules/csrf/README.md new file mode 100644 index 0000000..e5bbd38 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/README.md @@ -0,0 +1,81 @@ +# CSRF + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![Dependency Status][david-image]][david-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +Logic behind CSRF token creation and verification. +Read [Understanding-CSRF](http://www.jongleberry.com/understanding-csrf.html) for more information on CSRF. +Use this module to create custom CSRF middleware and what not. + +### Install + +```bash +$ npm install csrf-tokens +``` + +## API + +```js +var tokens = require('csrf-tokens')(options) + +var secret = tokens.secretSync() +var token = tokens.create(secret) +var valid = tokens.verify(secret, token) +``` + +### Options + +- `secretLength: 24` - the byte length of the secret key +- `saltLength: 8` - the string length of the salt +- `tokensize: (secret, salt) => token` - a custom token creation function + +#### tokens.secret([cb]) + +Asynchronously create a new `secret` of length `secretLength`. +If `cb` is not defined, a promise is returned. +You don't have to use this. + +```js +tokens.secret().then(function (secret) { + +}) + +tokens.secret(function (err, secret) { + +}) +``` + +#### var secret = tokens.secretSync() + +Synchronous version of `tokens.secret()` + +#### var token = tokens.token(secret) + +Create a CSRF token based on a `secret`. +This is the token you pass to clients. + +#### var valid = tokens.verify(secret, token) + +Check whether a CSRF token is valid based on a `secret`. +If it's not valid, you should probably throw a `403` error. + +## [License (MIT)](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/csrf.svg?style=flat-square +[npm-url]: https://npmjs.org/package/csrf +[github-tag]: http://img.shields.io/github/tag/pillarjs/csrf.svg?style=flat-square +[github-url]: https://github.com/pillarjs/csrf/tags +[travis-image]: https://img.shields.io/travis/pillarjs/csrf.svg?style=flat-square +[travis-url]: https://travis-ci.org/pillarjs/csrf +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/csrf.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/pillarjs/csrf?branch=master +[david-image]: http://img.shields.io/david/pillarjs/csrf.svg?style=flat-square +[david-url]: https://david-dm.org/pillarjs/csrf +[license-image]: http://img.shields.io/npm/l/csrf.svg?style=flat-square +[license-url]: LICENSE +[downloads-image]: http://img.shields.io/npm/dm/csrf.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/csrf diff --git a/node_modules/csurf/node_modules/csrf/index.js b/node_modules/csurf/node_modules/csrf/index.js new file mode 100644 index 0000000..26c6524 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/index.js @@ -0,0 +1,59 @@ + +var rndm = require('rndm') +var scmp = require('scmp') +var uid = require('uid-safe') +var crypto = require('crypto') +var escape = require('base64-url').escape + +module.exports = csrfTokens + +function csrfTokens(options) { + options = options || {} + + // adjustable lengths + var secretLength = options.secretLength || 18 // the longer the better + var saltLength = options.saltLength || 8 // doesn't need to be long + + // convert a secret + a salt to a token + // this does NOT have to be cryptographically secure, so we don't use HMAC, + // and we use sha1 because sha256 is unnecessarily long for cookies and stuff + var tokenize = options.tokenize || csrfTokens.tokenize + + return { + // create a secret key + // this __should__ be cryptographically secure, + // but generally client's can't/shouldn't-be-able-to access this so it really doesn't matter. + secret: function secret(cb) { + return uid(secretLength, cb) + }, + + // a sync version of secret() + secretSync: function secretSync() { + return uid.sync(secretLength) + }, + + // create a csrf token + create: function create(secret) { + return tokenize(secret, rndm(saltLength)) + }, + + // verify whether a token is valid + verify: function verify(secret, token) { + if (!secret || typeof secret !== 'string') return false + if (!token || typeof token !== 'string') return false + var expected = tokenize(secret, token.split('-')[0]) + if (!expected) return false + return scmp(token, expected) + }, + } +} + +csrfTokens.tokenize = function tokenize(secret, salt) { + var hash = escape(crypto + .createHash('sha1') + .update(salt) + .update('-') + .update(secret) + .digest('base64')) + return salt + '-' + hash +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.npmignore b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.npmignore new file mode 100644 index 0000000..b0e8ee7 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.npmignore @@ -0,0 +1,12 @@ +.*.swp +._* +.DS_Store +.git +.hg +.lock-wscript +.svn +.wafpickle-* +CVS +npm-debug.log +*.sublime-project +*.sublime-workspace \ No newline at end of file diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.travis.yml b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.travis.yml new file mode 100644 index 0000000..9c52355 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/.travis.yml @@ -0,0 +1,12 @@ + language: node_js + node_js: + - "0.11" + - "0.10" + - "0.8" + branches: + only: + - master + notifications: + email: + - joaquim.serafim@gmail.com + script: npm test diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/LICENSE b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/LICENSE new file mode 100644 index 0000000..da1b624 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Joaquim José F. Serafim + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. \ No newline at end of file diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/README.md b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/README.md new file mode 100644 index 0000000..aa34ec8 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/README.md @@ -0,0 +1,27 @@ +# base64-url + +Base64 encode, decode, escape and unescape for URL applications. + + + +[![Build Status](https://travis-ci.org/joaquimserafim/base64-url.png?branch=master)](https://travis-ci.org/joaquimserafim/base64-url) + + + +**V1** + + +####API + + > base64url.encode('Node.js is awesome.'); + Tm9kZS5qcyBpcyBhd2Vzb21lLg + + > base64url.decode('Tm9kZS5qcyBpcyBhd2Vzb21lLg'); + Node.js is awesome. + + > base64url.escape(This+is/goingto+escape==); + This-is_goingto-escape + + > base64url.unescape('This-is_goingto-escape'); + This+is/goingto+escape== + \ No newline at end of file diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/index.js b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/index.js new file mode 100644 index 0000000..c5547ee --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/index.js @@ -0,0 +1,17 @@ +var base64url = exports; + +base64url.unescape = function unescape (str) { + return (str + Array(5 - str.length % 4).join('=')).replace(/\-/g,'+').replace(/_/g, '/'); +}; + +base64url.escape = function escape (str) { + return str.replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, ''); +}; + +base64url.encode = function encode (str) { + return this.escape(new Buffer(str).toString('base64')); +}; + +base64url.decode = function decode (str) { + return new Buffer(this.unescape(str), 'base64').toString(); +}; diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/package.json b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/package.json new file mode 100644 index 0000000..713b545 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/package.json @@ -0,0 +1,51 @@ +{ + "name": "base64-url", + "version": "1.0.0", + "description": "Base64 encode, decode, escape and unescape for URL applications", + "main": "index.js", + "directories": { + "test": "test" + }, + "scripts": { + "test": "node test" + }, + "repository": { + "type": "git", + "url": "git://github.com/joaquimserafim/base64-url.git" + }, + "keywords": [ + "base64", + "base64url" + ], + "author": { + "name": "@joaquimserafim" + }, + "license": "ISC", + "bugs": { + "url": "https://github.com/joaquimserafim/base64-url/issues" + }, + "homepage": "https://github.com/joaquimserafim/base64-url", + "devDependencies": { + "tape": "^2.12.3" + }, + "_id": "base64-url@1.0.0", + "_shasum": "ab694376f2801af6c9260899ffef02f86b40ee2c", + "_from": "base64-url@1.0.0", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "quim", + "email": "joaquim.serafim@gmail.com" + }, + "maintainers": [ + { + "name": "quim", + "email": "joaquim.serafim@gmail.com" + } + ], + "dist": { + "shasum": "ab694376f2801af6c9260899ffef02f86b40ee2c", + "tarball": "http://registry.npmjs.org/base64-url/-/base64-url-1.0.0.tgz" + }, + "_resolved": "https://registry.npmjs.org/base64-url/-/base64-url-1.0.0.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/base64-url/test/index.js b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/test/index.js new file mode 100644 index 0000000..1c3c4ed --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/base64-url/test/index.js @@ -0,0 +1,24 @@ +var test = require('tape'); +var base64url = require('../'); + + +test('base64url', function (t) { + t.plan(4); + + var text = 'Node.js is awesome.'; + + var encode = base64url.encode(text); + t.ok(encode, 'encode: ' + encode); + + var decode = base64url.decode(encode); + t.deepEqual(decode, text, 'decode: ' + decode); + + var text_escape = 'This+is/goingto+escape=='; + console.log(text_escape); + + var escape = base64url.escape(text_escape); + t.equal(escape.match(/\+|\//g), null, 'escape (omit + and /): ' + escape); + + var unescape = base64url.unescape(escape); + t.equal(unescape.match(/\-|_/g), null, 'unescape (back to first form): ' + unescape); +}); diff --git a/node_modules/csurf/node_modules/csrf/node_modules/rndm/.npmignore b/node_modules/csurf/node_modules/csrf/node_modules/rndm/.npmignore new file mode 100644 index 0000000..72921ab --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/rndm/.npmignore @@ -0,0 +1,2 @@ +.DS_Store* +node_modules diff --git a/node_modules/mysql/node_modules/readable-stream/LICENSE b/node_modules/csurf/node_modules/csrf/node_modules/rndm/LICENSE similarity index 62% rename from node_modules/mysql/node_modules/readable-stream/LICENSE rename to node_modules/csurf/node_modules/csrf/node_modules/rndm/LICENSE index e3d4e69..a7ae8ee 100644 --- a/node_modules/mysql/node_modules/readable-stream/LICENSE +++ b/node_modules/csurf/node_modules/csrf/node_modules/rndm/LICENSE @@ -1,9 +1,13 @@ -Copyright Joyent, Inc. and other Node contributors. All rights reserved. + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to -deal in the Software without restriction, including without limitation the -rights to use, copy, modify, merge, publish, distribute, sublicense, and/or -sell copies of the Software, and to permit persons to whom the Software is +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in @@ -13,6 +17,6 @@ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING -FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS -IN THE SOFTWARE. +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/csurf/node_modules/csrf/node_modules/rndm/README.md b/node_modules/csurf/node_modules/csrf/node_modules/rndm/README.md new file mode 100644 index 0000000..7a00d2d --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/rndm/README.md @@ -0,0 +1,15 @@ + +# RNDM + +Random string generator. +Basically `Math.random().toString(36).slice(2)`, +but with both upper and lower case letters and arbitrary lengths. +Useful for creating fast, not cryptographically secure salts. + +## API + +```js +import rndm from 'rndm@1' + +var salt = rndm(16) +``` diff --git a/node_modules/csurf/node_modules/csrf/node_modules/rndm/index.js b/node_modules/csurf/node_modules/csrf/node_modules/rndm/index.js new file mode 100644 index 0000000..d52b43a --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/rndm/index.js @@ -0,0 +1,10 @@ + +var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789' +var length = chars.length + +module.exports = function rndm(len) { + var salt = '' + for (var i = 0; i < len; i++) + salt += chars[Math.floor(length * Math.random())] + return salt +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/rndm/package.json b/node_modules/csurf/node_modules/csrf/node_modules/rndm/package.json new file mode 100644 index 0000000..e437cbf --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/rndm/package.json @@ -0,0 +1,39 @@ +{ + "name": "rndm", + "description": "random string generator", + "version": "1.0.0", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "git://github.com/jonathanong/rndm" + }, + "bugs": { + "url": "https://github.com/jonathanong/rndm/issues" + }, + "homepage": "https://github.com/jonathanong/rndm", + "_id": "rndm@1.0.0", + "_shasum": "dcb6eb485b9b416d15e097f39c31458e4cfda2da", + "_from": "rndm@~1.0.0", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "dist": { + "shasum": "dcb6eb485b9b416d15e097f39c31458e4cfda2da", + "tarball": "http://registry.npmjs.org/rndm/-/rndm-1.0.0.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/rndm/-/rndm-1.0.0.tgz" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/.npmignore b/node_modules/csurf/node_modules/csrf/node_modules/scmp/.npmignore new file mode 100644 index 0000000..62ea75c --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/.npmignore @@ -0,0 +1,3 @@ +node_modules/ +.project + diff --git a/node_modules/mysql/node_modules/bignumber.js/.travis.yml b/node_modules/csurf/node_modules/csrf/node_modules/scmp/.travis.yml similarity index 65% rename from node_modules/mysql/node_modules/bignumber.js/.travis.yml rename to node_modules/csurf/node_modules/csrf/node_modules/scmp/.travis.yml index c696551..0175d82 100644 --- a/node_modules/mysql/node_modules/bignumber.js/.travis.yml +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/.travis.yml @@ -1,6 +1,5 @@ -language: node_js -node_js: - - "0.11" - - "0.10" - - "0.8" - - "0.6" \ No newline at end of file +language: node_js +node_js: + - "0.6" + - "0.8" + - "0.10" diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/README.md b/node_modules/csurf/node_modules/csrf/node_modules/scmp/README.md new file mode 100644 index 0000000..8b38b15 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/README.md @@ -0,0 +1,31 @@ +# scmp + +[![Build Status](https://travis-ci.org/freewil/scmp.png)](https://travis-ci.org/freewil/scmp) + +Safe, constant-time comparison of strings. + +## Install + +``` +npm install scmp +``` + +## Why? + +To minimize vulnerability against [timing attacks](http://codahale.com/a-lesson-in-timing-attacks/). + +## Examples + +```js +var scmp = require('scmp'); + +var hash = 'e727d1464ae12436e899a726da5b2f11d8381b26'; +var givenHash = 'e727e1b80e448a213b392049888111e1779a52db'; + +if (scmp(hash, givenHash)) { + console.log('good hash'); +} else { + console.log('bad hash'); +} + +``` diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/benchmark/benchmark.js b/node_modules/csurf/node_modules/csrf/node_modules/scmp/benchmark/benchmark.js new file mode 100644 index 0000000..af849db --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/benchmark/benchmark.js @@ -0,0 +1,15 @@ +var scmp = require('../'); + +suite('scmp', function() { + var HASH1 = 'e727d1464ae12436e899a726da5b2f11d8381b26'; + var HASH2 = 'f727d1464ae12436e899a726da5b2f11d8381b26'; + + bench('short-circuit compares', function() { + HASH1 === HASH2; + }); + + bench('scmp compares', function() { + scmp(HASH1, HASH2); + }); + +}); diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/index.js b/node_modules/csurf/node_modules/csrf/node_modules/scmp/index.js new file mode 100644 index 0000000..d4f7579 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/index.js @@ -0,0 +1,20 @@ +/** + * Does a constant-time string comparison by not short-circuiting + * on first sign of non-equivalency. + * + * @param {String} a The first string to be compared against the second + * @param {String} b The second string to be compared against the first + * @return {Boolean} + */ +module.exports = function scmp(a, b) { + a = String(a); + b = String(b); + if (a.length !== b.length) { + return false; + } + var result = 0; + for (var i = 0; i < a.length; ++i) { + result |= a.charCodeAt(i) ^ b.charCodeAt(i); + } + return result === 0; +}; diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/package.json b/node_modules/csurf/node_modules/csrf/node_modules/scmp/package.json new file mode 100644 index 0000000..594d4b0 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/package.json @@ -0,0 +1,54 @@ +{ + "name": "scmp", + "version": "0.0.3", + "description": "safe, constant-time string-comparison", + "main": "index.js", + "scripts": { + "test": "mocha", + "posttest": "matcha" + }, + "repository": { + "type": "git", + "url": "git://github.com/freewil/scmp.git" + }, + "keywords": [ + "safe-compare", + "compare", + "time-equivalent-comparison", + "time equivalent", + "constant-time", + "constant time" + ], + "author": { + "name": "Sean Lavine" + }, + "license": "BSD", + "devDependencies": { + "mocha": "~1.13.0", + "matcha": "~0.4.0" + }, + "bugs": { + "url": "https://github.com/freewil/scmp/issues" + }, + "homepage": "https://github.com/freewil/scmp", + "_id": "scmp@0.0.3", + "dist": { + "shasum": "3648df2d7294641e7f78673ffc29681d9bad9073", + "tarball": "http://registry.npmjs.org/scmp/-/scmp-0.0.3.tgz" + }, + "_from": "scmp@0.0.3", + "_npmVersion": "1.3.24", + "_npmUser": { + "name": "freewil", + "email": "sean@eternalrise.com" + }, + "maintainers": [ + { + "name": "freewil", + "email": "sean@eternalrise.com" + } + ], + "directories": {}, + "_shasum": "3648df2d7294641e7f78673ffc29681d9bad9073", + "_resolved": "https://registry.npmjs.org/scmp/-/scmp-0.0.3.tgz" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/scmp/test/test.js b/node_modules/csurf/node_modules/csrf/node_modules/scmp/test/test.js new file mode 100644 index 0000000..349ced8 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/scmp/test/test.js @@ -0,0 +1,24 @@ +var scmp = require('../'); +var assert = require('assert'); + +describe('scmp', function() { + it('should return true for identical strings', function() { + assert(scmp('a', 'a')); + assert(scmp('abc', 'abc')); + assert(scmp('e727d1464ae12436e899a726da5b2f11d8381b26', 'e727d1464ae12436e899a726da5b2f11d8381b26')); + }); + + it('should return false for non-identical strings', function() { + assert.ifError(scmp('a', 'b')); + assert.ifError(scmp('abc', 'b')); + assert.ifError(scmp('e727d1464ae12436e899a726da5b2f11d8381b26', 'e727e1b80e448a213b392049888111e1779a52db')); + }); + + it('should not throw errors for non-strings', function() { + assert.ifError(scmp('a', {})); + assert.ifError(scmp({}, 'b')); + assert.ifError(scmp(1, 2)); + assert.ifError(scmp(undefined, 2)); + assert.ifError(scmp(null, 2)); + }); +}); diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/.npmignore b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/.npmignore new file mode 100644 index 0000000..72921ab --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/.npmignore @@ -0,0 +1,2 @@ +.DS_Store* +node_modules diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/LICENSE b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/README.md b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/README.md new file mode 100644 index 0000000..2178c6c --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/README.md @@ -0,0 +1,44 @@ + +# UID Safe + +Create cryptographically secure UIDs safe for both cookie and URL usage. +This is in contrast to modules such as [rand-token](https://github.com/sehrope/node-rand-token) +and [uid2](https://github.com/coreh/uid2) whose UIDs are actually skewed +due to the use of `%` and unnecessarily truncate the UID. +Use this if you could still use UIDs with `-` and `_` in them. + +## API + +```js +var uid = require('uid-safe') +``` + +### uid(byteLength, [cb]) + +Asynchronously create a UID with a specific byte length. +Because `base64` encoding is used underneath, this is not the string length! +For example, to create a UID of length 24, you want a byte length of 18! + +If `cb` is not defined, a promise is returned. +However, to use promises, you must either install [bluebird](https://github.com/petkaantonov/bluebird) +or use a version of node.js that has native promises, +otherwise your process will crash and die. + +```js +uid(18).then(function (string) { + // do something with the string +}) + +uid(18, function (err, string) { + if (err) throw err + // do something with the string +}) +``` + +### uid.sync(byteLength) + +A synchronous version of above. + +```js +var string = uid.sync(18) +``` diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/index.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/index.js new file mode 100644 index 0000000..9e26461 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/index.js @@ -0,0 +1,27 @@ + +var pseudoRandomBytes = require('crypto').pseudoRandomBytes +var escape = require('base64-url').escape + +var pseudoRandomBytesProm + +module.exports = uid + +function uid(length, cb) { + if (cb) { + return pseudoRandomBytes(length, function (err, buf) { + if (err) return cb(err) + cb(null, escapeBuffer(buf)) + }) + } + + pseudoRandomBytesProm || (pseudoRandomBytesProm = require('mz/crypto').pseudoRandomBytes) + return pseudoRandomBytesProm(length).then(escapeBuffer) +} + +uid.sync = function uid_sync(length) { + return escapeBuffer(pseudoRandomBytes(length)) +} + +function escapeBuffer(buf) { + return escape(buf.toString('base64')) +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.npmignore b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.npmignore new file mode 100644 index 0000000..9daeafb --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.npmignore @@ -0,0 +1 @@ +test diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.travis.yml b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.travis.yml new file mode 100644 index 0000000..80407d8 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/.travis.yml @@ -0,0 +1,7 @@ +node_js: +- "0.8" +- "0.10" +- "0.11" +language: node_js +script: "npm run test-travis" +after_script: "npm install coveralls@2 && cat ./coverage/lcov.info | coveralls" diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/HISTORY.md b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/HISTORY.md new file mode 100644 index 0000000..57d20a0 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/HISTORY.md @@ -0,0 +1,6 @@ + +1.0.0 / 2014-06-18 +================== + + * use `bluebird` by default if found + * support node 0.8 diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/LICENSE b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/README.md b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/README.md new file mode 100644 index 0000000..6c931c3 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/README.md @@ -0,0 +1,114 @@ + +# MZ - Modernize node.js + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![Dependency Status][david-image]][david-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Modernize node.js to current ECMAScript specifications! +node.js will not update their API to ES6+ [for a while](https://github.com/joyent/node/issues/7549). +This library is a wrapper for various aspects of node.js' API. + +## Installation and Usage + +Set `mz` as a dependency and install it. + +```bash +npm i mz +``` + +Then prefix the relevant `require()`s with `mz/`: + +```js +var fs = require('mz/fs') + +fs.exists(__filename).then(function (exists) { + if (exists) // do something +}) +``` + +Personally, I use this with generator-based control flow libraries such as [co](https://github.com/visionmedia/co) so I don't need to use implementation-specific wrappers like [co-fs](https://github.com/visionmedia/co-fs). + +```js +var co = require('co') +var fs = require('mz/fs') + +co(function* () { + if (yield fs.exists(__filename)) // do something +})() +``` + +## Promisification + +Many node methods are converted into promises. +Any properties that are deprecated or aren't asynchronous will simply be proxied. +The modules wrapped are: + +- `child_process` +- `crypto` +- `dns` +- `fs` +- `zlib` + +```js +var exec = require('mz/child_process').exec + +exec('node --version').then(function (stdout) { + console.log(stdout) +}) +``` + +## Promise Engine + +If you've installed [bluebird][bluebird], +[bluebird][bluebird] will be used. +`mz` does not install [bluebird][bluebird] for you. + +Otherwise, if you're using a node that has native v8 Promises (v0.11.13+), +then that will be used. + +Otherwise, this library will crash the process and exit, +so you might as well install [bluebird][bluebird] as a dependency! + +## FAQ + +### Can I use this in production? + +If you do, you should probably install [bluebird][bluebird] as +native v8 promises are still pretty raw. + +### Will this make my app faster? + +Nope, probably slower actually. + +### Can I add more features? + +Sure. +Open an issue. + +Currently, the plans are to eventually support: + +- ECMAScript7 Streams + +[bluebird]: https://github.com/petkaantonov/bluebird + +[npm-image]: https://img.shields.io/npm/v/mz.svg?style=flat-square +[npm-url]: https://npmjs.org/package/mz +[github-tag]: http://img.shields.io/github/tag/normalize/mz.svg?style=flat-square +[github-url]: https://github.com/normalize/mz/tags +[travis-image]: https://img.shields.io/travis/normalize/mz.svg?style=flat-square +[travis-url]: https://travis-ci.org/normalize/mz +[coveralls-image]: https://img.shields.io/coveralls/normalize/mz.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/normalize/mz?branch=master +[david-image]: http://img.shields.io/david/normalize/mz.svg?style=flat-square +[david-url]: https://david-dm.org/normalize/mz +[license-image]: http://img.shields.io/npm/l/mz.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/mz.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/mz +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify.js new file mode 100644 index 0000000..5329a16 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify.js @@ -0,0 +1,34 @@ + +var Promise = require('native-or-bluebird') + +module.exports = function mz_promisify(name, fn) { + return eval('(function ' + name + '() {\n' + + 'var len = arguments.length\n' + + 'var args = new Array(len + 1)\n' + + 'for (var i = 0; i < len; ++i) args[i] = arguments[i]\n' + + 'var lastIndex = i\n' + + 'return new Promise(function (resolve, reject) {\n' + + 'args[lastIndex] = makeCallback(resolve, reject)\n' + + 'fn.apply(null, args)\n' + + '})\n' + + '})') +} + +function makeCallback(resolve, reject) { + return function(err, value) { + if (err) { + reject(err) + } else { + var len = arguments.length + if (len > 2) { + var values = new Array(len - 1) + for (var i = 1; i < len; ++i) { + values[i - 1] = arguments[i] + } + resolve(values) + } else { + resolve(value) + } + } + } +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify_all.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify_all.js new file mode 100644 index 0000000..1edb209 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/_promisify_all.js @@ -0,0 +1,24 @@ + +var promisify = require('./_promisify.js') + +module.exports = function (source, exports, methods) { + methods.forEach(function (name) { + if (deprecated(source, name)) return + if (typeof source[name] === 'function') + exports[name] = promisify(name, source[name]) + }) + + // proxy the rest + Object.keys(source).forEach(function (name) { + if (deprecated(source, name)) return + if (exports[name]) return + exports[name] = source[name] + }) +} + +function deprecated(source, name) { + var desc = Object.getOwnPropertyDescriptor(source, name) + if (!desc || !desc.get) return false + if (desc.get.name === 'deprecated') return true + return false +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/child_process.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/child_process.js new file mode 100644 index 0000000..a4b5162 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/child_process.js @@ -0,0 +1,8 @@ + +require('./_promisify_all')( + require('child_process'), + exports, [ + 'exec', + 'execFile', + ] +) diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/coverage.json b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/coverage.json new file mode 100644 index 0000000..3a35a88 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/coverage.json @@ -0,0 +1 @@ +{"/Users/jong/Workspace/mz/fs.js":{"path":"/Users/jong/Workspace/mz/fs.js","s":{"1":1,"2":1,"3":1,"4":1,"5":1,"6":1},"b":{},"f":{"1":1,"2":1},"fnMap":{"1":{"name":"exists","line":38,"loc":{"start":{"line":38,"column":37},"end":{"line":38,"column":69}}},"2":{"name":"(anonymous_2)","line":39,"loc":{"start":{"line":39,"column":20},"end":{"line":39,"column":35}}}},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":4,"column":0}},"2":{"start":{"line":4,"column":0},"end":{"line":35,"column":0}},"3":{"start":{"line":35,"column":0},"end":{"line":38,"column":0}},"4":{"start":{"line":38,"column":0},"end":{"line":44,"column":0}},"5":{"start":{"line":39,"column":2},"end":{"line":42,"column":0}},"6":{"start":{"line":40,"column":4},"end":{"line":41,"column":2}}},"branchMap":{}},"/Users/jong/Workspace/mz/_promisify_all.js":{"path":"/Users/jong/Workspace/mz/_promisify_all.js","s":{"1":1,"2":1,"3":4,"4":40,"5":0,"6":40,"7":40,"8":4,"9":189,"10":2,"11":187,"12":40,"13":147,"14":1,"15":229,"16":229,"17":227,"18":2,"19":2,"20":0},"b":{"1":[0,40],"2":[40,0],"3":[2,187],"4":[40,147],"5":[227,2],"6":[229,229],"7":[2,0]},"f":{"1":4,"2":40,"3":189,"4":229},"fnMap":{"1":{"name":"(anonymous_1)","line":4,"loc":{"start":{"line":4,"column":17},"end":{"line":4,"column":53}}},"2":{"name":"(anonymous_2)","line":5,"loc":{"start":{"line":5,"column":18},"end":{"line":5,"column":34}}},"3":{"name":"(anonymous_3)","line":12,"loc":{"start":{"line":12,"column":30},"end":{"line":12,"column":46}}},"4":{"name":"deprecated","line":19,"loc":{"start":{"line":19,"column":0},"end":{"line":19,"column":34}}}},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":4,"column":0}},"2":{"start":{"line":4,"column":0},"end":{"line":19,"column":0}},"3":{"start":{"line":5,"column":2},"end":{"line":12,"column":2}},"4":{"start":{"line":6,"column":4},"end":{"line":6,"column":40}},"5":{"start":{"line":6,"column":34},"end":{"line":6,"column":40}},"6":{"start":{"line":7,"column":4},"end":{"line":9,"column":2}},"7":{"start":{"line":8,"column":6},"end":{"line":9,"column":2}},"8":{"start":{"line":12,"column":2},"end":{"line":17,"column":0}},"9":{"start":{"line":13,"column":4},"end":{"line":13,"column":40}},"10":{"start":{"line":13,"column":34},"end":{"line":13,"column":40}},"11":{"start":{"line":14,"column":4},"end":{"line":14,"column":29}},"12":{"start":{"line":14,"column":23},"end":{"line":14,"column":29}},"13":{"start":{"line":15,"column":4},"end":{"line":16,"column":2}},"14":{"start":{"line":19,"column":0},"end":{"line":24,"column":1}},"15":{"start":{"line":20,"column":2},"end":{"line":21,"column":2}},"16":{"start":{"line":21,"column":2},"end":{"line":22,"column":2}},"17":{"start":{"line":21,"column":26},"end":{"line":22,"column":2}},"18":{"start":{"line":22,"column":2},"end":{"line":23,"column":2}},"19":{"start":{"line":22,"column":38},"end":{"line":23,"column":2}},"20":{"start":{"line":23,"column":2},"end":{"line":24,"column":0}}},"branchMap":{"1":{"line":6,"type":"if","locations":[{"start":{"line":6,"column":4},"end":{"line":6,"column":4}},{"start":{"line":6,"column":4},"end":{"line":6,"column":4}}]},"2":{"line":7,"type":"if","locations":[{"start":{"line":7,"column":4},"end":{"line":7,"column":4}},{"start":{"line":7,"column":4},"end":{"line":7,"column":4}}]},"3":{"line":13,"type":"if","locations":[{"start":{"line":13,"column":4},"end":{"line":13,"column":4}},{"start":{"line":13,"column":4},"end":{"line":13,"column":4}}]},"4":{"line":14,"type":"if","locations":[{"start":{"line":14,"column":4},"end":{"line":14,"column":4}},{"start":{"line":14,"column":4},"end":{"line":14,"column":4}}]},"5":{"line":21,"type":"if","locations":[{"start":{"line":21,"column":2},"end":{"line":21,"column":2}},{"start":{"line":21,"column":2},"end":{"line":21,"column":2}}]},"6":{"line":21,"type":"binary-expr","locations":[{"start":{"line":21,"column":6},"end":{"line":21,"column":11}},{"start":{"line":21,"column":15},"end":{"line":21,"column":24}}]},"7":{"line":22,"type":"if","locations":[{"start":{"line":22,"column":2},"end":{"line":22,"column":2}},{"start":{"line":22,"column":2},"end":{"line":22,"column":2}}]}}},"/Users/jong/Workspace/mz/_promisify.js":{"path":"/Users/jong/Workspace/mz/_promisify.js","s":{"1":1,"2":1,"3":45,"4":1,"5":10,"6":10,"7":3,"8":7,"9":7,"10":1,"11":1,"12":2,"13":1,"14":6},"b":{"1":[3,7],"2":[1,6]},"f":{"1":45,"2":10,"3":10},"fnMap":{"1":{"name":"mz_promisify","line":4,"loc":{"start":{"line":4,"column":17},"end":{"line":4,"column":49}}},"2":{"name":"makeCallback","line":17,"loc":{"start":{"line":17,"column":0},"end":{"line":17,"column":39}}},"3":{"name":"(anonymous_3)","line":18,"loc":{"start":{"line":18,"column":9},"end":{"line":18,"column":30}}}},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":4,"column":0}},"2":{"start":{"line":4,"column":0},"end":{"line":17,"column":0}},"3":{"start":{"line":5,"column":2},"end":{"line":15,"column":0}},"4":{"start":{"line":17,"column":0},"end":{"line":34,"column":1}},"5":{"start":{"line":18,"column":2},"end":{"line":34,"column":0}},"6":{"start":{"line":19,"column":4},"end":{"line":32,"column":5}},"7":{"start":{"line":20,"column":6},"end":{"line":21,"column":4}},"8":{"start":{"line":22,"column":6},"end":{"line":23,"column":6}},"9":{"start":{"line":23,"column":6},"end":{"line":31,"column":7}},"10":{"start":{"line":24,"column":8},"end":{"line":25,"column":8}},"11":{"start":{"line":25,"column":8},"end":{"line":27,"column":9}},"12":{"start":{"line":26,"column":10},"end":{"line":27,"column":8}},"13":{"start":{"line":28,"column":8},"end":{"line":29,"column":6}},"14":{"start":{"line":30,"column":8},"end":{"line":31,"column":6}}},"branchMap":{"1":{"line":19,"type":"if","locations":[{"start":{"line":19,"column":4},"end":{"line":19,"column":4}},{"start":{"line":19,"column":4},"end":{"line":19,"column":4}}]},"2":{"line":23,"type":"if","locations":[{"start":{"line":23,"column":6},"end":{"line":23,"column":6}},{"start":{"line":23,"column":6},"end":{"line":23,"column":6}}]}}},"/Users/jong/Workspace/mz/child_process.js":{"path":"/Users/jong/Workspace/mz/child_process.js","s":{"1":1},"b":{},"f":{},"fnMap":{},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":10,"column":0}}},"branchMap":{}},"/Users/jong/Workspace/mz/crypto.js":{"path":"/Users/jong/Workspace/mz/crypto.js","s":{"1":1},"b":{},"f":{},"fnMap":{},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":11,"column":0}}},"branchMap":{}},"/Users/jong/Workspace/mz/zlib.js":{"path":"/Users/jong/Workspace/mz/zlib.js","s":{"1":1},"b":{},"f":{},"fnMap":{},"statementMap":{"1":{"start":{"line":2,"column":0},"end":{"line":15,"column":0}}},"branchMap":{}}} \ No newline at end of file diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/index.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/index.html new file mode 100644 index 0000000..7d6d0e1 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/index.html @@ -0,0 +1,350 @@ + + + + Code coverage report for All files + + + + + + + +
+

Code coverage report for All files

+

+ + Statements: 95.35% (41 / 43)      + + + Branches: 83.33% (15 / 18)      + + + Functions: 100% (9 / 9)      + + + Lines: 97.37% (37 / 38)      + + Ignored: none      +

+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
mz/95.35%(41 / 43)83.33%(15 / 18)100%(9 / 9)97.37%(37 / 38)
+
+
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify.js.html new file mode 100644 index 0000000..2ef2929 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify.js.html @@ -0,0 +1,424 @@ + + + + Code coverage report for mz/_promisify.js + + + + + + + +
+

Code coverage report for mz/_promisify.js

+

+ + Statements: 100% (14 / 14)      + + + Branches: 100% (4 / 4)      + + + Functions: 100% (3 / 3)      + + + Lines: 100% (14 / 14)      + + Ignored: none      +

+
All files » mz/ » _promisify.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9
+10
+11
+12
+13
+14
+15
+16
+17
+18
+19
+20
+21
+22
+23
+24
+25
+26
+27
+28
+29
+30
+31
+32
+33
+34
+35 
+1
+ 
+1
+45
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+1
+10
+10
+3
+ 
+7
+7
+1
+1
+2
+ 
+1
+ 
+6
+ 
+ 
+ 
+ 
+ 
 
+var Promise = require('native-or-bluebird')
+ 
+module.exports = function mz_promisify(name, fn) {
+  return eval('(function ' + name + '() {\n'
+    + 'var len = arguments.length\n'
+    + 'var args = new Array(len + 1)\n'
+    + 'for (var i = 0; i < len; ++i) args[i] = arguments[i]\n'
+    + 'var lastIndex = i\n'
+    + 'return new Promise(function (resolve, reject) {\n'
+      + 'args[lastIndex] = makeCallback(resolve, reject)\n'
+      + 'fn.apply(null, args)\n'
+    + '})\n'
+  + '})')
+}
+ 
+function makeCallback(resolve, reject) {
+  return function(err, value) {
+    if (err) {
+      reject(err)
+    } else {
+      var len = arguments.length
+      if (len > 2) {
+        var values = new Array(len - 1)
+        for (var i = 1; i < len; ++i) {
+          values[i - 1] = arguments[i]
+        }
+        resolve(values)
+      } else {
+        resolve(value)
+      }
+    }
+  }
+}
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify_all.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify_all.js.html new file mode 100644 index 0000000..7c6fe8a --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/_promisify_all.js.html @@ -0,0 +1,394 @@ + + + + Code coverage report for mz/_promisify_all.js + + + + + + + +
+

Code coverage report for mz/_promisify_all.js

+

+ + Statements: 90% (18 / 20)      + + + Branches: 78.57% (11 / 14)      + + + Functions: 100% (4 / 4)      + + + Lines: 93.33% (14 / 15)      + + Ignored: none      +

+
All files » mz/ » _promisify_all.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9
+10
+11
+12
+13
+14
+15
+16
+17
+18
+19
+20
+21
+22
+23
+24
+25 
+1
+ 
+1
+4
+40
+40
+40
+ 
+ 
+ 
+4
+189
+187
+147
+ 
+ 
+ 
+1
+229
+229
+2
+ 
+ 
+ 
 
+var promisify = require('./_promisify.js')
+ 
+module.exports = function (source, exports, methods) {
+  methods.forEach(function (name) {
+    Iif (deprecated(source, name)) return
+    Eif (typeof source[name] === 'function')
+      exports[name] = promisify(name, source[name])
+  })
+ 
+  // proxy the rest
+  Object.keys(source).forEach(function (name) {
+    if (deprecated(source, name)) return
+    if (exports[name]) return
+    exports[name] = source[name]
+  })
+}
+ 
+function deprecated(source, name) {
+  var desc = Object.getOwnPropertyDescriptor(source, name)
+  if (!desc || !desc.get) return false
+  Eif (desc.get.name === 'deprecated') return true
+  return false
+}
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/child_process.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/child_process.js.html new file mode 100644 index 0000000..aa2195e --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/child_process.js.html @@ -0,0 +1,346 @@ + + + + Code coverage report for mz/child_process.js + + + + + + + +
+

Code coverage report for mz/child_process.js

+

+ + Statements: 100% (1 / 1)      + + + Branches: 100% (0 / 0)      + + + Functions: 100% (0 / 0)      + + + Lines: 100% (1 / 1)      + + Ignored: none      +

+
All files » mz/ » child_process.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9 
+1
+ 
+ 
+ 
+ 
+ 
+ 
+ 
 
+require('./_promisify_all')(
+  require('child_process'),
+  exports, [
+    'exec',
+    'execFile',
+  ]
+)
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/crypto.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/crypto.js.html new file mode 100644 index 0000000..5f0eeb0 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/crypto.js.html @@ -0,0 +1,349 @@ + + + + Code coverage report for mz/crypto.js + + + + + + + +
+

Code coverage report for mz/crypto.js

+

+ + Statements: 100% (1 / 1)      + + + Branches: 100% (0 / 0)      + + + Functions: 100% (0 / 0)      + + + Lines: 100% (1 / 1)      + + Ignored: none      +

+
All files » mz/ » crypto.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9
+10 
+1
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
 
+require('./_promisify_all')(
+  require('crypto'),
+  exports, [
+    'pbkdf2',
+    'randomBytes',
+    'pseudoRandomBytes',
+  ]
+)
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/fs.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/fs.js.html new file mode 100644 index 0000000..bf373d2 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/fs.js.html @@ -0,0 +1,448 @@ + + + + Code coverage report for mz/fs.js + + + + + + + +
+

Code coverage report for mz/fs.js

+

+ + Statements: 100% (6 / 6)      + + + Branches: 100% (0 / 0)      + + + Functions: 100% (2 / 2)      + + + Lines: 100% (6 / 6)      + + Ignored: none      +

+
All files » mz/ » fs.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9
+10
+11
+12
+13
+14
+15
+16
+17
+18
+19
+20
+21
+22
+23
+24
+25
+26
+27
+28
+29
+30
+31
+32
+33
+34
+35
+36
+37
+38
+39
+40
+41
+42
+43 
+1
+ 
+1
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+1
+ 
+ 
+1
+1
+1
+ 
+ 
+ 
 
+var fs = require('fs')
+ 
+require('./_promisify_all.js')(fs, exports, [
+  'rename',
+  'ftruncate',
+  'chown',
+  'fchown',
+  'lchown',
+  'chmod',
+  'fchmod',
+  'stat',
+  'lstat',
+  'fstat',
+  'link',
+  'symlink',
+  'readlink',
+  'realpath',
+  'unlink',
+  'rmdir',
+  'mkdir',
+  'readdir',
+  'close',
+  'open',
+  'utimes',
+  'futimes',
+  'fsync',
+  'write',
+  'read',
+  'readFile',
+  'writeFile',
+  'appendFile',
+])
+ 
+var promisify = require('./_promisify.js')
+ 
+// don't know enough about promises to do this haha
+exports.exists = promisify('exists', function exists(filename, done) {
+  fs.stat(filename, function (err) {
+    done(null, !err)
+  })
+})
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/index.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/index.html new file mode 100644 index 0000000..4db2982 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/index.html @@ -0,0 +1,415 @@ + + + + Code coverage report for mz/ + + + + + + + +
+

Code coverage report for mz/

+

+ + Statements: 95.35% (41 / 43)      + + + Branches: 83.33% (15 / 18)      + + + Functions: 100% (9 / 9)      + + + Lines: 97.37% (37 / 38)      + + Ignored: none      +

+
All files » mz/
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
_promisify.js100%(14 / 14)100%(4 / 4)100%(3 / 3)100%(14 / 14)
_promisify_all.js90%(18 / 20)78.57%(11 / 14)100%(4 / 4)93.33%(14 / 15)
child_process.js100%(1 / 1)100%(0 / 0)100%(0 / 0)100%(1 / 1)
crypto.js100%(1 / 1)100%(0 / 0)100%(0 / 0)100%(1 / 1)
fs.js100%(6 / 6)100%(0 / 0)100%(2 / 2)100%(6 / 6)
zlib.js100%(1 / 1)100%(0 / 0)100%(0 / 0)100%(1 / 1)
+
+
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/zlib.js.html b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/zlib.js.html new file mode 100644 index 0000000..4f2c9d2 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/mz/zlib.js.html @@ -0,0 +1,361 @@ + + + + Code coverage report for mz/zlib.js + + + + + + + +
+

Code coverage report for mz/zlib.js

+

+ + Statements: 100% (1 / 1)      + + + Branches: 100% (0 / 0)      + + + Functions: 100% (0 / 0)      + + + Lines: 100% (1 / 1)      + + Ignored: none      +

+
All files » mz/ » zlib.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9
+10
+11
+12
+13
+14 
+1
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
 
+require('./_promisify_all')(
+  require('zlib'),
+  exports, [
+    'deflate',
+    'deflateRaw',
+    'gzip',
+    'gunzip',
+    'inflate',
+    'inflateRaw',
+    'unzip',
+  ]
+)
+ 
+ +
+
+
Generated by istanbul at Mon Aug 18 2014 01:32:02 GMT-0700 (PDT)
+
+ + + + + + + diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.css b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.css new file mode 100644 index 0000000..b317a7c --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.css @@ -0,0 +1 @@ +.pln{color:#000}@media screen{.str{color:#080}.kwd{color:#008}.com{color:#800}.typ{color:#606}.lit{color:#066}.pun,.opn,.clo{color:#660}.tag{color:#008}.atn{color:#606}.atv{color:#080}.dec,.var{color:#606}.fun{color:red}}@media print,projection{.str{color:#060}.kwd{color:#006;font-weight:bold}.com{color:#600;font-style:italic}.typ{color:#404;font-weight:bold}.lit{color:#044}.pun,.opn,.clo{color:#440}.tag{color:#006;font-weight:bold}.atn{color:#404}.atv{color:#060}}pre.prettyprint{padding:2px;border:1px solid #888}ol.linenums{margin-top:0;margin-bottom:0}li.L0,li.L1,li.L2,li.L3,li.L5,li.L6,li.L7,li.L8{list-style-type:none}li.L1,li.L3,li.L5,li.L7,li.L9{background:#eee} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.js new file mode 100644 index 0000000..ef51e03 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov-report/prettify.js @@ -0,0 +1 @@ +window.PR_SHOULD_USE_CONTINUATION=true;(function(){var h=["break,continue,do,else,for,if,return,while"];var u=[h,"auto,case,char,const,default,double,enum,extern,float,goto,int,long,register,short,signed,sizeof,static,struct,switch,typedef,union,unsigned,void,volatile"];var p=[u,"catch,class,delete,false,import,new,operator,private,protected,public,this,throw,true,try,typeof"];var l=[p,"alignof,align_union,asm,axiom,bool,concept,concept_map,const_cast,constexpr,decltype,dynamic_cast,explicit,export,friend,inline,late_check,mutable,namespace,nullptr,reinterpret_cast,static_assert,static_cast,template,typeid,typename,using,virtual,where"];var x=[p,"abstract,boolean,byte,extends,final,finally,implements,import,instanceof,null,native,package,strictfp,super,synchronized,throws,transient"];var R=[x,"as,base,by,checked,decimal,delegate,descending,dynamic,event,fixed,foreach,from,group,implicit,in,interface,internal,into,is,lock,object,out,override,orderby,params,partial,readonly,ref,sbyte,sealed,stackalloc,string,select,uint,ulong,unchecked,unsafe,ushort,var"];var r="all,and,by,catch,class,else,extends,false,finally,for,if,in,is,isnt,loop,new,no,not,null,of,off,on,or,return,super,then,true,try,unless,until,when,while,yes";var w=[p,"debugger,eval,export,function,get,null,set,undefined,var,with,Infinity,NaN"];var s="caller,delete,die,do,dump,elsif,eval,exit,foreach,for,goto,if,import,last,local,my,next,no,our,print,package,redo,require,sub,undef,unless,until,use,wantarray,while,BEGIN,END";var I=[h,"and,as,assert,class,def,del,elif,except,exec,finally,from,global,import,in,is,lambda,nonlocal,not,or,pass,print,raise,try,with,yield,False,True,None"];var f=[h,"alias,and,begin,case,class,def,defined,elsif,end,ensure,false,in,module,next,nil,not,or,redo,rescue,retry,self,super,then,true,undef,unless,until,when,yield,BEGIN,END"];var H=[h,"case,done,elif,esac,eval,fi,function,in,local,set,then,until"];var A=[l,R,w,s+I,f,H];var e=/^(DIR|FILE|vector|(de|priority_)?queue|list|stack|(const_)?iterator|(multi)?(set|map)|bitset|u?(int|float)\d*)/;var C="str";var z="kwd";var j="com";var O="typ";var G="lit";var L="pun";var F="pln";var m="tag";var E="dec";var J="src";var P="atn";var n="atv";var N="nocode";var M="(?:^^\\.?|[+-]|\\!|\\!=|\\!==|\\#|\\%|\\%=|&|&&|&&=|&=|\\(|\\*|\\*=|\\+=|\\,|\\-=|\\->|\\/|\\/=|:|::|\\;|<|<<|<<=|<=|=|==|===|>|>=|>>|>>=|>>>|>>>=|\\?|\\@|\\[|\\^|\\^=|\\^\\^|\\^\\^=|\\{|\\||\\|=|\\|\\||\\|\\|=|\\~|break|case|continue|delete|do|else|finally|instanceof|return|throw|try|typeof)\\s*";function k(Z){var ad=0;var S=false;var ac=false;for(var V=0,U=Z.length;V122)){if(!(al<65||ag>90)){af.push([Math.max(65,ag)|32,Math.min(al,90)|32])}if(!(al<97||ag>122)){af.push([Math.max(97,ag)&~32,Math.min(al,122)&~32])}}}}af.sort(function(av,au){return(av[0]-au[0])||(au[1]-av[1])});var ai=[];var ap=[NaN,NaN];for(var ar=0;arat[0]){if(at[1]+1>at[0]){an.push("-")}an.push(T(at[1]))}}an.push("]");return an.join("")}function W(al){var aj=al.source.match(new RegExp("(?:\\[(?:[^\\x5C\\x5D]|\\\\[\\s\\S])*\\]|\\\\u[A-Fa-f0-9]{4}|\\\\x[A-Fa-f0-9]{2}|\\\\[0-9]+|\\\\[^ux0-9]|\\(\\?[:!=]|[\\(\\)\\^]|[^\\x5B\\x5C\\(\\)\\^]+)","g"));var ah=aj.length;var an=[];for(var ak=0,am=0;ak=2&&ai==="["){aj[ak]=X(ag)}else{if(ai!=="\\"){aj[ak]=ag.replace(/[a-zA-Z]/g,function(ao){var ap=ao.charCodeAt(0);return"["+String.fromCharCode(ap&~32,ap|32)+"]"})}}}}return aj.join("")}var aa=[];for(var V=0,U=Z.length;V=0;){S[ac.charAt(ae)]=Y}}var af=Y[1];var aa=""+af;if(!ag.hasOwnProperty(aa)){ah.push(af);ag[aa]=null}}ah.push(/[\0-\uffff]/);V=k(ah)})();var X=T.length;var W=function(ah){var Z=ah.sourceCode,Y=ah.basePos;var ad=[Y,F];var af=0;var an=Z.match(V)||[];var aj={};for(var ae=0,aq=an.length;ae=5&&"lang-"===ap.substring(0,5);if(am&&!(ai&&typeof ai[1]==="string")){am=false;ap=J}if(!am){aj[ag]=ap}}var ab=af;af+=ag.length;if(!am){ad.push(Y+ab,ap)}else{var al=ai[1];var ak=ag.indexOf(al);var ac=ak+al.length;if(ai[2]){ac=ag.length-ai[2].length;ak=ac-al.length}var ar=ap.substring(5);B(Y+ab,ag.substring(0,ak),W,ad);B(Y+ab+ak,al,q(ar,al),ad);B(Y+ab+ac,ag.substring(ac),W,ad)}}ah.decorations=ad};return W}function i(T){var W=[],S=[];if(T.tripleQuotedStrings){W.push([C,/^(?:\'\'\'(?:[^\'\\]|\\[\s\S]|\'{1,2}(?=[^\']))*(?:\'\'\'|$)|\"\"\"(?:[^\"\\]|\\[\s\S]|\"{1,2}(?=[^\"]))*(?:\"\"\"|$)|\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$))/,null,"'\""])}else{if(T.multiLineStrings){W.push([C,/^(?:\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$)|\`(?:[^\\\`]|\\[\s\S])*(?:\`|$))/,null,"'\"`"])}else{W.push([C,/^(?:\'(?:[^\\\'\r\n]|\\.)*(?:\'|$)|\"(?:[^\\\"\r\n]|\\.)*(?:\"|$))/,null,"\"'"])}}if(T.verbatimStrings){S.push([C,/^@\"(?:[^\"]|\"\")*(?:\"|$)/,null])}var Y=T.hashComments;if(Y){if(T.cStyleComments){if(Y>1){W.push([j,/^#(?:##(?:[^#]|#(?!##))*(?:###|$)|.*)/,null,"#"])}else{W.push([j,/^#(?:(?:define|elif|else|endif|error|ifdef|include|ifndef|line|pragma|undef|warning)\b|[^\r\n]*)/,null,"#"])}S.push([C,/^<(?:(?:(?:\.\.\/)*|\/?)(?:[\w-]+(?:\/[\w-]+)+)?[\w-]+\.h|[a-z]\w*)>/,null])}else{W.push([j,/^#[^\r\n]*/,null,"#"])}}if(T.cStyleComments){S.push([j,/^\/\/[^\r\n]*/,null]);S.push([j,/^\/\*[\s\S]*?(?:\*\/|$)/,null])}if(T.regexLiterals){var X=("/(?=[^/*])(?:[^/\\x5B\\x5C]|\\x5C[\\s\\S]|\\x5B(?:[^\\x5C\\x5D]|\\x5C[\\s\\S])*(?:\\x5D|$))+/");S.push(["lang-regex",new RegExp("^"+M+"("+X+")")])}var V=T.types;if(V){S.push([O,V])}var U=(""+T.keywords).replace(/^ | $/g,"");if(U.length){S.push([z,new RegExp("^(?:"+U.replace(/[\s,]+/g,"|")+")\\b"),null])}W.push([F,/^\s+/,null," \r\n\t\xA0"]);S.push([G,/^@[a-z_$][a-z_$@0-9]*/i,null],[O,/^(?:[@_]?[A-Z]+[a-z][A-Za-z_$@0-9]*|\w+_t\b)/,null],[F,/^[a-z_$][a-z_$@0-9]*/i,null],[G,new RegExp("^(?:0x[a-f0-9]+|(?:\\d(?:_\\d+)*\\d*(?:\\.\\d*)?|\\.\\d\\+)(?:e[+\\-]?\\d+)?)[a-z]*","i"),null,"0123456789"],[F,/^\\[\s\S]?/,null],[L,/^.[^\s\w\.$@\'\"\`\/\#\\]*/,null]);return g(W,S)}var K=i({keywords:A,hashComments:true,cStyleComments:true,multiLineStrings:true,regexLiterals:true});function Q(V,ag){var U=/(?:^|\s)nocode(?:\s|$)/;var ab=/\r\n?|\n/;var ac=V.ownerDocument;var S;if(V.currentStyle){S=V.currentStyle.whiteSpace}else{if(window.getComputedStyle){S=ac.defaultView.getComputedStyle(V,null).getPropertyValue("white-space")}}var Z=S&&"pre"===S.substring(0,3);var af=ac.createElement("LI");while(V.firstChild){af.appendChild(V.firstChild)}var W=[af];function ae(al){switch(al.nodeType){case 1:if(U.test(al.className)){break}if("BR"===al.nodeName){ad(al);if(al.parentNode){al.parentNode.removeChild(al)}}else{for(var an=al.firstChild;an;an=an.nextSibling){ae(an)}}break;case 3:case 4:if(Z){var am=al.nodeValue;var aj=am.match(ab);if(aj){var ai=am.substring(0,aj.index);al.nodeValue=ai;var ah=am.substring(aj.index+aj[0].length);if(ah){var ak=al.parentNode;ak.insertBefore(ac.createTextNode(ah),al.nextSibling)}ad(al);if(!ai){al.parentNode.removeChild(al)}}}break}}function ad(ak){while(!ak.nextSibling){ak=ak.parentNode;if(!ak){return}}function ai(al,ar){var aq=ar?al.cloneNode(false):al;var ao=al.parentNode;if(ao){var ap=ai(ao,1);var an=al.nextSibling;ap.appendChild(aq);for(var am=an;am;am=an){an=am.nextSibling;ap.appendChild(am)}}return aq}var ah=ai(ak.nextSibling,0);for(var aj;(aj=ah.parentNode)&&aj.nodeType===1;){ah=aj}W.push(ah)}for(var Y=0;Y=S){ah+=2}if(V>=ap){Z+=2}}}var t={};function c(U,V){for(var S=V.length;--S>=0;){var T=V[S];if(!t.hasOwnProperty(T)){t[T]=U}else{if(window.console){console.warn("cannot override language handler %s",T)}}}}function q(T,S){if(!(T&&t.hasOwnProperty(T))){T=/^\s*]*(?:>|$)/],[j,/^<\!--[\s\S]*?(?:-\->|$)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],[L,/^(?:<[%?]|[%?]>)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i]]),["default-markup","htm","html","mxml","xhtml","xml","xsl"]);c(g([[F,/^[\s]+/,null," \t\r\n"],[n,/^(?:\"[^\"]*\"?|\'[^\']*\'?)/,null,"\"'"]],[[m,/^^<\/?[a-z](?:[\w.:-]*\w)?|\/?>$/i],[P,/^(?!style[\s=]|on)[a-z](?:[\w:-]*\w)?/i],["lang-uq.val",/^=\s*([^>\'\"\s]*(?:[^>\'\"\s\/]|\/(?=\s)))/],[L,/^[=<>\/]+/],["lang-js",/^on\w+\s*=\s*\"([^\"]+)\"/i],["lang-js",/^on\w+\s*=\s*\'([^\']+)\'/i],["lang-js",/^on\w+\s*=\s*([^\"\'>\s]+)/i],["lang-css",/^style\s*=\s*\"([^\"]+)\"/i],["lang-css",/^style\s*=\s*\'([^\']+)\'/i],["lang-css",/^style\s*=\s*([^\"\'>\s]+)/i]]),["in.tag"]);c(g([],[[n,/^[\s\S]+/]]),["uq.val"]);c(i({keywords:l,hashComments:true,cStyleComments:true,types:e}),["c","cc","cpp","cxx","cyc","m"]);c(i({keywords:"null,true,false"}),["json"]);c(i({keywords:R,hashComments:true,cStyleComments:true,verbatimStrings:true,types:e}),["cs"]);c(i({keywords:x,cStyleComments:true}),["java"]);c(i({keywords:H,hashComments:true,multiLineStrings:true}),["bsh","csh","sh"]);c(i({keywords:I,hashComments:true,multiLineStrings:true,tripleQuotedStrings:true}),["cv","py"]);c(i({keywords:s,hashComments:true,multiLineStrings:true,regexLiterals:true}),["perl","pl","pm"]);c(i({keywords:f,hashComments:true,multiLineStrings:true,regexLiterals:true}),["rb"]);c(i({keywords:w,cStyleComments:true,regexLiterals:true}),["js"]);c(i({keywords:r,hashComments:3,cStyleComments:true,multilineStrings:true,tripleQuotedStrings:true,regexLiterals:true}),["coffee"]);c(g([],[[C,/^[\s\S]+/]]),["regex"]);function d(V){var U=V.langExtension;try{var S=a(V.sourceNode);var T=S.sourceCode;V.sourceCode=T;V.spans=S.spans;V.basePos=0;q(U,T)(V);D(V)}catch(W){if("console" in window){console.log(W&&W.stack?W.stack:W)}}}function y(W,V,U){var S=document.createElement("PRE");S.innerHTML=W;if(U){Q(S,U)}var T={langExtension:V,numberLines:U,sourceNode:S};d(T);return S.innerHTML}function b(ad){function Y(af){return document.getElementsByTagName(af)}var ac=[Y("pre"),Y("code"),Y("xmp")];var T=[];for(var aa=0;aa=0){var ah=ai.match(ab);var am;if(!ah&&(am=o(aj))&&"CODE"===am.tagName){ah=am.className.match(ab)}if(ah){ah=ah[1]}var al=false;for(var ak=aj.parentNode;ak;ak=ak.parentNode){if((ak.tagName==="pre"||ak.tagName==="code"||ak.tagName==="xmp")&&ak.className&&ak.className.indexOf("prettyprint")>=0){al=true;break}}if(!al){var af=aj.className.match(/\blinenums\b(?::(\d+))?/);af=af?af[1]&&af[1].length?+af[1]:true:false;if(af){Q(aj,af)}S={langExtension:ah,sourceNode:aj,numberLines:af};d(S)}}}if(X]*(?:>|$)/],[PR.PR_COMMENT,/^<\!--[\s\S]*?(?:-\->|$)/],[PR.PR_PUNCTUATION,/^(?:<[%?]|[%?]>)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-handlebars",/^]*type\s*=\s*['"]?text\/x-handlebars-template['"]?\b[^>]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i],[PR.PR_DECLARATION,/^{{[#^>/]?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{&?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{{>?\s*[\w.][^}]*}}}/],[PR.PR_COMMENT,/^{{![^}]*}}/]]),["handlebars","hbs"]);PR.registerLangHandler(PR.createSimpleLexer([[PR.PR_PLAIN,/^[ \t\r\n\f]+/,null," \t\r\n\f"]],[[PR.PR_STRING,/^\"(?:[^\n\r\f\\\"]|\\(?:\r\n?|\n|\f)|\\[\s\S])*\"/,null],[PR.PR_STRING,/^\'(?:[^\n\r\f\\\']|\\(?:\r\n?|\n|\f)|\\[\s\S])*\'/,null],["lang-css-str",/^url\(([^\)\"\']*)\)/i],[PR.PR_KEYWORD,/^(?:url|rgb|\!important|@import|@page|@media|@charset|inherit)(?=[^\-\w]|$)/i,null],["lang-css-kw",/^(-?(?:[_a-z]|(?:\\[0-9a-f]+ ?))(?:[_a-z0-9\-]|\\(?:\\[0-9a-f]+ ?))*)\s*:/i],[PR.PR_COMMENT,/^\/\*[^*]*\*+(?:[^\/*][^*]*\*+)*\//],[PR.PR_COMMENT,/^(?:)/],[PR.PR_LITERAL,/^(?:\d+|\d*\.\d+)(?:%|[a-z]+)?/i],[PR.PR_LITERAL,/^#(?:[0-9a-f]{3}){1,2}/i],[PR.PR_PLAIN,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i],[PR.PR_PUNCTUATION,/^[^\s\w\'\"]+/]]),["css"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_KEYWORD,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i]]),["css-kw"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_STRING,/^[^\)\"\']+/]]),["css-str"]); diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov.info b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov.info new file mode 100644 index 0000000..08f9a33 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/coverage/lcov.info @@ -0,0 +1,128 @@ +TN: +SF:/Users/jong/Workspace/mz/fs.js +FN:38,exists +FN:39,(anonymous_2) +FNF:2 +FNH:2 +FNDA:1,exists +FNDA:1,(anonymous_2) +DA:2,1 +DA:4,1 +DA:35,1 +DA:38,1 +DA:39,1 +DA:40,1 +LF:6 +LH:6 +BRF:0 +BRH:0 +end_of_record +TN: +SF:/Users/jong/Workspace/mz/_promisify_all.js +FN:4,(anonymous_1) +FN:5,(anonymous_2) +FN:12,(anonymous_3) +FN:19,deprecated +FNF:4 +FNH:4 +FNDA:4,(anonymous_1) +FNDA:40,(anonymous_2) +FNDA:189,(anonymous_3) +FNDA:229,deprecated +DA:2,1 +DA:4,1 +DA:5,4 +DA:6,40 +DA:7,40 +DA:8,40 +DA:12,4 +DA:13,189 +DA:14,187 +DA:15,147 +DA:19,1 +DA:20,229 +DA:21,229 +DA:22,2 +DA:23,0 +LF:15 +LH:14 +BRDA:6,1,0,0 +BRDA:6,1,1,40 +BRDA:7,2,0,40 +BRDA:7,2,1,0 +BRDA:13,3,0,2 +BRDA:13,3,1,187 +BRDA:14,4,0,40 +BRDA:14,4,1,147 +BRDA:21,5,0,227 +BRDA:21,5,1,2 +BRDA:21,6,0,229 +BRDA:21,6,1,229 +BRDA:22,7,0,2 +BRDA:22,7,1,0 +BRF:14 +BRH:11 +end_of_record +TN: +SF:/Users/jong/Workspace/mz/_promisify.js +FN:4,mz_promisify +FN:17,makeCallback +FN:18,(anonymous_3) +FNF:3 +FNH:3 +FNDA:45,mz_promisify +FNDA:10,makeCallback +FNDA:10,(anonymous_3) +DA:2,1 +DA:4,1 +DA:5,45 +DA:17,1 +DA:18,10 +DA:19,10 +DA:20,3 +DA:22,7 +DA:23,7 +DA:24,1 +DA:25,1 +DA:26,2 +DA:28,1 +DA:30,6 +LF:14 +LH:14 +BRDA:19,1,0,3 +BRDA:19,1,1,7 +BRDA:23,2,0,1 +BRDA:23,2,1,6 +BRF:4 +BRH:4 +end_of_record +TN: +SF:/Users/jong/Workspace/mz/child_process.js +FNF:0 +FNH:0 +DA:2,1 +LF:1 +LH:1 +BRF:0 +BRH:0 +end_of_record +TN: +SF:/Users/jong/Workspace/mz/crypto.js +FNF:0 +FNH:0 +DA:2,1 +LF:1 +LH:1 +BRF:0 +BRH:0 +end_of_record +TN: +SF:/Users/jong/Workspace/mz/zlib.js +FNF:0 +FNH:0 +DA:2,1 +LF:1 +LH:1 +BRF:0 +BRH:0 +end_of_record diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/crypto.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/crypto.js new file mode 100644 index 0000000..58a0392 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/crypto.js @@ -0,0 +1,9 @@ + +require('./_promisify_all')( + require('crypto'), + exports, [ + 'pbkdf2', + 'randomBytes', + 'pseudoRandomBytes', + ] +) diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/dns.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/dns.js new file mode 100644 index 0000000..ed45826 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/dns.js @@ -0,0 +1,16 @@ + +require('./_promisify_all')( + require('dns'), + exports, [ + 'lookup', + 'resolve', + 'resolve4', + 'resolve6', + 'resolveMx', + 'resolveTxt', + 'resolveSrv', + 'resolveNs', + 'resolveCname', + 'reverse', + ] +) diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/fs.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/fs.js new file mode 100644 index 0000000..5ea92c7 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/fs.js @@ -0,0 +1,42 @@ + +var fs = require('fs') + +require('./_promisify_all.js')(fs, exports, [ + 'rename', + 'ftruncate', + 'chown', + 'fchown', + 'lchown', + 'chmod', + 'fchmod', + 'stat', + 'lstat', + 'fstat', + 'link', + 'symlink', + 'readlink', + 'realpath', + 'unlink', + 'rmdir', + 'mkdir', + 'readdir', + 'close', + 'open', + 'utimes', + 'futimes', + 'fsync', + 'write', + 'read', + 'readFile', + 'writeFile', + 'appendFile', +]) + +var promisify = require('./_promisify.js') + +// don't know enough about promises to do this haha +exports.exists = promisify('exists', function exists(filename, done) { + fs.stat(filename, function (err) { + done(null, !err) + }) +}) diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/LICENSE b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/README.md b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/README.md new file mode 100644 index 0000000..c4aa50b --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/README.md @@ -0,0 +1,48 @@ + +# native-or-bluebird + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![Dependency Status][david-image]][david-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Use either `bluebird` or the native `Promise` implementation. +If no implementation is found, an error will be thrown: + +```js +var Promise = require('native-or-bluebird'); +``` + +The goal of this library is to be able to eventually remove this line +from your code and use native `Promise`s, allowing you to +to write future-compatible code with ease. +You should install `bluebird` in your libraries for maximum compatibility. + +If you do not want an error to be thrown, +`require()` the `Promise` implementation directly. +If no implementation is found, `undefined` will be returned. + +```js +var Promise = require('native-or-bluebird/promise'); +if (Promise) // do stuff with promises +``` + +[npm-image]: https://img.shields.io/npm/v/native-or-bluebird.svg?style=flat-square +[npm-url]: https://npmjs.org/package/native-or-bluebird +[github-tag]: http://img.shields.io/github/tag/normalize/native-or-bluebird.svg?style=flat-square +[github-url]: https://github.com/normalize/native-or-bluebird/tags +[travis-image]: https://img.shields.io/travis/normalize/native-or-bluebird.svg?style=flat-square +[travis-url]: https://travis-ci.org/normalize/native-or-bluebird +[coveralls-image]: https://img.shields.io/coveralls/normalize/native-or-bluebird.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/normalize/native-or-bluebird?branch=master +[david-image]: http://img.shields.io/david/normalize/native-or-bluebird.svg?style=flat-square +[david-url]: https://david-dm.org/normalize/native-or-bluebird +[license-image]: http://img.shields.io/npm/l/native-or-bluebird.svg?style=flat-square +[license-url]: LICENSE +[downloads-image]: http://img.shields.io/npm/dm/native-or-bluebird.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/native-or-bluebird +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/index.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/index.js new file mode 100644 index 0000000..4e385ec --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/index.js @@ -0,0 +1,9 @@ + +module.exports = require('./promise') + +/* istanbul ignore next */ +if (!module.exports) { + console.error('Neither `bluebird` nor the native `Promise` functions were found.') + console.error('Please install `bluebird` yourself.') + process.exit(1) +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/package.json b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/package.json new file mode 100644 index 0000000..68d7733 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/package.json @@ -0,0 +1,65 @@ +{ + "name": "native-or-bluebird", + "description": "use either the native Promise or Bluebird", + "version": "1.1.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/normalize/native-or-bluebird" + }, + "keywords": [ + "bluebird", + "promise", + "promises" + ], + "devDependencies": { + "bluebird": "*", + "istanbul": "0", + "mocha": "1" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "files": [ + "index.js", + "promise.js", + "LICENSE" + ], + "gitHead": "fc9ac96f8915371fa1ba3ad5efc84909e5c8f2de", + "bugs": { + "url": "https://github.com/normalize/native-or-bluebird/issues" + }, + "homepage": "https://github.com/normalize/native-or-bluebird", + "_id": "native-or-bluebird@1.1.1", + "_shasum": "9131a6d6532afdfb5635f9703734cc6652c905ee", + "_from": "native-or-bluebird@1", + "_npmVersion": "1.4.21", + "_npmUser": { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "swatinem", + "email": "arpad.borsos@googlemail.com" + } + ], + "dist": { + "shasum": "9131a6d6532afdfb5635f9703734cc6652c905ee", + "tarball": "http://registry.npmjs.org/native-or-bluebird/-/native-or-bluebird-1.1.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/native-or-bluebird/-/native-or-bluebird-1.1.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/promise.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/promise.js new file mode 100644 index 0000000..bed7e89 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/node_modules/native-or-bluebird/promise.js @@ -0,0 +1,8 @@ + +module.exports = global.Promise + +if (!module.exports) { + try { + module.exports = require('bluebird') + } catch (_) {} +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/package.json b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/package.json new file mode 100644 index 0000000..a922511 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/package.json @@ -0,0 +1,58 @@ +{ + "name": "mz", + "description": "modernize node.js to current ECMAScript standards", + "version": "1.0.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/normalize/mz" + }, + "dependencies": { + "native-or-bluebird": "1" + }, + "devDependencies": { + "istanbul": "0", + "bluebird": "2", + "mocha": "1" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "gitHead": "e6bd4cb4d0e0b3176638184a38dd54ca9f6f547c", + "bugs": { + "url": "https://github.com/normalize/mz/issues" + }, + "homepage": "https://github.com/normalize/mz", + "_id": "mz@1.0.1", + "_shasum": "5ce1d3fe5cb3267c9c3141fb6a070f8d17f215d8", + "_from": "mz@1", + "_npmVersion": "1.4.21", + "_npmUser": { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "swatinem", + "email": "arpad.borsos@googlemail.com" + } + ], + "dist": { + "shasum": "5ce1d3fe5cb3267c9c3141fb6a070f8d17f215d8", + "tarball": "http://registry.npmjs.org/mz/-/mz-1.0.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/mz/-/mz-1.0.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/zlib.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/zlib.js new file mode 100644 index 0000000..5cf3222 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/node_modules/mz/zlib.js @@ -0,0 +1,13 @@ + +require('./_promisify_all')( + require('zlib'), + exports, [ + 'deflate', + 'deflateRaw', + 'gzip', + 'gunzip', + 'inflate', + 'inflateRaw', + 'unzip', + ] +) diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/package.json b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/package.json new file mode 100644 index 0000000..1657a18 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/package.json @@ -0,0 +1,59 @@ +{ + "name": "uid-safe", + "description": "URL and cookie safe UIDs", + "version": "1.0.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "git://github.com/crypto-utils/uid-safe" + }, + "dependencies": { + "mz": "1", + "base64-url": "1" + }, + "devDependencies": { + "bluebird": "2", + "mocha": "1" + }, + "scripts": { + "test": "mocha --reporter spec --bail" + }, + "bugs": { + "url": "https://github.com/crypto-utils/uid-safe/issues" + }, + "homepage": "https://github.com/crypto-utils/uid-safe", + "_id": "uid-safe@1.0.1", + "_shasum": "5bd148460a2e84f54f193fd20352c8c3d7de6ac8", + "_from": "uid-safe@~1.0.1", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + } + ], + "dist": { + "shasum": "5bd148460a2e84f54f193fd20352c8c3d7de6ac8", + "tarball": "http://registry.npmjs.org/uid-safe/-/uid-safe-1.0.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-1.0.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/test.js b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/test.js new file mode 100644 index 0000000..3665fb9 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/node_modules/uid-safe/test.js @@ -0,0 +1,46 @@ + +var assert = require('assert') + +var uid = require('./') + +describe('uid-url', function () { + describe('uid()', function () { + it('should return a uid of the correct length', function () { + return uid(18).then(function (val) { + assert.equal(24, Buffer.byteLength(val)) + }) + }) + + it('should not contain +, /, or =', function () { + return uid(100000).then(function (val) { + assert(!~val.indexOf('+')) + assert(!~val.indexOf('/')) + assert(!~val.indexOf('=')) + }) + }) + + it('should support callbacks', function (done) { + uid(1000000, function (err, val) { + if (err) return done(err) + assert(!~val.indexOf('+')) + assert(!~val.indexOf('/')) + assert(!~val.indexOf('=')) + done() + }) + }) + }) + + describe('uid.sync()', function () { + it('should return a uid of the correct length', function () { + var val = uid.sync(18) + assert.equal(24, Buffer.byteLength(val)) + }) + + it('should not contain +, /, or =', function () { + var val = uid.sync(100000) + assert(!~val.indexOf('+')) + assert(!~val.indexOf('/')) + assert(!~val.indexOf('=')) + }) + }) +}) diff --git a/node_modules/csurf/node_modules/csrf/package.json b/node_modules/csurf/node_modules/csrf/package.json new file mode 100644 index 0000000..11ea802 --- /dev/null +++ b/node_modules/csurf/node_modules/csrf/package.json @@ -0,0 +1,67 @@ +{ + "name": "csrf", + "description": "primary logic behind csrf tokens", + "version": "2.0.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/pillarjs/csrf" + }, + "dependencies": { + "rndm": "~1.0.0", + "scmp": "0.0.3", + "uid-safe": "~1.0.1", + "base64-url": "1.0.0" + }, + "devDependencies": { + "istanbul": "0", + "bluebird": "2", + "mocha": "1" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "keywords": [ + "csrf", + "tokens" + ], + "files": [ + "index.js" + ], + "gitHead": "d23024ade7607942a2236ec0ae5903396f610db0", + "bugs": { + "url": "https://github.com/pillarjs/csrf/issues" + }, + "homepage": "https://github.com/pillarjs/csrf", + "_id": "csrf@2.0.1", + "_shasum": "d673a2efb4db7d0e6805dadd838c57e30ae0ee73", + "_from": "csrf@~2.0.1", + "_npmVersion": "1.4.21", + "_npmUser": { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + "maintainers": [ + { + "name": "dwolla", + "email": "michael@dwolla.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "dist": { + "shasum": "d673a2efb4db7d0e6805dadd838c57e30ae0ee73", + "tarball": "http://registry.npmjs.org/csrf/-/csrf-2.0.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/csrf/-/csrf-2.0.1.tgz" +} diff --git a/node_modules/csurf/package.json b/node_modules/csurf/package.json new file mode 100644 index 0000000..9a6f4b9 --- /dev/null +++ b/node_modules/csurf/package.json @@ -0,0 +1,100 @@ +{ + "name": "csurf", + "description": "CSRF token middleware", + "version": "1.6.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/expressjs/csurf" + }, + "dependencies": { + "cookie": "0.1.2", + "cookie-signature": "1.0.5", + "csrf": "~2.0.1" + }, + "devDependencies": { + "body-parser": "~1.8.0", + "connect": "3", + "cookie-parser": "~1.3.3", + "cookie-session": "~1.0.2", + "istanbul": "0.3.2", + "mocha": "~1.21.3", + "should": "~4.0.4", + "supertest": "~0.13.0" + }, + "engines": { + "node": ">= 0.8.0" + }, + "scripts": { + "test": "mocha --check-leaks --reporter spec --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "keywords": [ + "csrf", + "tokens", + "middleware", + "express" + ], + "gitHead": "fb69d592c265764184744dd764d878a6dc83bd0c", + "bugs": { + "url": "https://github.com/expressjs/csurf/issues" + }, + "homepage": "https://github.com/expressjs/csurf", + "_id": "csurf@1.6.1", + "_shasum": "78da376f016bcaa48275d553d133585e478f4054", + "_from": "csurf@", + "_npmVersion": "1.4.21", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "shtylman", + "email": "shtylman@gmail.com" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "mscdex", + "email": "mscdex@mscdex.net" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + } + ], + "dist": { + "shasum": "78da376f016bcaa48275d553d133585e478f4054", + "tarball": "http://registry.npmjs.org/csurf/-/csurf-1.6.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/csurf/-/csurf-1.6.1.tgz" +} diff --git a/node_modules/express/History.md b/node_modules/express/History.md index d67cb81..ec5c90b 100644 --- a/node_modules/express/History.md +++ b/node_modules/express/History.md @@ -1,3 +1,9 @@ +4.9.4 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + 4.9.3 / 2014-09-18 ================== @@ -493,6 +499,13 @@ - `app.route()` - Proxy to the app's `Router#route()` method to create a new route - Router & Route - public API +3.17.4 / 2014-09-19 +=================== + + * deps: connect@2.26.2 + - deps: body-parser@~1.8.3 + - deps: qs@2.2.4 + 3.17.3 / 2014-09-18 =================== diff --git a/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json b/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json index f067351..5bde5db 100644 --- a/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json +++ b/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json @@ -52,7 +52,7 @@ "homepage": "https://github.com/jshttp/mime-db", "_id": "mime-db@1.0.1", "_shasum": "35d99b0965967253bb30633a7d07a8de9975a952", - "_from": "mime-db@~1.0.1", + "_from": "mime-db@>=1.0.1 <1.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "jongleberry", diff --git a/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json b/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json index 494c346..e11bce8 100644 --- a/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json +++ b/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json @@ -50,7 +50,7 @@ "homepage": "https://github.com/jshttp/mime-types", "_id": "mime-types@2.0.1", "_shasum": "7f5b4712592e7dd46ca733fd1c5f5d71356de615", - "_from": "mime-types@~2.0.1", + "_from": "mime-types@>=2.0.1 <2.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json b/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json index 73193ba..0572f18 100644 --- a/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json +++ b/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json @@ -62,5 +62,6 @@ ], "directories": {}, "_shasum": "a4160f7177ec806738631d0d3052325da42abdc8", - "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.4.7.tgz" + "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.4.7.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/accepts/package.json b/node_modules/express/node_modules/accepts/package.json index 441d8dc..877bc5d 100644 --- a/node_modules/express/node_modules/accepts/package.json +++ b/node_modules/express/node_modules/accepts/package.json @@ -45,7 +45,7 @@ "homepage": "https://github.com/jshttp/accepts", "_id": "accepts@1.1.0", "_shasum": "43ba6d946374c80f91823eaec6bb43dc4955500b", - "_from": "accepts@~1.1.0", + "_from": "accepts@>=1.1.0 <1.2.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "jongleberry", diff --git a/node_modules/express/node_modules/etag/node_modules/crc/package.json b/node_modules/express/node_modules/etag/node_modules/crc/package.json index 5d8586f..712dbd8 100644 --- a/node_modules/express/node_modules/etag/node_modules/crc/package.json +++ b/node_modules/express/node_modules/etag/node_modules/crc/package.json @@ -53,5 +53,6 @@ "tarball": "http://registry.npmjs.org/crc/-/crc-3.0.0.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/crc/-/crc-3.0.0.tgz" + "_resolved": "https://registry.npmjs.org/crc/-/crc-3.0.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/etag/package.json b/node_modules/express/node_modules/etag/package.json index c33c203..34e68ca 100644 --- a/node_modules/express/node_modules/etag/package.json +++ b/node_modules/express/node_modules/etag/package.json @@ -53,7 +53,7 @@ "homepage": "https://github.com/jshttp/etag", "_id": "etag@1.3.1", "_shasum": "e51925728688a32dc4eea1cfa9ab4f734d055567", - "_from": "etag@~1.3.1", + "_from": "etag@>=1.3.1 <1.4.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -70,5 +70,6 @@ "tarball": "http://registry.npmjs.org/etag/-/etag-1.3.1.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/etag/-/etag-1.3.1.tgz" + "_resolved": "https://registry.npmjs.org/etag/-/etag-1.3.1.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/.jshintrc b/node_modules/express/node_modules/finalhandler/node_modules/debug/.jshintrc deleted file mode 100644 index 299877f..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/.jshintrc +++ /dev/null @@ -1,3 +0,0 @@ -{ - "laxbreak": true -} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/History.md b/node_modules/express/node_modules/finalhandler/node_modules/debug/History.md deleted file mode 100644 index 79429ff..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/History.md +++ /dev/null @@ -1,150 +0,0 @@ - -2.0.0 / 2014-09-01 -================== - - * package: update "browserify" to v5.11.0 - * node: use stderr rather than stdout for logging (#29, @stephenmathieson) - -1.0.4 / 2014-07-15 -================== - - * dist: recompile - * example: remove `console.info()` log usage - * example: add "Content-Type" UTF-8 header to browser example - * browser: place %c marker after the space character - * browser: reset the "content" color via `color: inherit` - * browser: add colors support for Firefox >= v31 - * debug: prefer an instance `log()` function over the global one (#119) - * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) - -1.0.3 / 2014-07-09 -================== - - * Add support for multiple wildcards in namespaces (#122, @seegno) - * browser: fix lint - -1.0.2 / 2014-06-10 -================== - - * browser: update color palette (#113, @gscottolson) - * common: make console logging function configurable (#108, @timoxley) - * node: fix %o colors on old node <= 0.8.x - * Makefile: find node path using shell/which (#109, @timoxley) - -1.0.1 / 2014-06-06 -================== - - * browser: use `removeItem()` to clear localStorage - * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) - * package: add "contributors" section - * node: fix comment typo - * README: list authors - -1.0.0 / 2014-06-04 -================== - - * make ms diff be global, not be scope - * debug: ignore empty strings in enable() - * node: make DEBUG_COLORS able to disable coloring - * *: export the `colors` array - * npmignore: don't publish the `dist` dir - * Makefile: refactor to use browserify - * package: add "browserify" as a dev dependency - * Readme: add Web Inspector Colors section - * node: reset terminal color for the debug content - * node: map "%o" to `util.inspect()` - * browser: map "%j" to `JSON.stringify()` - * debug: add custom "formatters" - * debug: use "ms" module for humanizing the diff - * Readme: add "bash" syntax highlighting - * browser: add Firebug color support - * browser: add colors for WebKit browsers - * node: apply log to `console` - * rewrite: abstract common logic for Node & browsers - * add .jshintrc file - -0.8.1 / 2014-04-14 -================== - - * package: re-add the "component" section - -0.8.0 / 2014-03-30 -================== - - * add `enable()` method for nodejs. Closes #27 - * change from stderr to stdout - * remove unnecessary index.js file - -0.7.4 / 2013-11-13 -================== - - * remove "browserify" key from package.json (fixes something in browserify) - -0.7.3 / 2013-10-30 -================== - - * fix: catch localStorage security error when cookies are blocked (Chrome) - * add debug(err) support. Closes #46 - * add .browser prop to package.json. Closes #42 - -0.7.2 / 2013-02-06 -================== - - * fix package.json - * fix: Mobile Safari (private mode) is broken with debug - * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript - -0.7.1 / 2013-02-05 -================== - - * add repository URL to package.json - * add DEBUG_COLORED to force colored output - * add browserify support - * fix component. Closes #24 - -0.7.0 / 2012-05-04 -================== - - * Added .component to package.json - * Added debug.component.js build - -0.6.0 / 2012-03-16 -================== - - * Added support for "-" prefix in DEBUG [Vinay Pulim] - * Added `.enabled` flag to the node version [TooTallNate] - -0.5.0 / 2012-02-02 -================== - - * Added: humanize diffs. Closes #8 - * Added `debug.disable()` to the CS variant - * Removed padding. Closes #10 - * Fixed: persist client-side variant again. Closes #9 - -0.4.0 / 2012-02-01 -================== - - * Added browser variant support for older browsers [TooTallNate] - * Added `debug.enable('project:*')` to browser variant [TooTallNate] - * Added padding to diff (moved it to the right) - -0.3.0 / 2012-01-26 -================== - - * Added millisecond diff when isatty, otherwise UTC string - -0.2.0 / 2012-01-22 -================== - - * Added wildcard support - -0.1.0 / 2011-12-02 -================== - - * Added: remove colors unless stderr isatty [TooTallNate] - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/Makefile b/node_modules/express/node_modules/finalhandler/node_modules/debug/Makefile deleted file mode 100644 index b0bde6e..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/Makefile +++ /dev/null @@ -1,33 +0,0 @@ - -# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 -THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) -THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) - -# BIN directory -BIN := $(THIS_DIR)/node_modules/.bin - -# applications -NODE ?= $(shell which node) -NPM ?= $(NODE) $(shell which npm) -BROWSERIFY ?= $(NODE) $(BIN)/browserify - -all: dist/debug.js - -install: node_modules - -clean: - @rm -rf node_modules dist - -dist: - @mkdir -p $@ - -dist/debug.js: node_modules browser.js debug.js dist - @$(BROWSERIFY) \ - --standalone debug \ - . > $@ - -node_modules: package.json - @NODE_ENV= $(NPM) install - @touch node_modules - -.PHONY: all install clean diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/Readme.md b/node_modules/express/node_modules/finalhandler/node_modules/debug/Readme.md deleted file mode 100644 index e59b9ad..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/Readme.md +++ /dev/null @@ -1,156 +0,0 @@ -# debug - - tiny node.js debugging utility modelled after node core's debugging technique. - -## Installation - -```bash -$ npm install debug -``` - -## Usage - - With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility. - -Example _app.js_: - -```js -var debug = require('debug')('http') - , http = require('http') - , name = 'My App'; - -// fake app - -debug('booting %s', name); - -http.createServer(function(req, res){ - debug(req.method + ' ' + req.url); - res.end('hello\n'); -}).listen(3000, function(){ - debug('listening'); -}); - -// fake worker of some kind - -require('./worker'); -``` - -Example _worker.js_: - -```js -var debug = require('debug')('worker'); - -setInterval(function(){ - debug('doing some work'); -}, 1000); -``` - - The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: - - ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) - - ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) - -## Millisecond diff - - When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. - - ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) - - When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: - - ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) - -## Conventions - - If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". - -## Wildcards - - The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect.compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. - - You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". - -## Browser support - - Debug works in the browser as well, currently persisted by `localStorage`. For example if you have `worker:a` and `worker:b` as shown below, and wish to debug both type `debug.enable('worker:*')` in the console and refresh the page, this will remain until you disable with `debug.disable()`. - -```js -a = debug('worker:a'); -b = debug('worker:b'); - -setInterval(function(){ - a('doing some work'); -}, 1000); - -setInterval(function(){ - b('doing some work'); -}, 1200); -``` - -#### Web Inspector Colors - - Colors are also enabled on "Web Inspectors" that understand the `%c` formatting - option. These are WebKit web inspectors, Firefox ([since version - 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) - and the Firebug plugin for Firefox (any version). - - Colored output looks something like: - - ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) - -### stderr vs stdout - -You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally: - -Example _stderr.js_: - -```js -var debug = require('../'); -var log = debug('app:log'); - -// by default console.log is used -log('goes to stdout!'); - -var error = debug('app:error'); -// set this namespace to log via console.error -error.log = console.error.bind(console); // don't forget to bind to console! -error('goes to stderr'); -log('still goes to stdout!'); - -// set all output to go via console.warn -// overrides all per-namespace log settings -debug.log = console.warn.bind(console); -log('now goes to stderr via console.warn'); -error('still goes to stderr, but via console.warn now'); -``` - -## Authors - - - TJ Holowaychuk - - Nathan Rajlich - -## License - -(The MIT License) - -Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/browser.js b/node_modules/express/node_modules/finalhandler/node_modules/debug/browser.js deleted file mode 100644 index ce6369f..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/browser.js +++ /dev/null @@ -1,147 +0,0 @@ - -/** - * This is the web browser implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; - -/** - * Colors. - */ - -exports.colors = [ - 'lightseagreen', - 'forestgreen', - 'goldenrod', - 'dodgerblue', - 'darkorchid', - 'crimson' -]; - -/** - * Currently only WebKit-based Web Inspectors, Firefox >= v31, - * and the Firebug extension (any Firefox version) are known - * to support "%c" CSS customizations. - * - * TODO: add a `localStorage` variable to explicitly enable/disable colors - */ - -function useColors() { - // is webkit? http://stackoverflow.com/a/16459606/376773 - return ('WebkitAppearance' in document.documentElement.style) || - // is firebug? http://stackoverflow.com/a/398120/376773 - (window.console && (console.firebug || (console.exception && console.table))) || - // is firefox >= v31? - // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages - (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31); -} - -/** - * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. - */ - -exports.formatters.j = function(v) { - return JSON.stringify(v); -}; - - -/** - * Colorize log arguments if enabled. - * - * @api public - */ - -function formatArgs() { - var args = arguments; - var useColors = this.useColors; - - args[0] = (useColors ? '%c' : '') - + this.namespace - + (useColors ? ' %c' : ' ') - + args[0] - + (useColors ? '%c ' : ' ') - + '+' + exports.humanize(this.diff); - - if (!useColors) return args; - - var c = 'color: ' + this.color; - args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1)); - - // the final "%c" is somewhat tricky, because there could be other - // arguments passed either before or after the %c, so we need to - // figure out the correct index to insert the CSS into - var index = 0; - var lastC = 0; - args[0].replace(/%[a-z%]/g, function(match) { - if ('%%' === match) return; - index++; - if ('%c' === match) { - // we only are interested in the *last* %c - // (the user may have provided their own) - lastC = index; - } - }); - - args.splice(lastC, 0, c); - return args; -} - -/** - * Invokes `console.log()` when available. - * No-op when `console.log` is not a "function". - * - * @api public - */ - -function log() { - // This hackery is required for IE8, - // where the `console.log` function doesn't have 'apply' - return 'object' == typeof console - && 'function' == typeof console.log - && Function.prototype.apply.call(console.log, console, arguments); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - try { - if (null == namespaces) { - localStorage.removeItem('debug'); - } else { - localStorage.debug = namespaces; - } - } catch(e) {} -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - var r; - try { - r = localStorage.debug; - } catch(e) {} - return r; -} - -/** - * Enable namespaces listed in `localStorage.debug` initially. - */ - -exports.enable(load()); diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/component.json b/node_modules/express/node_modules/finalhandler/node_modules/debug/component.json deleted file mode 100644 index db1ceed..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/component.json +++ /dev/null @@ -1,19 +0,0 @@ -{ - "name": "debug", - "repo": "visionmedia/debug", - "description": "small debugging utility", - "version": "2.0.0", - "keywords": [ - "debug", - "log", - "debugger" - ], - "main": "browser.js", - "scripts": [ - "browser.js", - "debug.js" - ], - "dependencies": { - "guille/ms.js": "0.6.1" - } -} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/debug.js b/node_modules/express/node_modules/finalhandler/node_modules/debug/debug.js deleted file mode 100644 index 7571a86..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/debug.js +++ /dev/null @@ -1,197 +0,0 @@ - -/** - * This is the common logic for both the Node.js and web browser - * implementations of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = debug; -exports.coerce = coerce; -exports.disable = disable; -exports.enable = enable; -exports.enabled = enabled; -exports.humanize = require('ms'); - -/** - * The currently active debug mode names, and names to skip. - */ - -exports.names = []; -exports.skips = []; - -/** - * Map of special "%n" handling functions, for the debug "format" argument. - * - * Valid key names are a single, lowercased letter, i.e. "n". - */ - -exports.formatters = {}; - -/** - * Previously assigned color. - */ - -var prevColor = 0; - -/** - * Previous log timestamp. - */ - -var prevTime; - -/** - * Select a color. - * - * @return {Number} - * @api private - */ - -function selectColor() { - return exports.colors[prevColor++ % exports.colors.length]; -} - -/** - * Create a debugger with the given `namespace`. - * - * @param {String} namespace - * @return {Function} - * @api public - */ - -function debug(namespace) { - - // define the `disabled` version - function disabled() { - } - disabled.enabled = false; - - // define the `enabled` version - function enabled() { - - var self = enabled; - - // set `diff` timestamp - var curr = +new Date(); - var ms = curr - (prevTime || curr); - self.diff = ms; - self.prev = prevTime; - self.curr = curr; - prevTime = curr; - - // add the `color` if not set - if (null == self.useColors) self.useColors = exports.useColors(); - if (null == self.color && self.useColors) self.color = selectColor(); - - var args = Array.prototype.slice.call(arguments); - - args[0] = exports.coerce(args[0]); - - if ('string' !== typeof args[0]) { - // anything else let's inspect with %o - args = ['%o'].concat(args); - } - - // apply any `formatters` transformations - var index = 0; - args[0] = args[0].replace(/%([a-z%])/g, function(match, format) { - // if we encounter an escaped % then don't increase the array index - if (match === '%%') return match; - index++; - var formatter = exports.formatters[format]; - if ('function' === typeof formatter) { - var val = args[index]; - match = formatter.call(self, val); - - // now we need to remove `args[index]` since it's inlined in the `format` - args.splice(index, 1); - index--; - } - return match; - }); - - if ('function' === typeof exports.formatArgs) { - args = exports.formatArgs.apply(self, args); - } - var logFn = enabled.log || exports.log || console.log.bind(console); - logFn.apply(self, args); - } - enabled.enabled = true; - - var fn = exports.enabled(namespace) ? enabled : disabled; - - fn.namespace = namespace; - - return fn; -} - -/** - * Enables a debug mode by namespaces. This can include modes - * separated by a colon and wildcards. - * - * @param {String} namespaces - * @api public - */ - -function enable(namespaces) { - exports.save(namespaces); - - var split = (namespaces || '').split(/[\s,]+/); - var len = split.length; - - for (var i = 0; i < len; i++) { - if (!split[i]) continue; // ignore empty strings - namespaces = split[i].replace(/\*/g, '.*?'); - if (namespaces[0] === '-') { - exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); - } else { - exports.names.push(new RegExp('^' + namespaces + '$')); - } - } -} - -/** - * Disable debug output. - * - * @api public - */ - -function disable() { - exports.enable(''); -} - -/** - * Returns true if the given mode name is enabled, false otherwise. - * - * @param {String} name - * @return {Boolean} - * @api public - */ - -function enabled(name) { - var i, len; - for (i = 0, len = exports.skips.length; i < len; i++) { - if (exports.skips[i].test(name)) { - return false; - } - } - for (i = 0, len = exports.names.length; i < len; i++) { - if (exports.names[i].test(name)) { - return true; - } - } - return false; -} - -/** - * Coerce `val`. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function coerce(val) { - if (val instanceof Error) return val.stack || val.message; - return val; -} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/node.js b/node_modules/express/node_modules/finalhandler/node_modules/debug/node.js deleted file mode 100644 index db86f64..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/node.js +++ /dev/null @@ -1,129 +0,0 @@ - -/** - * Module dependencies. - */ - -var tty = require('tty'); -var util = require('util'); - -/** - * This is the Node.js implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; - -/** - * Colors. - */ - -exports.colors = [6, 2, 3, 4, 5, 1]; - -/** - * Is stdout a TTY? Colored output is enabled when `true`. - */ - -function useColors() { - var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase(); - if (0 === debugColors.length) { - return tty.isatty(1); - } else { - return '0' !== debugColors - && 'no' !== debugColors - && 'false' !== debugColors - && 'disabled' !== debugColors; - } -} - -/** - * Map %o to `util.inspect()`, since Node doesn't do that out of the box. - */ - -var inspect = (4 === util.inspect.length ? - // node <= 0.8.x - function (v, colors) { - return util.inspect(v, void 0, void 0, colors); - } : - // node > 0.8.x - function (v, colors) { - return util.inspect(v, { colors: colors }); - } -); - -exports.formatters.o = function(v) { - return inspect(v, this.useColors) - .replace(/\s*\n\s*/g, ' '); -}; - -/** - * Adds ANSI color escape codes if enabled. - * - * @api public - */ - -function formatArgs() { - var args = arguments; - var useColors = this.useColors; - var name = this.namespace; - - if (useColors) { - var c = this.color; - - args[0] = ' \u001b[9' + c + 'm' + name + ' ' - + '\u001b[0m' - + args[0] + '\u001b[3' + c + 'm' - + ' +' + exports.humanize(this.diff) + '\u001b[0m'; - } else { - args[0] = new Date().toUTCString() - + ' ' + name + ' ' + args[0]; - } - return args; -} - -/** - * Invokes `console.error()` with the specified arguments. - */ - -function log() { - return console.error.apply(console, arguments); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - if (null == namespaces) { - // If you set a process.env field to null or undefined, it gets cast to the - // string 'null' or 'undefined'. Just delete instead. - delete process.env.DEBUG; - } else { - process.env.DEBUG = namespaces; - } -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - return process.env.DEBUG; -} - -/** - * Enable namespaces listed in `process.env.DEBUG` initially. - */ - -exports.enable(load()); diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/.npmignore b/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/.npmignore deleted file mode 100644 index d1aa0ce..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/.npmignore +++ /dev/null @@ -1,5 +0,0 @@ -node_modules -test -History.md -Makefile -component.json diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/README.md b/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/README.md deleted file mode 100644 index d4ab12a..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/README.md +++ /dev/null @@ -1,33 +0,0 @@ -# ms.js: miliseconds conversion utility - -```js -ms('1d') // 86400000 -ms('10h') // 36000000 -ms('2h') // 7200000 -ms('1m') // 60000 -ms('5s') // 5000 -ms('100') // 100 -``` - -```js -ms(60000) // "1m" -ms(2 * 60000) // "2m" -ms(ms('10 hours')) // "10h" -``` - -```js -ms(60000, { long: true }) // "1 minute" -ms(2 * 60000, { long: true }) // "2 minutes" -ms(ms('10 hours', { long: true })) // "10 hours" -``` - -- Node/Browser compatible. Published as `ms` in NPM. -- If a number is supplied to `ms`, a string with a unit is returned. -- If a string that contains the number is supplied, it returns it as -a number (e.g: it returns `100` for `'100'`). -- If you pass a string with a number and a valid unit, the number of -equivalent ms is returned. - -## License - -MIT \ No newline at end of file diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/index.js b/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/index.js deleted file mode 100644 index c5847f8..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/index.js +++ /dev/null @@ -1,111 +0,0 @@ -/** - * Helpers. - */ - -var s = 1000; -var m = s * 60; -var h = m * 60; -var d = h * 24; -var y = d * 365.25; - -/** - * Parse or format the given `val`. - * - * Options: - * - * - `long` verbose formatting [false] - * - * @param {String|Number} val - * @param {Object} options - * @return {String|Number} - * @api public - */ - -module.exports = function(val, options){ - options = options || {}; - if ('string' == typeof val) return parse(val); - return options.long - ? long(val) - : short(val); -}; - -/** - * Parse the given `str` and return milliseconds. - * - * @param {String} str - * @return {Number} - * @api private - */ - -function parse(str) { - var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str); - if (!match) return; - var n = parseFloat(match[1]); - var type = (match[2] || 'ms').toLowerCase(); - switch (type) { - case 'years': - case 'year': - case 'y': - return n * y; - case 'days': - case 'day': - case 'd': - return n * d; - case 'hours': - case 'hour': - case 'h': - return n * h; - case 'minutes': - case 'minute': - case 'm': - return n * m; - case 'seconds': - case 'second': - case 's': - return n * s; - case 'ms': - return n; - } -} - -/** - * Short format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function short(ms) { - if (ms >= d) return Math.round(ms / d) + 'd'; - if (ms >= h) return Math.round(ms / h) + 'h'; - if (ms >= m) return Math.round(ms / m) + 'm'; - if (ms >= s) return Math.round(ms / s) + 's'; - return ms + 'ms'; -} - -/** - * Long format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function long(ms) { - return plural(ms, d, 'day') - || plural(ms, h, 'hour') - || plural(ms, m, 'minute') - || plural(ms, s, 'second') - || ms + ' ms'; -} - -/** - * Pluralization helper. - */ - -function plural(ms, n, name) { - if (ms < n) return; - if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; - return Math.ceil(ms / n) + ' ' + name + 's'; -} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/package.json b/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/package.json deleted file mode 100644 index 654cde8..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/node_modules/ms/package.json +++ /dev/null @@ -1,47 +0,0 @@ -{ - "name": "ms", - "version": "0.6.2", - "description": "Tiny ms conversion utility", - "repository": { - "type": "git", - "url": "git://github.com/guille/ms.js.git" - }, - "main": "./index", - "devDependencies": { - "mocha": "*", - "expect.js": "*", - "serve": "*" - }, - "component": { - "scripts": { - "ms/index.js": "index.js" - } - }, - "readme": "# ms.js: miliseconds conversion utility\n\n```js\nms('1d') // 86400000\nms('10h') // 36000000\nms('2h') // 7200000\nms('1m') // 60000\nms('5s') // 5000\nms('100') // 100\n```\n\n```js\nms(60000) // \"1m\"\nms(2 * 60000) // \"2m\"\nms(ms('10 hours')) // \"10h\"\n```\n\n```js\nms(60000, { long: true }) // \"1 minute\"\nms(2 * 60000, { long: true }) // \"2 minutes\"\nms(ms('10 hours', { long: true })) // \"10 hours\"\n```\n\n- Node/Browser compatible. Published as `ms` in NPM.\n- If a number is supplied to `ms`, a string with a unit is returned.\n- If a string that contains the number is supplied, it returns it as\na number (e.g: it returns `100` for `'100'`).\n- If you pass a string with a number and a valid unit, the number of\nequivalent ms is returned.\n\n## License\n\nMIT", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/guille/ms.js/issues" - }, - "_id": "ms@0.6.2", - "dist": { - "shasum": "d89c2124c6fdc1353d65a8b77bf1aac4b193708c", - "tarball": "http://registry.npmjs.org/ms/-/ms-0.6.2.tgz" - }, - "_from": "ms@0.6.2", - "_npmVersion": "1.2.30", - "_npmUser": { - "name": "rauchg", - "email": "rauchg@gmail.com" - }, - "maintainers": [ - { - "name": "rauchg", - "email": "rauchg@gmail.com" - } - ], - "directories": {}, - "_shasum": "d89c2124c6fdc1353d65a8b77bf1aac4b193708c", - "_resolved": "https://registry.npmjs.org/ms/-/ms-0.6.2.tgz", - "homepage": "https://github.com/guille/ms.js", - "scripts": {} -} diff --git a/node_modules/express/node_modules/finalhandler/node_modules/debug/package.json b/node_modules/express/node_modules/finalhandler/node_modules/debug/package.json deleted file mode 100644 index 551da3b..0000000 --- a/node_modules/express/node_modules/finalhandler/node_modules/debug/package.json +++ /dev/null @@ -1,71 +0,0 @@ -{ - "name": "debug", - "version": "2.0.0", - "repository": { - "type": "git", - "url": "git://github.com/visionmedia/debug.git" - }, - "description": "small debugging utility", - "keywords": [ - "debug", - "log", - "debugger" - ], - "author": { - "name": "TJ Holowaychuk", - "email": "tj@vision-media.ca" - }, - "contributors": [ - { - "name": "Nathan Rajlich", - "email": "nathan@tootallnate.net", - "url": "http://n8.io" - } - ], - "dependencies": { - "ms": "0.6.2" - }, - "devDependencies": { - "browserify": "5.11.0", - "mocha": "*" - }, - "main": "./node.js", - "browser": "./browser.js", - "component": { - "scripts": { - "debug/index.js": "browser.js", - "debug/debug.js": "debug.js" - } - }, - "gitHead": "c61ae82bde19c6fdedfc6684817ff7eb541ff029", - "bugs": { - "url": "https://github.com/visionmedia/debug/issues" - }, - "homepage": "https://github.com/visionmedia/debug", - "_id": "debug@2.0.0", - "scripts": {}, - "_shasum": "89bd9df6732b51256bc6705342bba02ed12131ef", - "_from": "debug@~2.0.0", - "_npmVersion": "1.4.21", - "_npmUser": { - "name": "tootallnate", - "email": "nathan@tootallnate.net" - }, - "maintainers": [ - { - "name": "tjholowaychuk", - "email": "tj@vision-media.ca" - }, - { - "name": "tootallnate", - "email": "nathan@tootallnate.net" - } - ], - "dist": { - "shasum": "89bd9df6732b51256bc6705342bba02ed12131ef", - "tarball": "http://registry.npmjs.org/debug/-/debug-2.0.0.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/debug/-/debug-2.0.0.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/node_modules/express/node_modules/merge-descriptors/package.json b/node_modules/express/node_modules/merge-descriptors/package.json index 76673a2..b1b83d4 100644 --- a/node_modules/express/node_modules/merge-descriptors/package.json +++ b/node_modules/express/node_modules/merge-descriptors/package.json @@ -38,5 +38,6 @@ ], "directories": {}, "_shasum": "c36a52a781437513c57275f39dd9d317514ac8c7", - "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-0.0.2.tgz" + "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-0.0.2.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/methods/package.json b/node_modules/express/node_modules/methods/package.json index 7d57f1a..8d1c198 100644 --- a/node_modules/express/node_modules/methods/package.json +++ b/node_modules/express/node_modules/methods/package.json @@ -53,5 +53,6 @@ "tarball": "http://registry.npmjs.org/methods/-/methods-1.1.0.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.0.tgz" + "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/on-finished/package.json b/node_modules/express/node_modules/on-finished/package.json index 374a921..076151c 100644 --- a/node_modules/express/node_modules/on-finished/package.json +++ b/node_modules/express/node_modules/on-finished/package.json @@ -45,7 +45,7 @@ "homepage": "https://github.com/jshttp/on-finished", "_id": "on-finished@2.1.0", "_shasum": "0c539f09291e8ffadde0c8a25850fb2cedc7022d", - "_from": "on-finished@~2.1.0", + "_from": "on-finished@>=2.1.0 <2.2.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/parseurl/package.json b/node_modules/express/node_modules/parseurl/package.json index 6fbd23e..4a6a46b 100644 --- a/node_modules/express/node_modules/parseurl/package.json +++ b/node_modules/express/node_modules/parseurl/package.json @@ -38,7 +38,7 @@ "homepage": "https://github.com/expressjs/parseurl", "_id": "parseurl@1.3.0", "_shasum": "b58046db4223e145afa76009e61bac87cc2281b3", - "_from": "parseurl@~1.3.0", + "_from": "parseurl@>=1.3.0 <1.4.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/proxy-addr/HISTORY.md b/node_modules/express/node_modules/proxy-addr/HISTORY.md index be5a4ff..c0ff10e 100644 --- a/node_modules/express/node_modules/proxy-addr/HISTORY.md +++ b/node_modules/express/node_modules/proxy-addr/HISTORY.md @@ -1,3 +1,8 @@ +1.0.3 / 2014-09-21 +================== + + * Use `forwarded` npm module + 1.0.2 / 2014-09-18 ================== diff --git a/node_modules/express/node_modules/proxy-addr/index.js b/node_modules/express/node_modules/proxy-addr/index.js index f10b2d5..d739513 100644 --- a/node_modules/express/node_modules/proxy-addr/index.js +++ b/node_modules/express/node_modules/proxy-addr/index.js @@ -16,6 +16,7 @@ module.exports.compile = compile; * Module dependencies. */ +var forwarded = require('forwarded'); var ipaddr = require('ipaddr.js'); /** @@ -46,16 +47,8 @@ var ipranges = { */ function alladdrs(req, trust) { - if (!req) { - throw new TypeError('req argument is required'); - } - - var proxyAddrs = (req.headers['x-forwarded-for'] || '') - .split(/ *, */) - .filter(Boolean) - .reverse(); - var socketAddr = req.connection.remoteAddress; - var addrs = [socketAddr].concat(proxyAddrs); + // get addresses + var addrs = forwarded(req); if (!trust) { // Return all addresses diff --git a/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md new file mode 100644 index 0000000..97fa1d1 --- /dev/null +++ b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md @@ -0,0 +1,4 @@ +0.1.0 / 2014-09-21 +================== + + * Initial release diff --git a/node_modules/express/node_modules/send/node_modules/depd/LICENSE b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/LICENSE similarity index 100% rename from node_modules/express/node_modules/send/node_modules/depd/LICENSE rename to node_modules/express/node_modules/proxy-addr/node_modules/forwarded/LICENSE diff --git a/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md new file mode 100644 index 0000000..2b4988f --- /dev/null +++ b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md @@ -0,0 +1,53 @@ +# forwarded + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse HTTP X-Forwarded-For header + +## Installation + +```sh +$ npm install forwarded +``` + +## API + +```js +var forwarded = require('forwarded') +``` + +### forwarded(req) + +```js +var addresses = forwarded(req) +``` + +Parse the `X-Forwarded-For` header from the request. Returns an array +of the addresses, including the socket address for the `req`. In reverse +order (i.e. index `0` is the socket address and the last index is the +furthest address, typically the end-user). + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/forwarded.svg?style=flat +[npm-url]: https://npmjs.org/package/forwarded +[node-version-image]: https://img.shields.io/node/v/forwarded.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/forwarded.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/forwarded +[coveralls-image]: https://img.shields.io/coveralls/jshttp/forwarded.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/forwarded?branch=master +[downloads-image]: https://img.shields.io/npm/dm/forwarded.svg?style=flat +[downloads-url]: https://npmjs.org/package/forwarded diff --git a/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js new file mode 100644 index 0000000..2f5c340 --- /dev/null +++ b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js @@ -0,0 +1,35 @@ +/*! + * forwarded + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = forwarded + +/** + * Get all addresses in the request, using the `X-Forwarded-For` header. + * + * @param {Object} req + * @api public + */ + +function forwarded(req) { + if (!req) { + throw new TypeError('argument req is required') + } + + // simple header parsing + var proxyAddrs = (req.headers['x-forwarded-for'] || '') + .split(/ *, */) + .filter(Boolean) + .reverse() + var socketAddr = req.connection.remoteAddress + var addrs = [socketAddr].concat(proxyAddrs) + + // return all addresses + return addrs +} diff --git a/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json new file mode 100644 index 0000000..fa8af9e --- /dev/null +++ b/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json @@ -0,0 +1,65 @@ +{ + "name": "forwarded", + "description": "Parse HTTP X-Forwarded-For header", + "version": "0.1.0", + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "license": "MIT", + "keywords": [ + "x-forwarded-for", + "http", + "req" + ], + "repository": { + "type": "git", + "url": "https://github.com/jshttp/forwarded" + }, + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "gitHead": "e9a9faeb3cfaadf40eb57d144fff26bca9b818e8", + "bugs": { + "url": "https://github.com/jshttp/forwarded/issues" + }, + "homepage": "https://github.com/jshttp/forwarded", + "_id": "forwarded@0.1.0", + "_shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363", + "_from": "forwarded@>=0.1.0 <0.2.0", + "_npmVersion": "1.4.21", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "dist": { + "shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363", + "tarball": "http://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json b/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json index a174603..cf21861 100644 --- a/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json +++ b/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json @@ -52,5 +52,7 @@ } ], "_shasum": "27a9ca37f148d2102b0ef191ccbf2c51a8f025c6", - "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-0.1.3.tgz" + "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-0.1.3.tgz", + "readme": "ERROR: No README data found!", + "homepage": "https://github.com/whitequark/ipaddr.js" } diff --git a/node_modules/express/node_modules/proxy-addr/package.json b/node_modules/express/node_modules/proxy-addr/package.json index 8c63b83..57f7e1a 100644 --- a/node_modules/express/node_modules/proxy-addr/package.json +++ b/node_modules/express/node_modules/proxy-addr/package.json @@ -1,7 +1,7 @@ { "name": "proxy-addr", "description": "Determine address of proxied request", - "version": "1.0.2", + "version": "1.0.3", "author": { "name": "Douglas Christopher Wilson", "email": "doug@somethingdoug.com" @@ -17,6 +17,7 @@ "url": "https://github.com/jshttp/proxy-addr" }, "dependencies": { + "forwarded": "~0.1.0", "ipaddr.js": "0.1.3" }, "devDependencies": { @@ -41,14 +42,14 @@ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" }, - "gitHead": "63a0f679bd4b074b7391fa464cb779275f24b1da", + "gitHead": "0a9006a64de938d879f1e4b38b275c1c46524dfd", "bugs": { "url": "https://github.com/jshttp/proxy-addr/issues" }, "homepage": "https://github.com/jshttp/proxy-addr", - "_id": "proxy-addr@1.0.2", - "_shasum": "b322f905aa4f4bd3ce60550295eabbbb07c92143", - "_from": "proxy-addr@~1.0.2", + "_id": "proxy-addr@1.0.3", + "_shasum": "17d824aac844707441249da6d1ea5e889007cdd6", + "_from": "proxy-addr@>=1.0.2 <1.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -81,9 +82,10 @@ } ], "dist": { - "shasum": "b322f905aa4f4bd3ce60550295eabbbb07c92143", - "tarball": "http://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.2.tgz" + "shasum": "17d824aac844707441249da6d1ea5e889007cdd6", + "tarball": "http://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.3.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.2.tgz" + "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.3.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/qs/CHANGELOG.md b/node_modules/express/node_modules/qs/CHANGELOG.md index 2f20704..ed42edc 100644 --- a/node_modules/express/node_modules/qs/CHANGELOG.md +++ b/node_modules/express/node_modules/qs/CHANGELOG.md @@ -1,5 +1,5 @@ -## [**2.2.3**](https://github.com/hapijs/qs/issues?milestone=12&state=open) +## [**2.2.3**](https://github.com/hapijs/qs/issues?milestone=12&state=closed) - [**#37**](https://github.com/hapijs/qs/issues/37) parser discards first empty value in array - [**#36**](https://github.com/hapijs/qs/issues/36) Update to lab 4.x @@ -8,45 +8,22 @@ - [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty - [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? ---- - - - -## [**2.2.2**](https://github.com/hapijs/qs/issues?milestone=11&state=closed) -- [**#33**](https://github.com/hapijs/qs/issues/33) Error when plain object in a value -- [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty -- [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? - ---- - - - -## [**2.2.2**](https://github.com/hapijs/qs/issues?milestone=11&state=open) -- [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty -- [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver? - ---- - - -# 2014-08-28 -95 commits against 24 issues, over a month [`32edf33`](https://github.com/hapijs/qs/commit/32edf33)⎆[`b1e7b53`](https://github.com/hapijs/qs/commit/b1e7b53) - ## [**2.2.1**](https://github.com/hapijs/qs/issues?milestone=10&state=closed) - [**#32**](https://github.com/hapijs/qs/issues/32) account for circular references properly, closes #31 - [**#31**](https://github.com/hapijs/qs/issues/31) qs.parse stackoverflow on circular objects ## [**2.2.0**](https://github.com/hapijs/qs/issues?milestone=9&state=closed) +- [**#26**](https://github.com/hapijs/qs/issues/26) Don't use Buffer global if it's not present - [**#30**](https://github.com/hapijs/qs/issues/30) Bug when merging non-object values into arrays - [**#29**](https://github.com/hapijs/qs/issues/29) Don't call Utils.clone at the top of Utils.merge -- [**#26**](https://github.com/hapijs/qs/issues/26) Don't use Buffer global if it's not present - [**#23**](https://github.com/hapijs/qs/issues/23) Ability to not limit parameters? ## [**2.1.0**](https://github.com/hapijs/qs/issues?milestone=8&state=closed) - [**#22**](https://github.com/hapijs/qs/issues/22) Enable using a RegExp as delimiter ## [**2.0.0**](https://github.com/hapijs/qs/issues?milestone=7&state=closed) -- [**#20**](https://github.com/hapijs/qs/issues/20) Configurable parametersLimit - [**#18**](https://github.com/hapijs/qs/issues/18) Why is there arrayLimit? +- [**#20**](https://github.com/hapijs/qs/issues/20) Configurable parametersLimit - [**#21**](https://github.com/hapijs/qs/issues/21) make all limits optional, for #18, for #20 ## [**1.2.2**](https://github.com/hapijs/qs/issues?milestone=6&state=closed) @@ -68,11 +45,3 @@ ## [**1.0.2**](https://github.com/hapijs/qs/issues?milestone=2&state=closed) - [**#5**](https://github.com/hapijs/qs/issues/5) array holes incorrectly copied into object on large index - -## Issues -- [**#25**](https://github.com/hapijs/qs/issues/25) Remove references to Buffer -- [**#11**](https://github.com/hapijs/qs/issues/11) Flattened keys in array does not parse correctly -- [**#8**](https://github.com/hapijs/qs/issues/8) Square brackets should be URI encoded -- [**#3**](https://github.com/hapijs/qs/issues/3) Update README.md -- [**#2**](https://github.com/hapijs/qs/issues/2) Add travis and rework package - diff --git a/node_modules/express/node_modules/qs/lib/parse.js b/node_modules/express/node_modules/qs/lib/parse.js index f2e0a0d..3627397 100755 --- a/node_modules/express/node_modules/qs/lib/parse.js +++ b/node_modules/express/node_modules/qs/lib/parse.js @@ -58,8 +58,10 @@ internals.parseObject = function (chain, val, options) { else { var cleanRoot = root[0] === '[' && root[root.length - 1] === ']' ? root.slice(1, root.length - 1) : root; var index = parseInt(cleanRoot, 10); + var indexString = '' + index; if (!isNaN(index) && root !== cleanRoot && + indexString === cleanRoot && index <= options.arrayLimit) { obj = []; diff --git a/node_modules/express/node_modules/qs/package.json b/node_modules/express/node_modules/qs/package.json index 01b285a..6e38b4e 100755 --- a/node_modules/express/node_modules/qs/package.json +++ b/node_modules/express/node_modules/qs/package.json @@ -1,6 +1,6 @@ { "name": "qs", - "version": "2.2.3", + "version": "2.2.4", "description": "A querystring parser that supports nesting and arrays, with a depth limit", "homepage": "https://github.com/hapijs/qs", "main": "index.js", @@ -29,13 +29,13 @@ "url": "http://github.com/hapijs/qs/raw/master/LICENSE" } ], - "gitHead": "904528124a6eb879ebc5197376e9613069414f67", + "gitHead": "9775242fa57cbfa4db62e4b0aa4f82b23e2ce6af", "bugs": { "url": "https://github.com/hapijs/qs/issues" }, - "_id": "qs@2.2.3", - "_shasum": "6139c1f47960eff5655e56aab0ef9f6dd16d4eeb", - "_from": "qs@2.2.3", + "_id": "qs@2.2.4", + "_shasum": "2e9fbcd34b540e3421c924ecd01e90aa975319c8", + "_from": "qs@2.2.4", "_npmVersion": "1.4.23", "_npmUser": { "name": "nlf", @@ -52,10 +52,10 @@ } ], "dist": { - "shasum": "6139c1f47960eff5655e56aab0ef9f6dd16d4eeb", - "tarball": "http://registry.npmjs.org/qs/-/qs-2.2.3.tgz" + "shasum": "2e9fbcd34b540e3421c924ecd01e90aa975319c8", + "tarball": "http://registry.npmjs.org/qs/-/qs-2.2.4.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/qs/-/qs-2.2.3.tgz", + "_resolved": "https://registry.npmjs.org/qs/-/qs-2.2.4.tgz", "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/qs/test/parse.js b/node_modules/express/node_modules/qs/test/parse.js index 15a4888..22083f6 100755 --- a/node_modules/express/node_modules/qs/test/parse.js +++ b/node_modules/express/node_modules/qs/test/parse.js @@ -104,6 +104,12 @@ describe('#parse', function () { done(); }); + it('supports keys that begin with a number', function (done) { + + expect(Qs.parse('a[12b]=c')).to.deep.equal({ a: { '12b': 'c' } }); + done(); + }); + it('supports encoded = signs', function (done) { expect(Qs.parse('he%3Dllo=th%3Dere')).to.deep.equal({ 'he=llo': 'th=ere' }); diff --git a/node_modules/express/node_modules/range-parser/package.json b/node_modules/express/node_modules/range-parser/package.json index 9fc243b..c4f8b2f 100644 --- a/node_modules/express/node_modules/range-parser/package.json +++ b/node_modules/express/node_modules/range-parser/package.json @@ -42,7 +42,7 @@ "homepage": "https://github.com/jshttp/range-parser", "_id": "range-parser@1.0.2", "_shasum": "06a12a42e5131ba8e457cd892044867f2344e549", - "_from": "range-parser@~1.0.2", + "_from": "range-parser@>=1.0.2 <1.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/send/node_modules/depd/History.md b/node_modules/express/node_modules/send/node_modules/depd/History.md deleted file mode 100644 index 800eab1..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/History.md +++ /dev/null @@ -1,62 +0,0 @@ -0.4.5 / 2014-09-09 -================== - - * Improve call speed to functions using the function wrapper - * Support Node.js 0.6 - -0.4.4 / 2014-07-27 -================== - - * Work-around v8 generating empty stack traces - -0.4.3 / 2014-07-26 -================== - - * Fix exception when global `Error.stackTraceLimit` is too low - -0.4.2 / 2014-07-19 -================== - - * Correct call site for wrapped functions and properties - -0.4.1 / 2014-07-19 -================== - - * Improve automatic message generation for function properties - -0.4.0 / 2014-07-19 -================== - - * Add `TRACE_DEPRECATION` environment variable - * Remove non-standard grey color from color output - * Support `--no-deprecation` argument - * Support `--trace-deprecation` argument - * Support `deprecate.property(fn, prop, message)` - -0.3.0 / 2014-06-16 -================== - - * Add `NO_DEPRECATION` environment variable - -0.2.0 / 2014-06-15 -================== - - * Add `deprecate.property(obj, prop, message)` - * Remove `supports-color` dependency for node.js 0.8 - -0.1.0 / 2014-06-15 -================== - - * Add `deprecate.function(fn, message)` - * Add `process.on('deprecation', fn)` emitter - * Automatically generate message when omitted from `deprecate()` - -0.0.1 / 2014-06-15 -================== - - * Fix warning for dynamic calls at singe call site - -0.0.0 / 2014-06-15 -================== - - * Initial implementation diff --git a/node_modules/express/node_modules/send/node_modules/depd/Readme.md b/node_modules/express/node_modules/send/node_modules/depd/Readme.md deleted file mode 100644 index 098953e..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/Readme.md +++ /dev/null @@ -1,266 +0,0 @@ -# depd - -[![NPM Version][npm-version-image]][npm-url] -[![NPM Downloads][npm-downloads-image]][npm-url] -[![Node.js Version][node-image]][node-url] -[![Build Status][travis-image]][travis-url] -[![Coverage Status][coveralls-image]][coveralls-url] -[![Gittip][gittip-image]][gittip-url] - -Deprecate all the things - -> With great modules comes great responsibility; mark things deprecated! - -## Install - -```sh -$ npm install depd -``` - -## API - -```js -var deprecate = require('depd')('my-module') -``` - -This library allows you to display deprecation messages to your users. -This library goes above and beyond with deprecation warnings by -introspecting the call stack (but only the bits that it is interested -in). - -Instead of just warning on the first invocation of a deprecated -function and never again, this module will warn on the first invocation -of a deprecated function per unique call site, making it ideal to alert -users of all deprecated uses across the code base, rather than just -whatever happens to execute first. - -The deprecation warnings from this module also include the file and line -information for the call into the module that the deprecated function was -in. - -### depd(namespace) - -Create a new deprecate function that uses the given namespace name in the -messages and will display the call site prior to the stack entering the -file this function was called from. It is highly suggested you use the -name of your module as the namespace. - -### deprecate(message) - -Call this function from deprecated code to display a deprecation message. -This message will appear once per unique caller site. Caller site is the -first call site in the stack in a different file from the caller of this -function. - -If the message is omitted, a message is generated for you based on the site -of the `deprecate()` call and will display the name of the function called, -similar to the name displayed in a stack trace. - -### deprecate.function(fn, message) - -Call this function to wrap a given function in a deprecation message on any -call to the function. An optional message can be supplied to provide a custom -message. - -### deprecate.property(obj, prop, message) - -Call this function to wrap a given property on object in a deprecation message -on any accessing or setting of the property. An optional message can be supplied -to provide a custom message. - -The method must be called on the object where the property belongs (not -inherited from the prototype). - -If the property is a data descriptor, it will be converted to an accessor -descriptor in order to display the deprecation message. - -### process.on('deprecation', fn) - -This module will allow easy capturing of deprecation errors by emitting the -errors as the type "deprecation" on the global `process`. If there are no -listeners for this type, the errors are written to STDERR as normal, but if -there are any listeners, nothing will be written to STDERR and instead only -emitted. From there, you can write the errors in a different format or to a -logging source. - -The error represents the deprecation and is emitted only once with the same -rules as writing to STDERR. The error has the following properties: - - - `message` - This is the message given by the library - - `name` - This is always `'DeprecationError'` - - `namespace` - This is the namespace the deprecation came from - - `stack` - This is the stack of the call to the deprecated thing - -Example `error.stack` output: - -``` -DeprecationError: my-cool-module deprecated oldfunction - at Object. ([eval]-wrapper:6:22) - at Module._compile (module.js:456:26) - at evalScript (node.js:532:25) - at startup (node.js:80:7) - at node.js:902:3 -``` - -### process.env.NO_DEPRECATION - -As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` -is provided as a quick solution to silencing deprecation warnings from being -output. The format of this is similar to that of `DEBUG`: - -```sh -$ NO_DEPRECATION=my-module,othermod node app.js -``` - -This will suppress deprecations from being output for "my-module" and "othermod". -The value is a list of comma-separated namespaces. To suppress every warning -across all namespaces, use the value `*` for a namespace. - -Providing the argument `--no-deprecation` to the `node` executable will suppress -all deprecations (only available in Node.js 0.8 or higher). - -**NOTE** This will not suppress the deperecations given to any "deprecation" -event listeners, just the output to STDERR. - -### process.env.TRACE_DEPRECATION - -As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` -is provided as a solution to getting more detailed location information in deprecation -warnings by including the entire stack trace. The format of this is the same as -`NO_DEPRECATION`: - -```sh -$ TRACE_DEPRECATION=my-module,othermod node app.js -``` - -This will include stack traces for deprecations being output for "my-module" and -"othermod". The value is a list of comma-separated namespaces. To trace every -warning across all namespaces, use the value `*` for a namespace. - -Providing the argument `--trace-deprecation` to the `node` executable will trace -all deprecations (only available in Node.js 0.8 or higher). - -**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. - -## Display - -![message](files/message.png) - -When a user calls a function in your library that you mark deprecated, they -will see the following written to STDERR (in the given colors, similar colors -and layout to the `debug` module): - -``` -bright cyan bright yellow -| | reset cyan -| | | | -▼ ▼ ▼ ▼ -my-cool-module deprecated oldfunction [eval]-wrapper:6:22 -▲ ▲ ▲ ▲ -| | | | -namespace | | location of mycoolmod.oldfunction() call - | deprecation message - the word "deprecated" -``` - -If the user redirects their STDERR to a file or somewhere that does not support -colors, they see (similar layout to the `debug` module): - -``` -Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 -▲ ▲ ▲ ▲ ▲ -| | | | | -timestamp of message namespace | | location of mycoolmod.oldfunction() call - | deprecation message - the word "deprecated" -``` - -## Examples - -### Deprecating all calls to a function - -This will display a deprecated message about "oldfunction" being deprecated -from "my-module" on STDERR. - -```js -var deprecate = require('depd')('my-cool-module') - -// message automatically derived from function name -// Object.oldfunction -exports.oldfunction = deprecate.function(function oldfunction() { - // all calls to function are deprecated -}) - -// specific message -exports.oldfunction = deprecate.function(function () { - // all calls to function are deprecated -}, 'oldfunction') -``` - -### Conditionally deprecating a function call - -This will display a deprecated message about "weirdfunction" being deprecated -from "my-module" on STDERR when called with less than 2 arguments. - -```js -var deprecate = require('depd')('my-cool-module') - -exports.weirdfunction = function () { - if (arguments.length < 2) { - // calls with 0 or 1 args are deprecated - deprecate('weirdfunction args < 2') - } -} -``` - -When calling `deprecate` as a function, the warning is counted per call site -within your own module, so you can display different deprecations depending -on different situations and the users will still get all the warnings: - -```js -var deprecate = require('depd')('my-cool-module') - -exports.weirdfunction = function () { - if (arguments.length < 2) { - // calls with 0 or 1 args are deprecated - deprecate('weirdfunction args < 2') - } else if (typeof arguments[0] !== 'string') { - // calls with non-string first argument are deprecated - deprecate('weirdfunction non-string first arg') - } -} -``` - -### Deprecating property access - -This will display a deprecated message about "oldprop" being deprecated -from "my-module" on STDERR when accessed. A deprecation will be displayed -when setting the value and when getting the value. - -```js -var deprecate = require('depd')('my-cool-module') - -exports.oldprop = 'something' - -// message automatically derives from property name -deprecate.property(exports, 'oldprop') - -// explicit message -deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') -``` - -## License - -[MIT](LICENSE) - -[npm-version-image]: https://img.shields.io/npm/v/depd.svg?style=flat -[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg?style=flat -[npm-url]: https://npmjs.org/package/depd -[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd.svg?style=flat -[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd -[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd.svg?style=flat -[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master -[node-image]: https://img.shields.io/node/v/depd.svg?style=flat -[node-url]: http://nodejs.org/download/ -[gittip-image]: https://img.shields.io/gittip/dougwilson.svg?style=flat -[gittip-url]: https://www.gittip.com/dougwilson/ diff --git a/node_modules/express/node_modules/send/node_modules/depd/index.js b/node_modules/express/node_modules/send/node_modules/depd/index.js deleted file mode 100644 index 4fee4d9..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/index.js +++ /dev/null @@ -1,522 +0,0 @@ -/*! - * depd - * Copyright(c) 2014 Douglas Christopher Wilson - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var callSiteToString = require('./lib/compat').callSiteToString -var EventEmitter = require('events').EventEmitter -var relative = require('path').relative - -/** - * Module exports. - */ - -module.exports = depd - -/** - * Get the path to base files on. - */ - -var basePath = process.cwd() - -/** - * Get listener count on event emitter. - */ - -/*istanbul ignore next*/ -var eventListenerCount = EventEmitter.listenerCount - || function (emitter, type) { return emitter.listeners(type).length } - -/** - * Determine if namespace is contained in the string. - */ - -function containsNamespace(str, namespace) { - var val = str.split(/[ ,]+/) - - namespace = String(namespace).toLowerCase() - - for (var i = 0 ; i < val.length; i++) { - if (!(str = val[i])) continue; - - // namespace contained - if (str === '*' || str.toLowerCase() === namespace) { - return true - } - } - - return false -} - -/** - * Convert a data descriptor to accessor descriptor. - */ - -function convertDataDescriptorToAccessor(obj, prop, message) { - var descriptor = Object.getOwnPropertyDescriptor(obj, prop) - var value = descriptor.value - - descriptor.get = function getter() { return value } - - if (descriptor.writable) { - descriptor.set = function setter(val) { return value = val } - } - - delete descriptor.value - delete descriptor.writable - - Object.defineProperty(obj, prop, descriptor) - - return descriptor -} - -/** - * Create arguments string to keep arity. - */ - -function createArgumentsString(arity) { - var str = '' - - for (var i = 0; i < arity; i++) { - str += ', arg' + i - } - - return str.substr(2) -} - -/** - * Create stack string from stack. - */ - -function createStackString(stack) { - var str = this.name + ': ' + this.namespace - - if (this.message) { - str += ' deprecated ' + this.message - } - - for (var i = 0; i < stack.length; i++) { - str += '\n at ' + callSiteToString(stack[i]) - } - - return str -} - -/** - * Create deprecate for namespace in caller. - */ - -function depd(namespace) { - if (!namespace) { - throw new TypeError('argument namespace is required') - } - - var stack = getStack() - var site = callSiteLocation(stack[1]) - var file = site[0] - - function deprecate(message) { - // call to self as log - log.call(deprecate, message) - } - - deprecate._file = file - deprecate._ignored = isignored(namespace) - deprecate._namespace = namespace - deprecate._traced = istraced(namespace) - deprecate._warned = Object.create(null) - - deprecate.function = wrapfunction - deprecate.property = wrapproperty - - return deprecate -} - -/** - * Determine if namespace is ignored. - */ - -function isignored(namespace) { - /* istanbul ignore next: tested in a child processs */ - if (process.noDeprecation) { - // --no-deprecation support - return true - } - - var str = process.env.NO_DEPRECATION || '' - - // namespace ignored - return containsNamespace(str, namespace) -} - -/** - * Determine if namespace is traced. - */ - -function istraced(namespace) { - /* istanbul ignore next: tested in a child processs */ - if (process.traceDeprecation) { - // --trace-deprecation support - return true - } - - var str = process.env.TRACE_DEPRECATION || '' - - // namespace traced - return containsNamespace(str, namespace) -} - -/** - * Display deprecation message. - */ - -function log(message, site) { - var haslisteners = eventListenerCount(process, 'deprecation') !== 0 - - // abort early if no destination - if (!haslisteners && this._ignored) { - return - } - - var caller - var callFile - var callSite - var i = 0 - var seen = false - var stack = getStack() - var file = this._file - - if (site) { - // provided site - callSite = callSiteLocation(stack[1]) - callSite.name = site.name - file = callSite[0] - } else { - // get call site - i = 2 - site = callSiteLocation(stack[i]) - callSite = site - } - - // get caller of deprecated thing in relation to file - for (; i < stack.length; i++) { - caller = callSiteLocation(stack[i]) - callFile = caller[0] - - if (callFile === file) { - seen = true - } else if (callFile === this._file) { - file = this._file - } else if (seen) { - break - } - } - - var key = caller - ? site.join(':') + '__' + caller.join(':') - : undefined - - if (key !== undefined && key in this._warned) { - // already warned - return - } - - this._warned[key] = true - - // generate automatic message from call site - if (!message) { - message = callSite === site || !callSite.name - ? defaultMessage(site) - : defaultMessage(callSite) - } - - // emit deprecation if listeners exist - if (haslisteners) { - var err = DeprecationError(this._namespace, message, stack.slice(i)) - process.emit('deprecation', err) - return - } - - // format and write message - var format = process.stderr.isTTY - ? formatColor - : formatPlain - var msg = format.call(this, message, caller, stack.slice(i)) - process.stderr.write(msg + '\n', 'utf8') - - return -} - -/** - * Get call site location as array. - */ - -function callSiteLocation(callSite) { - var file = callSite.getFileName() || '' - var line = callSite.getLineNumber() - var colm = callSite.getColumnNumber() - - if (callSite.isEval()) { - file = callSite.getEvalOrigin() + ', ' + file - } - - var site = [file, line, colm] - - site.callSite = callSite - site.name = callSite.getFunctionName() - - return site -} - -/** - * Generate a default message from the site. - */ - -function defaultMessage(site) { - var callSite = site.callSite - var funcName = site.name - var typeName = callSite.getTypeName() - - // make useful anonymous name - if (!funcName) { - funcName = '' - } - - // make useful type name - if (typeName === 'Function') { - typeName = callSite.getThis().name || typeName - } - - return callSite.getMethodName() - ? typeName + '.' + funcName - : funcName -} - -/** - * Format deprecation message without color. - */ - -function formatPlain(msg, caller, stack) { - var timestamp = new Date().toUTCString() - - var formatted = timestamp - + ' ' + this._namespace - + ' deprecated ' + msg - - // add stack trace - if (this._traced) { - for (var i = 0; i < stack.length; i++) { - formatted += '\n at ' + callSiteToString(stack[i]) - } - - return formatted - } - - if (caller) { - formatted += ' at ' + formatLocation(caller) - } - - return formatted -} - -/** - * Format deprecation message with color. - */ - -function formatColor(msg, caller, stack) { - var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' // bold cyan - + ' \x1b[33;1mdeprecated\x1b[22;39m' // bold yellow - + ' \x1b[0m' + msg + '\x1b[39m' // reset - - // add stack trace - if (this._traced) { - for (var i = 0; i < stack.length; i++) { - formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan - } - - return formatted - } - - if (caller) { - formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan - } - - return formatted -} - -/** - * Format call site location. - */ - -function formatLocation(callSite) { - return relative(basePath, callSite[0]) - + ':' + callSite[1] - + ':' + callSite[2] -} - -/** - * Get the stack as array of call sites. - */ - -function getStack() { - var limit = Error.stackTraceLimit - var obj = {} - var prep = Error.prepareStackTrace - - Error.prepareStackTrace = prepareObjectStackTrace - Error.stackTraceLimit = Math.max(10, limit) - - // capture the stack - Error.captureStackTrace(obj) - - // slice this function off the top - var stack = obj.stack.slice(1) - - Error.prepareStackTrace = prep - Error.stackTraceLimit = limit - - return stack -} - -/** - * Capture call site stack from v8. - */ - -function prepareObjectStackTrace(obj, stack) { - return stack -} - -/** - * Return a wrapped function in a deprecation message. - */ - -function wrapfunction(fn, message) { - if (typeof fn !== 'function') { - throw new TypeError('argument fn must be a function') - } - - var args = createArgumentsString(fn.length) - var deprecate = this - var stack = getStack() - var site = callSiteLocation(stack[1]) - - site.name = fn.name - - var deprecatedfn = eval('(function (' + args + ') {\n' - + '"use strict"\n' - + 'log.call(deprecate, message, site)\n' - + 'return fn.apply(this, arguments)\n' - + '})') - - return deprecatedfn -} - -/** - * Wrap property in a deprecation message. - */ - -function wrapproperty(obj, prop, message) { - if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { - throw new TypeError('argument obj must be object') - } - - var descriptor = Object.getOwnPropertyDescriptor(obj, prop) - - if (!descriptor) { - throw new TypeError('must call property on owner object') - } - - if (!descriptor.configurable) { - throw new TypeError('property must be configurable') - } - - var deprecate = this - var stack = getStack() - var site = callSiteLocation(stack[1]) - - // set site name - site.name = prop - - // convert data descriptor - if ('value' in descriptor) { - descriptor = convertDataDescriptorToAccessor(obj, prop, message) - } - - var get = descriptor.get - var set = descriptor.set - - // wrap getter - if (typeof get === 'function') { - descriptor.get = function getter() { - log.call(deprecate, message, site) - return get.apply(this, arguments) - } - } - - // wrap setter - if (typeof set === 'function') { - descriptor.set = function setter() { - log.call(deprecate, message, site) - return set.apply(this, arguments) - } - } - - Object.defineProperty(obj, prop, descriptor) -} - -/** - * Create DeprecationError for deprecation - */ - -function DeprecationError(namespace, message, stack) { - var error = new Error() - var stackString - - Object.defineProperty(error, 'constructor', { - value: DeprecationError - }) - - Object.defineProperty(error, 'message', { - configurable: true, - enumerable: false, - value: message, - writable: true - }) - - Object.defineProperty(error, 'name', { - enumerable: false, - configurable: true, - value: 'DeprecationError', - writable: true - }) - - Object.defineProperty(error, 'namespace', { - configurable: true, - enumerable: false, - value: namespace, - writable: true - }) - - Object.defineProperty(error, 'stack', { - configurable: true, - enumerable: false, - get: function () { - if (stackString !== undefined) { - return stackString - } - - // prepare stack trace - return stackString = createStackString.call(this, stack) - }, - set: function setter(val) { - stackString = val - } - }) - - return error -} diff --git a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/buffer-concat.js b/node_modules/express/node_modules/send/node_modules/depd/lib/compat/buffer-concat.js deleted file mode 100644 index 09d9721..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/buffer-concat.js +++ /dev/null @@ -1,33 +0,0 @@ -/*! - * depd - * Copyright(c) 2014 Douglas Christopher Wilson - * MIT Licensed - */ - -/** - * Module exports. - */ - -module.exports = bufferConcat - -/** - * Concatenate an array of Buffers. - */ - -function bufferConcat(bufs) { - var length = 0 - - for (var i = 0, len = bufs.length; i < len; i++) { - length += bufs[i].length - } - - var buf = new Buffer(length) - var pos = 0 - - for (var i = 0, len = bufs.length; i < len; i++) { - bufs[i].copy(buf, pos) - pos += bufs[i].length - } - - return buf -} diff --git a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/callsite-tostring.js b/node_modules/express/node_modules/send/node_modules/depd/lib/compat/callsite-tostring.js deleted file mode 100644 index 17cf7ed..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/callsite-tostring.js +++ /dev/null @@ -1,101 +0,0 @@ -/*! - * depd - * Copyright(c) 2014 Douglas Christopher Wilson - * MIT Licensed - */ - -/** - * Module exports. - */ - -module.exports = callSiteToString - -/** - * Format a CallSite file location to a string. - */ - -function callSiteFileLocation(callSite) { - var fileName - var fileLocation = '' - - if (callSite.isNative()) { - fileLocation = 'native' - } else if (callSite.isEval()) { - fileName = callSite.getScriptNameOrSourceURL() - if (!fileName) { - fileLocation = callSite.getEvalOrigin() - } - } else { - fileName = callSite.getFileName() - } - - if (fileName) { - fileLocation += fileName - - var lineNumber = callSite.getLineNumber() - if (lineNumber != null) { - fileLocation += ':' + lineNumber - - var columnNumber = callSite.getColumnNumber() - if (columnNumber) { - fileLocation += ':' + columnNumber - } - } - } - - return fileLocation || 'unknown source' -} - -/** - * Format a CallSite to a string. - */ - -function callSiteToString(callSite) { - var addSuffix = true - var fileLocation = callSiteFileLocation(callSite) - var functionName = callSite.getFunctionName() - var isConstructor = callSite.isConstructor() - var isMethodCall = !(callSite.isToplevel() || isConstructor) - var line = '' - - if (isMethodCall) { - var methodName = callSite.getMethodName() - var typeName = getConstructorName(callSite) - - if (functionName) { - if (typeName && functionName.indexOf(typeName) !== 0) { - line += typeName + '.' - } - - line += functionName - - if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) { - line += ' [as ' + methodName + ']' - } - } else { - line += typeName + '.' + (methodName || '') - } - } else if (isConstructor) { - line += 'new ' + (functionName || '') - } else if (functionName) { - line += functionName - } else { - addSuffix = false - line += fileLocation - } - - if (addSuffix) { - line += ' (' + fileLocation + ')' - } - - return line -} - -/** - * Get constructor name of reviver. - */ - -function getConstructorName(obj) { - var receiver = obj.receiver - return (receiver.constructor && receiver.constructor.name) || null -} diff --git a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/index.js b/node_modules/express/node_modules/send/node_modules/depd/lib/compat/index.js deleted file mode 100644 index 7fee026..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/lib/compat/index.js +++ /dev/null @@ -1,69 +0,0 @@ -/*! - * depd - * Copyright(c) 2014 Douglas Christopher Wilson - * MIT Licensed - */ - -/** - * Module exports. - */ - -lazyProperty(module.exports, 'bufferConcat', function bufferConcat() { - return Buffer.concat || require('./buffer-concat') -}) - -lazyProperty(module.exports, 'callSiteToString', function callSiteToString() { - var limit = Error.stackTraceLimit - var obj = {} - var prep = Error.prepareStackTrace - - function prepareObjectStackTrace(obj, stack) { - return stack - } - - Error.prepareStackTrace = prepareObjectStackTrace - Error.stackTraceLimit = 2 - - // capture the stack - Error.captureStackTrace(obj) - - // slice the stack - var stack = obj.stack.slice() - - Error.prepareStackTrace = prep - Error.stackTraceLimit = limit - - return stack[0].toString ? toString : require('./callsite-tostring') -}) - -/** - * Define a lazy property. - */ - -function lazyProperty(obj, prop, getter) { - function get() { - var val = getter() - - Object.defineProperty(obj, prop, { - configurable: true, - enumerable: true, - value: val - }) - - return val - } - - Object.defineProperty(obj, prop, { - configurable: true, - enumerable: true, - get: get - }) -} - -/** - * Call toString() on the obj - */ - -function toString(obj) { - return obj.toString() -} diff --git a/node_modules/express/node_modules/send/node_modules/depd/package.json b/node_modules/express/node_modules/send/node_modules/depd/package.json deleted file mode 100644 index 55a9db0..0000000 --- a/node_modules/express/node_modules/send/node_modules/depd/package.json +++ /dev/null @@ -1,67 +0,0 @@ -{ - "name": "depd", - "description": "Deprecate all the things", - "version": "0.4.5", - "author": { - "name": "Douglas Christopher Wilson", - "email": "doug@somethingdoug.com" - }, - "license": "MIT", - "keywords": [ - "deprecate", - "deprecated" - ], - "repository": { - "type": "git", - "url": "https://github.com/dougwilson/nodejs-depd" - }, - "devDependencies": { - "benchmark": "1.0.0", - "beautify-benchmark": "0.2.4", - "istanbul": "0.3.2", - "mocha": "~1.21.4", - "should": "~4.0.4" - }, - "files": [ - "lib/", - "History.md", - "LICENSE", - "index.js", - "Readme.md" - ], - "engines": { - "node": ">= 0.6" - }, - "scripts": { - "bench": "node benchmark/index.js", - "test": "mocha --reporter spec --bail --require should test/", - "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --require should test/", - "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --require should test/" - }, - "gitHead": "e37a15044f7da76b94d8e0d46a6343feb168c82b", - "bugs": { - "url": "https://github.com/dougwilson/nodejs-depd/issues" - }, - "homepage": "https://github.com/dougwilson/nodejs-depd", - "_id": "depd@0.4.5", - "_shasum": "1a664b53388b4a6573e8ae67b5f767c693ca97f1", - "_from": "depd@0.4.5", - "_npmVersion": "1.4.21", - "_npmUser": { - "name": "dougwilson", - "email": "doug@somethingdoug.com" - }, - "maintainers": [ - { - "name": "dougwilson", - "email": "doug@somethingdoug.com" - } - ], - "dist": { - "shasum": "1a664b53388b4a6573e8ae67b5f767c693ca97f1", - "tarball": "http://registry.npmjs.org/depd/-/depd-0.4.5.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/depd/-/depd-0.4.5.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/node_modules/express/node_modules/send/node_modules/destroy/package.json b/node_modules/express/node_modules/send/node_modules/destroy/package.json index 8a58cad..c88380a 100644 --- a/node_modules/express/node_modules/send/node_modules/destroy/package.json +++ b/node_modules/express/node_modules/send/node_modules/destroy/package.json @@ -62,5 +62,6 @@ "tarball": "http://registry.npmjs.org/destroy/-/destroy-1.0.3.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.3.tgz" + "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.3.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/send/node_modules/mime/package.json b/node_modules/express/node_modules/send/node_modules/mime/package.json index 9782ade..ab6beca 100644 --- a/node_modules/express/node_modules/send/node_modules/mime/package.json +++ b/node_modules/express/node_modules/send/node_modules/mime/package.json @@ -53,5 +53,7 @@ ], "directories": {}, "_shasum": "58203eed86e3a5ef17aed2b7d9ebd47f0a60dd10", - "_resolved": "https://registry.npmjs.org/mime/-/mime-1.2.11.tgz" + "_resolved": "https://registry.npmjs.org/mime/-/mime-1.2.11.tgz", + "homepage": "https://github.com/broofa/node-mime", + "scripts": {} } diff --git a/node_modules/express/node_modules/send/package.json b/node_modules/express/node_modules/send/package.json index 74d6f9c..c984c4e 100644 --- a/node_modules/express/node_modules/send/package.json +++ b/node_modules/express/node_modules/send/package.json @@ -81,5 +81,6 @@ "tarball": "http://registry.npmjs.org/send/-/send-0.9.2.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/send/-/send-0.9.2.tgz" + "_resolved": "https://registry.npmjs.org/send/-/send-0.9.2.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/serve-static/package.json b/node_modules/express/node_modules/serve-static/package.json index ddcbf74..ef899c5 100644 --- a/node_modules/express/node_modules/serve-static/package.json +++ b/node_modules/express/node_modules/serve-static/package.json @@ -43,7 +43,7 @@ "homepage": "https://github.com/expressjs/serve-static", "_id": "serve-static@1.6.2", "_shasum": "c1390ff43941867250296b091391d25be7c87571", - "_from": "serve-static@~1.6.2", + "_from": "serve-static@>=1.6.2 <1.7.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -80,5 +80,6 @@ "tarball": "http://registry.npmjs.org/serve-static/-/serve-static-1.6.2.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.6.2.tgz" + "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.6.2.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json b/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json index f067351..5bde5db 100644 --- a/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json +++ b/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json @@ -52,7 +52,7 @@ "homepage": "https://github.com/jshttp/mime-db", "_id": "mime-db@1.0.1", "_shasum": "35d99b0965967253bb30633a7d07a8de9975a952", - "_from": "mime-db@~1.0.1", + "_from": "mime-db@>=1.0.1 <1.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "jongleberry", diff --git a/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json b/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json index 494c346..e11bce8 100644 --- a/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json +++ b/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json @@ -50,7 +50,7 @@ "homepage": "https://github.com/jshttp/mime-types", "_id": "mime-types@2.0.1", "_shasum": "7f5b4712592e7dd46ca733fd1c5f5d71356de615", - "_from": "mime-types@~2.0.1", + "_from": "mime-types@>=2.0.1 <2.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/type-is/package.json b/node_modules/express/node_modules/type-is/package.json index 0518a9b..2cc4941 100644 --- a/node_modules/express/node_modules/type-is/package.json +++ b/node_modules/express/node_modules/type-is/package.json @@ -51,7 +51,7 @@ "homepage": "https://github.com/jshttp/type-is", "_id": "type-is@1.5.1", "_shasum": "5c1e62d874f79199fb16b34d16972dba376ccbed", - "_from": "type-is@~1.5.1", + "_from": "type-is@>=1.5.1 <1.6.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/node_modules/utils-merge/package.json b/node_modules/express/node_modules/utils-merge/package.json index c168717..e655383 100644 --- a/node_modules/express/node_modules/utils-merge/package.json +++ b/node_modules/express/node_modules/utils-merge/package.json @@ -30,7 +30,7 @@ "chai": "1.x.x" }, "scripts": { - "test": "node_modules/.bin/mocha --reporter spec --require test/bootstrap/node test/*.test.js" + "test": "mocha --reporter spec --require test/bootstrap/node test/*.test.js" }, "engines": { "node": ">= 0.4.0" @@ -56,5 +56,6 @@ ], "directories": {}, "_shasum": "0294fb922bb9375153541c4f7096231f287c8af8", - "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz" + "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz", + "homepage": "https://github.com/jaredhanson/utils-merge" } diff --git a/node_modules/express/node_modules/vary/package.json b/node_modules/express/node_modules/vary/package.json index 4c4bd62..4e43572 100644 --- a/node_modules/express/node_modules/vary/package.json +++ b/node_modules/express/node_modules/vary/package.json @@ -37,7 +37,7 @@ "homepage": "https://github.com/jshttp/vary", "_id": "vary@1.0.0", "_shasum": "c5e76cec20d3820d8f2a96e7bee38731c34da1e7", - "_from": "vary@~1.0.0", + "_from": "vary@>=1.0.0 <1.1.0", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", diff --git a/node_modules/express/package.json b/node_modules/express/package.json index 653a847..18b3051 100644 --- a/node_modules/express/package.json +++ b/node_modules/express/package.json @@ -1,7 +1,7 @@ { "name": "express", "description": "Fast, unopinionated, minimalist web framework", - "version": "4.9.3", + "version": "4.9.4", "author": { "name": "TJ Holowaychuk", "email": "tj@vision-media.ca" @@ -68,7 +68,7 @@ "parseurl": "~1.3.0", "path-to-regexp": "0.1.3", "proxy-addr": "~1.0.2", - "qs": "2.2.3", + "qs": "2.2.4", "range-parser": "~1.0.2", "send": "0.9.2", "serve-static": "~1.6.2", @@ -107,13 +107,13 @@ "test-tap": "mocha --require test/support/env --reporter tap --check-leaks test/ test/acceptance/", "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/ test/acceptance/" }, - "gitHead": "bc38d896ea6bb8049e08467c0ff7fcf40956e744", + "gitHead": "8e46af1b1dd543b9933b86613a16ddcb7dc286be", "bugs": { "url": "https://github.com/strongloop/express/issues" }, - "_id": "express@4.9.3", - "_shasum": "6aadd470fbb0fdd2550536ab33b63c3fcb7f1028", - "_from": "express@4.9.3", + "_id": "express@4.9.4", + "_shasum": "008e18c92add61fcb534968e04c7e0102a66690b", + "_from": "express@4.9.4", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -150,10 +150,10 @@ } ], "dist": { - "shasum": "6aadd470fbb0fdd2550536ab33b63c3fcb7f1028", - "tarball": "http://registry.npmjs.org/express/-/express-4.9.3.tgz" + "shasum": "008e18c92add61fcb534968e04c7e0102a66690b", + "tarball": "http://registry.npmjs.org/express/-/express-4.9.4.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/express/-/express-4.9.3.tgz", + "_resolved": "https://registry.npmjs.org/express/-/express-4.9.4.tgz", "readme": "ERROR: No README data found!" } diff --git a/node_modules/mysql/.npmignore b/node_modules/mysql/.npmignore deleted file mode 100644 index 14aea2a..0000000 --- a/node_modules/mysql/.npmignore +++ /dev/null @@ -1,6 +0,0 @@ -benchmark/ -coverage/ -lib-cov/ -test/ -tool/ -.travis.yml diff --git a/node_modules/mysql/Changes.md b/node_modules/mysql/Changes.md deleted file mode 100644 index 00d3b30..0000000 --- a/node_modules/mysql/Changes.md +++ /dev/null @@ -1,351 +0,0 @@ -# Changes - -This file is a manually maintained list of changes for each release. Feel free -to add your changes here when sending pull requests. Also send corrections if -you spot any mistakes. - -## v2.5.0 (2014-09-07) - -* Add code `POOL_ENQUEUELIMIT` to error reaching `queueLimit` -* Add `enqueue` event to pool #716 -* Add `enqueue` event to protocol and connection #381 -* Blacklist unsupported connection flags #881 -* Make only column names enumerable in `RowDataPacket` #549 #895 -* Support Node.js 0.6 #718 - -## v2.4.3 (2014-08-25) - -* Fix `pool.query` to use `typeCast` configuration - -## v2.4.2 (2014-08-03) - -* Fix incorrect sequence packet errors to be catchable #867 -* Fix stray protocol packet errors to be catchable #867 -* Fix timing of fatal protocol errors bubbling to user #879 - -## v2.4.1 (2014-07-17) - -* Fix `pool.query` not invoking callback on connection error #872 - -## v2.4.0 (2014-07-13) - -* Add code `POOL_NOEXIST` in PoolCluster error #846 -* Add `acquireTimeout` pool option to specify a timeout for acquiring a connection #821 #854 -* Add `connection.escapeId` -* Add `pool.escapeId` -* Add `timeout` option to all sequences #855 #863 -* Default `connectTimeout` to 10 seconds -* Fix domain binding with `conn.connect` -* Fix `packet.default` to actually be a string -* Fix `PARSER_*` errors to be catchable -* Fix `PROTOCOL_PACKETS_OUT_OF_ORDER` error to be catchable #844 -* Include packets that failed parsing under `debug` -* Return `Query` object from `pool.query` like `conn.query` #830 -* Use `EventEmitter.listenerCount` when possible for faster counting - -## v2.3.2 (2014-05-29) - -* Fix pool leaking connections after `conn.changeUser` #833 - -## v2.3.1 (2014-05-26) - -* Add database errors to error constants -* Add global errors to error constants -* Throw when calling `conn.release` multiple times #824 #827 -* Update known error codes - -## v2.3.0 (2014-05-16) - -* Accept MySQL charset (like `UTF8` or `UTF8MB4`) in `charset` option #808 -* Accept pool options in connection string to `mysql.createPool` #811 -* Clone connection config for new pool connections -* Default `connectTimeout` to 2 minutes -* Reject unauthorized SSL connections (use `ssl.rejectUnauthorized` to override) #816 -* Return last error when PoolCluster exhausts connection retries #818 -* Remove connection from pool after `conn.changeUser` is released #806 -* Throw on unknown SSL profile name #817 -* User newer TLS functions when available #809 - -## v2.2.0 (2014-04-27) - -* Use indexOf instead of for loops removing conn from pool #611 -* Make callback to `pool.query` optional like `conn.query` #585 -* Prevent enqueuing sequences after fatal error #400 -* Fix geometry parser for empty fields #742 -* Accept lower-case charset option -* Throw on unknown charset option #789 -* Update known charsets -* Remove console.warn from PoolCluster #744 -* Fix `pool.end` to handle queued connections #797 -* Fix `pool.releaseConnection` to keep connection queue flowing #797 -* Fix SSL handshake error to be catchable #800 -* Add `connection.threadId` to get MySQL connection ID #602 -* Ensure `pool.getConnection` retrieves good connections #434 #557 #778 -* Fix pool cluster wildcard matching #627 -* Pass query values through to `SqlString.format` #590 - -## v2.1.1 (2014-03-13) - -* fix authentication w/password failure for node.js 0.10.5 #746 #752 -* fix authentication w/password TypeError exception for node.js 0.10.0-0.10.4 #747 -* fix specifying `values` in `conn.query({...}).on(...)` pattern #755 -* fix long stack trace to include the `pool.query(...)` call #715 - -## v2.1.0 (2014-02-20) - -* crypto.createHash fix for node.js < 11 #735 -* Add `connectTimeout` option to specify a timeout for establishing a connection #726 -* SSL support #481 - -## v2.0.1 - -* internal parser speed improvement #702 -* domains support -* 'trace' connection option to control if long stack traces are generated #713 #710 #439 - -## v2.0.0 (2014-01-09) - -* stream improvements: - - node 0.8 support #692 - - Emit 'close' events from query streams #688 -* encoding fix in streaming LOAD DATA LOCAL INFILE #670 -* Doc improvements - -## v2.0.0-rc2 (2013-12-07) - -* Streaming LOAD DATA LOCAL INFILE #668 -* Doc improvements - -## v2.0.0-rc1 (2013-11-30) - -* Transaction support -* Expose SqlString.format as mysql.format() -* Many bug fixes -* Better support for dates in local time zone -* Doc improvements - -## v2.0.0-alpha9 (2013-08-27) - -* Add query to pool to execute queries directly using the pool -* Pool option to set queue limit -* Pool sends 'connection' event when it opens a new connection -* Added stringifyObjects option to treat input as strings rather than objects (#501) -* Support for poolClusters -* Datetime improvements -* Bug fixes - -## v2.0.0-alpha8 (2013-04-30) - -* Switch to old mode for Streams 2 (Node.js v 0.10.x) -* Add stream method to Query Wraps events from the query object into a node v0.10.x Readable stream -* DECIMAL should also be treated as big number -* Removed slow unnecessary stack access -* Added charsets -* Added bigNumberStrings option for forcing BIGINT columns as strings -* Changes date parsing to return String if not a valid JS Date -* Adds support for ?? escape sequence to escape identifiers -* Changes Auth.token() to force password to be in binary, not utf8 (#378) -* Restrict debugging by packet types -* Add 'multipleStatements' option tracking to ConnectionConfig. Fixes GH-408 -* Changes Pool to handle 'error' events and dispose connection -* Allows db.query({ sql: "..." }, [ val1, ... ], cb); (#390) -* Improved documentation -* Bug fixes - -## v2.0.0-alpha7 (2013-02-03) - -* Add connection pooling (#351) - -## v2.0.0-alpha6 (2013-01-31) - -* Add supportBigNumbers option (#381, #382) -* Accept prebuilt Query object in connection.query -* Bug fixes - -## v2.0.0-alpha5 (2012-12-03) - -* Add mysql.escapeId to escape identifiers (closes #342) -* Allow custom escaping mode (config.queryFormat) -* Convert DATE columns to configured timezone instead of UTC (#332) -* Convert LONGLONG and NEWDECIMAL to numbers (#333) -* Fix Connection.escape() (fixes #330) -* Changed Readme ambiguity about custom type cast fallback -* Change typeCast to receive Connection instead of Connection.config.timezone -* Fix drain event having useless err parameter -* Add Connection.statistics() back from v0.9 -* Add Connection.ping() back from v0.9 - -## v2.0.0-alpha4 (2012-10-03) - -* Fix some OOB errors on resume() -* Fix quick pause() / resume() usage -* Properly parse host denied / similar errors -* Add Connection.ChangeUser functionality -* Make sure changeUser errors are fatal -* Enable formatting nested arrays for bulk inserts -* Add Connection.escape functionality -* Renamed 'close' to 'end' event -* Return parsed object instead of Buffer for GEOMETRY types -* Allow nestTables inline (using a string instead of a boolean) -* Check for ZEROFILL_FLAG and format number accordingly -* Add timezone support (default: local) -* Add custom typeCast functionality -* Export mysql column types -* Add connection flags functionality (#237) -* Exports drain event when queue finishes processing (#272, #271, #306) - -## v2.0.0-alpha3 (2012-06-12) - -* Implement support for `LOAD DATA LOCAL INFILE` queries (#182). -* Support OLD\_PASSWORD() accounts like 0.9.x did. You should still upgrade any - user accounts in your your MySQL user table that has short (16 byte) Password - values. Connecting to those accounts is not secure. (#204) -* Ignore function values when escaping objects, allows to use RowDataPacket - objects as query arguments. (Alex Gorbatchev, #213) -* Handle initial error packets from server such as `ER_HOST_NOT_PRIVILEGED`. -* Treat `utf8\_bin` as a String, not Buffer. (#214) -* Handle empty strings in first row column value. (#222) -* Honor Connection#nestTables setting for queries. (#221) -* Remove `CLIENT_INTERACTIVE` flag from config. Improves #225. -* Improve docs for connections settings. -* Implement url string support for Connection configs. - -## v2.0.0-alpha2 (2012-05-31) - -* Specify escaping before for NaN / Infinity (they are as unquoted constants). -* Support for unix domain socket connections (use: {socketPath: '...'}). -* Fix type casting for NULL values for Date/Number fields -* Add `fields` argument to `query()` as well as `'fields'` event. This is - similar to what was available in 0.9.x. -* Support connecting to the sphinx searchd daemon as well as MariaDB (#199). -* Implement long stack trace support, will be removed / disabled if the node - core ever supports it natively. -* Implement `nestTables` option for queries, allows fetching JOIN result sets - with overlapping column names. -* Fix ? placeholder mechanism for values containing '?' characters (#205). -* Detect when `connect()` is called more than once on a connection and provide - the user with a good error message for it (#204). -* Switch to `UTF8_GENERAL_CI` (previously `UTF8_UNICODE_CI`) as the default - charset for all connections to avoid strange MySQL performance issues (#200), - and also make the charset user configurable. -* Fix BLOB type casting for `TINY_BLOB`, `MEDIUM_BLOB` and `LONG_BLOB`. -* Add support for sending and receiving large (> 16 MB) packets. - -## v2.0.0-alpha (2012-05-15) - -This release is a rewrite. You should carefully test your application after -upgrading to avoid problems. This release features many improvements, most -importantly: - -* ~5x faster than v0.9.x for parsing query results -* Support for pause() / resume() (for streaming rows) -* Support for multiple statement queries -* Support for stored procedures -* Support for transactions -* Support for binary columns (as blobs) -* Consistent & well documented error handling -* A new Connection class that has well defined semantics (unlike the old Client class). -* Convenient escaping of objects / arrays that allows for simpler query construction -* A significantly simpler code base -* Many bug fixes & other small improvements (Closed 62 out of 66 GitHub issues) - -Below are a few notes on the upgrade process itself: - -The first thing you will run into is that the old `Client` class is gone and -has been replaced with a less ambitious `Connection` class. So instead of -`mysql.createClient()`, you now have to: - -```js -var mysql = require('mysql'); -var connection = mysql.createConnection({ - host : 'localhost', - user : 'me', - password : 'secret', -}); - -connection.query('SELECT 1', function(err, rows) { - if (err) throw err; - - console.log('Query result: ', rows); -}); - -connection.end(); -``` - -The new `Connection` class does not try to handle re-connects, please study the -`Server disconnects` section in the new Readme. - -Other than that, the interface has stayed very similar. Here are a few things -to check out so: - -* BIGINT's are now cast into strings -* Binary data is now cast to buffers -* The `'row'` event on the `Query` object is now called `'result'` and will - also be emitted for queries that produce an OK/Error response. -* Error handling is consistently defined now, check the Readme -* Escaping has become more powerful which may break your code if you are - currently using objects to fill query placeholders. -* Connections can now be established explicitly again, so you may wish to do so - if you want to handle connection errors specifically. - -That should be most of it, if you run into anything else, please send a patch -or open an issue to improve this document. - -## v0.9.6 (2012-03-12) - -* Escape array values so they produce sql arrays (Roger Castells, Colin Smith) -* docs: mention mysql transaction stop gap solution (Blake Miner) -* docs: Mention affectedRows in FAQ (Michael Baldwin) - -## v0.9.5 (2011-11-26) - -* Fix #142 Driver stalls upon reconnect attempt that's immediately closed -* Add travis build -* Switch to urun as a test runner -* Switch to utest for unit tests -* Remove fast-or-slow dependency for tests -* Split integration tests into individual files again - -## v0.9.4 (2011-08-31) - -* Expose package.json as `mysql.PACKAGE` (#104) - -## v0.9.3 (2011-08-22) - -* Set default `client.user` to root -* Fix #91: Client#format should not mutate params array -* Fix #94: TypeError in client.js -* Parse decimals as string (vadimg) - -## v0.9.2 (2011-08-07) - -* The underlaying socket connection is now managed implicitly rather than explicitly. -* Check the [upgrading guide][] for a full list of changes. - -## v0.9.1 (2011-02-20) - -* Fix issue #49 / `client.escape()` throwing exceptions on objects. (Nick Payne) -* Drop < v0.4.x compatibility. From now on you need node v0.4.x to use this module. - -## Older releases - -These releases were done before maintaining this file: - -* [v0.9.0](https://github.com/felixge/node-mysql/compare/v0.8.0...v0.9.0) - (2011-01-04) -* [v0.8.0](https://github.com/felixge/node-mysql/compare/v0.7.0...v0.8.0) - (2010-10-30) -* [v0.7.0](https://github.com/felixge/node-mysql/compare/v0.6.0...v0.7.0) - (2010-10-14) -* [v0.6.0](https://github.com/felixge/node-mysql/compare/v0.5.0...v0.6.0) - (2010-09-28) -* [v0.5.0](https://github.com/felixge/node-mysql/compare/v0.4.0...v0.5.0) - (2010-09-17) -* [v0.4.0](https://github.com/felixge/node-mysql/compare/v0.3.0...v0.4.0) - (2010-09-02) -* [v0.3.0](https://github.com/felixge/node-mysql/compare/v0.2.0...v0.3.0) - (2010-08-25) -* [v0.2.0](https://github.com/felixge/node-mysql/compare/v0.1.0...v0.2.0) - (2010-08-22) -* [v0.1.0](https://github.com/felixge/node-mysql/commits/v0.1.0) - (2010-08-22) diff --git a/node_modules/mysql/Readme.md b/node_modules/mysql/Readme.md deleted file mode 100644 index 51b9d14..0000000 --- a/node_modules/mysql/Readme.md +++ /dev/null @@ -1,1182 +0,0 @@ -# mysql - -[![NPM Version][npm-image]][npm-url] -[![NPM Downloads][downloads-image]][downloads-url] -[![Node.js Version][node-version-image]][node-version-url] -[![Build Status][travis-image]][travis-url] -[![Test Coverage][coveralls-image]][coveralls-url] - -## Install - -```sh -$ npm install mysql -``` - -For information about the previous 0.9.x releases, visit the [v0.9 branch][]. - -Sometimes I may also ask you to install the latest version from Github to check -if a bugfix is working. In this case, please do: - -```sh -$ npm install felixge/node-mysql -``` - -[v0.9 branch]: https://github.com/felixge/node-mysql/tree/v0.9 - -## Introduction - -This is a node.js driver for mysql. It is written in JavaScript, does not -require compiling, and is 100% MIT licensed. - -Here is an example on how to use it: - -```js -var mysql = require('mysql'); -var connection = mysql.createConnection({ - host : 'localhost', - user : 'me', - password : 'secret' -}); - -connection.connect(); - -connection.query('SELECT 1 + 1 AS solution', function(err, rows, fields) { - if (err) throw err; - - console.log('The solution is: ', rows[0].solution); -}); - -connection.end(); -``` - -From this example, you can learn the following: - -* Every method you invoke on a connection is queued and executed in sequence. -* Closing the connection is done using `end()` which makes sure all remaining - queries are executed before sending a quit packet to the mysql server. - -## Contributors - -Thanks goes to the people who have contributed code to this module, see the -[GitHub Contributors page][]. - -[GitHub Contributors page]: https://github.com/felixge/node-mysql/graphs/contributors - -Additionally I'd like to thank the following people: - -* [Andrey Hristov][] (Oracle) - for helping me with protocol questions. -* [Ulf Wendel][] (Oracle) - for helping me with protocol questions. - -[Ulf Wendel]: http://blog.ulf-wendel.de/ -[Andrey Hristov]: http://andrey.hristov.com/ - -## Sponsors - -The following companies have supported this project financially, allowing me to -spend more time on it (ordered by time of contribution): - -* [Transloadit](http://transloadit.com) (my startup, we do file uploading & - video encoding as a service, check it out) -* [Joyent](http://www.joyent.com/) -* [pinkbike.com](http://pinkbike.com/) -* [Holiday Extras](http://www.holidayextras.co.uk/) (they are [hiring](http://join.holidayextras.co.uk/vacancy/software-engineer/)) -* [Newscope](http://newscope.com/) (they are [hiring](http://www.newscope.com/stellenangebote)) - -If you are interested in sponsoring a day or more of my time, please -[get in touch][]. - -[get in touch]: http://felixge.de/#consulting - -## Community - -If you'd like to discuss this module, or ask questions about it, please use one -of the following: - -* **Mailing list**: https://groups.google.com/forum/#!forum/node-mysql -* **IRC Channel**: #node.js (on freenode.net, I pay attention to any message - including the term `mysql`) - -## Establishing connections - -The recommended way to establish a connection is this: - -```js -var mysql = require('mysql'); -var connection = mysql.createConnection({ - host : 'example.org', - user : 'bob', - password : 'secret' -}); - -connection.connect(function(err) { - if (err) { - console.error('error connecting: ' + err.stack); - return; - } - - console.log('connected as id ' + connection.threadId); -}); -``` - -However, a connection can also be implicitly established by invoking a query: - -```js -var mysql = require('mysql'); -var connection = mysql.createConnection(...); - -connection.query('SELECT 1', function(err, rows) { - // connected! (unless `err` is set) -}); -``` - -Depending on how you like to handle your errors, either method may be -appropriate. Any type of connection error (handshake or network) is considered -a fatal error, see the [Error Handling](#error-handling) section for more -information. - -## Connection options - -When establishing a connection, you can set the following options: - -* `host`: The hostname of the database you are connecting to. (Default: - `localhost`) -* `port`: The port number to connect to. (Default: `3306`) -* `localAddress`: The source IP address to use for TCP connection. (Optional) -* `socketPath`: The path to a unix domain socket to connect to. When used `host` - and `port` are ignored. -* `user`: The MySQL user to authenticate as. -* `password`: The password of that MySQL user. -* `database`: Name of the database to use for this connection (Optional). -* `charset`: The charset for the connection. This is called "collation" in the SQL-level - of MySQL (like `utf8_general_ci`). If a SQL-level charset is specified (like `utf8mb4`) - then the default collation for that charset is used. (Default: `'UTF8_GENERAL_CI'`) -* `timezone`: The timezone used to store local dates. (Default: `'local'`) -* `connectTimeout`: The milliseconds before a timeout occurs during the initial connection - to the MySQL server. (Default: 10 seconds) -* `stringifyObjects`: Stringify objects instead of converting to values. See -issue [#501](https://github.com/felixge/node-mysql/issues/501). (Default: `'false'`) -* `insecureAuth`: Allow connecting to MySQL instances that ask for the old - (insecure) authentication method. (Default: `false`) -* `typeCast`: Determines if column values should be converted to native - JavaScript types. (Default: `true`) -* `queryFormat`: A custom query format function. See [Custom format](#custom-format). -* `supportBigNumbers`: When dealing with big numbers (BIGINT and DECIMAL columns) in the database, - you should enable this option (Default: `false`). -* `bigNumberStrings`: Enabling both `supportBigNumbers` and `bigNumberStrings` forces big numbers - (BIGINT and DECIMAL columns) to be always returned as JavaScript String objects (Default: `false`). - Enabling `supportBigNumbers` but leaving `bigNumberStrings` disabled will return big numbers as String - objects only when they cannot be accurately represented with [JavaScript Number objects] (http://ecma262-5.com/ELS5_HTML.htm#Section_8.5) - (which happens when they exceed the [-2^53, +2^53] range), otherwise they will be returned as - Number objects. This option is ignored if `supportBigNumbers` is disabled. -* `dateStrings`: Force date types (TIMESTAMP, DATETIME, DATE) to be returned as strings rather then - inflated into JavaScript Date objects. (Default: `false`) -* `debug`: Prints protocol details to stdout. (Default: `false`) -* `trace`: Generates stack traces on `Error` to include call site of library - entrance ("long stack traces"). Slight performance penalty for most calls. - (Default: `true`) -* `multipleStatements`: Allow multiple mysql statements per query. Be careful - with this, it exposes you to SQL injection attacks. (Default: `false`) -* `flags`: List of connection flags to use other than the default ones. It is - also possible to blacklist default ones. For more information, check - [Connection Flags](#connection-flags). -* `ssl`: object with ssl parameters or a string containing name of ssl profile. See [SSL options](#ssl-options). - - -In addition to passing these options as an object, you can also use a url -string. For example: - -```js -var connection = mysql.createConnection('mysql://user:pass@host/db?debug=true&charset=BIG5_CHINESE_CI&timezone=-0700'); -``` - -Note: The query values are first attempted to be parsed as JSON, and if that -fails assumed to be plaintext strings. - -### SSL options - -The `ssl` option in the connection options takes a string or an object. When given a string, -it uses one of the predefined SSL profiles included. The following profiles are included: - -* `"Amazon RDS"`: this profile is for connecting to an Amazon RDS server and contains the - ca from https://rds.amazonaws.com/doc/rds-ssl-ca-cert.pem - -When connecting to other servers, you will need to provide an object of options, in the -same format as [crypto.createCredentials](http://nodejs.org/api/crypto.html#crypto_crypto_createcredentials_details). -Please note the arguments expect a string of the certificate, not a file name to the -certificate. Here is a simple example: - -```js -var connection = mysql.createConnection({ - host : 'localhost', - ssl : { - ca : fs.readFileSync(__dirname + '/mysql-ca.crt') - } -}); -``` - -You can also connect to a MySQL server without properly providing the appropriate -CA to trust. _You should not do this_. - -```js -var connection = mysql.createConnection({ - host : 'localhost', - ssl : { - // DO NOT DO THIS - // set up your ca correctly to trust the connection - rejectUnauthorized: false - } -}); -``` - -## Terminating connections - -There are two ways to end a connection. Terminating a connection gracefully is -done by calling the `end()` method: - -```js -connection.end(function(err) { - // The connection is terminated now -}); -``` - -This will make sure all previously enqueued queries are still before sending a -`COM_QUIT` packet to the MySQL server. If a fatal error occurs before the -`COM_QUIT` packet can be sent, an `err` argument will be provided to the -callback, but the connection will be terminated regardless of that. - -An alternative way to end the connection is to call the `destroy()` method. -This will cause an immediate termination of the underlying socket. -Additionally `destroy()` guarantees that no more events or callbacks will be -triggered for the connection. - -```js -connection.destroy(); -``` - -Unlike `end()` the `destroy()` method does not take a callback argument. - -## Pooling connections - -Use pool directly. -```js -var mysql = require('mysql'); -var pool = mysql.createPool({ - connectionLimit : 10, - host : 'example.org', - user : 'bob', - password : 'secret' -}); - -pool.query('SELECT 1 + 1 AS solution', function(err, rows, fields) { - if (err) throw err; - - console.log('The solution is: ', rows[0].solution); -}); -``` - -Connections can be pooled to ease sharing a single connection, or managing -multiple connections. - -```js -var mysql = require('mysql'); -var pool = mysql.createPool({ - host : 'example.org', - user : 'bob', - password : 'secret' -}); - -pool.getConnection(function(err, connection) { - // connected! (unless `err` is set) -}); -``` - -When you are done with a connection, just call `connection.release()` and the -connection will return to the pool, ready to be used again by someone else. - -```js -var mysql = require('mysql'); -var pool = mysql.createPool(...); - -pool.getConnection(function(err, connection) { - // Use the connection - connection.query( 'SELECT something FROM sometable', function(err, rows) { - // And done with the connection. - connection.release(); - - // Don't use the connection here, it has been returned to the pool. - }); -}); -``` - -If you would like to close the connection and remove it from the pool, use -`connection.destroy()` instead. The pool will create a new connection the next -time one is needed. - -Connections are lazily created by the pool. If you configure the pool to allow -up to 100 connections, but only ever use 5 simultaneously, only 5 connections -will be made. Connections are also cycled round-robin style, with connections -being taken from the top of the pool and returning to the bottom. - -When a previous connection is retrieved from the pool, a ping packet is sent -to the server to check if the connection is still good. - -## Pool options - -Pools accept all the same options as a connection. When creating a new -connection, the options are simply passed to the connection constructor. In -addition to those options pools accept a few extras: - -* `acquireTimeout`: The milliseconds before a timeout occurs during the connection - acquisition. This is slightly different from `connectTimeout`, because acquiring - a pool connection does not always involve making a connection. (Default: 10 seconds) -* `waitForConnections`: Determines the pool's action when no connections are - available and the limit has been reached. If `true`, the pool will queue the - connection request and call it when one becomes available. If `false`, the - pool will immediately call back with an error. (Default: `true`) -* `connectionLimit`: The maximum number of connections to create at once. - (Default: `10`) -* `queueLimit`: The maximum number of connection requests the pool will queue - before returning an error from `getConnection`. If set to `0`, there is no - limit to the number of queued connection requests. (Default: `0`) - -## Pool events - -### connection - -The pool will emit a `connection` event when a new connection is made within the pool. -If you need to set session variables on the connection before it gets used, you can -listen to the `connection` event. - -```js -pool.on('connection', function (connection) { - connection.query('SET SESSION auto_increment_increment=1') -}); -``` - -### enqueue - -The pool will emit an `enqueue` event when a callback has been queued to wait for -an available connection. - -```js -pool.on('enqueue', function () { - console.log('Waiting for available connection slot'); -}); -``` - -## PoolCluster - -PoolCluster provides multiple hosts connection. (group & retry & selector) - -```js -// create -var poolCluster = mysql.createPoolCluster(); - -poolCluster.add(config); // anonymous group -poolCluster.add('MASTER', masterConfig); -poolCluster.add('SLAVE1', slave1Config); -poolCluster.add('SLAVE2', slave2Config); - -// Target Group : ALL(anonymous, MASTER, SLAVE1-2), Selector : round-robin(default) -poolCluster.getConnection(function (err, connection) {}); - -// Target Group : MASTER, Selector : round-robin -poolCluster.getConnection('MASTER', function (err, connection) {}); - -// Target Group : SLAVE1-2, Selector : order -// If can't connect to SLAVE1, return SLAVE2. (remove SLAVE1 in the cluster) -poolCluster.on('remove', function (nodeId) { - console.log('REMOVED NODE : ' + nodeId); // nodeId = SLAVE1 -}); - -poolCluster.getConnection('SLAVE*', 'ORDER', function (err, connection) {}); - -// of namespace : of(pattern, selector) -poolCluster.of('*').getConnection(function (err, connection) {}); - -var pool = poolCluster.of('SLAVE*', 'RANDOM'); -pool.getConnection(function (err, connection) {}); -pool.getConnection(function (err, connection) {}); - -// destroy -poolCluster.end(); -``` - -## PoolCluster Option -* `canRetry`: If `true`, `PoolCluster` will attempt to reconnect when connection fails. (Default: `true`) -* `removeNodeErrorCount`: If connection fails, node's `errorCount` increases. - When `errorCount` is greater than `removeNodeErrorCount`, remove a node in the `PoolCluster`. (Default: `5`) -* `defaultSelector`: The default selector. (Default: `RR`) - * `RR`: Select one alternately. (Round-Robin) - * `RANDOM`: Select the node by random function. - * `ORDER`: Select the first node available unconditionally. - -```js -var clusterConfig = { - removeNodeErrorCount: 1, // Remove the node immediately when connection fails. - defaultSelector: 'ORDER' -}; - -var poolCluster = mysql.createPoolCluster(clusterConfig); -``` - -## Switching users / altering connection state - -MySQL offers a changeUser command that allows you to alter the current user and -other aspects of the connection without shutting down the underlying socket: - -```js -connection.changeUser({user : 'john'}, function(err) { - if (err) throw err; -}); -``` - -The available options for this feature are: - -* `user`: The name of the new user (defaults to the previous one). -* `password`: The password of the new user (defaults to the previous one). -* `charset`: The new charset (defaults to the previous one). -* `database`: The new database (defaults to the previous one). - -A sometimes useful side effect of this functionality is that this function also -resets any connection state (variables, transactions, etc.). - -Errors encountered during this operation are treated as fatal connection errors -by this module. - -## Server disconnects - -You may lose the connection to a MySQL server due to network problems, the -server timing you out, the server being restarted, or crashing. All of these -events are considered fatal errors, and will have the `err.code = -'PROTOCOL_CONNECTION_LOST'`. See the [Error Handling](#error-handling) section -for more information. - -Re-connecting a connection is done by establishing a new connection. Once -terminated, an existing connection object cannot be re-connected by design. - -With Pool, disconnected connections will be removed from the pool freeing up -space for a new connection to be created on the next getConnection call. - -## Escaping query values - -In order to avoid SQL Injection attacks, you should always escape any user -provided data before using it inside a SQL query. You can do so using the -`connection.escape()` or `pool.escape()` methods: - -```js -var userId = 'some user provided value'; -var sql = 'SELECT * FROM users WHERE id = ' + connection.escape(userId); -connection.query(sql, function(err, results) { - // ... -}); -``` - -Alternatively, you can use `?` characters as placeholders for values you would -like to have escaped like this: - -```js -connection.query('SELECT * FROM users WHERE id = ?', [userId], function(err, results) { - // ... -}); -``` - -This looks similar to prepared statements in MySQL, however it really just uses -the same `connection.escape()` method internally. - -**Caution** This also differs from prepared statements in that all `?` are -replaced, even those contained in comments and strings. - -Different value types are escaped differently, here is how: - -* Numbers are left untouched -* Booleans are converted to `true` / `false` strings -* Date objects are converted to `'YYYY-mm-dd HH:ii:ss'` strings -* Buffers are converted to hex strings, e.g. `X'0fa5'` -* Strings are safely escaped -* Arrays are turned into list, e.g. `['a', 'b']` turns into `'a', 'b'` -* Nested arrays are turned into grouped lists (for bulk inserts), e.g. `[['a', - 'b'], ['c', 'd']]` turns into `('a', 'b'), ('c', 'd')` -* Objects are turned into `key = 'val'` pairs. Nested objects are cast to - strings. -* `undefined` / `null` are converted to `NULL` -* `NaN` / `Infinity` are left as-is. MySQL does not support these, and trying - to insert them as values will trigger MySQL errors until they implement - support. - -If you paid attention, you may have noticed that this escaping allows you -to do neat things like this: - -```js -var post = {id: 1, title: 'Hello MySQL'}; -var query = connection.query('INSERT INTO posts SET ?', post, function(err, result) { - // Neat! -}); -console.log(query.sql); // INSERT INTO posts SET `id` = 1, `title` = 'Hello MySQL' - -``` - -If you feel the need to escape queries by yourself, you can also use the escaping -function directly: - -```js -var query = "SELECT * FROM posts WHERE title=" + mysql.escape("Hello MySQL"); - -console.log(query); // SELECT * FROM posts WHERE title='Hello MySQL' -``` - -## Escaping query identifiers - -If you can't trust an SQL identifier (database / table / column name) because it is -provided by a user, you should escape it with `mysql.escapeId(identifier)`, -`connection.escapeId(identifier)` or `pool.escapeId(identifier)` like this: - -```js -var sorter = 'date'; -var sql = 'SELECT * FROM posts ORDER BY ' + connection.escapeId(sorter); -connection.query(sql, function(err, results) { - // ... -}); -``` - -It also supports adding qualified identifiers. It will escape both parts. - -```js -var sorter = 'date'; -var sql = 'SELECT * FROM posts ORDER BY ' + connection.escapeId('posts.' + sorter); -connection.query(sql, function(err, results) { - // ... -}); -``` - -Alternatively, you can use `??` characters as placeholders for identifiers you would -like to have escaped like this: - -```js -var userId = 1; -var columns = ['username', 'email']; -var query = connection.query('SELECT ?? FROM ?? WHERE id = ?', [columns, 'users', userId], function(err, results) { - // ... -}); - -console.log(query.sql); // SELECT `username`, `email` FROM `users` WHERE id = 1 -``` -**Please note that this last character sequence is experimental and syntax might change** - -When you pass an Object to `.escape()` or `.query()`, `.escapeId()` is used to avoid SQL injection in object keys. - -### Preparing Queries - -You can use mysql.format to prepare a query with multiple insertion points, utilizing the proper escaping for ids and values. A simple example of this follows: - -```js -var sql = "SELECT * FROM ?? WHERE ?? = ?"; -var inserts = ['users', 'id', userId]; -sql = mysql.format(sql, inserts); -``` - -Following this you then have a valid, escaped query that you can then send to the database safely. This is useful if you are looking to prepare the query before actually sending it to the database. As mysql.format is exposed from SqlString.format you also have the option (but are not required) to pass in stringifyObject and timezone, allowing you provide a custom means of turning objects into strings, as well as a location-specific/timezone-aware Date. - -### Custom format - -If you prefer to have another type of query escape format, there's a connection configuration option you can use to define a custom format function. You can access the connection object if you want to use the built-in `.escape()` or any other connection function. - -Here's an example of how to implement another format: - -```js -connection.config.queryFormat = function (query, values) { - if (!values) return query; - return query.replace(/\:(\w+)/g, function (txt, key) { - if (values.hasOwnProperty(key)) { - return this.escape(values[key]); - } - return txt; - }.bind(this)); -}; - -connection.query("UPDATE posts SET title = :title", { title: "Hello MySQL" }); -``` - -## Getting the id of an inserted row - -If you are inserting a row into a table with an auto increment primary key, you -can retrieve the insert id like this: - -```js -connection.query('INSERT INTO posts SET ?', {title: 'test'}, function(err, result) { - if (err) throw err; - - console.log(result.insertId); -}); -``` - -When dealing with big numbers (above JavaScript Number precision limit), you should -consider enabling `supportBigNumbers` option to be able to read the insert id as a -string, otherwise it will throw. - -This option is also required when fetching big numbers from the database, otherwise -you will get values rounded to hundreds or thousands due to the precision limit. - -## Getting the number of affected rows. - -You can get the number of affected rows from an insert, update or delete statement. - -```js -connection.query('DELETE FROM posts WHERE title = "wrong"', function (err, result) { - if (err) throw err; - - console.log('deleted ' + result.affectedRows + ' rows'); -}) -``` - -## Getting the number of changed rows. - -You can get the number of changed rows from an update statement. - -"changedRows" differs from "affectedRows" in that it does not count updated rows -whose values were not changed. - -```js -connection.query('UPDATE posts SET ...', function (err, result) { - if (err) throw err; - - console.log('changed ' + result.changedRows + ' rows'); -}) -``` - -## Getting the connection ID - -You can get the MySQL connection ID ("thread ID") of a given connection using the `threadId` -property. - -```js -connection.connect(function(err) { - if (err) throw err; - console.log('connected as id ' + connection.threadId); -}); -``` - -## Executing queries in parallel - -The MySQL protocol is sequential, this means that you need multiple connections -to execute queries in parallel. You can use a Pool to manage connections, one -simple approach is to create one connection per incoming http request. - -## Streaming query rows - -Sometimes you may want to select large quantities of rows and process each of -them as they are received. This can be done like this: - -```js -var query = connection.query('SELECT * FROM posts'); -query - .on('error', function(err) { - // Handle error, an 'end' event will be emitted after this as well - }) - .on('fields', function(fields) { - // the field packets for the rows to follow - }) - .on('result', function(row) { - // Pausing the connnection is useful if your processing involves I/O - connection.pause(); - - processRow(row, function() { - connection.resume(); - }); - }) - .on('end', function() { - // all rows have been received - }); -``` - -Please note a few things about the example above: - -* Usually you will want to receive a certain amount of rows before starting to - throttle the connection using `pause()`. This number will depend on the - amount and size of your rows. -* `pause()` / `resume()` operate on the underlying socket and parser. You are - guaranteed that no more `'result'` events will fire after calling `pause()`. -* You MUST NOT provide a callback to the `query()` method when streaming rows. -* The `'result'` event will fire for both rows as well as OK packets - confirming the success of a INSERT/UPDATE query. - -Additionally you may be interested to know that it is currently not possible to -stream individual row columns, they will always be buffered up entirely. If you -have a good use case for streaming large fields to and from MySQL, I'd love to -get your thoughts and contributions on this. - -### Piping results with [Streams2](http://blog.nodejs.org/2012/12/20/streams2/) - -The query object provides a convenience method `.stream([options])` that wraps -query events into a [Readable](http://nodejs.org/api/stream.html#stream_class_stream_readable) -Streams2 object. This stream can easily be piped downstream and provides -automatic pause/resume, based on downstream congestion and the optional -`highWaterMark`. The `objectMode` parameter of the stream is set to `true` by -default. - -For example, piping query results into another stream (with a max buffer of 5 -objects) is simply: - -```js -connection.query('SELECT * FROM posts') - .stream({highWaterMark: 5}) - .pipe(...); -``` - -## Multiple statement queries - -Support for multiple statements is disabled for security reasons (it allows for -SQL injection attacks if values are not properly escaped). To use this feature -you have to enable it for your connection: - -```js -var connection = mysql.createConnection({multipleStatements: true}); -``` - -Once enabled, you can execute multiple statement queries like any other query: - -```js -connection.query('SELECT 1; SELECT 2', function(err, results) { - if (err) throw err; - - // `results` is an array with one element for every statement in the query: - console.log(results[0]); // [{1: 1}] - console.log(results[1]); // [{2: 2}] -}); -``` - -Additionally you can also stream the results of multiple statement queries: - -```js -var query = connection.query('SELECT 1; SELECT 2'); - -query - .on('fields', function(fields, index) { - // the fields for the result rows that follow - }) - .on('result', function(row, index) { - // index refers to the statement this result belongs to (starts at 0) - }); -``` - -If one of the statements in your query causes an error, the resulting Error -object contains a `err.index` property which tells you which statement caused -it. MySQL will also stop executing any remaining statements when an error -occurs. - -Please note that the interface for streaming multiple statement queries is -experimental and I am looking forward to feedback on it. - -## Stored procedures - -You can call stored procedures from your queries as with any other mysql driver. -If the stored procedure produces several result sets, they are exposed to you -the same way as the results for multiple statement queries. - -## Joins with overlapping column names - -When executing joins, you are likely to get result sets with overlapping column -names. - -By default, node-mysql will overwrite colliding column names in the -order the columns are received from MySQL, causing some of the received values -to be unavailable. - -However, you can also specify that you want your columns to be nested below -the table name like this: - -```js -var options = {sql: '...', nestTables: true}; -connection.query(options, function(err, results) { - /* results will be an array like this now: - [{ - table1: { - fieldA: '...', - fieldB: '...', - }, - table2: { - fieldA: '...', - fieldB: '...', - }, - }, ...] - */ -}); -``` - -Or use a string separator to have your results merged. - -```js -var options = {sql: '...', nestTables: '_'}; -connection.query(options, function(err, results) { - /* results will be an array like this now: - [{ - table1_fieldA: '...', - table1_fieldB: '...', - table2_fieldA: '...', - table2_fieldB: '...', - }, ...] - */ -}); -``` - -## Transactions - -Simple transaction support is available at the connection level: - -```js -connection.beginTransaction(function(err) { - if (err) { throw err; } - connection.query('INSERT INTO posts SET title=?', title, function(err, result) { - if (err) { - connection.rollback(function() { - throw err; - }); - } - - var log = 'Post ' + result.insertId + ' added'; - - connection.query('INSERT INTO log SET data=?', log, function(err, result) { - if (err) { - connection.rollback(function() { - throw err; - }); - } - connection.commit(function(err) { - if (err) { - connection.rollback(function() { - throw err; - }); - } - console.log('success!'); - }); - }); - }); -}); -``` -Please note that beginTransaction(), commit() and rollback() are simply convenience -functions that execute the START TRANSACTION, COMMIT, and ROLLBACK commands respectively. -It is important to understand that many commands in MySQL can cause an implicit commit, -as described [in the MySQL documentation](http://dev.mysql.com/doc/refman/5.5/en/implicit-commit.html) - -## Timeouts - -Every operation takes an optional inactivity timeout option. This allows you to -specify appropriate timeouts for operations. It is important to note that these -timeouts are not part of the MySQL protocol, and rather timeout operations through -the client. This means that when a timeout is reached, the connection it occurred -on will be destroyed and no further operations can be performed. - -```js -// Kill query after 60s -connection.query({sql: 'SELECT COUNT(*) AS count FROM big_table', timeout: 60000}, function (err, rows) { - if (err && err.code === 'PROTOCOL_SEQUENCE_TIMEOUT') { - throw new Error('too long to count table rows!'); - } - - if (err) { - throw err; - } - - console.log(rows[0].count + ' rows'); -}); -``` - -## Error handling - -This module comes with a consistent approach to error handling that you should -review carefully in order to write solid applications. - -All errors created by this module are instances of the JavaScript [Error][] -object. Additionally they come with two properties: - -* `err.code`: Either a [MySQL server error][] (e.g. - `'ER_ACCESS_DENIED_ERROR'`), a node.js error (e.g. `'ECONNREFUSED'`) or an - internal error (e.g. `'PROTOCOL_CONNECTION_LOST'`). -* `err.fatal`: Boolean, indicating if this error is terminal to the connection - object. - -[Error]: https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/Error -[MySQL server error]: http://dev.mysql.com/doc/refman/5.5/en/error-messages-server.html - -Fatal errors are propagated to *all* pending callbacks. In the example below, a -fatal error is triggered by trying to connect to an invalid port. Therefore the -error object is propagated to both pending callbacks: - -```js -var connection = require('mysql').createConnection({ - port: 84943, // WRONG PORT -}); - -connection.connect(function(err) { - console.log(err.code); // 'ECONNREFUSED' - console.log(err.fatal); // true -}); - -connection.query('SELECT 1', function(err) { - console.log(err.code); // 'ECONNREFUSED' - console.log(err.fatal); // true -}); -``` - -Normal errors however are only delegated to the callback they belong to. So in -the example below, only the first callback receives an error, the second query -works as expected: - -```js -connection.query('USE name_of_db_that_does_not_exist', function(err, rows) { - console.log(err.code); // 'ER_BAD_DB_ERROR' -}); - -connection.query('SELECT 1', function(err, rows) { - console.log(err); // null - console.log(rows.length); // 1 -}); -``` - -Last but not least: If a fatal errors occurs and there are no pending -callbacks, or a normal error occurs which has no callback belonging to it, the -error is emitted as an `'error'` event on the connection object. This is -demonstrated in the example below: - -```js -connection.on('error', function(err) { - console.log(err.code); // 'ER_BAD_DB_ERROR' -}); - -connection.query('USE name_of_db_that_does_not_exist'); -``` - -Note: `'error'` are special in node. If they occur without an attached -listener, a stack trace is printed and your process is killed. - -**tl;dr:** This module does not want you to deal with silent failures. You -should always provide callbacks to your method calls. If you want to ignore -this advice and suppress unhandled errors, you can do this: - -```js -// I am Chuck Norris: -connection.on('error', function() {}); -``` - -## Exception Safety - -This module is exception safe. That means you can continue to use it, even if -one of your callback functions throws an error which you're catching using -'uncaughtException' or a domain. - -## Type casting - -For your convenience, this driver will cast mysql types into native JavaScript -types by default. The following mappings exist: - -### Number - -* TINYINT -* SMALLINT -* INT -* MEDIUMINT -* YEAR -* FLOAT -* DOUBLE - -### Date - -* TIMESTAMP -* DATE -* DATETIME - -### Buffer - -* TINYBLOB -* MEDIUMBLOB -* LONGBLOB -* BLOB -* BINARY -* VARBINARY -* BIT (last byte will be filled with 0 bits as necessary) - -### String - -* CHAR -* VARCHAR -* TINYTEXT -* MEDIUMTEXT -* LONGTEXT -* TEXT -* ENUM -* SET -* DECIMAL (may exceed float precision) -* BIGINT (may exceed float precision) -* TIME (could be mapped to Date, but what date would be set?) -* GEOMETRY (never used those, get in touch if you do) - -It is not recommended (and may go away / change in the future) to disable type -casting, but you can currently do so on either the connection: - -```js -var connection = require('mysql').createConnection({typeCast: false}); -``` - -Or on the query level: - -```js -var options = {sql: '...', typeCast: false}; -var query = connection.query(options, function(err, results) { - -}); -``` - -You can also pass a function and handle type casting yourself. You're given some -column information like database, table and name and also type and length. If you -just want to apply a custom type casting to a specific type you can do it and then -fallback to the default. Here's an example of converting `TINYINT(1)` to boolean: - -```js -connection.query({ - sql: '...', - typeCast: function (field, next) { - if (field.type == 'TINY' && field.length == 1) { - return (field.string() == '1'); // 1 = true, 0 = false - } - return next(); - } -}); -``` -__WARNING: YOU MUST INVOKE the parser using one of these three field functions in your custom typeCast callback. They can only be called once.( see #539 for discussion)__ - -``` -field.string() -field.buffer() -field.geometry() -``` -are aliases for -``` -parser.parseLengthCodedString() -parser.parseLengthCodedBuffer() -parser.parseGeometryValue() -``` -__You can find which field function you need to use by looking at: [RowDataPacket.prototype._typeCast](https://github.com/felixge/node-mysql/blob/master/lib/protocol/packets/RowDataPacket.js#L41)__ - - -## Connection Flags - -If, for any reason, you would like to change the default connection flags, you -can use the connection option `flags`. Pass a string with a comma separated list -of items to add to the default flags. If you don't want a default flag to be used -prepend the flag with a minus sign. To add a flag that is not in the default list, -just write the flag name, or prefix it with a plus (case insensitive). - -**Please note that some available flags that are not not supported (e.g.: Compression), -are still not allowed to be specified.** - -### Example - -The next example blacklists FOUND_ROWS flag from default connection flags. - -```js -var connection = mysql.createConnection("mysql://localhost/test?flags=-FOUND_ROWS"); -``` - -### Default Flags - -The following flags are sent by default on a new connection: - -- `CONNECT_WITH_DB` - Ability to specify the database on connection. -- `FOUND_ROWS` - Send the found rows instead of the affected rows as `affectedRows`. -- `IGNORE_SIGPIPE` - Old; no effect. -- `IGNORE_SPACE` - Let the parser ignore spaces before the `(` in queries. -- `LOCAL_FILES` - Can use `LOAD DATA LOCAL`. -- `LONG_FLAG` -- `LONG_PASSWORD` - Use the improved version of Old Password Authentication. -- `MULTI_RESULTS` - Can handle multiple resultsets for COM_QUERY. -- `ODBC` Old; no effect. -- `PROTOCOL_41` - Uses the 4.1 protocol. -- `PS_MULTI_RESULTS` - Can handle multiple resultsets for COM_STMT_EXECUTE. -- `RESERVED` - Old flag for the 4.1 protocol. -- `SECURE_CONNECTION` - Support native 4.1 authentication. -- `TRANSACTIONS` - Asks for the transaction status flags. - -In addition, the following flag will be sent if the option `multipleStatements` -is set to `true`: - -- `MULTI_STATEMENTS` - The client may send multiple statement per query or - statement prepare. - -### Other Available Flags - -There are other flags available. They may or may not function, but are still -available to specify. - -- COMPRESS -- INTERACTIVE -- NO_SCHEMA -- PLUGIN_AUTH -- REMEMBER_OPTIONS -- SSL -- SSL_VERIFY_SERVER_CERT - -## Debugging and reporting problems - -If you are running into problems, one thing that may help is enabling the -`debug` mode for the connection: - -```js -var connection = mysql.createConnection({debug: true}); -``` - -This will print all incoming and outgoing packets on stdout. You can also restrict debugging to -packet types by passing an array of types to debug: - -```js -var connection = mysql.createConnection({debug: ['ComQueryPacket', 'RowDataPacket']}); -``` - -to restrict debugging to the query and data packets. - -If that does not help, feel free to open a GitHub issue. A good GitHub issue -will have: - -* The minimal amount of code required to reproduce the problem (if possible) -* As much debugging output and information about your environment (mysql - version, node version, os, etc.) as you can gather. - -## Running tests - -The test suite is split into two parts: unit tests and integration tests. -The unit tests run on any machine while the integration tests require a -MySQL server instance to be setup. - -### Running unit tests - -```sh -$ FILTER=unit npm test -``` - -### Running integration tests - -Set the environment variables `MYSQL_DATABASE`, `MYSQL_HOST`, `MYSQL_PORT`, -`MYSQL_USER` and `MYSQL_PASSWORD`. Then run `npm test`. - -For example, if you have an installation of mysql running on localhost:3306 -and no password set for the `root` user, run: - -```sh -$ mysql -u root -e "CREATE DATABASE IF NOT EXISTS node_mysql_test" -$ MYSQL_HOST=localhost MYSQL_PORT=3306 MYSQL_DATABASE=node_mysql_test MYSQL_USER=root MYSQL_PASSWORD= FILTER=integration npm test -``` - -## Todo - -* Prepared statements -* Support for encodings other than UTF-8 / ASCII - -[npm-image]: https://img.shields.io/npm/v/mysql.svg?style=flat -[npm-url]: https://npmjs.org/package/mysql -[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat -[node-version-url]: http://nodejs.org/download/ -[travis-image]: https://img.shields.io/travis/felixge/node-mysql.svg?style=flat -[travis-url]: https://travis-ci.org/felixge/node-mysql -[coveralls-image]: https://img.shields.io/coveralls/felixge/node-mysql.svg?style=flat -[coveralls-url]: https://coveralls.io/r/felixge/node-mysql?branch=master -[downloads-image]: https://img.shields.io/npm/dm/mysql.svg?style=flat -[downloads-url]: https://npmjs.org/package/mysql diff --git a/node_modules/mysql/fixtures/ssl-profiles.json b/node_modules/mysql/fixtures/ssl-profiles.json deleted file mode 100644 index 0629d5e..0000000 --- a/node_modules/mysql/fixtures/ssl-profiles.json +++ /dev/null @@ -1,5 +0,0 @@ -{ - "Amazon RDS": { - "ca": "-----BEGIN CERTIFICATE-----\nMIIDQzCCAqygAwIBAgIJAOd1tlfiGoEoMA0GCSqGSIb3DQEBBQUAMHUxCzAJBgNV\nBAYTAlVTMRMwEQYDVQQIEwpXYXNoaW5ndG9uMRAwDgYDVQQHEwdTZWF0dGxlMRMw\nEQYDVQQKEwpBbWF6b24uY29tMQwwCgYDVQQLEwNSRFMxHDAaBgNVBAMTE2F3cy5h\nbWF6b24uY29tL3Jkcy8wHhcNMTAwNDA1MjI0NDMxWhcNMTUwNDA0MjI0NDMxWjB1\nMQswCQYDVQQGEwJVUzETMBEGA1UECBMKV2FzaGluZ3RvbjEQMA4GA1UEBxMHU2Vh\ndHRsZTETMBEGA1UEChMKQW1hem9uLmNvbTEMMAoGA1UECxMDUkRTMRwwGgYDVQQD\nExNhd3MuYW1hem9uLmNvbS9yZHMvMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKB\ngQDKhXGU7tizxUR5WaFoMTFcxNxa05PEjZaIOEN5ctkWrqYSRov0/nOMoZjqk8bC\nmed9vPFoQGD0OTakPs0jVe3wwmR735hyVwmKIPPsGlaBYj1O6llIpZeQVyupNx56\nUzqtiLaDzh1KcmfqP3qP2dInzBfJQKjiRudo1FWnpPt33QIDAQABo4HaMIHXMB0G\nA1UdDgQWBBT/H3x+cqSkR/ePSIinPtc4yWKe3DCBpwYDVR0jBIGfMIGcgBT/H3x+\ncqSkR/ePSIinPtc4yWKe3KF5pHcwdTELMAkGA1UEBhMCVVMxEzARBgNVBAgTCldh\nc2hpbmd0b24xEDAOBgNVBAcTB1NlYXR0bGUxEzARBgNVBAoTCkFtYXpvbi5jb20x\nDDAKBgNVBAsTA1JEUzEcMBoGA1UEAxMTYXdzLmFtYXpvbi5jb20vcmRzL4IJAOd1\ntlfiGoEoMAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADgYEAvguZy/BDT66x\nGfgnJlyQwnFSeVLQm9u/FIvz4huGjbq9dqnD6h/Gm56QPFdyMEyDiZWaqY6V08lY\nLTBNb4kcIc9/6pc0/ojKciP5QJRm6OiZ4vgG05nF4fYjhU7WClUx7cxq1fKjNc2J\nUCmmYqgiVkAGWRETVo+byOSDZ4swb10=\n-----END CERTIFICATE-----\n" - } -} diff --git a/node_modules/mysql/index.js b/node_modules/mysql/index.js deleted file mode 100644 index 523eb53..0000000 --- a/node_modules/mysql/index.js +++ /dev/null @@ -1,26 +0,0 @@ -var Connection = require('./lib/Connection'); -var ConnectionConfig = require('./lib/ConnectionConfig'); -var Types = require('./lib/protocol/constants/types'); -var SqlString = require('./lib/protocol/SqlString'); -var Pool = require('./lib/Pool'); -var PoolConfig = require('./lib/PoolConfig'); -var PoolCluster = require('./lib/PoolCluster'); - -exports.createConnection = function(config) { - return new Connection({config: new ConnectionConfig(config)}); -}; - -exports.createPool = function(config) { - return new Pool({config: new PoolConfig(config)}); -}; - -exports.createPoolCluster = function(config) { - return new PoolCluster(config); -}; - -exports.createQuery = Connection.createQuery; - -exports.Types = Types; -exports.escape = SqlString.escape; -exports.escapeId = SqlString.escapeId; -exports.format = SqlString.format; diff --git a/node_modules/mysql/lib/Connection.js b/node_modules/mysql/lib/Connection.js deleted file mode 100644 index 600cbdd..0000000 --- a/node_modules/mysql/lib/Connection.js +++ /dev/null @@ -1,389 +0,0 @@ -var Crypto = require('crypto'); -var Net = require('net'); -var tls = require('tls'); -var ConnectionConfig = require('./ConnectionConfig'); -var Protocol = require('./protocol/Protocol'); -var SqlString = require('./protocol/SqlString'); -var Query = require('./protocol/sequences/Query'); -var EventEmitter = require('events').EventEmitter; -var Util = require('util'); - -module.exports = Connection; -Util.inherits(Connection, EventEmitter); -function Connection(options) { - EventEmitter.call(this); - - this.config = options.config; - - this._socket = options.socket; - this._protocol = new Protocol({config: this.config, connection: this}); - this._connectCalled = false; - this.state = "disconnected"; - this.threadId = null; -} - -function bindToCurrentDomain(callback) { - if (!callback) return; - - var domain = process.domain; - - return domain - ? domain.bind(callback) - : callback; -} - -Connection.createQuery = function(sql, values, cb) { - if (sql instanceof Query) { - return sql; - } - - var options = {}; - - if (typeof sql === 'object') { - // query(options, cb) - options = sql; - if (typeof values === 'function') { - cb = values; - } else if (typeof values !== 'undefined') { - options.values = values; - } - } else if (typeof values === 'function') { - // query(sql, cb) - cb = values; - options.sql = sql; - options.values = undefined; - } else { - // query(sql, values, cb) - options.sql = sql; - options.values = values; - } - return new Query(options, bindToCurrentDomain(cb)); -}; - -Connection.prototype.connect = function connect(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - if (!this._connectCalled) { - this._connectCalled = true; - - // Connect either via a UNIX domain socket or a TCP socket. - this._socket = (this.config.socketPath) - ? Net.createConnection(this.config.socketPath) - : Net.createConnection(this.config.port, this.config.host); - - var connection = this; - this._protocol.on('data', function(data) { - connection._socket.write(data); - }); - this._socket.on('data', function(data) { - connection._protocol.write(data); - }); - this._protocol.on('end', function() { - connection._socket.end() - }); - this._socket.on('end', function(err) { - connection._protocol.end(); - }); - - this._socket.on('error', this._handleNetworkError.bind(this)); - this._socket.on('connect', this._handleProtocolConnect.bind(this)); - this._protocol.on('handshake', this._handleProtocolHandshake.bind(this)); - this._protocol.on('unhandledError', this._handleProtocolError.bind(this)); - this._protocol.on('drain', this._handleProtocolDrain.bind(this)); - this._protocol.on('end', this._handleProtocolEnd.bind(this)); - this._protocol.on('enqueue', this._handleProtocolEnqueue.bind(this)); - - if (this.config.connectTimeout) { - var handleConnectTimeout = this._handleConnectTimeout.bind(this); - - this._socket.setTimeout(this.config.connectTimeout, handleConnectTimeout); - this._socket.once('connect', function() { - this.setTimeout(0, handleConnectTimeout); - }); - } - } - - this._protocol.handshake(options, bindToCurrentDomain(callback)); -}; - -Connection.prototype.changeUser = function changeUser(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - this._implyConnect(); - - var charsetNumber = (options.charset) - ? ConnectionConfig.getCharsetNumber(options.charset) - : this.config.charsetNumber; - - return this._protocol.changeUser({ - user : options.user || this.config.user, - password : options.password || this.config.password, - database : options.database || this.config.database, - timeout : options.timeout, - charsetNumber : charsetNumber, - currentConfig : this.config - }, bindToCurrentDomain(callback)); -}; - -Connection.prototype.beginTransaction = function beginTransaction(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - options = options || {}; - options.sql = 'START TRANSACTION'; - options.values = null; - - return this.query(options, callback); -}; - -Connection.prototype.commit = function commit(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - options = options || {}; - options.sql = 'COMMIT'; - options.values = null; - - return this.query(options, callback); -}; - -Connection.prototype.rollback = function rollback(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - options = options || {}; - options.sql = 'ROLLBACK'; - options.values = null; - - return this.query(options, callback); -}; - -Connection.prototype.query = function(sql, values, cb) { - this._implyConnect(); - - var query = Connection.createQuery(sql, values, cb); - query._connection = this; - - if (!(typeof sql == 'object' && 'typeCast' in sql)) { - query.typeCast = this.config.typeCast; - } - - query.sql = this.format(query.sql, query.values); - - return this._protocol._enqueue(query); -}; - -Connection.prototype.ping = function ping(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - this._implyConnect(); - this._protocol.ping(options, bindToCurrentDomain(callback)); -}; - -Connection.prototype.statistics = function statistics(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - this._implyConnect(); - this._protocol.stats(options, bindToCurrentDomain(callback)); -}; - -Connection.prototype.end = function end(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - this._implyConnect(); - this._protocol.quit(options, bindToCurrentDomain(callback)); -}; - -Connection.prototype.destroy = function() { - this.state = "disconnected"; - this._implyConnect(); - this._socket.destroy(); - this._protocol.destroy(); -}; - -Connection.prototype.pause = function() { - this._socket.pause(); - this._protocol.pause(); -}; - -Connection.prototype.resume = function() { - this._socket.resume(); - this._protocol.resume(); -}; - -Connection.prototype.escape = function(value) { - return SqlString.escape(value, false, this.config.timezone); -}; - -Connection.prototype.escapeId = function escapeId(value) { - return SqlString.escapeId(value, false); -}; - -Connection.prototype.format = function(sql, values) { - if (typeof this.config.queryFormat == "function") { - return this.config.queryFormat.call(this, sql, values, this.config.timezone); - } - return SqlString.format(sql, values, this.config.stringifyObjects, this.config.timezone); -}; - -if (tls.TLSSocket) { - // 0.11+ environment - Connection.prototype._startTLS = function _startTLS(onSecure) { - var secureContext = tls.createSecureContext({ - key : this.config.ssl.key, - cert : this.config.ssl.cert, - passphrase : this.config.ssl.passphrase, - ca : this.config.ssl.ca - }); - - // "unpipe" - this._socket.removeAllListeners('data'); - this._protocol.removeAllListeners('data'); - - // socket <-> encrypted - var rejectUnauthorized = this.config.ssl.rejectUnauthorized; - var secureSocket = new tls.TLSSocket(this._socket, { - rejectUnauthorized : rejectUnauthorized, - requestCert : true, - secureContext : secureContext, - isServer : false - }); - - // cleartext <-> protocol - secureSocket.pipe(this._protocol); - this._protocol.on('data', function(data) { - secureSocket.write(data); - }); - - secureSocket.on('secure', function() { - onSecure(rejectUnauthorized ? this.ssl.verifyError() : null); - }); - - // start TLS communications - secureSocket._start(); - }; -} else { - // pre-0.11 environment - Connection.prototype._startTLS = function _startTLS(onSecure) { - // before TLS: - // _socket <-> _protocol - // after: - // _socket <-> securePair.encrypted <-> securePair.cleartext <-> _protocol - - var credentials = Crypto.createCredentials({ - key : this.config.ssl.key, - cert : this.config.ssl.cert, - passphrase : this.config.ssl.passphrase, - ca : this.config.ssl.ca - }); - - var rejectUnauthorized = this.config.ssl.rejectUnauthorized; - var securePair = tls.createSecurePair(credentials, false, true, rejectUnauthorized); - - // "unpipe" - this._socket.removeAllListeners('data'); - this._protocol.removeAllListeners('data'); - - // socket <-> encrypted - securePair.encrypted.pipe(this._socket); - this._socket.on('data', function(data) { - securePair.encrypted.write(data); - }); - - // cleartext <-> protocol - securePair.cleartext.pipe(this._protocol); - this._protocol.on('data', function(data) { - securePair.cleartext.write(data); - }); - - securePair.on('secure', function() { - if (!rejectUnauthorized) { - onSecure(); - return; - } - - var verifyError = this.ssl.verifyError(); - var err = verifyError; - - // node.js 0.6 support - if (typeof err === 'string') { - err = new Error(verifyError); - err.code = verifyError; - } - - onSecure(err); - }); - }; -} - -Connection.prototype._handleConnectTimeout = function() { - if (this._socket) { - this._socket.setTimeout(0); - this._socket.destroy(); - } - - var err = new Error('connect ETIMEDOUT'); - err.errorno = 'ETIMEDOUT'; - err.code = 'ETIMEDOUT'; - err.syscall = 'connect'; - - this._handleNetworkError(err); -}; - -Connection.prototype._handleNetworkError = function(err) { - this._protocol.handleNetworkError(err); -}; - -Connection.prototype._handleProtocolError = function(err) { - this.state = "protocol_error"; - this.emit('error', err); -}; - -Connection.prototype._handleProtocolDrain = function() { - this.emit('drain'); -}; - -Connection.prototype._handleProtocolConnect = function() { - this.state = "connected"; -}; - -Connection.prototype._handleProtocolHandshake = function _handleProtocolHandshake(packet) { - this.state = "authenticated"; - this.threadId = packet.threadId; -}; - -Connection.prototype._handleProtocolEnd = function(err) { - this.state = "disconnected"; - this.emit('end', err); -}; - -Connection.prototype._handleProtocolEnqueue = function _handleProtocolEnqueue(sequence) { - this.emit('enqueue', sequence); -}; - -Connection.prototype._implyConnect = function() { - if (!this._connectCalled) { - this.connect(); - } -}; diff --git a/node_modules/mysql/lib/ConnectionConfig.js b/node_modules/mysql/lib/ConnectionConfig.js deleted file mode 100644 index 294a538..0000000 --- a/node_modules/mysql/lib/ConnectionConfig.js +++ /dev/null @@ -1,201 +0,0 @@ -var urlParse = require('url').parse; -var ClientConstants = require('./protocol/constants/client'); -var Charsets = require('./protocol/constants/charsets'); -var SSLProfiles = null; - -module.exports = ConnectionConfig; -function ConnectionConfig(options) { - if (typeof options === 'string') { - options = ConnectionConfig.parseUrl(options); - } - - this.host = options.host || 'localhost'; - this.port = options.port || 3306; - this.localAddress = options.localAddress; - this.socketPath = options.socketPath; - this.user = options.user || undefined; - this.password = options.password || undefined; - this.database = options.database; - this.connectTimeout = (options.connectTimeout === undefined) - ? (10 * 1000) - : options.connectTimeout; - this.insecureAuth = options.insecureAuth || false; - this.supportBigNumbers = options.supportBigNumbers || false; - this.bigNumberStrings = options.bigNumberStrings || false; - this.dateStrings = options.dateStrings || false; - this.debug = options.debug; - this.trace = options.trace !== false; - this.stringifyObjects = options.stringifyObjects || false; - this.timezone = options.timezone || 'local'; - this.flags = options.flags || ''; - this.queryFormat = options.queryFormat; - this.pool = options.pool || undefined; - this.ssl = (typeof options.ssl === 'string') - ? ConnectionConfig.getSSLProfile(options.ssl) - : (options.ssl || false); - this.multipleStatements = options.multipleStatements || false; - this.typeCast = (options.typeCast === undefined) - ? true - : options.typeCast; - - if (this.timezone[0] == " ") { - // "+" is a url encoded char for space so it - // gets translated to space when giving a - // connection string.. - this.timezone = "+" + this.timezone.substr(1); - } - - if (this.ssl) { - // Default rejectUnauthorized to true - this.ssl.rejectUnauthorized = this.ssl.rejectUnauthorized !== false; - } - - this.maxPacketSize = 0; - this.charsetNumber = (options.charset) - ? ConnectionConfig.getCharsetNumber(options.charset) - : options.charsetNumber||Charsets.UTF8_GENERAL_CI; - - // Set the client flags - var defaultFlags = ConnectionConfig.getDefaultFlags(options); - this.clientFlags = ConnectionConfig.mergeFlags(defaultFlags, options.flags) -} - -ConnectionConfig.mergeFlags = function mergeFlags(defaultFlags, userFlags) { - var allFlags = ConnectionConfig.parseFlagList(defaultFlags); - var newFlags = ConnectionConfig.parseFlagList(userFlags); - - // Merge the new flags - for (var flag in newFlags) { - if (allFlags[flag] !== false) { - allFlags[flag] = newFlags[flag]; - } - } - - // Build flags - var flags = 0x0; - for (var flag in allFlags) { - if (allFlags[flag]) { - // TODO: Throw here on some future release - flags |= ClientConstants['CLIENT_' + flag] || 0x0; - } - } - - return flags; -}; - -ConnectionConfig.getCharsetNumber = function getCharsetNumber(charset) { - var num = Charsets[charset.toUpperCase()]; - - if (num === undefined) { - throw new TypeError('Unknown charset \'' + charset + '\''); - } - - return num; -}; - -ConnectionConfig.getDefaultFlags = function getDefaultFlags(options) { - var defaultFlags = [ - '-COMPRESS', // Compression protocol *NOT* supported - '-CONNECT_ATTRS', // Does *NOT* send connection attributes in Protocol::HandshakeResponse41 - '+CONNECT_WITH_DB', // One can specify db on connect in Handshake Response Packet - '+FOUND_ROWS', // Send found rows instead of affected rows - '+IGNORE_SIGPIPE', // Don't issue SIGPIPE if network failures - '+IGNORE_SPACE', // Let the parser ignore spaces before '(' - '+LOCAL_FILES', // Can use LOAD DATA LOCAL - '+LONG_FLAG', // Longer flags in Protocol::ColumnDefinition320 - '+LONG_PASSWORD', // Use the improved version of Old Password Authentication - '+MULTI_RESULTS', // Can handle multiple resultsets for COM_QUERY - '+ODBC', // Special handling of ODBC behaviour - '-PLUGIN_AUTH', // Does *NOT* support auth plugins - '+PROTOCOL_41', // Uses the 4.1 protocol - '+PS_MULTI_RESULTS', // Can handle multiple resultsets for COM_STMT_EXECUTE - '+RESERVED', // Unused - '+SECURE_CONNECTION', // Supports Authentication::Native41 - '+TRANSACTIONS' // Expects status flags - ]; - - if (options && options.multipleStatements) { - // May send multiple statements per COM_QUERY and COM_STMT_PREPARE - defaultFlags.push('+MULTI_STATEMENTS'); - } - - return defaultFlags; -}; - -ConnectionConfig.getSSLProfile = function getSSLProfile(name) { - if (!SSLProfiles) { - SSLProfiles = require('./../fixtures/ssl-profiles.json'); - } - - var ssl = SSLProfiles[name]; - - if (ssl === undefined) { - throw new TypeError('Unknown SSL profile \'' + name + '\''); - } - - return ssl; -}; - -ConnectionConfig.parseFlagList = function parseFlagList(flagList) { - var allFlags = Object.create(null); - - if (!flagList) { - return allFlags; - } - - var flags = !Array.isArray(flagList) - ? String(flagList || '').toUpperCase().split(/\s*,+\s*/) - : flagList; - - for (var i = 0; i < flags.length; i++) { - var flag = flags[i]; - var offset = 1; - var state = flag[0]; - - if (state === undefined) { - // TODO: throw here on some future release - continue; - } - - if (state !== '-' && state !== '+') { - offset = 0; - state = '+'; - } - - allFlags[flag.substr(offset)] = state === '+'; - } - - return allFlags; -}; - -ConnectionConfig.parseUrl = function(url) { - url = urlParse(url, true); - - var options = { - host : url.hostname, - port : url.port, - database : url.pathname.substr(1), - }; - - if (url.auth) { - var auth = url.auth.split(':'); - options.user = auth[0]; - options.password = auth[1]; - } - - if (url.query) { - for (var key in url.query) { - var value = url.query[key]; - - try { - // Try to parse this as a JSON expression first - options[key] = JSON.parse(value); - } catch (err) { - // Otherwise assume it is a plain string - options[key] = value; - } - } - } - - return options; -}; diff --git a/node_modules/mysql/lib/Pool.js b/node_modules/mysql/lib/Pool.js deleted file mode 100644 index 57c4b3d..0000000 --- a/node_modules/mysql/lib/Pool.js +++ /dev/null @@ -1,243 +0,0 @@ -var mysql = require('../'); -var Connection = require('./Connection'); -var EventEmitter = require('events').EventEmitter; -var Util = require('util'); -var PoolConnection = require('./PoolConnection'); - -module.exports = Pool; - -Util.inherits(Pool, EventEmitter); -function Pool(options) { - EventEmitter.call(this); - this.config = options.config; - this.config.connectionConfig.pool = this; - - this._allConnections = []; - this._freeConnections = []; - this._connectionQueue = []; - this._closed = false; -} - -Pool.prototype.getConnection = function (cb) { - - if (this._closed) { - return process.nextTick(function(){ - return cb(new Error('Pool is closed.')); - }); - } - - var connection; - - if (this._freeConnections.length > 0) { - connection = this._freeConnections.shift(); - - return this.acquireConnection(connection, cb); - } - - if (this.config.connectionLimit === 0 || this._allConnections.length < this.config.connectionLimit) { - connection = new PoolConnection(this, { config: this.config.newConnectionConfig() }); - - this._allConnections.push(connection); - - return connection.connect({timeout: this.config.acquireTimeout}, function (err) { - if (this._closed) { - return cb(new Error('Pool is closed.')); - } - if (err) { - return cb(err); - } - - this.emit('connection', connection); - return cb(null, connection); - }.bind(this)); - } - - if (!this.config.waitForConnections) { - return process.nextTick(function(){ - return cb(new Error('No connections available.')); - }); - } - - this._enqueueCallback(cb); -}; - -Pool.prototype.acquireConnection = function acquireConnection(connection, cb) { - if (connection._pool !== this) { - throw new Error('Connection acquired from wrong pool.'); - } - - var pool = this; - - connection._pool = null; - connection.ping({timeout: this.config.acquireTimeout}, function(err) { - if (!err) { - connection._pool = pool; - cb(null, connection); - return; - } - - connection.destroy(); - pool._connectionQueue.unshift(cb); - pool._removeConnection(connection); - }); -}; - -Pool.prototype.releaseConnection = function releaseConnection(connection) { - var cb; - - if (connection._pool) { - if (connection._pool !== this) { - throw new Error('Connection released to wrong pool'); - } - - if (connection._purge) { - // purge connection from pool - this._purgeConnection(connection); - return; - } else if (this._freeConnections.indexOf(connection) !== -1) { - // connection already in free connection pool - // this won't catch all double-release cases - throw new Error('Connection already released'); - } else { - // add connection to end of free queue - this._freeConnections.push(connection); - } - } - - while (this._closed && this._connectionQueue.length) { - // empty the connection queue - cb = this._connectionQueue.shift(); - - process.nextTick(cb.bind(null, new Error('Pool is closed.'))); - } - - if (this._connectionQueue.length) { - cb = this._connectionQueue.shift(); - - this.getConnection(cb); - } -}; - -Pool.prototype.end = function (cb) { - this._closed = true; - - if (typeof cb != "function") { - cb = function (err) { - if (err) throw err; - }; - } - - var calledBack = false; - var closedConnections = 0; - var connection; - - var endCB = function(err) { - if (calledBack) { - return; - } - - if (err || ++closedConnections >= this._allConnections.length) { - calledBack = true; - return cb(err); - } - }.bind(this); - - if (this._allConnections.length === 0) { - return process.nextTick(endCB); - } - - while (this._allConnections.length) { - connection = this._allConnections[0]; - connection._pool = null; - connection._realEnd(endCB); - this._removeConnection(connection); - } -}; - -Pool.prototype.query = function (sql, values, cb) { - var query = Connection.createQuery(sql, values, cb); - - if (!(typeof sql === 'object' && 'typeCast' in sql)) { - query.typeCast = this.config.connectionConfig.typeCast; - } - - if (this.config.connectionConfig.trace) { - // Long stack trace support - query._callSite = new Error; - } - - this.getConnection(function (err, conn) { - if (err) { - var cb = query._callback; - cb && cb(err); - return; - } - - // Release connection based off event - query.once('end', function() { - conn.release(); - }); - - conn.query(query); - }); - - return query; -}; - -Pool.prototype._enqueueCallback = function _enqueueCallback(callback) { - - if (this.config.queueLimit && this._connectionQueue.length >= this.config.queueLimit) { - process.nextTick(function () { - var err = new Error('Queue limit reached.'); - err.code = 'POOL_ENQUEUELIMIT'; - callback(err); - }); - return; - } - - // Bind to domain, as dequeue will likely occur in a different domain - var cb = process.domain - ? process.domain.bind(callback) - : callback; - - this._connectionQueue.push(cb); - this.emit('enqueue'); -}; - -Pool.prototype._purgeConnection = function _purgeConnection(connection) { - var pool = this; - - connection._realEnd(function(err) { - if (err) { - connection.destroy(); - } - - pool._removeConnection(connection); - }); -}; - -Pool.prototype._removeConnection = function(connection) { - var index; - - connection._pool = null; - - if ((index = this._allConnections.indexOf(connection)) !== -1) { - // Remove connection from all connections - this._allConnections.splice(index, 1); - } - - if ((index = this._freeConnections.indexOf(connection)) !== -1) { - // Remove connection from free connections - this._freeConnections.splice(index, 1); - } - - this.releaseConnection(connection); -}; - -Pool.prototype.escape = function(value) { - return mysql.escape(value, this.config.connectionConfig.stringifyObjects, this.config.connectionConfig.timezone); -}; - -Pool.prototype.escapeId = function escapeId(value) { - return mysql.escapeId(value, false); -}; diff --git a/node_modules/mysql/lib/PoolConfig.js b/node_modules/mysql/lib/PoolConfig.js deleted file mode 100644 index 8c5017a..0000000 --- a/node_modules/mysql/lib/PoolConfig.js +++ /dev/null @@ -1,32 +0,0 @@ - -var ConnectionConfig = require('./ConnectionConfig'); - -module.exports = PoolConfig; -function PoolConfig(options) { - if (typeof options === 'string') { - options = ConnectionConfig.parseUrl(options); - } - - this.acquireTimeout = (options.acquireTimeout === undefined) - ? 10 * 1000 - : Number(options.acquireTimeout); - this.connectionConfig = new ConnectionConfig(options); - this.waitForConnections = (options.waitForConnections === undefined) - ? true - : Boolean(options.waitForConnections); - this.connectionLimit = (options.connectionLimit === undefined) - ? 10 - : Number(options.connectionLimit); - this.queueLimit = (options.queueLimit === undefined) - ? 0 - : Number(options.queueLimit); -} - -PoolConfig.prototype.newConnectionConfig = function newConnectionConfig() { - var connectionConfig = new ConnectionConfig(this.connectionConfig); - - connectionConfig.clientFlags = this.connectionConfig.clientFlags; - connectionConfig.maxPacketSize = this.connectionConfig.maxPacketSize; - - return connectionConfig; -}; diff --git a/node_modules/mysql/lib/protocol/Auth.js b/node_modules/mysql/lib/protocol/Auth.js deleted file mode 100644 index edf2f25..0000000 --- a/node_modules/mysql/lib/protocol/Auth.js +++ /dev/null @@ -1,165 +0,0 @@ -var Buffer = require('buffer').Buffer; -var Crypto = require('crypto'); -var Auth = exports; - -function sha1(msg) { - var hash = Crypto.createHash('sha1'); - hash.update(msg, 'binary'); - return hash.digest('binary'); -} -Auth.sha1 = sha1; - -function xor(a, b) { - a = new Buffer(a, 'binary'); - b = new Buffer(b, 'binary'); - var result = new Buffer(a.length); - for (var i = 0; i < a.length; i++) { - result[i] = (a[i] ^ b[i]); - } - return result; -}; -Auth.xor = xor; - -Auth.token = function(password, scramble) { - if (!password) { - return new Buffer(0); - } - - // password must be in binary format, not utf8 - var stage1 = sha1((new Buffer(password, "utf8")).toString("binary")); - var stage2 = sha1(stage1); - var stage3 = sha1(scramble.toString('binary') + stage2); - return xor(stage3, stage1); -}; - -// This is a port of sql/password.c:hash_password which needs to be used for -// pre-4.1 passwords. -Auth.hashPassword = function(password) { - var nr = [0x5030, 0x5735], - add = 7, - nr2 = [0x1234, 0x5671], - result = new Buffer(8); - - if (typeof password == 'string'){ - password = new Buffer(password); - } - - for (var i = 0; i < password.length; i++) { - var c = password[i]; - if (c == 32 || c == 9) { - // skip space in password - continue; - } - - // nr^= (((nr & 63)+add)*c)+ (nr << 8); - // nr = xor(nr, add(mul(add(and(nr, 63), add), c), shl(nr, 8))) - nr = this.xor32(nr, this.add32(this.mul32(this.add32(this.and32(nr, [0,63]), [0,add]), [0,c]), this.shl32(nr, 8))); - - // nr2+=(nr2 << 8) ^ nr; - // nr2 = add(nr2, xor(shl(nr2, 8), nr)) - nr2 = this.add32(nr2, this.xor32(this.shl32(nr2, 8), nr)); - - // add+=tmp; - add += c; - } - - this.int31Write(result, nr, 0); - this.int31Write(result, nr2, 4); - - return result; -}; - -Auth.randomInit = function(seed1, seed2) { - return { - max_value: 0x3FFFFFFF, - max_value_dbl: 0x3FFFFFFF, - seed1: seed1 % 0x3FFFFFFF, - seed2: seed2 % 0x3FFFFFFF - }; -}; - -Auth.myRnd = function(r){ - r.seed1 = (r.seed1 * 3 + r.seed2) % r.max_value; - r.seed2 = (r.seed1 + r.seed2 + 33) % r.max_value; - - return r.seed1 / r.max_value_dbl; -}; - -Auth.scramble323 = function(message, password) { - var to = new Buffer(8), - hashPass = this.hashPassword(password), - hashMessage = this.hashPassword(message.slice(0, 8)), - seed1 = this.int32Read(hashPass, 0) ^ this.int32Read(hashMessage, 0), - seed2 = this.int32Read(hashPass, 4) ^ this.int32Read(hashMessage, 4), - r = this.randomInit(seed1, seed2); - - for (var i = 0; i < 8; i++){ - to[i] = Math.floor(this.myRnd(r) * 31) + 64; - } - var extra = (Math.floor(this.myRnd(r) * 31)); - - for (var i = 0; i < 8; i++){ - to[i] ^= extra; - } - - return to; -}; - -Auth.fmt32 = function(x){ - var a = x[0].toString(16), - b = x[1].toString(16); - - if (a.length == 1) a = '000'+a; - if (a.length == 2) a = '00'+a; - if (a.length == 3) a = '0'+a; - if (b.length == 1) b = '000'+b; - if (b.length == 2) b = '00'+b; - if (b.length == 3) b = '0'+b; - return '' + a + '/' + b; -}; - -Auth.xor32 = function(a,b){ - return [a[0] ^ b[0], a[1] ^ b[1]]; -}; - -Auth.add32 = function(a,b){ - var w1 = a[1] + b[1], - w2 = a[0] + b[0] + ((w1 & 0xFFFF0000) >> 16); - - return [w2 & 0xFFFF, w1 & 0xFFFF]; -}; - -Auth.mul32 = function(a,b){ - // based on this example of multiplying 32b ints using 16b - // http://www.dsprelated.com/showmessage/89790/1.php - var w1 = a[1] * b[1], - w2 = (((a[1] * b[1]) >> 16) & 0xFFFF) + ((a[0] * b[1]) & 0xFFFF) + (a[1] * b[0] & 0xFFFF); - - return [w2 & 0xFFFF, w1 & 0xFFFF]; -}; - -Auth.and32 = function(a,b){ - return [a[0] & b[0], a[1] & b[1]]; -}; - -Auth.shl32 = function(a,b){ - // assume b is 16 or less - var w1 = a[1] << b, - w2 = (a[0] << b) | ((w1 & 0xFFFF0000) >> 16); - - return [w2 & 0xFFFF, w1 & 0xFFFF]; -}; - -Auth.int31Write = function(buffer, number, offset) { - buffer[offset] = (number[0] >> 8) & 0x7F; - buffer[offset + 1] = (number[0]) & 0xFF; - buffer[offset + 2] = (number[1] >> 8) & 0xFF; - buffer[offset + 3] = (number[1]) & 0xFF; -}; - -Auth.int32Read = function(buffer, offset){ - return (buffer[offset] << 24) - + (buffer[offset+1] << 16) - + (buffer[offset+2] << 8) - + (buffer[offset+3]); -}; diff --git a/node_modules/mysql/lib/protocol/PacketHeader.js b/node_modules/mysql/lib/protocol/PacketHeader.js deleted file mode 100644 index 1bb282e..0000000 --- a/node_modules/mysql/lib/protocol/PacketHeader.js +++ /dev/null @@ -1,5 +0,0 @@ -module.exports = PacketHeader; -function PacketHeader(length, number) { - this.length = length; - this.number = number; -} diff --git a/node_modules/mysql/lib/protocol/PacketWriter.js b/node_modules/mysql/lib/protocol/PacketWriter.js deleted file mode 100644 index 7de4e5a..0000000 --- a/node_modules/mysql/lib/protocol/PacketWriter.js +++ /dev/null @@ -1,197 +0,0 @@ -var BIT_16 = Math.pow(2, 16); -var BIT_24 = Math.pow(2, 24); -// The maximum precision JS Numbers can hold precisely -// Don't panic: Good enough to represent byte values up to 8192 TB -var IEEE_754_BINARY_64_PRECISION = Math.pow(2, 53); -var MAX_PACKET_LENGTH = Math.pow(2, 24) - 1; - -module.exports = PacketWriter; -function PacketWriter() { - this._buffer = new Buffer(0); - this._offset = 0; -} - -PacketWriter.prototype.toBuffer = function(parser) { - var packets = Math.floor(this._buffer.length / MAX_PACKET_LENGTH) + 1; - var buffer = this._buffer; - this._buffer = new Buffer(this._buffer.length + packets * 4); - - for (var packet = 0; packet < packets; packet++) { - this._offset = packet * (MAX_PACKET_LENGTH + 4); - - var isLast = (packet + 1 === packets); - var packetLength = (isLast) - ? buffer.length % MAX_PACKET_LENGTH - : MAX_PACKET_LENGTH; - - var packetNumber = parser.incrementPacketNumber(); - - this.writeUnsignedNumber(3, packetLength); - this.writeUnsignedNumber(1, packetNumber); - - var start = packet * MAX_PACKET_LENGTH; - var end = start + packetLength; - - this.writeBuffer(buffer.slice(start, end)); - } - - return this._buffer; -}; - -PacketWriter.prototype.writeUnsignedNumber = function(bytes, value) { - this._allocate(bytes); - - for (var i = 0; i < bytes; i++) { - this._buffer[this._offset++] = (value >> (i * 8)) & 0xff; - } -}; - -PacketWriter.prototype.writeFiller = function(bytes) { - this._allocate(bytes); - - for (var i = 0; i < bytes; i++) { - this._buffer[this._offset++] = 0x00; - } -}; - -PacketWriter.prototype.writeNullTerminatedString = function(value, encoding) { - // Typecast undefined into '' and numbers into strings - value = value || ''; - value = value + ''; - - var bytes = Buffer.byteLength(value, encoding || 'utf-8') + 1; - this._allocate(bytes); - - this._buffer.write(value, this._offset, encoding); - this._buffer[this._offset + bytes - 1] = 0x00; - - this._offset += bytes; -}; - -PacketWriter.prototype.writeString = function(value) { - // Typecast undefined into '' and numbers into strings - value = value || ''; - value = value + ''; - - var bytes = Buffer.byteLength(value, 'utf-8'); - this._allocate(bytes); - - this._buffer.write(value, this._offset, 'utf-8'); - - this._offset += bytes; -}; - -PacketWriter.prototype.writeBuffer = function(value) { - var bytes = value.length; - - this._allocate(bytes); - value.copy(this._buffer, this._offset); - this._offset += bytes; -}; - -PacketWriter.prototype.writeLengthCodedNumber = function(value) { - if (value === null) { - this._allocate(1); - this._buffer[this._offset++] = 251; - return; - } - - if (value <= 250) { - this._allocate(1); - this._buffer[this._offset++] = value; - return; - } - - if (value > IEEE_754_BINARY_64_PRECISION) { - throw new Error( - 'writeLengthCodedNumber: JS precision range exceeded, your ' + - 'number is > 53 bit: "' + value + '"' - ); - } - - if (value <= BIT_16) { - this._allocate(3) - this._buffer[this._offset++] = 252; - } else if (value <= BIT_24) { - this._allocate(4) - this._buffer[this._offset++] = 253; - } else { - this._allocate(9); - this._buffer[this._offset++] = 254; - } - - // 16 Bit - this._buffer[this._offset++] = value & 0xff; - this._buffer[this._offset++] = (value >> 8) & 0xff; - - if (value <= BIT_16) return; - - // 24 Bit - this._buffer[this._offset++] = (value >> 16) & 0xff; - - if (value <= BIT_24) return; - - this._buffer[this._offset++] = (value >> 24) & 0xff; - - // Hack: Get the most significant 32 bit (JS bitwise operators are 32 bit) - value = value.toString(2); - value = value.substr(0, value.length - 32); - value = parseInt(value, 2); - - this._buffer[this._offset++] = value & 0xff; - this._buffer[this._offset++] = (value >> 8) & 0xff; - this._buffer[this._offset++] = (value >> 16) & 0xff; - - // Set last byte to 0, as we can only support 53 bits in JS (see above) - this._buffer[this._offset++] = 0; -}; - -PacketWriter.prototype.writeLengthCodedBuffer = function(value) { - var bytes = value.length; - this.writeLengthCodedNumber(bytes); - this.writeBuffer(value); -}; - -PacketWriter.prototype.writeNullTerminatedBuffer = function(value) { - this.writeBuffer(value); - this.writeFiller(1); // 0x00 terminator -}; - -PacketWriter.prototype.writeLengthCodedString = function(value) { - if (value === null) { - this.writeLengthCodedNumber(null); - return; - } - - value = (value === undefined) - ? '' - : String(value); - - var bytes = Buffer.byteLength(value, 'utf-8'); - this.writeLengthCodedNumber(bytes); - - if (!bytes) { - return; - } - - this._allocate(bytes); - this._buffer.write(value, this._offset, 'utf-8'); - this._offset += bytes; -}; - -PacketWriter.prototype._allocate = function(bytes) { - if (!this._buffer) { - this._buffer = new Buffer(bytes); - return; - } - - var bytesRemaining = this._buffer.length - this._offset; - if (bytesRemaining >= bytes) { - return; - } - - var oldBuffer = this._buffer; - - this._buffer = new Buffer(oldBuffer.length + bytes); - oldBuffer.copy(this._buffer); -}; diff --git a/node_modules/mysql/lib/protocol/Parser.js b/node_modules/mysql/lib/protocol/Parser.js deleted file mode 100644 index a00ccd0..0000000 --- a/node_modules/mysql/lib/protocol/Parser.js +++ /dev/null @@ -1,412 +0,0 @@ -var MAX_PACKET_LENGTH = Math.pow(2, 24) - 1; -var MUL_32BIT = Math.pow(2, 32); -var PacketHeader = require('./PacketHeader'); -var BigNumber = require('bignumber.js'); - -module.exports = Parser; -function Parser(options) { - options = options || {}; - - this._supportBigNumbers = options.config && options.config.supportBigNumbers; - this._buffer = new Buffer(0); - this._longPacketBuffers = []; - this._offset = 0; - this._packetEnd = null; - this._packetHeader = null; - this._packetOffset = null; - this._onError = options.onError || function(err) { throw err; }; - this._onPacket = options.onPacket || function() {}; - this._nextPacketNumber = 0; - this._encoding = 'utf-8'; - this._paused = false; -} - -Parser.prototype.write = function(buffer) { - this.append(buffer); - - while (true) { - if (this._paused) { - return; - } - - if (!this._packetHeader) { - if (this._bytesRemaining() < 4) { - break; - } - - this._packetHeader = new PacketHeader( - this.parseUnsignedNumber(3), - this.parseUnsignedNumber(1) - ); - - if (this._packetHeader.number !== this._nextPacketNumber) { - var err = new Error( - 'Packets out of order. Got: ' + this._packetHeader.number + ' ' + - 'Expected: ' + this._nextPacketNumber - ); - - err.code = 'PROTOCOL_PACKETS_OUT_OF_ORDER'; - err.fatal = true; - - this._onError(err); - } - - this.incrementPacketNumber(); - } - - if (this._bytesRemaining() < this._packetHeader.length) { - break; - } - - this._packetEnd = this._offset + this._packetHeader.length; - this._packetOffset = this._offset; - - if (this._packetHeader.length === MAX_PACKET_LENGTH) { - this._longPacketBuffers.push(this._buffer.slice(this._packetOffset, this._packetEnd)); - - this._advanceToNextPacket(); - continue; - } - - this._combineLongPacketBuffers(); - - // Try...finally to ensure exception safety. Unfortunately this is costing - // us up to ~10% performance in some benchmarks. - var hadException = true; - try { - this._onPacket(this._packetHeader); - hadException = false; - } catch (err) { - if (typeof err.code !== 'string' || err.code.substr(0, 7) !== 'PARSER_') { - // Rethrow unknown errors - throw err; - } - - // Pass down parser errors - this._onError(err); - hadException = false; - } finally { - this._advanceToNextPacket(); - - // If we had an exception, the parser while loop will be broken out - // of after the finally block. So we need to make sure to re-enter it - // to continue parsing any bytes that may already have been received. - if (hadException) { - process.nextTick(this.write.bind(this)); - } - } - } -}; - -Parser.prototype.append = function(newBuffer) { - // If resume() is called, we don't pass a buffer to write() - if (!newBuffer) { - return; - } - - var oldBuffer = this._buffer; - var bytesRemaining = this._bytesRemaining(); - var newLength = bytesRemaining + newBuffer.length; - - var combinedBuffer = (this._offset > newLength) - ? oldBuffer.slice(0, newLength) - : new Buffer(newLength); - - oldBuffer.copy(combinedBuffer, 0, this._offset); - newBuffer.copy(combinedBuffer, bytesRemaining); - - this._buffer = combinedBuffer; - this._offset = 0; -}; - -Parser.prototype.pause = function() { - this._paused = true; -}; - -Parser.prototype.resume = function() { - this._paused = false; - - // nextTick() to avoid entering write() multiple times within the same stack - // which would cause problems as write manipulates the state of the object. - process.nextTick(this.write.bind(this)); -}; - -Parser.prototype.peak = function() { - return this._buffer[this._offset]; -}; - -Parser.prototype.parseUnsignedNumber = function(bytes) { - if (bytes === 1) { - return this._buffer[this._offset++]; - } - - var buffer = this._buffer; - var offset = this._offset + bytes - 1; - var value = 0; - - if (bytes > 4) { - var err = new Error('parseUnsignedNumber: Supports only up to 4 bytes'); - err.offset = (this._offset - this._packetOffset - 1); - err.code = 'PARSER_UNSIGNED_TOO_LONG'; - throw err; - } - - while (offset >= this._offset) { - value = ((value << 8) | buffer[offset]) >>> 0; - offset--; - } - - this._offset += bytes; - - return value; -}; - -Parser.prototype.parseLengthCodedString = function() { - var length = this.parseLengthCodedNumber(); - - if (length === null) { - return null; - } - - return this.parseString(length); -}; - -Parser.prototype.parseLengthCodedBuffer = function() { - var length = this.parseLengthCodedNumber(); - - if (length === null) { - return null; - } - - return this.parseBuffer(length); -}; - -Parser.prototype.parseLengthCodedNumber = function parseLengthCodedNumber() { - if (this._offset >= this._buffer.length) { - var err = new Error('Parser: read past end'); - err.offset = (this._offset - this._packetOffset); - err.code = 'PARSER_READ_PAST_END'; - throw err; - } - - var bits = this._buffer[this._offset++]; - - if (bits <= 250) { - return bits; - } - - switch (bits) { - case 251: - return null; - case 252: - return this.parseUnsignedNumber(2); - case 253: - return this.parseUnsignedNumber(3); - case 254: - break; - default: - var err = new Error('Unexpected first byte' + (bits ? ': 0x' + bits.toString(16) : '')); - err.offset = (this._offset - this._packetOffset - 1); - err.code = 'PARSER_BAD_LENGTH_BYTE'; - throw err; - } - - var low = this.parseUnsignedNumber(4); - var high = this.parseUnsignedNumber(4); - var value; - - if (high >>> 21) { - value = (new BigNumber(low)).plus((new BigNumber(MUL_32BIT)).times(high)).toString(); - - if (this._supportBigNumbers) { - return value; - } - - var err = new Error( - 'parseLengthCodedNumber: JS precision range exceeded, ' + - 'number is >= 53 bit: "' + value + '"' - ); - err.offset = (this._offset - this._packetOffset - 8); - err.code = 'PARSER_JS_PRECISION_RANGE_EXCEEDED'; - throw err; - } - - value = low + (MUL_32BIT * high); - - return value; -}; - -Parser.prototype.parseFiller = function(length) { - return this.parseBuffer(length); -}; - -Parser.prototype.parseNullTerminatedBuffer = function() { - var end = this._nullByteOffset(); - var value = this._buffer.slice(this._offset, end); - this._offset = end + 1; - - return value; -}; - -Parser.prototype.parseNullTerminatedString = function() { - var end = this._nullByteOffset(); - var value = this._buffer.toString(this._encoding, this._offset, end); - this._offset = end + 1; - - return value; -}; - -Parser.prototype._nullByteOffset = function() { - var offset = this._offset; - - while (this._buffer[offset] !== 0x00) { - offset++; - - if (offset >= this._buffer.length) { - var err = new Error('Offset of null terminated string not found.'); - err.offset = (this._offset - this._packetOffset); - err.code = 'PARSER_MISSING_NULL_BYTE'; - throw err; - } - } - - return offset; -}; - -Parser.prototype.parsePacketTerminatedString = function() { - var length = this._packetEnd - this._offset; - return this.parseString(length); -}; - -Parser.prototype.parseBuffer = function(length) { - var response = new Buffer(length); - this._buffer.copy(response, 0, this._offset, this._offset + length); - - this._offset += length; - return response; -}; - -Parser.prototype.parseString = function(length) { - var offset = this._offset; - var end = offset + length; - var value = this._buffer.toString(this._encoding, offset, end); - - this._offset = end; - return value; -}; - -Parser.prototype.parseGeometryValue = function() { - var buffer = this.parseLengthCodedBuffer(); - var offset = 4; - - if (buffer === null || !buffer.length) { - return null; - } - - function parseGeometry() { - var result = null; - var byteOrder = buffer.readUInt8(offset); offset += 1; - var wkbType = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; - switch(wkbType) { - case 1: // WKBPoint - var x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - var y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - result = {x: x, y: y}; - break; - case 2: // WKBLineString - var numPoints = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; - result = []; - for(var i=numPoints;i>0;i--) { - var x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - var y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - result.push({x: x, y: y}); - } - break; - case 3: // WKBPolygon - var numRings = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; - result = []; - for(var i=numRings;i>0;i--) { - var numPoints = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; - var line = []; - for(var j=numPoints;j>0;j--) { - var x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - var y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; - line.push({x: x, y: y}); - } - result.push(line); - } - break; - case 4: // WKBMultiPoint - case 5: // WKBMultiLineString - case 6: // WKBMultiPolygon - case 7: // WKBGeometryCollection - var num = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; - var result = []; - for(var i=num;i>0;i--) { - result.push(parseGeometry()); - } - break; - } - return result; - } - return parseGeometry(); -}; - -Parser.prototype.reachedPacketEnd = function() { - return this._offset === this._packetEnd; -}; - -Parser.prototype._bytesRemaining = function() { - return this._buffer.length - this._offset; -}; - -Parser.prototype.incrementPacketNumber = function() { - var currentPacketNumber = this._nextPacketNumber; - this._nextPacketNumber = (this._nextPacketNumber + 1) % 256; - - return currentPacketNumber; -}; - -Parser.prototype.resetPacketNumber = function() { - this._nextPacketNumber = 0; -}; - -Parser.prototype.packetLength = function() { - return this._longPacketBuffers.reduce(function(length, buffer) { - return length + buffer.length; - }, this._packetHeader.length); -}; - -Parser.prototype._combineLongPacketBuffers = function() { - if (!this._longPacketBuffers.length) { - return; - } - - var trailingPacketBytes = this._buffer.length - this._packetEnd; - - var length = this._longPacketBuffers.reduce(function(length, buffer) { - return length + buffer.length; - }, this._bytesRemaining()); - - var combinedBuffer = new Buffer(length); - - var offset = this._longPacketBuffers.reduce(function(offset, buffer) { - buffer.copy(combinedBuffer, offset); - return offset + buffer.length; - }, 0); - - this._buffer.copy(combinedBuffer, offset, this._offset); - - this._buffer = combinedBuffer; - this._longPacketBuffers = []; - this._offset = 0; - this._packetEnd = this._buffer.length - trailingPacketBytes; - this._packetOffset = 0; -}; - -Parser.prototype._advanceToNextPacket = function() { - this._offset = this._packetEnd; - this._packetHeader = null; - this._packetEnd = null; - this._packetOffset = null; -}; diff --git a/node_modules/mysql/lib/protocol/Protocol.js b/node_modules/mysql/lib/protocol/Protocol.js deleted file mode 100644 index 35bf0ef..0000000 --- a/node_modules/mysql/lib/protocol/Protocol.js +++ /dev/null @@ -1,446 +0,0 @@ -var Parser = require('./Parser'); -var Sequences = require('./sequences'); -var Packets = require('./packets'); -var Timers = require('timers'); -var Stream = require('stream').Stream; -var Util = require('util'); -var PacketWriter = require('./PacketWriter'); - -module.exports = Protocol; -Util.inherits(Protocol, Stream); -function Protocol(options) { - Stream.call(this); - - options = options || {}; - - this.readable = true; - this.writable = true; - - this._config = options.config || {}; - this._connection = options.connection; - this._callback = null; - this._fatalError = null; - this._quitSequence = null; - this._handshakeSequence = null; - this._handshaked = false; - this._ended = false; - this._destroyed = false; - this._queue = []; - this._handshakeInitializationPacket = null; - - this._parser = new Parser({ - onError : this.handleParserError.bind(this), - onPacket : this._parsePacket.bind(this), - config : this._config - }); -} - -Protocol.prototype.write = function(buffer) { - this._parser.write(buffer); - return true; -}; - -Protocol.prototype.handshake = function handshake(options, callback) { - if (typeof options === 'function') { - callback = options; - options = {}; - } - - options = options || {}; - options.config = this._config; - - return this._handshakeSequence = this._enqueue(new Sequences.Handshake(options, callback)); -}; - -Protocol.prototype.query = function query(options, callback) { - return this._enqueue(new Sequences.Query(options, callback)); -}; - -Protocol.prototype.changeUser = function changeUser(options, callback) { - return this._enqueue(new Sequences.ChangeUser(options, callback)); -}; - -Protocol.prototype.ping = function ping(options, callback) { - if (typeof options === 'function') { - callback = options; - options = {}; - } - - return this._enqueue(new Sequences.Ping(options, callback)); -}; - -Protocol.prototype.stats = function stats(options, callback) { - if (typeof options === 'function') { - callback = options; - options = {}; - } - - return this._enqueue(new Sequences.Statistics(options, callback)); -}; - -Protocol.prototype.quit = function quit(options, callback) { - if (typeof options === 'function') { - callback = options; - options = {}; - } - - return this._quitSequence = this._enqueue(new Sequences.Quit(options, callback)); -}; - -Protocol.prototype.end = function() { - if(this._ended) { - return; - } - this._ended = true; - - var expected = (this._quitSequence && this._queue[0] === this._quitSequence); - if (expected) { - this._quitSequence.end(); - this.emit('end'); - return; - } - - var err = new Error('Connection lost: The server closed the connection.'); - err.fatal = true; - err.code = 'PROTOCOL_CONNECTION_LOST'; - - this._delegateError(err); -}; - -Protocol.prototype.pause = function() { - this._parser.pause(); - // Since there is a file stream in query, we must transmit pause/resume event to current sequence. - var seq = this._queue[0]; - if (seq && seq.emit) { - seq.emit('pause'); - } -}; - -Protocol.prototype.resume = function() { - this._parser.resume(); - // Since there is a file stream in query, we must transmit pause/resume event to current sequence. - var seq = this._queue[0]; - if (seq && seq.emit) { - seq.emit('resume'); - } -}; - -Protocol.prototype._enqueue = function(sequence) { - if (!this._validateEnqueue(sequence)) { - return sequence; - } - - if (this._config.trace) { - // Long stack trace support - sequence._callSite = sequence._callSite || new Error; - } - - this._queue.push(sequence); - this.emit('enqueue', sequence); - - var self = this; - sequence - .on('error', function(err) { - self._delegateError(err, sequence); - }) - .on('packet', function(packet) { - Timers.active(sequence); - self._emitPacket(packet); - }) - .on('end', function() { - self._dequeue(sequence); - }) - .on('timeout', function() { - var err = new Error(sequence.constructor.name + ' inactivity timeout'); - - err.code = 'PROTOCOL_SEQUENCE_TIMEOUT'; - err.fatal = true; - err.timeout = sequence._timeout; - - self._delegateError(err, sequence); - }) - .on('start-tls', function() { - Timers.active(sequence); - self._connection._startTLS(function(err) { - if (err) { - // SSL negotiation error are fatal - err.code = 'HANDSHAKE_SSL_ERROR'; - err.fatal = true; - sequence.end(err); - return - } - - Timers.active(sequence); - sequence._tlsUpgradeCompleteHandler(); - }) - }); - - if (this._queue.length === 1) { - this._parser.resetPacketNumber(); - this._startSequence(sequence); - } - - return sequence; -}; - -Protocol.prototype._validateEnqueue = function(sequence) { - var err; - var prefix = 'Cannot enqueue ' + sequence.constructor.name; - var prefixBefore = prefix + ' before '; - var prefixAfter = prefix + ' after '; - - if (this._fatalError) { - err = new Error(prefixAfter + 'fatal error.'); - err.code = 'PROTOCOL_ENQUEUE_AFTER_FATAL_ERROR'; - } else if (this._quitSequence) { - err = new Error(prefixAfter + 'invoking quit.'); - err.code = 'PROTOCOL_ENQUEUE_AFTER_QUIT'; - } else if (this._destroyed) { - err = new Error(prefixAfter + 'being destroyed.'); - err.code = 'PROTOCOL_ENQUEUE_AFTER_DESTROY'; - } else if (this._handshakeSequence && sequence.constructor === Sequences.Handshake) { - err = new Error(prefixAfter + 'already enqueuing a Handshake.'); - err.code = 'PROTOCOL_ENQUEUE_HANDSHAKE_TWICE'; - } else if (!this._handshakeSequence && sequence.constructor === Sequences.ChangeUser) { - err = new Error(prefixBefore + 'a Handshake.'); - err.code = 'PROTOCOL_ENQUEUE_BEFORE_HANDSHAKE'; - } else { - return true; - } - - var self = this; - err.fatal = false; - - sequence - .on('error', function(err) { - self._delegateError(err, sequence); - }) - .end(err); - - return false; -}; - -Protocol.prototype._parsePacket = function() { - var sequence = this._queue[0]; - - if (!sequence) { - var err = new Error('Received packet with no active sequence.'); - err.code = 'PROTOCOL_STRAY_PACKET'; - err.fatal = true; - - this._delegateError(err); - return; - } - - var Packet = this._determinePacket(sequence); - var packet = new Packet({protocol41: this._config.protocol41}); - var packetName = Packet.name; - - // Special case: Faster dispatch, and parsing done inside sequence - if (Packet === Packets.RowDataPacket) { - sequence.RowDataPacket(packet, this._parser, this._connection); - - if (this._config.debug) { - this._debugPacket(true, packet); - } - - return; - } - - if (this._config.debug) { - this._parsePacketDebug(packet); - } else { - packet.parse(this._parser); - } - - if (Packet === Packets.HandshakeInitializationPacket) { - this._handshakeInitializationPacket = packet; - } - - Timers.active(sequence); - - if (!sequence[packetName]) { - var err = new Error('Received packet in the wrong sequence.'); - err.code = 'PROTOCOL_INCORRECT_PACKET_SEQUENCE'; - err.fatal = true; - - this._delegateError(err); - return; - } - - sequence[packetName](packet); -}; - -Protocol.prototype._parsePacketDebug = function _parsePacketDebug(packet) { - try { - packet.parse(this._parser); - } finally { - this._debugPacket(true, packet); - } -}; - -Protocol.prototype._emitPacket = function(packet) { - var packetWriter = new PacketWriter(); - packet.write(packetWriter); - this.emit('data', packetWriter.toBuffer(this._parser)); - - if (this._config.debug) { - this._debugPacket(false, packet); - } -}; - -Protocol.prototype._determinePacket = function(sequence) { - var firstByte = this._parser.peak(); - - if (sequence.determinePacket) { - var Packet = sequence.determinePacket(firstByte, this._parser); - if (Packet) { - return Packet; - } - } - - switch (firstByte) { - case 0x00: - if (!this._handshaked) { - this._handshaked = true; - this.emit('handshake', this._handshakeInitializationPacket); - } - return Packets.OkPacket; - case 0xfe: return Packets.EofPacket; - case 0xff: return Packets.ErrorPacket; - } - - throw new Error('Could not determine packet, firstByte = ' + firstByte); -}; - -Protocol.prototype._dequeue = function(sequence) { - Timers.unenroll(sequence); - - // No point in advancing the queue, we are dead - if (this._fatalError) { - return; - } - - this._queue.shift(); - - var sequence = this._queue[0]; - if (!sequence) { - this.emit('drain'); - return; - } - - this._parser.resetPacketNumber(); - - this._startSequence(sequence); -}; - -Protocol.prototype._startSequence = function(sequence) { - if (sequence._timeout > 0 && isFinite(sequence._timeout)) { - Timers.enroll(sequence, sequence._timeout); - Timers.active(sequence); - } - - if (sequence.constructor === Sequences.ChangeUser) { - sequence.start(this._handshakeInitializationPacket); - } else { - sequence.start(); - } -}; - -Protocol.prototype.handleNetworkError = function(err) { - err.fatal = true; - - var sequence = this._queue[0]; - if (sequence) { - sequence.end(err); - } else { - this._delegateError(err); - } -}; - -Protocol.prototype.handleParserError = function handleParserError(err) { - var sequence = this._queue[0]; - if (sequence) { - sequence.end(err); - } else { - this._delegateError(err); - } -}; - -Protocol.prototype._delegateError = function(err, sequence) { - // Stop delegating errors after the first fatal error - if (this._fatalError) { - return; - } - - if (err.fatal) { - this._fatalError = err; - } - - if (this._shouldErrorBubbleUp(err, sequence)) { - // Can't use regular 'error' event here as that always destroys the pipe - // between socket and protocol which is not what we want (unless the - // exception was fatal). - this.emit('unhandledError', err); - } else if (err.fatal) { - // Send fatal error to all sequences in the queue - var queue = this._queue; - process.nextTick(function () { - queue.forEach(function (sequence) { - sequence.end(err); - }); - queue.length = 0; - }); - } - - // Make sure the stream we are piping to is getting closed - if (err.fatal) { - this.emit('end', err); - } -}; - -Protocol.prototype._shouldErrorBubbleUp = function(err, sequence) { - if (sequence) { - if (sequence.hasErrorHandler()) { - return false; - } else if (!err.fatal) { - return true; - } - } - - return (err.fatal && !this._hasPendingErrorHandlers()); -}; - -Protocol.prototype._hasPendingErrorHandlers = function() { - return this._queue.some(function(sequence) { - return sequence.hasErrorHandler(); - }); -}; - -Protocol.prototype.destroy = function() { - this._destroyed = true; - this._parser.pause(); - - if (this._connection.state !== "disconnected") { - if(!this._ended) { - this.end(); - } - } -}; - -Protocol.prototype._debugPacket = function(incoming, packet) { - var headline = (incoming) - ? '<-- ' - : '--> '; - - headline = headline + packet.constructor.name; - - // check for debug packet restriction - if (Array.isArray(this._config.debug) && this._config.debug.indexOf(packet.constructor.name) === -1) { - return; - } - - console.log(headline); - console.log(packet); - console.log(''); -}; diff --git a/node_modules/mysql/lib/protocol/ResultSet.js b/node_modules/mysql/lib/protocol/ResultSet.js deleted file mode 100644 index f58d74f..0000000 --- a/node_modules/mysql/lib/protocol/ResultSet.js +++ /dev/null @@ -1,7 +0,0 @@ -module.exports = ResultSet; -function ResultSet(resultSetHeaderPacket) { - this.resultSetHeaderPacket = resultSetHeaderPacket; - this.fieldPackets = []; - this.eofPackets = []; - this.rows = []; -} diff --git a/node_modules/mysql/lib/protocol/constants/charsets.js b/node_modules/mysql/lib/protocol/constants/charsets.js deleted file mode 100644 index 98b88ea..0000000 --- a/node_modules/mysql/lib/protocol/constants/charsets.js +++ /dev/null @@ -1,262 +0,0 @@ -exports.BIG5_CHINESE_CI = 1; -exports.LATIN2_CZECH_CS = 2; -exports.DEC8_SWEDISH_CI = 3; -exports.CP850_GENERAL_CI = 4; -exports.LATIN1_GERMAN1_CI = 5; -exports.HP8_ENGLISH_CI = 6; -exports.KOI8R_GENERAL_CI = 7; -exports.LATIN1_SWEDISH_CI = 8; -exports.LATIN2_GENERAL_CI = 9; -exports.SWE7_SWEDISH_CI = 10; -exports.ASCII_GENERAL_CI = 11; -exports.UJIS_JAPANESE_CI = 12; -exports.SJIS_JAPANESE_CI = 13; -exports.CP1251_BULGARIAN_CI = 14; -exports.LATIN1_DANISH_CI = 15; -exports.HEBREW_GENERAL_CI = 16; -exports.TIS620_THAI_CI = 18; -exports.EUCKR_KOREAN_CI = 19; -exports.LATIN7_ESTONIAN_CS = 20; -exports.LATIN2_HUNGARIAN_CI = 21; -exports.KOI8U_GENERAL_CI = 22; -exports.CP1251_UKRAINIAN_CI = 23; -exports.GB2312_CHINESE_CI = 24; -exports.GREEK_GENERAL_CI = 25; -exports.CP1250_GENERAL_CI = 26; -exports.LATIN2_CROATIAN_CI = 27; -exports.GBK_CHINESE_CI = 28; -exports.CP1257_LITHUANIAN_CI = 29; -exports.LATIN5_TURKISH_CI = 30; -exports.LATIN1_GERMAN2_CI = 31; -exports.ARMSCII8_GENERAL_CI = 32; -exports.UTF8_GENERAL_CI = 33; -exports.CP1250_CZECH_CS = 34; -exports.UCS2_GENERAL_CI = 35; -exports.CP866_GENERAL_CI = 36; -exports.KEYBCS2_GENERAL_CI = 37; -exports.MACCE_GENERAL_CI = 38; -exports.MACROMAN_GENERAL_CI = 39; -exports.CP852_GENERAL_CI = 40; -exports.LATIN7_GENERAL_CI = 41; -exports.LATIN7_GENERAL_CS = 42; -exports.MACCE_BIN = 43; -exports.CP1250_CROATIAN_CI = 44; -exports.UTF8MB4_GENERAL_CI = 45; -exports.UTF8MB4_BIN = 46; -exports.LATIN1_BIN = 47; -exports.LATIN1_GENERAL_CI = 48; -exports.LATIN1_GENERAL_CS = 49; -exports.CP1251_BIN = 50; -exports.CP1251_GENERAL_CI = 51; -exports.CP1251_GENERAL_CS = 52; -exports.MACROMAN_BIN = 53; -exports.UTF16_GENERAL_CI = 54; -exports.UTF16_BIN = 55; -exports.UTF16LE_GENERAL_CI = 56; -exports.CP1256_GENERAL_CI = 57; -exports.CP1257_BIN = 58; -exports.CP1257_GENERAL_CI = 59; -exports.UTF32_GENERAL_CI = 60; -exports.UTF32_BIN = 61; -exports.UTF16LE_BIN = 62; -exports.BINARY = 63; -exports.ARMSCII8_BIN = 64; -exports.ASCII_BIN = 65; -exports.CP1250_BIN = 66; -exports.CP1256_BIN = 67; -exports.CP866_BIN = 68; -exports.DEC8_BIN = 69; -exports.GREEK_BIN = 70; -exports.HEBREW_BIN = 71; -exports.HP8_BIN = 72; -exports.KEYBCS2_BIN = 73; -exports.KOI8R_BIN = 74; -exports.KOI8U_BIN = 75; -exports.LATIN2_BIN = 77; -exports.LATIN5_BIN = 78; -exports.LATIN7_BIN = 79; -exports.CP850_BIN = 80; -exports.CP852_BIN = 81; -exports.SWE7_BIN = 82; -exports.UTF8_BIN = 83; -exports.BIG5_BIN = 84; -exports.EUCKR_BIN = 85; -exports.GB2312_BIN = 86; -exports.GBK_BIN = 87; -exports.SJIS_BIN = 88; -exports.TIS620_BIN = 89; -exports.UCS2_BIN = 90; -exports.UJIS_BIN = 91; -exports.GEOSTD8_GENERAL_CI = 92; -exports.GEOSTD8_BIN = 93; -exports.LATIN1_SPANISH_CI = 94; -exports.CP932_JAPANESE_CI = 95; -exports.CP932_BIN = 96; -exports.EUCJPMS_JAPANESE_CI = 97; -exports.EUCJPMS_BIN = 98; -exports.CP1250_POLISH_CI = 99; -exports.UTF16_UNICODE_CI = 101; -exports.UTF16_ICELANDIC_CI = 102; -exports.UTF16_LATVIAN_CI = 103; -exports.UTF16_ROMANIAN_CI = 104; -exports.UTF16_SLOVENIAN_CI = 105; -exports.UTF16_POLISH_CI = 106; -exports.UTF16_ESTONIAN_CI = 107; -exports.UTF16_SPANISH_CI = 108; -exports.UTF16_SWEDISH_CI = 109; -exports.UTF16_TURKISH_CI = 110; -exports.UTF16_CZECH_CI = 111; -exports.UTF16_DANISH_CI = 112; -exports.UTF16_LITHUANIAN_CI = 113; -exports.UTF16_SLOVAK_CI = 114; -exports.UTF16_SPANISH2_CI = 115; -exports.UTF16_ROMAN_CI = 116; -exports.UTF16_PERSIAN_CI = 117; -exports.UTF16_ESPERANTO_CI = 118; -exports.UTF16_HUNGARIAN_CI = 119; -exports.UTF16_SINHALA_CI = 120; -exports.UTF16_GERMAN2_CI = 121; -exports.UTF16_CROATIAN_MYSQL561_CI = 122; -exports.UTF16_UNICODE_520_CI = 123; -exports.UTF16_VIETNAMESE_CI = 124; -exports.UCS2_UNICODE_CI = 128; -exports.UCS2_ICELANDIC_CI = 129; -exports.UCS2_LATVIAN_CI = 130; -exports.UCS2_ROMANIAN_CI = 131; -exports.UCS2_SLOVENIAN_CI = 132; -exports.UCS2_POLISH_CI = 133; -exports.UCS2_ESTONIAN_CI = 134; -exports.UCS2_SPANISH_CI = 135; -exports.UCS2_SWEDISH_CI = 136; -exports.UCS2_TURKISH_CI = 137; -exports.UCS2_CZECH_CI = 138; -exports.UCS2_DANISH_CI = 139; -exports.UCS2_LITHUANIAN_CI = 140; -exports.UCS2_SLOVAK_CI = 141; -exports.UCS2_SPANISH2_CI = 142; -exports.UCS2_ROMAN_CI = 143; -exports.UCS2_PERSIAN_CI = 144; -exports.UCS2_ESPERANTO_CI = 145; -exports.UCS2_HUNGARIAN_CI = 146; -exports.UCS2_SINHALA_CI = 147; -exports.UCS2_GERMAN2_CI = 148; -exports.UCS2_CROATIAN_MYSQL561_CI = 149; -exports.UCS2_UNICODE_520_CI = 150; -exports.UCS2_VIETNAMESE_CI = 151; -exports.UCS2_GENERAL_MYSQL500_CI = 159; -exports.UTF32_UNICODE_CI = 160; -exports.UTF32_ICELANDIC_CI = 161; -exports.UTF32_LATVIAN_CI = 162; -exports.UTF32_ROMANIAN_CI = 163; -exports.UTF32_SLOVENIAN_CI = 164; -exports.UTF32_POLISH_CI = 165; -exports.UTF32_ESTONIAN_CI = 166; -exports.UTF32_SPANISH_CI = 167; -exports.UTF32_SWEDISH_CI = 168; -exports.UTF32_TURKISH_CI = 169; -exports.UTF32_CZECH_CI = 170; -exports.UTF32_DANISH_CI = 171; -exports.UTF32_LITHUANIAN_CI = 172; -exports.UTF32_SLOVAK_CI = 173; -exports.UTF32_SPANISH2_CI = 174; -exports.UTF32_ROMAN_CI = 175; -exports.UTF32_PERSIAN_CI = 176; -exports.UTF32_ESPERANTO_CI = 177; -exports.UTF32_HUNGARIAN_CI = 178; -exports.UTF32_SINHALA_CI = 179; -exports.UTF32_GERMAN2_CI = 180; -exports.UTF32_CROATIAN_MYSQL561_CI = 181; -exports.UTF32_UNICODE_520_CI = 182; -exports.UTF32_VIETNAMESE_CI = 183; -exports.UTF8_UNICODE_CI = 192; -exports.UTF8_ICELANDIC_CI = 193; -exports.UTF8_LATVIAN_CI = 194; -exports.UTF8_ROMANIAN_CI = 195; -exports.UTF8_SLOVENIAN_CI = 196; -exports.UTF8_POLISH_CI = 197; -exports.UTF8_ESTONIAN_CI = 198; -exports.UTF8_SPANISH_CI = 199; -exports.UTF8_SWEDISH_CI = 200; -exports.UTF8_TURKISH_CI = 201; -exports.UTF8_CZECH_CI = 202; -exports.UTF8_DANISH_CI = 203; -exports.UTF8_LITHUANIAN_CI = 204; -exports.UTF8_SLOVAK_CI = 205; -exports.UTF8_SPANISH2_CI = 206; -exports.UTF8_ROMAN_CI = 207; -exports.UTF8_PERSIAN_CI = 208; -exports.UTF8_ESPERANTO_CI = 209; -exports.UTF8_HUNGARIAN_CI = 210; -exports.UTF8_SINHALA_CI = 211; -exports.UTF8_GERMAN2_CI = 212; -exports.UTF8_CROATIAN_MYSQL561_CI = 213; -exports.UTF8_UNICODE_520_CI = 214; -exports.UTF8_VIETNAMESE_CI = 215; -exports.UTF8_GENERAL_MYSQL500_CI = 223; -exports.UTF8MB4_UNICODE_CI = 224; -exports.UTF8MB4_ICELANDIC_CI = 225; -exports.UTF8MB4_LATVIAN_CI = 226; -exports.UTF8MB4_ROMANIAN_CI = 227; -exports.UTF8MB4_SLOVENIAN_CI = 228; -exports.UTF8MB4_POLISH_CI = 229; -exports.UTF8MB4_ESTONIAN_CI = 230; -exports.UTF8MB4_SPANISH_CI = 231; -exports.UTF8MB4_SWEDISH_CI = 232; -exports.UTF8MB4_TURKISH_CI = 233; -exports.UTF8MB4_CZECH_CI = 234; -exports.UTF8MB4_DANISH_CI = 235; -exports.UTF8MB4_LITHUANIAN_CI = 236; -exports.UTF8MB4_SLOVAK_CI = 237; -exports.UTF8MB4_SPANISH2_CI = 238; -exports.UTF8MB4_ROMAN_CI = 239; -exports.UTF8MB4_PERSIAN_CI = 240; -exports.UTF8MB4_ESPERANTO_CI = 241; -exports.UTF8MB4_HUNGARIAN_CI = 242; -exports.UTF8MB4_SINHALA_CI = 243; -exports.UTF8MB4_GERMAN2_CI = 244; -exports.UTF8MB4_CROATIAN_MYSQL561_CI = 245; -exports.UTF8MB4_UNICODE_520_CI = 246; -exports.UTF8MB4_VIETNAMESE_CI = 247; -exports.UTF8_GENERAL50_CI = 253; - -// short aliases -exports.ARMSCII8 = exports.ARMSCII8_GENERAL_CI; -exports.ASCII = exports.ASCII_GENERAL_CI; -exports.BIG5 = exports.BIG5_CHINESE_CI; -exports.BINARY = exports.BINARY; -exports.CP1250 = exports.CP1250_GENERAL_CI; -exports.CP1251 = exports.CP1251_GENERAL_CI; -exports.CP1256 = exports.CP1256_GENERAL_CI; -exports.CP1257 = exports.CP1257_GENERAL_CI; -exports.CP866 = exports.CP866_GENERAL_CI; -exports.CP850 = exports.CP850_GENERAL_CI; -exports.CP852 = exports.CP852_GENERAL_CI; -exports.CP932 = exports.CP932_JAPANESE_CI; -exports.DEC8 = exports.DEC8_SWEDISH_CI; -exports.EUCJPMS = exports.EUCJPMS_JAPANESE_CI; -exports.EUCKR = exports.EUCKR_KOREAN_CI; -exports.GB2312 = exports.GB2312_CHINESE_CI; -exports.GBK = exports.GBK_CHINESE_CI; -exports.GEOSTD8 = exports.GEOSTD8_GENERAL_CI; -exports.GREEK = exports.GREEK_GENERAL_CI; -exports.HEBREW = exports.HEBREW_GENERAL_CI; -exports.HP8 = exports.HP8_ENGLISH_CI; -exports.KEYBCS2 = exports.KEYBCS2_GENERAL_CI; -exports.KOI8R = exports.KOI8R_GENERAL_CI; -exports.KOI8U = exports.KOI8U_GENERAL_CI; -exports.LATIN1 = exports.LATIN1_SWEDISH_CI; -exports.LATIN2 = exports.LATIN2_GENERAL_CI; -exports.LATIN5 = exports.LATIN5_TURKISH_CI; -exports.LATIN7 = exports.LATIN7_GENERAL_CI; -exports.MACCE = exports.MACCE_GENERAL_CI; -exports.MACROMAN = exports.MACROMAN_GENERAL_CI; -exports.SJIS = exports.SJIS_JAPANESE_CI; -exports.SWE7 = exports.SWE7_SWEDISH_CI; -exports.TIS620 = exports.TIS620_THAI_CI; -exports.UCS2 = exports.UCS2_GENERAL_CI; -exports.UJIS = exports.UJIS_JAPANESE_CI; -exports.UTF16 = exports.UTF16_GENERAL_CI; -exports.UTF16LE = exports.UTF16LE_GENERAL_CI; -exports.UTF8 = exports.UTF8_GENERAL_CI; -exports.UTF8MB4 = exports.UTF8MB4_GENERAL_CI; -exports.UTF32 = exports.UTF32_GENERAL_CI; diff --git a/node_modules/mysql/lib/protocol/constants/client.js b/node_modules/mysql/lib/protocol/constants/client.js deleted file mode 100644 index 59aadc6..0000000 --- a/node_modules/mysql/lib/protocol/constants/client.js +++ /dev/null @@ -1,26 +0,0 @@ -// Manually extracted from mysql-5.5.23/include/mysql_com.h -exports.CLIENT_LONG_PASSWORD = 1; /* new more secure passwords */ -exports.CLIENT_FOUND_ROWS = 2; /* Found instead of affected rows */ -exports.CLIENT_LONG_FLAG = 4; /* Get all column flags */ -exports.CLIENT_CONNECT_WITH_DB = 8; /* One can specify db on connect */ -exports.CLIENT_NO_SCHEMA = 16; /* Don't allow database.table.column */ -exports.CLIENT_COMPRESS = 32; /* Can use compression protocol */ -exports.CLIENT_ODBC = 64; /* Odbc client */ -exports.CLIENT_LOCAL_FILES = 128; /* Can use LOAD DATA LOCAL */ -exports.CLIENT_IGNORE_SPACE = 256; /* Ignore spaces before '(' */ -exports.CLIENT_PROTOCOL_41 = 512; /* New 4.1 protocol */ -exports.CLIENT_INTERACTIVE = 1024; /* This is an interactive client */ -exports.CLIENT_SSL = 2048; /* Switch to SSL after handshake */ -exports.CLIENT_IGNORE_SIGPIPE = 4096; /* IGNORE sigpipes */ -exports.CLIENT_TRANSACTIONS = 8192; /* Client knows about transactions */ -exports.CLIENT_RESERVED = 16384; /* Old flag for 4.1 protocol */ -exports.CLIENT_SECURE_CONNECTION = 32768; /* New 4.1 authentication */ - -exports.CLIENT_MULTI_STATEMENTS = 65536; /* Enable/disable multi-stmt support */ -exports.CLIENT_MULTI_RESULTS = 131072; /* Enable/disable multi-results */ -exports.CLIENT_PS_MULTI_RESULTS = 262144; /* Multi-results in PS-protocol */ - -exports.CLIENT_PLUGIN_AUTH = 524288; /* Client supports plugin authentication */ - -exports.CLIENT_SSL_VERIFY_SERVER_CERT = 1073741824; -exports.CLIENT_REMEMBER_OPTIONS = 2147483648; diff --git a/node_modules/mysql/lib/protocol/constants/errors.js b/node_modules/mysql/lib/protocol/constants/errors.js deleted file mode 100644 index 8856456..0000000 --- a/node_modules/mysql/lib/protocol/constants/errors.js +++ /dev/null @@ -1,1978 +0,0 @@ -/** - * MySQL error constants - * - * !! Generated by generate-error-constants.js, do not modify by hand !! - */ - -exports.EE_CANTCREATEFILE = 1; -exports.EE_READ = 2; -exports.EE_WRITE = 3; -exports.EE_BADCLOSE = 4; -exports.EE_OUTOFMEMORY = 5; -exports.EE_DELETE = 6; -exports.EE_LINK = 7; -exports.EE_EOFERR = 9; -exports.EE_CANTLOCK = 10; -exports.EE_CANTUNLOCK = 11; -exports.EE_DIR = 12; -exports.EE_STAT = 13; -exports.EE_CANT_CHSIZE = 14; -exports.EE_CANT_OPEN_STREAM = 15; -exports.EE_GETWD = 16; -exports.EE_SETWD = 17; -exports.EE_LINK_WARNING = 18; -exports.EE_OPEN_WARNING = 19; -exports.EE_DISK_FULL = 20; -exports.EE_CANT_MKDIR = 21; -exports.EE_UNKNOWN_CHARSET = 22; -exports.EE_OUT_OF_FILERESOURCES = 23; -exports.EE_CANT_READLINK = 24; -exports.EE_CANT_SYMLINK = 25; -exports.EE_REALPATH = 26; -exports.EE_SYNC = 27; -exports.EE_UNKNOWN_COLLATION = 28; -exports.EE_FILENOTFOUND = 29; -exports.EE_FILE_NOT_CLOSED = 30; -exports.EE_CHANGE_OWNERSHIP = 31; -exports.EE_CHANGE_PERMISSIONS = 32; -exports.EE_CANT_SEEK = 33; -exports.HA_ERR_KEY_NOT_FOUND = 120; -exports.HA_ERR_FOUND_DUPP_KEY = 121; -exports.HA_ERR_INTERNAL_ERROR = 122; -exports.HA_ERR_RECORD_CHANGED = 123; -exports.HA_ERR_WRONG_INDEX = 124; -exports.HA_ERR_CRASHED = 126; -exports.HA_ERR_WRONG_IN_RECORD = 127; -exports.HA_ERR_OUT_OF_MEM = 128; -exports.HA_ERR_NOT_A_TABLE = 130; -exports.HA_ERR_WRONG_COMMAND = 131; -exports.HA_ERR_OLD_FILE = 132; -exports.HA_ERR_NO_ACTIVE_RECORD = 133; -exports.HA_ERR_RECORD_DELETED = 134; -exports.HA_ERR_RECORD_FILE_FULL = 135; -exports.HA_ERR_INDEX_FILE_FULL = 136; -exports.HA_ERR_END_OF_FILE = 137; -exports.HA_ERR_UNSUPPORTED = 138; -exports.HA_ERR_TO_BIG_ROW = 139; -exports.HA_WRONG_CREATE_OPTION = 140; -exports.HA_ERR_FOUND_DUPP_UNIQUE = 141; -exports.HA_ERR_UNKNOWN_CHARSET = 142; -exports.HA_ERR_WRONG_MRG_TABLE_DEF = 143; -exports.HA_ERR_CRASHED_ON_REPAIR = 144; -exports.HA_ERR_CRASHED_ON_USAGE = 145; -exports.HA_ERR_LOCK_WAIT_TIMEOUT = 146; -exports.HA_ERR_LOCK_TABLE_FULL = 147; -exports.HA_ERR_READ_ONLY_TRANSACTION = 148; -exports.HA_ERR_LOCK_DEADLOCK = 149; -exports.HA_ERR_CANNOT_ADD_FOREIGN = 150; -exports.HA_ERR_NO_REFERENCED_ROW = 151; -exports.HA_ERR_ROW_IS_REFERENCED = 152; -exports.HA_ERR_NO_SAVEPOINT = 153; -exports.HA_ERR_NON_UNIQUE_BLOCK_SIZE = 154; -exports.HA_ERR_NO_SUCH_TABLE = 155; -exports.HA_ERR_TABLE_EXIST = 156; -exports.HA_ERR_NO_CONNECTION = 157; -exports.HA_ERR_NULL_IN_SPATIAL = 158; -exports.HA_ERR_TABLE_DEF_CHANGED = 159; -exports.HA_ERR_NO_PARTITION_FOUND = 160; -exports.HA_ERR_RBR_LOGGING_FAILED = 161; -exports.HA_ERR_DROP_INDEX_FK = 162; -exports.HA_ERR_FOREIGN_DUPLICATE_KEY = 163; -exports.HA_ERR_TABLE_NEEDS_UPGRADE = 164; -exports.HA_ERR_TABLE_READONLY = 165; -exports.HA_ERR_AUTOINC_READ_FAILED = 166; -exports.HA_ERR_AUTOINC_ERANGE = 167; -exports.HA_ERR_GENERIC = 168; -exports.HA_ERR_RECORD_IS_THE_SAME = 169; -exports.HA_ERR_LOGGING_IMPOSSIBLE = 170; -exports.HA_ERR_CORRUPT_EVENT = 171; -exports.HA_ERR_NEW_FILE = 172; -exports.HA_ERR_ROWS_EVENT_APPLY = 173; -exports.HA_ERR_INITIALIZATION = 174; -exports.HA_ERR_FILE_TOO_SHORT = 175; -exports.HA_ERR_WRONG_CRC = 176; -exports.HA_ERR_TOO_MANY_CONCURRENT_TRXS = 177; -exports.HA_ERR_NOT_IN_LOCK_PARTITIONS = 178; -exports.HA_ERR_INDEX_COL_TOO_LONG = 179; -exports.HA_ERR_INDEX_CORRUPT = 180; -exports.HA_ERR_UNDO_REC_TOO_BIG = 181; -exports.HA_FTS_INVALID_DOCID = 182; -exports.HA_ERR_TABLE_IN_FK_CHECK = 183; -exports.HA_ERR_TABLESPACE_EXISTS = 184; -exports.HA_ERR_TOO_MANY_FIELDS = 185; -exports.HA_ERR_ROW_IN_WRONG_PARTITION = 186; -exports.HA_ERR_INNODB_READ_ONLY = 187; -exports.HA_ERR_FTS_EXCEED_RESULT_CACHE_LIMIT = 188; -exports.HA_ERR_TEMP_FILE_WRITE_FAILURE = 189; -exports.HA_ERR_INNODB_FORCED_RECOVERY = 190; -exports.HA_ERR_FTS_TOO_MANY_WORDS_IN_PHRASE = 191; -exports.ER_HASHCHK = 1000; -exports.ER_NISAMCHK = 1001; -exports.ER_NO = 1002; -exports.ER_YES = 1003; -exports.ER_CANT_CREATE_FILE = 1004; -exports.ER_CANT_CREATE_TABLE = 1005; -exports.ER_CANT_CREATE_DB = 1006; -exports.ER_DB_CREATE_EXISTS = 1007; -exports.ER_DB_DROP_EXISTS = 1008; -exports.ER_DB_DROP_DELETE = 1009; -exports.ER_DB_DROP_RMDIR = 1010; -exports.ER_CANT_DELETE_FILE = 1011; -exports.ER_CANT_FIND_SYSTEM_REC = 1012; -exports.ER_CANT_GET_STAT = 1013; -exports.ER_CANT_GET_WD = 1014; -exports.ER_CANT_LOCK = 1015; -exports.ER_CANT_OPEN_FILE = 1016; -exports.ER_FILE_NOT_FOUND = 1017; -exports.ER_CANT_READ_DIR = 1018; -exports.ER_CANT_SET_WD = 1019; -exports.ER_CHECKREAD = 1020; -exports.ER_DISK_FULL = 1021; -exports.ER_DUP_KEY = 1022; -exports.ER_ERROR_ON_CLOSE = 1023; -exports.ER_ERROR_ON_READ = 1024; -exports.ER_ERROR_ON_RENAME = 1025; -exports.ER_ERROR_ON_WRITE = 1026; -exports.ER_FILE_USED = 1027; -exports.ER_FILSORT_ABORT = 1028; -exports.ER_FORM_NOT_FOUND = 1029; -exports.ER_GET_ERRNO = 1030; -exports.ER_ILLEGAL_HA = 1031; -exports.ER_KEY_NOT_FOUND = 1032; -exports.ER_NOT_FORM_FILE = 1033; -exports.ER_NOT_KEYFILE = 1034; -exports.ER_OLD_KEYFILE = 1035; -exports.ER_OPEN_AS_READONLY = 1036; -exports.ER_OUTOFMEMORY = 1037; -exports.ER_OUT_OF_SORTMEMORY = 1038; -exports.ER_UNEXPECTED_EOF = 1039; -exports.ER_CON_COUNT_ERROR = 1040; -exports.ER_OUT_OF_RESOURCES = 1041; -exports.ER_BAD_HOST_ERROR = 1042; -exports.ER_HANDSHAKE_ERROR = 1043; -exports.ER_DBACCESS_DENIED_ERROR = 1044; -exports.ER_ACCESS_DENIED_ERROR = 1045; -exports.ER_NO_DB_ERROR = 1046; -exports.ER_UNKNOWN_COM_ERROR = 1047; -exports.ER_BAD_NULL_ERROR = 1048; -exports.ER_BAD_DB_ERROR = 1049; -exports.ER_TABLE_EXISTS_ERROR = 1050; -exports.ER_BAD_TABLE_ERROR = 1051; -exports.ER_NON_UNIQ_ERROR = 1052; -exports.ER_SERVER_SHUTDOWN = 1053; -exports.ER_BAD_FIELD_ERROR = 1054; -exports.ER_WRONG_FIELD_WITH_GROUP = 1055; -exports.ER_WRONG_GROUP_FIELD = 1056; -exports.ER_WRONG_SUM_SELECT = 1057; -exports.ER_WRONG_VALUE_COUNT = 1058; -exports.ER_TOO_LONG_IDENT = 1059; -exports.ER_DUP_FIELDNAME = 1060; -exports.ER_DUP_KEYNAME = 1061; -exports.ER_DUP_ENTRY = 1062; -exports.ER_WRONG_FIELD_SPEC = 1063; -exports.ER_PARSE_ERROR = 1064; -exports.ER_EMPTY_QUERY = 1065; -exports.ER_NONUNIQ_TABLE = 1066; -exports.ER_INVALID_DEFAULT = 1067; -exports.ER_MULTIPLE_PRI_KEY = 1068; -exports.ER_TOO_MANY_KEYS = 1069; -exports.ER_TOO_MANY_KEY_PARTS = 1070; -exports.ER_TOO_LONG_KEY = 1071; -exports.ER_KEY_COLUMN_DOES_NOT_EXITS = 1072; -exports.ER_BLOB_USED_AS_KEY = 1073; -exports.ER_TOO_BIG_FIELDLENGTH = 1074; -exports.ER_WRONG_AUTO_KEY = 1075; -exports.ER_READY = 1076; -exports.ER_NORMAL_SHUTDOWN = 1077; -exports.ER_GOT_SIGNAL = 1078; -exports.ER_SHUTDOWN_COMPLETE = 1079; -exports.ER_FORCING_CLOSE = 1080; -exports.ER_IPSOCK_ERROR = 1081; -exports.ER_NO_SUCH_INDEX = 1082; -exports.ER_WRONG_FIELD_TERMINATORS = 1083; -exports.ER_BLOBS_AND_NO_TERMINATED = 1084; -exports.ER_TEXTFILE_NOT_READABLE = 1085; -exports.ER_FILE_EXISTS_ERROR = 1086; -exports.ER_LOAD_INFO = 1087; -exports.ER_ALTER_INFO = 1088; -exports.ER_WRONG_SUB_KEY = 1089; -exports.ER_CANT_REMOVE_ALL_FIELDS = 1090; -exports.ER_CANT_DROP_FIELD_OR_KEY = 1091; -exports.ER_INSERT_INFO = 1092; -exports.ER_UPDATE_TABLE_USED = 1093; -exports.ER_NO_SUCH_THREAD = 1094; -exports.ER_KILL_DENIED_ERROR = 1095; -exports.ER_NO_TABLES_USED = 1096; -exports.ER_TOO_BIG_SET = 1097; -exports.ER_NO_UNIQUE_LOGFILE = 1098; -exports.ER_TABLE_NOT_LOCKED_FOR_WRITE = 1099; -exports.ER_TABLE_NOT_LOCKED = 1100; -exports.ER_BLOB_CANT_HAVE_DEFAULT = 1101; -exports.ER_WRONG_DB_NAME = 1102; -exports.ER_WRONG_TABLE_NAME = 1103; -exports.ER_TOO_BIG_SELECT = 1104; -exports.ER_UNKNOWN_ERROR = 1105; -exports.ER_UNKNOWN_PROCEDURE = 1106; -exports.ER_WRONG_PARAMCOUNT_TO_PROCEDURE = 1107; -exports.ER_WRONG_PARAMETERS_TO_PROCEDURE = 1108; -exports.ER_UNKNOWN_TABLE = 1109; -exports.ER_FIELD_SPECIFIED_TWICE = 1110; -exports.ER_INVALID_GROUP_FUNC_USE = 1111; -exports.ER_UNSUPPORTED_EXTENSION = 1112; -exports.ER_TABLE_MUST_HAVE_COLUMNS = 1113; -exports.ER_RECORD_FILE_FULL = 1114; -exports.ER_UNKNOWN_CHARACTER_SET = 1115; -exports.ER_TOO_MANY_TABLES = 1116; -exports.ER_TOO_MANY_FIELDS = 1117; -exports.ER_TOO_BIG_ROWSIZE = 1118; -exports.ER_STACK_OVERRUN = 1119; -exports.ER_WRONG_OUTER_JOIN = 1120; -exports.ER_NULL_COLUMN_IN_INDEX = 1121; -exports.ER_CANT_FIND_UDF = 1122; -exports.ER_CANT_INITIALIZE_UDF = 1123; -exports.ER_UDF_NO_PATHS = 1124; -exports.ER_UDF_EXISTS = 1125; -exports.ER_CANT_OPEN_LIBRARY = 1126; -exports.ER_CANT_FIND_DL_ENTRY = 1127; -exports.ER_FUNCTION_NOT_DEFINED = 1128; -exports.ER_HOST_IS_BLOCKED = 1129; -exports.ER_HOST_NOT_PRIVILEGED = 1130; -exports.ER_PASSWORD_ANONYMOUS_USER = 1131; -exports.ER_PASSWORD_NOT_ALLOWED = 1132; -exports.ER_PASSWORD_NO_MATCH = 1133; -exports.ER_UPDATE_INFO = 1134; -exports.ER_CANT_CREATE_THREAD = 1135; -exports.ER_WRONG_VALUE_COUNT_ON_ROW = 1136; -exports.ER_CANT_REOPEN_TABLE = 1137; -exports.ER_INVALID_USE_OF_NULL = 1138; -exports.ER_REGEXP_ERROR = 1139; -exports.ER_MIX_OF_GROUP_FUNC_AND_FIELDS = 1140; -exports.ER_NONEXISTING_GRANT = 1141; -exports.ER_TABLEACCESS_DENIED_ERROR = 1142; -exports.ER_COLUMNACCESS_DENIED_ERROR = 1143; -exports.ER_ILLEGAL_GRANT_FOR_TABLE = 1144; -exports.ER_GRANT_WRONG_HOST_OR_USER = 1145; -exports.ER_NO_SUCH_TABLE = 1146; -exports.ER_NONEXISTING_TABLE_GRANT = 1147; -exports.ER_NOT_ALLOWED_COMMAND = 1148; -exports.ER_SYNTAX_ERROR = 1149; -exports.ER_DELAYED_CANT_CHANGE_LOCK = 1150; -exports.ER_TOO_MANY_DELAYED_THREADS = 1151; -exports.ER_ABORTING_CONNECTION = 1152; -exports.ER_NET_PACKET_TOO_LARGE = 1153; -exports.ER_NET_READ_ERROR_FROM_PIPE = 1154; -exports.ER_NET_FCNTL_ERROR = 1155; -exports.ER_NET_PACKETS_OUT_OF_ORDER = 1156; -exports.ER_NET_UNCOMPRESS_ERROR = 1157; -exports.ER_NET_READ_ERROR = 1158; -exports.ER_NET_READ_INTERRUPTED = 1159; -exports.ER_NET_ERROR_ON_WRITE = 1160; -exports.ER_NET_WRITE_INTERRUPTED = 1161; -exports.ER_TOO_LONG_STRING = 1162; -exports.ER_TABLE_CANT_HANDLE_BLOB = 1163; -exports.ER_TABLE_CANT_HANDLE_AUTO_INCREMENT = 1164; -exports.ER_DELAYED_INSERT_TABLE_LOCKED = 1165; -exports.ER_WRONG_COLUMN_NAME = 1166; -exports.ER_WRONG_KEY_COLUMN = 1167; -exports.ER_WRONG_MRG_TABLE = 1168; -exports.ER_DUP_UNIQUE = 1169; -exports.ER_BLOB_KEY_WITHOUT_LENGTH = 1170; -exports.ER_PRIMARY_CANT_HAVE_NULL = 1171; -exports.ER_TOO_MANY_ROWS = 1172; -exports.ER_REQUIRES_PRIMARY_KEY = 1173; -exports.ER_NO_RAID_COMPILED = 1174; -exports.ER_UPDATE_WITHOUT_KEY_IN_SAFE_MODE = 1175; -exports.ER_KEY_DOES_NOT_EXITS = 1176; -exports.ER_CHECK_NO_SUCH_TABLE = 1177; -exports.ER_CHECK_NOT_IMPLEMENTED = 1178; -exports.ER_CANT_DO_THIS_DURING_AN_TRANSACTION = 1179; -exports.ER_ERROR_DURING_COMMIT = 1180; -exports.ER_ERROR_DURING_ROLLBACK = 1181; -exports.ER_ERROR_DURING_FLUSH_LOGS = 1182; -exports.ER_ERROR_DURING_CHECKPOINT = 1183; -exports.ER_NEW_ABORTING_CONNECTION = 1184; -exports.ER_DUMP_NOT_IMPLEMENTED = 1185; -exports.ER_FLUSH_MASTER_BINLOG_CLOSED = 1186; -exports.ER_INDEX_REBUILD = 1187; -exports.ER_MASTER = 1188; -exports.ER_MASTER_NET_READ = 1189; -exports.ER_MASTER_NET_WRITE = 1190; -exports.ER_FT_MATCHING_KEY_NOT_FOUND = 1191; -exports.ER_LOCK_OR_ACTIVE_TRANSACTION = 1192; -exports.ER_UNKNOWN_SYSTEM_VARIABLE = 1193; -exports.ER_CRASHED_ON_USAGE = 1194; -exports.ER_CRASHED_ON_REPAIR = 1195; -exports.ER_WARNING_NOT_COMPLETE_ROLLBACK = 1196; -exports.ER_TRANS_CACHE_FULL = 1197; -exports.ER_SLAVE_MUST_STOP = 1198; -exports.ER_SLAVE_NOT_RUNNING = 1199; -exports.ER_BAD_SLAVE = 1200; -exports.ER_MASTER_INFO = 1201; -exports.ER_SLAVE_THREAD = 1202; -exports.ER_TOO_MANY_USER_CONNECTIONS = 1203; -exports.ER_SET_CONSTANTS_ONLY = 1204; -exports.ER_LOCK_WAIT_TIMEOUT = 1205; -exports.ER_LOCK_TABLE_FULL = 1206; -exports.ER_READ_ONLY_TRANSACTION = 1207; -exports.ER_DROP_DB_WITH_READ_LOCK = 1208; -exports.ER_CREATE_DB_WITH_READ_LOCK = 1209; -exports.ER_WRONG_ARGUMENTS = 1210; -exports.ER_NO_PERMISSION_TO_CREATE_USER = 1211; -exports.ER_UNION_TABLES_IN_DIFFERENT_DIR = 1212; -exports.ER_LOCK_DEADLOCK = 1213; -exports.ER_TABLE_CANT_HANDLE_FT = 1214; -exports.ER_CANNOT_ADD_FOREIGN = 1215; -exports.ER_NO_REFERENCED_ROW = 1216; -exports.ER_ROW_IS_REFERENCED = 1217; -exports.ER_CONNECT_TO_MASTER = 1218; -exports.ER_QUERY_ON_MASTER = 1219; -exports.ER_ERROR_WHEN_EXECUTING_COMMAND = 1220; -exports.ER_WRONG_USAGE = 1221; -exports.ER_WRONG_NUMBER_OF_COLUMNS_IN_SELECT = 1222; -exports.ER_CANT_UPDATE_WITH_READLOCK = 1223; -exports.ER_MIXING_NOT_ALLOWED = 1224; -exports.ER_DUP_ARGUMENT = 1225; -exports.ER_USER_LIMIT_REACHED = 1226; -exports.ER_SPECIFIC_ACCESS_DENIED_ERROR = 1227; -exports.ER_LOCAL_VARIABLE = 1228; -exports.ER_GLOBAL_VARIABLE = 1229; -exports.ER_NO_DEFAULT = 1230; -exports.ER_WRONG_VALUE_FOR_VAR = 1231; -exports.ER_WRONG_TYPE_FOR_VAR = 1232; -exports.ER_VAR_CANT_BE_READ = 1233; -exports.ER_CANT_USE_OPTION_HERE = 1234; -exports.ER_NOT_SUPPORTED_YET = 1235; -exports.ER_MASTER_FATAL_ERROR_READING_BINLOG = 1236; -exports.ER_SLAVE_IGNORED_TABLE = 1237; -exports.ER_INCORRECT_GLOBAL_LOCAL_VAR = 1238; -exports.ER_WRONG_FK_DEF = 1239; -exports.ER_KEY_REF_DO_NOT_MATCH_TABLE_REF = 1240; -exports.ER_OPERAND_COLUMNS = 1241; -exports.ER_SUBQUERY_NO_ = 1242; -exports.ER_UNKNOWN_STMT_HANDLER = 1243; -exports.ER_CORRUPT_HELP_DB = 1244; -exports.ER_CYCLIC_REFERENCE = 1245; -exports.ER_AUTO_CONVERT = 1246; -exports.ER_ILLEGAL_REFERENCE = 1247; -exports.ER_DERIVED_MUST_HAVE_ALIAS = 1248; -exports.ER_SELECT_REDUCED = 1249; -exports.ER_TABLENAME_NOT_ALLOWED_HERE = 1250; -exports.ER_NOT_SUPPORTED_AUTH_MODE = 1251; -exports.ER_SPATIAL_CANT_HAVE_NULL = 1252; -exports.ER_COLLATION_CHARSET_MISMATCH = 1253; -exports.ER_SLAVE_WAS_RUNNING = 1254; -exports.ER_SLAVE_WAS_NOT_RUNNING = 1255; -exports.ER_TOO_BIG_FOR_UNCOMPRESS = 1256; -exports.ER_ZLIB_Z_MEM_ERROR = 1257; -exports.ER_ZLIB_Z_BUF_ERROR = 1258; -exports.ER_ZLIB_Z_DATA_ERROR = 1259; -exports.ER_CUT_VALUE_GROUP_CONCAT = 1260; -exports.ER_WARN_TOO_FEW_RECORDS = 1261; -exports.ER_WARN_TOO_MANY_RECORDS = 1262; -exports.ER_WARN_NULL_TO_NOTNULL = 1263; -exports.ER_WARN_DATA_OUT_OF_RANGE = 1264; -exports.WARN_DATA_TRUNCATED = 1265; -exports.ER_WARN_USING_OTHER_HANDLER = 1266; -exports.ER_CANT_AGGREGATE_ = 1267; -exports.ER_DROP_USER = 1268; -exports.ER_REVOKE_GRANTS = 1269; -exports.ER_CANT_AGGREGATE_ = 1270; -exports.ER_CANT_AGGREGATE_NCOLLATIONS = 1271; -exports.ER_VARIABLE_IS_NOT_STRUCT = 1272; -exports.ER_UNKNOWN_COLLATION = 1273; -exports.ER_SLAVE_IGNORED_SSL_PARAMS = 1274; -exports.ER_SERVER_IS_IN_SECURE_AUTH_MODE = 1275; -exports.ER_WARN_FIELD_RESOLVED = 1276; -exports.ER_BAD_SLAVE_UNTIL_COND = 1277; -exports.ER_MISSING_SKIP_SLAVE = 1278; -exports.ER_UNTIL_COND_IGNORED = 1279; -exports.ER_WRONG_NAME_FOR_INDEX = 1280; -exports.ER_WRONG_NAME_FOR_CATALOG = 1281; -exports.ER_WARN_QC_RESIZE = 1282; -exports.ER_BAD_FT_COLUMN = 1283; -exports.ER_UNKNOWN_KEY_CACHE = 1284; -exports.ER_WARN_HOSTNAME_WONT_WORK = 1285; -exports.ER_UNKNOWN_STORAGE_ENGINE = 1286; -exports.ER_WARN_DEPRECATED_SYNTAX = 1287; -exports.ER_NON_UPDATABLE_TABLE = 1288; -exports.ER_FEATURE_DISABLED = 1289; -exports.ER_OPTION_PREVENTS_STATEMENT = 1290; -exports.ER_DUPLICATED_VALUE_IN_TYPE = 1291; -exports.ER_TRUNCATED_WRONG_VALUE = 1292; -exports.ER_TOO_MUCH_AUTO_TIMESTAMP_COLS = 1293; -exports.ER_INVALID_ON_UPDATE = 1294; -exports.ER_UNSUPPORTED_PS = 1295; -exports.ER_GET_ERRMSG = 1296; -exports.ER_GET_TEMPORARY_ERRMSG = 1297; -exports.ER_UNKNOWN_TIME_ZONE = 1298; -exports.ER_WARN_INVALID_TIMESTAMP = 1299; -exports.ER_INVALID_CHARACTER_STRING = 1300; -exports.ER_WARN_ALLOWED_PACKET_OVERFLOWED = 1301; -exports.ER_CONFLICTING_DECLARATIONS = 1302; -exports.ER_SP_NO_RECURSIVE_CREATE = 1303; -exports.ER_SP_ALREADY_EXISTS = 1304; -exports.ER_SP_DOES_NOT_EXIST = 1305; -exports.ER_SP_DROP_FAILED = 1306; -exports.ER_SP_STORE_FAILED = 1307; -exports.ER_SP_LILABEL_MISMATCH = 1308; -exports.ER_SP_LABEL_REDEFINE = 1309; -exports.ER_SP_LABEL_MISMATCH = 1310; -exports.ER_SP_UNINIT_VAR = 1311; -exports.ER_SP_BADSELECT = 1312; -exports.ER_SP_BADRETURN = 1313; -exports.ER_SP_BADSTATEMENT = 1314; -exports.ER_UPDATE_LOG_DEPRECATED_IGNORED = 1315; -exports.ER_UPDATE_LOG_DEPRECATED_TRANSLATED = 1316; -exports.ER_QUERY_INTERRUPTED = 1317; -exports.ER_SP_WRONG_NO_OF_ARGS = 1318; -exports.ER_SP_COND_MISMATCH = 1319; -exports.ER_SP_NORETURN = 1320; -exports.ER_SP_NORETURNEND = 1321; -exports.ER_SP_BAD_CURSOR_QUERY = 1322; -exports.ER_SP_BAD_CURSOR_SELECT = 1323; -exports.ER_SP_CURSOR_MISMATCH = 1324; -exports.ER_SP_CURSOR_ALREADY_OPEN = 1325; -exports.ER_SP_CURSOR_NOT_OPEN = 1326; -exports.ER_SP_UNDECLARED_VAR = 1327; -exports.ER_SP_WRONG_NO_OF_FETCH_ARGS = 1328; -exports.ER_SP_FETCH_NO_DATA = 1329; -exports.ER_SP_DUP_PARAM = 1330; -exports.ER_SP_DUP_VAR = 1331; -exports.ER_SP_DUP_COND = 1332; -exports.ER_SP_DUP_CURS = 1333; -exports.ER_SP_CANT_ALTER = 1334; -exports.ER_SP_SUBSELECT_NYI = 1335; -exports.ER_STMT_NOT_ALLOWED_IN_SF_OR_TRG = 1336; -exports.ER_SP_VARCOND_AFTER_CURSHNDLR = 1337; -exports.ER_SP_CURSOR_AFTER_HANDLER = 1338; -exports.ER_SP_CASE_NOT_FOUND = 1339; -exports.ER_FPARSER_TOO_BIG_FILE = 1340; -exports.ER_FPARSER_BAD_HEADER = 1341; -exports.ER_FPARSER_EOF_IN_COMMENT = 1342; -exports.ER_FPARSER_ERROR_IN_PARAMETER = 1343; -exports.ER_FPARSER_EOF_IN_UNKNOWN_PARAMETER = 1344; -exports.ER_VIEW_NO_EXPLAIN = 1345; -exports.ER_FRM_UNKNOWN_TYPE = 1346; -exports.ER_WRONG_OBJECT = 1347; -exports.ER_NONUPDATEABLE_COLUMN = 1348; -exports.ER_VIEW_SELECT_DERIVED = 1349; -exports.ER_VIEW_SELECT_CLAUSE = 1350; -exports.ER_VIEW_SELECT_VARIABLE = 1351; -exports.ER_VIEW_SELECT_TMPTABLE = 1352; -exports.ER_VIEW_WRONG_LIST = 1353; -exports.ER_WARN_VIEW_MERGE = 1354; -exports.ER_WARN_VIEW_WITHOUT_KEY = 1355; -exports.ER_VIEW_INVALID = 1356; -exports.ER_SP_NO_DROP_SP = 1357; -exports.ER_SP_GOTO_IN_HNDLR = 1358; -exports.ER_TRG_ALREADY_EXISTS = 1359; -exports.ER_TRG_DOES_NOT_EXIST = 1360; -exports.ER_TRG_ON_VIEW_OR_TEMP_TABLE = 1361; -exports.ER_TRG_CANT_CHANGE_ROW = 1362; -exports.ER_TRG_NO_SUCH_ROW_IN_TRG = 1363; -exports.ER_NO_DEFAULT_FOR_FIELD = 1364; -exports.ER_DIVISION_BY_ZERO = 1365; -exports.ER_TRUNCATED_WRONG_VALUE_FOR_FIELD = 1366; -exports.ER_ILLEGAL_VALUE_FOR_TYPE = 1367; -exports.ER_VIEW_NONUPD_CHECK = 1368; -exports.ER_VIEW_CHECK_FAILED = 1369; -exports.ER_PROCACCESS_DENIED_ERROR = 1370; -exports.ER_RELAY_LOG_FAIL = 1371; -exports.ER_PASSWD_LENGTH = 1372; -exports.ER_UNKNOWN_TARGET_BINLOG = 1373; -exports.ER_IO_ERR_LOG_INDEX_READ = 1374; -exports.ER_BINLOG_PURGE_PROHIBITED = 1375; -exports.ER_FSEEK_FAIL = 1376; -exports.ER_BINLOG_PURGE_FATAL_ERR = 1377; -exports.ER_LOG_IN_USE = 1378; -exports.ER_LOG_PURGE_UNKNOWN_ERR = 1379; -exports.ER_RELAY_LOG_INIT = 1380; -exports.ER_NO_BINARY_LOGGING = 1381; -exports.ER_RESERVED_SYNTAX = 1382; -exports.ER_WSAS_FAILED = 1383; -exports.ER_DIFF_GROUPS_PROC = 1384; -exports.ER_NO_GROUP_FOR_PROC = 1385; -exports.ER_ORDER_WITH_PROC = 1386; -exports.ER_LOGGING_PROHIBIT_CHANGING_OF = 1387; -exports.ER_NO_FILE_MAPPING = 1388; -exports.ER_WRONG_MAGIC = 1389; -exports.ER_PS_MANY_PARAM = 1390; -exports.ER_KEY_PART_ = 1391; -exports.ER_VIEW_CHECKSUM = 1392; -exports.ER_VIEW_MULTIUPDATE = 1393; -exports.ER_VIEW_NO_INSERT_FIELD_LIST = 1394; -exports.ER_VIEW_DELETE_MERGE_VIEW = 1395; -exports.ER_CANNOT_USER = 1396; -exports.ER_XAER_NOTA = 1397; -exports.ER_XAER_INVAL = 1398; -exports.ER_XAER_RMFAIL = 1399; -exports.ER_XAER_OUTSIDE = 1400; -exports.ER_XAER_RMERR = 1401; -exports.ER_XA_RBROLLBACK = 1402; -exports.ER_NONEXISTING_PROC_GRANT = 1403; -exports.ER_PROC_AUTO_GRANT_FAIL = 1404; -exports.ER_PROC_AUTO_REVOKE_FAIL = 1405; -exports.ER_DATA_TOO_LONG = 1406; -exports.ER_SP_BAD_SQLSTATE = 1407; -exports.ER_STARTUP = 1408; -exports.ER_LOAD_FROM_FIXED_SIZE_ROWS_TO_VAR = 1409; -exports.ER_CANT_CREATE_USER_WITH_GRANT = 1410; -exports.ER_WRONG_VALUE_FOR_TYPE = 1411; -exports.ER_TABLE_DEF_CHANGED = 1412; -exports.ER_SP_DUP_HANDLER = 1413; -exports.ER_SP_NOT_VAR_ARG = 1414; -exports.ER_SP_NO_RETSET = 1415; -exports.ER_CANT_CREATE_GEOMETRY_OBJECT = 1416; -exports.ER_FAILED_ROUTINE_BREAK_BINLOG = 1417; -exports.ER_BINLOG_UNSAFE_ROUTINE = 1418; -exports.ER_BINLOG_CREATE_ROUTINE_NEED_SUPER = 1419; -exports.ER_EXEC_STMT_WITH_OPEN_CURSOR = 1420; -exports.ER_STMT_HAS_NO_OPEN_CURSOR = 1421; -exports.ER_COMMIT_NOT_ALLOWED_IN_SF_OR_TRG = 1422; -exports.ER_NO_DEFAULT_FOR_VIEW_FIELD = 1423; -exports.ER_SP_NO_RECURSION = 1424; -exports.ER_TOO_BIG_SCALE = 1425; -exports.ER_TOO_BIG_PRECISION = 1426; -exports.ER_M_BIGGER_THAN_D = 1427; -exports.ER_WRONG_LOCK_OF_SYSTEM_TABLE = 1428; -exports.ER_CONNECT_TO_FOREIGN_DATA_SOURCE = 1429; -exports.ER_QUERY_ON_FOREIGN_DATA_SOURCE = 1430; -exports.ER_FOREIGN_DATA_SOURCE_DOESNT_EXIST = 1431; -exports.ER_FOREIGN_DATA_STRING_INVALID_CANT_CREATE = 1432; -exports.ER_FOREIGN_DATA_STRING_INVALID = 1433; -exports.ER_CANT_CREATE_FEDERATED_TABLE = 1434; -exports.ER_TRG_IN_WRONG_SCHEMA = 1435; -exports.ER_STACK_OVERRUN_NEED_MORE = 1436; -exports.ER_TOO_LONG_BODY = 1437; -exports.ER_WARN_CANT_DROP_DEFAULT_KEYCACHE = 1438; -exports.ER_TOO_BIG_DISPLAYWIDTH = 1439; -exports.ER_XAER_DUPID = 1440; -exports.ER_DATETIME_FUNCTION_OVERFLOW = 1441; -exports.ER_CANT_UPDATE_USED_TABLE_IN_SF_OR_TRG = 1442; -exports.ER_VIEW_PREVENT_UPDATE = 1443; -exports.ER_PS_NO_RECURSION = 1444; -exports.ER_SP_CANT_SET_AUTOCOMMIT = 1445; -exports.ER_MALFORMED_DEFINER = 1446; -exports.ER_VIEW_FRM_NO_USER = 1447; -exports.ER_VIEW_OTHER_USER = 1448; -exports.ER_NO_SUCH_USER = 1449; -exports.ER_FORBID_SCHEMA_CHANGE = 1450; -exports.ER_ROW_IS_REFERENCED_ = 1451; -exports.ER_NO_REFERENCED_ROW_ = 1452; -exports.ER_SP_BAD_VAR_SHADOW = 1453; -exports.ER_TRG_NO_DEFINER = 1454; -exports.ER_OLD_FILE_FORMAT = 1455; -exports.ER_SP_RECURSION_LIMIT = 1456; -exports.ER_SP_PROC_TABLE_CORRUPT = 1457; -exports.ER_SP_WRONG_NAME = 1458; -exports.ER_TABLE_NEEDS_UPGRADE = 1459; -exports.ER_SP_NO_AGGREGATE = 1460; -exports.ER_MAX_PREPARED_STMT_COUNT_REACHED = 1461; -exports.ER_VIEW_RECURSIVE = 1462; -exports.ER_NON_GROUPING_FIELD_USED = 1463; -exports.ER_TABLE_CANT_HANDLE_SPKEYS = 1464; -exports.ER_NO_TRIGGERS_ON_SYSTEM_SCHEMA = 1465; -exports.ER_REMOVED_SPACES = 1466; -exports.ER_AUTOINC_READ_FAILED = 1467; -exports.ER_USERNAME = 1468; -exports.ER_HOSTNAME = 1469; -exports.ER_WRONG_STRING_LENGTH = 1470; -exports.ER_NON_INSERTABLE_TABLE = 1471; -exports.ER_ADMIN_WRONG_MRG_TABLE = 1472; -exports.ER_TOO_HIGH_LEVEL_OF_NESTING_FOR_SELECT = 1473; -exports.ER_NAME_BECOMES_EMPTY = 1474; -exports.ER_AMBIGUOUS_FIELD_TERM = 1475; -exports.ER_FOREIGN_SERVER_EXISTS = 1476; -exports.ER_FOREIGN_SERVER_DOESNT_EXIST = 1477; -exports.ER_ILLEGAL_HA_CREATE_OPTION = 1478; -exports.ER_PARTITION_REQUIRES_VALUES_ERROR = 1479; -exports.ER_PARTITION_WRONG_VALUES_ERROR = 1480; -exports.ER_PARTITION_MAXVALUE_ERROR = 1481; -exports.ER_PARTITION_SUBPARTITION_ERROR = 1482; -exports.ER_PARTITION_SUBPART_MIX_ERROR = 1483; -exports.ER_PARTITION_WRONG_NO_PART_ERROR = 1484; -exports.ER_PARTITION_WRONG_NO_SUBPART_ERROR = 1485; -exports.ER_WRONG_EXPR_IN_PARTITION_FUNC_ERROR = 1486; -exports.ER_NO_CONST_EXPR_IN_RANGE_OR_LIST_ERROR = 1487; -exports.ER_FIELD_NOT_FOUND_PART_ERROR = 1488; -exports.ER_LIST_OF_FIELDS_ONLY_IN_HASH_ERROR = 1489; -exports.ER_INCONSISTENT_PARTITION_INFO_ERROR = 1490; -exports.ER_PARTITION_FUNC_NOT_ALLOWED_ERROR = 1491; -exports.ER_PARTITIONS_MUST_BE_DEFINED_ERROR = 1492; -exports.ER_RANGE_NOT_INCREASING_ERROR = 1493; -exports.ER_INCONSISTENT_TYPE_OF_FUNCTIONS_ERROR = 1494; -exports.ER_MULTIPLE_DEF_CONST_IN_LIST_PART_ERROR = 1495; -exports.ER_PARTITION_ENTRY_ERROR = 1496; -exports.ER_MIX_HANDLER_ERROR = 1497; -exports.ER_PARTITION_NOT_DEFINED_ERROR = 1498; -exports.ER_TOO_MANY_PARTITIONS_ERROR = 1499; -exports.ER_SUBPARTITION_ERROR = 1500; -exports.ER_CANT_CREATE_HANDLER_FILE = 1501; -exports.ER_BLOB_FIELD_IN_PART_FUNC_ERROR = 1502; -exports.ER_UNIQUE_KEY_NEED_ALL_FIELDS_IN_PF = 1503; -exports.ER_NO_PARTS_ERROR = 1504; -exports.ER_PARTITION_MGMT_ON_NONPARTITIONED = 1505; -exports.ER_FOREIGN_KEY_ON_PARTITIONED = 1506; -exports.ER_DROP_PARTITION_NON_EXISTENT = 1507; -exports.ER_DROP_LAST_PARTITION = 1508; -exports.ER_COALESCE_ONLY_ON_HASH_PARTITION = 1509; -exports.ER_REORG_HASH_ONLY_ON_SAME_NO = 1510; -exports.ER_REORG_NO_PARAM_ERROR = 1511; -exports.ER_ONLY_ON_RANGE_LIST_PARTITION = 1512; -exports.ER_ADD_PARTITION_SUBPART_ERROR = 1513; -exports.ER_ADD_PARTITION_NO_NEW_PARTITION = 1514; -exports.ER_COALESCE_PARTITION_NO_PARTITION = 1515; -exports.ER_REORG_PARTITION_NOT_EXIST = 1516; -exports.ER_SAME_NAME_PARTITION = 1517; -exports.ER_NO_BINLOG_ERROR = 1518; -exports.ER_CONSECUTIVE_REORG_PARTITIONS = 1519; -exports.ER_REORG_OUTSIDE_RANGE = 1520; -exports.ER_PARTITION_FUNCTION_FAILURE = 1521; -exports.ER_PART_STATE_ERROR = 1522; -exports.ER_LIMITED_PART_RANGE = 1523; -exports.ER_PLUGIN_IS_NOT_LOADED = 1524; -exports.ER_WRONG_VALUE = 1525; -exports.ER_NO_PARTITION_FOR_GIVEN_VALUE = 1526; -exports.ER_FILEGROUP_OPTION_ONLY_ONCE = 1527; -exports.ER_CREATE_FILEGROUP_FAILED = 1528; -exports.ER_DROP_FILEGROUP_FAILED = 1529; -exports.ER_TABLESPACE_AUTO_EXTEND_ERROR = 1530; -exports.ER_WRONG_SIZE_NUMBER = 1531; -exports.ER_SIZE_OVERFLOW_ERROR = 1532; -exports.ER_ALTER_FILEGROUP_FAILED = 1533; -exports.ER_BINLOG_ROW_LOGGING_FAILED = 1534; -exports.ER_BINLOG_ROW_WRONG_TABLE_DEF = 1535; -exports.ER_BINLOG_ROW_RBR_TO_SBR = 1536; -exports.ER_EVENT_ALREADY_EXISTS = 1537; -exports.ER_EVENT_STORE_FAILED = 1538; -exports.ER_EVENT_DOES_NOT_EXIST = 1539; -exports.ER_EVENT_CANT_ALTER = 1540; -exports.ER_EVENT_DROP_FAILED = 1541; -exports.ER_EVENT_INTERVAL_NOT_POSITIVE_OR_TOO_BIG = 1542; -exports.ER_EVENT_ENDS_BEFORE_STARTS = 1543; -exports.ER_EVENT_EXEC_TIME_IN_THE_PAST = 1544; -exports.ER_EVENT_OPEN_TABLE_FAILED = 1545; -exports.ER_EVENT_NEITHER_M_EXPR_NOR_M_AT = 1546; -exports.ER_COL_COUNT_DOESNT_MATCH_CORRUPTED = 1547; -exports.ER_CANNOT_LOAD_FROM_TABLE = 1548; -exports.ER_EVENT_CANNOT_DELETE = 1549; -exports.ER_EVENT_COMPILE_ERROR = 1550; -exports.ER_EVENT_SAME_NAME = 1551; -exports.ER_EVENT_DATA_TOO_LONG = 1552; -exports.ER_DROP_INDEX_FK = 1553; -exports.ER_WARN_DEPRECATED_SYNTAX_WITH_VER = 1554; -exports.ER_CANT_WRITE_LOCK_LOG_TABLE = 1555; -exports.ER_CANT_LOCK_LOG_TABLE = 1556; -exports.ER_FOREIGN_DUPLICATE_KEY = 1557; -exports.ER_COL_COUNT_DOESNT_MATCH_PLEASE_UPDATE = 1558; -exports.ER_TEMP_TABLE_PREVENTS_SWITCH_OUT_OF_RBR = 1559; -exports.ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_FORMAT = 1560; -exports.ER_NDB_CANT_SWITCH_BINLOG_FORMAT = 1561; -exports.ER_PARTITION_NO_TEMPORARY = 1562; -exports.ER_PARTITION_CONST_DOMAIN_ERROR = 1563; -exports.ER_PARTITION_FUNCTION_IS_NOT_ALLOWED = 1564; -exports.ER_DDL_LOG_ERROR = 1565; -exports.ER_NULL_IN_VALUES_LESS_THAN = 1566; -exports.ER_WRONG_PARTITION_NAME = 1567; -exports.ER_CANT_CHANGE_TX_CHARACTERISTICS = 1568; -exports.ER_DUP_ENTRY_AUTOINCREMENT_CASE = 1569; -exports.ER_EVENT_MODIFY_QUEUE_ERROR = 1570; -exports.ER_EVENT_SET_VAR_ERROR = 1571; -exports.ER_PARTITION_MERGE_ERROR = 1572; -exports.ER_CANT_ACTIVATE_LOG = 1573; -exports.ER_RBR_NOT_AVAILABLE = 1574; -exports.ER_BASE = 1575; -exports.ER_EVENT_RECURSION_FORBIDDEN = 1576; -exports.ER_EVENTS_DB_ERROR = 1577; -exports.ER_ONLY_INTEGERS_ALLOWED = 1578; -exports.ER_UNSUPORTED_LOG_ENGINE = 1579; -exports.ER_BAD_LOG_STATEMENT = 1580; -exports.ER_CANT_RENAME_LOG_TABLE = 1581; -exports.ER_WRONG_PARAMCOUNT_TO_NATIVE_FCT = 1582; -exports.ER_WRONG_PARAMETERS_TO_NATIVE_FCT = 1583; -exports.ER_WRONG_PARAMETERS_TO_STORED_FCT = 1584; -exports.ER_NATIVE_FCT_NAME_COLLISION = 1585; -exports.ER_DUP_ENTRY_WITH_KEY_NAME = 1586; -exports.ER_BINLOG_PURGE_EMFILE = 1587; -exports.ER_EVENT_CANNOT_CREATE_IN_THE_PAST = 1588; -exports.ER_EVENT_CANNOT_ALTER_IN_THE_PAST = 1589; -exports.ER_SLAVE_INCIDENT = 1590; -exports.ER_NO_PARTITION_FOR_GIVEN_VALUE_SILENT = 1591; -exports.ER_BINLOG_UNSAFE_STATEMENT = 1592; -exports.ER_SLAVE_FATAL_ERROR = 1593; -exports.ER_SLAVE_RELAY_LOG_READ_FAILURE = 1594; -exports.ER_SLAVE_RELAY_LOG_WRITE_FAILURE = 1595; -exports.ER_SLAVE_CREATE_EVENT_FAILURE = 1596; -exports.ER_SLAVE_MASTER_COM_FAILURE = 1597; -exports.ER_BINLOG_LOGGING_IMPOSSIBLE = 1598; -exports.ER_VIEW_NO_CREATION_CTX = 1599; -exports.ER_VIEW_INVALID_CREATION_CTX = 1600; -exports.ER_SR_INVALID_CREATION_CTX = 1601; -exports.ER_TRG_CORRUPTED_FILE = 1602; -exports.ER_TRG_NO_CREATION_CTX = 1603; -exports.ER_TRG_INVALID_CREATION_CTX = 1604; -exports.ER_EVENT_INVALID_CREATION_CTX = 1605; -exports.ER_TRG_CANT_OPEN_TABLE = 1606; -exports.ER_CANT_CREATE_SROUTINE = 1607; -exports.ER_NEVER_USED = 1608; -exports.ER_NO_FORMAT_DESCRIPTION_EVENT_BEFORE_BINLOG_STATEMENT = 1609; -exports.ER_SLAVE_CORRUPT_EVENT = 1610; -exports.ER_LOAD_DATA_INVALID_COLUMN = 1611; -exports.ER_LOG_PURGE_NO_FILE = 1612; -exports.ER_XA_RBTIMEOUT = 1613; -exports.ER_XA_RBDEADLOCK = 1614; -exports.ER_NEED_REPREPARE = 1615; -exports.ER_DELAYED_NOT_SUPPORTED = 1616; -exports.WARN_NO_MASTER_INFO = 1617; -exports.WARN_OPTION_IGNORED = 1618; -exports.WARN_PLUGIN_DELETE_BUILTIN = 1619; -exports.WARN_PLUGIN_BUSY = 1620; -exports.ER_VARIABLE_IS_READONLY = 1621; -exports.ER_WARN_ENGINE_TRANSACTION_ROLLBACK = 1622; -exports.ER_SLAVE_HEARTBEAT_FAILURE = 1623; -exports.ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE = 1624; -exports.ER_NDB_REPLICATION_SCHEMA_ERROR = 1625; -exports.ER_CONFLICT_FN_PARSE_ERROR = 1626; -exports.ER_EXCEPTIONS_WRITE_ERROR = 1627; -exports.ER_TOO_LONG_TABLE_COMMENT = 1628; -exports.ER_TOO_LONG_FIELD_COMMENT = 1629; -exports.ER_FUNC_INEXISTENT_NAME_COLLISION = 1630; -exports.ER_DATABASE_NAME = 1631; -exports.ER_TABLE_NAME = 1632; -exports.ER_PARTITION_NAME = 1633; -exports.ER_SUBPARTITION_NAME = 1634; -exports.ER_TEMPORARY_NAME = 1635; -exports.ER_RENAMED_NAME = 1636; -exports.ER_TOO_MANY_CONCURRENT_TRXS = 1637; -exports.WARN_NON_ASCII_SEPARATOR_NOT_IMPLEMENTED = 1638; -exports.ER_DEBUG_SYNC_TIMEOUT = 1639; -exports.ER_DEBUG_SYNC_HIT_LIMIT = 1640; -exports.ER_DUP_SIGNAL_SET = 1641; -exports.ER_SIGNAL_WARN = 1642; -exports.ER_SIGNAL_NOT_FOUND = 1643; -exports.ER_SIGNAL_EXCEPTION = 1644; -exports.ER_RESIGNAL_WITHOUT_ACTIVE_HANDLER = 1645; -exports.ER_SIGNAL_BAD_CONDITION_TYPE = 1646; -exports.WARN_COND_ITEM_TRUNCATED = 1647; -exports.ER_COND_ITEM_TOO_LONG = 1648; -exports.ER_UNKNOWN_LOCALE = 1649; -exports.ER_SLAVE_IGNORE_SERVER_IDS = 1650; -exports.ER_QUERY_CACHE_DISABLED = 1651; -exports.ER_SAME_NAME_PARTITION_FIELD = 1652; -exports.ER_PARTITION_COLUMN_LIST_ERROR = 1653; -exports.ER_WRONG_TYPE_COLUMN_VALUE_ERROR = 1654; -exports.ER_TOO_MANY_PARTITION_FUNC_FIELDS_ERROR = 1655; -exports.ER_MAXVALUE_IN_VALUES_IN = 1656; -exports.ER_TOO_MANY_VALUES_ERROR = 1657; -exports.ER_ROW_SINGLE_PARTITION_FIELD_ERROR = 1658; -exports.ER_FIELD_TYPE_NOT_ALLOWED_AS_PARTITION_FIELD = 1659; -exports.ER_PARTITION_FIELDS_TOO_LONG = 1660; -exports.ER_BINLOG_ROW_ENGINE_AND_STMT_ENGINE = 1661; -exports.ER_BINLOG_ROW_MODE_AND_STMT_ENGINE = 1662; -exports.ER_BINLOG_UNSAFE_AND_STMT_ENGINE = 1663; -exports.ER_BINLOG_ROW_INJECTION_AND_STMT_ENGINE = 1664; -exports.ER_BINLOG_STMT_MODE_AND_ROW_ENGINE = 1665; -exports.ER_BINLOG_ROW_INJECTION_AND_STMT_MODE = 1666; -exports.ER_BINLOG_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE = 1667; -exports.ER_BINLOG_UNSAFE_LIMIT = 1668; -exports.ER_BINLOG_UNSAFE_INSERT_DELAYED = 1669; -exports.ER_BINLOG_UNSAFE_SYSTEM_TABLE = 1670; -exports.ER_BINLOG_UNSAFE_AUTOINC_COLUMNS = 1671; -exports.ER_BINLOG_UNSAFE_UDF = 1672; -exports.ER_BINLOG_UNSAFE_SYSTEM_VARIABLE = 1673; -exports.ER_BINLOG_UNSAFE_SYSTEM_FUNCTION = 1674; -exports.ER_BINLOG_UNSAFE_NONTRANS_AFTER_TRANS = 1675; -exports.ER_MESSAGE_AND_STATEMENT = 1676; -exports.ER_SLAVE_CONVERSION_FAILED = 1677; -exports.ER_SLAVE_CANT_CREATE_CONVERSION = 1678; -exports.ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_FORMAT = 1679; -exports.ER_PATH_LENGTH = 1680; -exports.ER_WARN_DEPRECATED_SYNTAX_NO_REPLACEMENT = 1681; -exports.ER_WRONG_NATIVE_TABLE_STRUCTURE = 1682; -exports.ER_WRONG_PERFSCHEMA_USAGE = 1683; -exports.ER_WARN_I_S_SKIPPED_TABLE = 1684; -exports.ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_DIRECT = 1685; -exports.ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_DIRECT = 1686; -exports.ER_SPATIAL_MUST_HAVE_GEOM_COL = 1687; -exports.ER_TOO_LONG_INDEX_COMMENT = 1688; -exports.ER_LOCK_ABORTED = 1689; -exports.ER_DATA_OUT_OF_RANGE = 1690; -exports.ER_WRONG_SPVAR_TYPE_IN_LIMIT = 1691; -exports.ER_BINLOG_UNSAFE_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE = 1692; -exports.ER_BINLOG_UNSAFE_MIXED_STATEMENT = 1693; -exports.ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_SQL_LOG_BIN = 1694; -exports.ER_STORED_FUNCTION_PREVENTS_SWITCH_SQL_LOG_BIN = 1695; -exports.ER_FAILED_READ_FROM_PAR_FILE = 1696; -exports.ER_VALUES_IS_NOT_INT_TYPE_ERROR = 1697; -exports.ER_ACCESS_DENIED_NO_PASSWORD_ERROR = 1698; -exports.ER_SET_PASSWORD_AUTH_PLUGIN = 1699; -exports.ER_GRANT_PLUGIN_USER_EXISTS = 1700; -exports.ER_TRUNCATE_ILLEGAL_FK = 1701; -exports.ER_PLUGIN_IS_PERMANENT = 1702; -exports.ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MIN = 1703; -exports.ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MAX = 1704; -exports.ER_STMT_CACHE_FULL = 1705; -exports.ER_MULTI_UPDATE_KEY_CONFLICT = 1706; -exports.ER_TABLE_NEEDS_REBUILD = 1707; -exports.WARN_OPTION_BELOW_LIMIT = 1708; -exports.ER_INDEX_COLUMN_TOO_LONG = 1709; -exports.ER_ERROR_IN_TRIGGER_BODY = 1710; -exports.ER_ERROR_IN_UNKNOWN_TRIGGER_BODY = 1711; -exports.ER_INDEX_CORRUPT = 1712; -exports.ER_UNDO_RECORD_TOO_BIG = 1713; -exports.ER_BINLOG_UNSAFE_INSERT_IGNORE_SELECT = 1714; -exports.ER_BINLOG_UNSAFE_INSERT_SELECT_UPDATE = 1715; -exports.ER_BINLOG_UNSAFE_REPLACE_SELECT = 1716; -exports.ER_BINLOG_UNSAFE_CREATE_IGNORE_SELECT = 1717; -exports.ER_BINLOG_UNSAFE_CREATE_REPLACE_SELECT = 1718; -exports.ER_BINLOG_UNSAFE_UPDATE_IGNORE = 1719; -exports.ER_PLUGIN_NO_UNINSTALL = 1720; -exports.ER_PLUGIN_NO_INSTALL = 1721; -exports.ER_BINLOG_UNSAFE_WRITE_AUTOINC_SELECT = 1722; -exports.ER_BINLOG_UNSAFE_CREATE_SELECT_AUTOINC = 1723; -exports.ER_BINLOG_UNSAFE_INSERT_TWO_KEYS = 1724; -exports.ER_TABLE_IN_FK_CHECK = 1725; -exports.ER_UNSUPPORTED_ENGINE = 1726; -exports.ER_BINLOG_UNSAFE_AUTOINC_NOT_FIRST = 1727; -exports.ER_CANNOT_LOAD_FROM_TABLE_V = 1728; -exports.ER_MASTER_DELAY_VALUE_OUT_OF_RANGE = 1729; -exports.ER_ONLY_FD_AND_RBR_EVENTS_ALLOWED_IN_BINLOG_STATEMENT = 1730; -exports.ER_PARTITION_EXCHANGE_DIFFERENT_OPTION = 1731; -exports.ER_PARTITION_EXCHANGE_PART_TABLE = 1732; -exports.ER_PARTITION_EXCHANGE_TEMP_TABLE = 1733; -exports.ER_PARTITION_INSTEAD_OF_SUBPARTITION = 1734; -exports.ER_UNKNOWN_PARTITION = 1735; -exports.ER_TABLES_DIFFERENT_METADATA = 1736; -exports.ER_ROW_DOES_NOT_MATCH_PARTITION = 1737; -exports.ER_BINLOG_CACHE_SIZE_GREATER_THAN_MAX = 1738; -exports.ER_WARN_INDEX_NOT_APPLICABLE = 1739; -exports.ER_PARTITION_EXCHANGE_FOREIGN_KEY = 1740; -exports.ER_NO_SUCH_KEY_VALUE = 1741; -exports.ER_RPL_INFO_DATA_TOO_LONG = 1742; -exports.ER_NETWORK_READ_EVENT_CHECKSUM_FAILURE = 1743; -exports.ER_BINLOG_READ_EVENT_CHECKSUM_FAILURE = 1744; -exports.ER_BINLOG_STMT_CACHE_SIZE_GREATER_THAN_MAX = 1745; -exports.ER_CANT_UPDATE_TABLE_IN_CREATE_TABLE_SELECT = 1746; -exports.ER_PARTITION_CLAUSE_ON_NONPARTITIONED = 1747; -exports.ER_ROW_DOES_NOT_MATCH_GIVEN_PARTITION_SET = 1748; -exports.ER_NO_SUCH_PARTITION = 1749; -exports.ER_CHANGE_RPL_INFO_REPOSITORY_FAILURE = 1750; -exports.ER_WARNING_NOT_COMPLETE_ROLLBACK_WITH_CREATED_TEMP_TABLE = 1751; -exports.ER_WARNING_NOT_COMPLETE_ROLLBACK_WITH_DROPPED_TEMP_TABLE = 1752; -exports.ER_MTS_FEATURE_IS_NOT_SUPPORTED = 1753; -exports.ER_MTS_UPDATED_DBS_GREATER_MAX = 1754; -exports.ER_MTS_CANT_PARALLEL = 1755; -exports.ER_MTS_INCONSISTENT_DATA = 1756; -exports.ER_FULLTEXT_NOT_SUPPORTED_WITH_PARTITIONING = 1757; -exports.ER_DA_INVALID_CONDITION_NUMBER = 1758; -exports.ER_INSECURE_PLAIN_TEXT = 1759; -exports.ER_INSECURE_CHANGE_MASTER = 1760; -exports.ER_FOREIGN_DUPLICATE_KEY_WITH_CHILD_INFO = 1761; -exports.ER_FOREIGN_DUPLICATE_KEY_WITHOUT_CHILD_INFO = 1762; -exports.ER_SQLTHREAD_WITH_SECURE_SLAVE = 1763; -exports.ER_TABLE_HAS_NO_FT = 1764; -exports.ER_VARIABLE_NOT_SETTABLE_IN_SF_OR_TRIGGER = 1765; -exports.ER_VARIABLE_NOT_SETTABLE_IN_TRANSACTION = 1766; -exports.ER_GTID_NEXT_IS_NOT_IN_GTID_NEXT_LIST = 1767; -exports.ER_CANT_CHANGE_GTID_NEXT_IN_TRANSACTION_WHEN_GTID_NEXT_LIST_IS_NULL = 1768; -exports.ER_SET_STATEMENT_CANNOT_INVOKE_FUNCTION = 1769; -exports.ER_GTID_NEXT_CANT_BE_AUTOMATIC_IF_GTID_NEXT_LIST_IS_NON_NULL = 1770; -exports.ER_SKIPPING_LOGGED_TRANSACTION = 1771; -exports.ER_MALFORMED_GTID_SET_SPECIFICATION = 1772; -exports.ER_MALFORMED_GTID_SET_ENCODING = 1773; -exports.ER_MALFORMED_GTID_SPECIFICATION = 1774; -exports.ER_GNO_EXHAUSTED = 1775; -exports.ER_BAD_SLAVE_AUTO_POSITION = 1776; -exports.ER_AUTO_POSITION_REQUIRES_GTID_MODE_ON = 1777; -exports.ER_CANT_DO_IMPLICIT_COMMIT_IN_TRX_WHEN_GTID_NEXT_IS_SET = 1778; -exports.ER_GTID_MODE_ = 1779; -exports.ER_GTID_MODE_REQUIRES_BINLOG = 1780; -exports.ER_CANT_SET_GTID_NEXT_TO_GTID_WHEN_GTID_MODE_IS_OFF = 1781; -exports.ER_CANT_SET_GTID_NEXT_TO_ANONYMOUS_WHEN_GTID_MODE_IS_ON = 1782; -exports.ER_CANT_SET_GTID_NEXT_LIST_TO_NON_NULL_WHEN_GTID_MODE_IS_OFF = 1783; -exports.ER_FOUND_GTID_EVENT_WHEN_GTID_MODE_IS_OFF = 1784; -exports.ER_GTID_UNSAFE_NON_TRANSACTIONAL_TABLE = 1785; -exports.ER_GTID_UNSAFE_CREATE_SELECT = 1786; -exports.ER_GTID_UNSAFE_CREATE_DROP_TEMPORARY_TABLE_IN_TRANSACTION = 1787; -exports.ER_GTID_MODE_CAN_ONLY_CHANGE_ONE_STEP_AT_A_TIME = 1788; -exports.ER_MASTER_HAS_PURGED_REQUIRED_GTIDS = 1789; -exports.ER_CANT_SET_GTID_NEXT_WHEN_OWNING_GTID = 1790; -exports.ER_UNKNOWN_EXPLAIN_FORMAT = 1791; -exports.ER_CANT_EXECUTE_IN_READ_ONLY_TRANSACTION = 1792; -exports.ER_TOO_LONG_TABLE_PARTITION_COMMENT = 1793; -exports.ER_SLAVE_CONFIGURATION = 1794; -exports.ER_INNODB_FT_LIMIT = 1795; -exports.ER_INNODB_NO_FT_TEMP_TABLE = 1796; -exports.ER_INNODB_FT_WRONG_DOCID_COLUMN = 1797; -exports.ER_INNODB_FT_WRONG_DOCID_INDEX = 1798; -exports.ER_INNODB_ONLINE_LOG_TOO_BIG = 1799; -exports.ER_UNKNOWN_ALTER_ALGORITHM = 1800; -exports.ER_UNKNOWN_ALTER_LOCK = 1801; -exports.ER_MTS_CHANGE_MASTER_CANT_RUN_WITH_GAPS = 1802; -exports.ER_MTS_RECOVERY_FAILURE = 1803; -exports.ER_MTS_RESET_WORKERS = 1804; -exports.ER_COL_COUNT_DOESNT_MATCH_CORRUPTED_V = 1805; -exports.ER_SLAVE_SILENT_RETRY_TRANSACTION = 1806; -exports.ER_DISCARD_FK_CHECKS_RUNNING = 1807; -exports.ER_TABLE_SCHEMA_MISMATCH = 1808; -exports.ER_TABLE_IN_SYSTEM_TABLESPACE = 1809; -exports.ER_IO_READ_ERROR = 1810; -exports.ER_IO_WRITE_ERROR = 1811; -exports.ER_TABLESPACE_MISSING = 1812; -exports.ER_TABLESPACE_EXISTS = 1813; -exports.ER_TABLESPACE_DISCARDED = 1814; -exports.ER_INTERNAL_ERROR = 1815; -exports.ER_INNODB_IMPORT_ERROR = 1816; -exports.ER_INNODB_INDEX_CORRUPT = 1817; -exports.ER_INVALID_YEAR_COLUMN_LENGTH = 1818; -exports.ER_NOT_VALID_PASSWORD = 1819; -exports.ER_MUST_CHANGE_PASSWORD = 1820; -exports.ER_FK_NO_INDEX_CHILD = 1821; -exports.ER_FK_NO_INDEX_PARENT = 1822; -exports.ER_FK_FAIL_ADD_SYSTEM = 1823; -exports.ER_FK_CANNOT_OPEN_PARENT = 1824; -exports.ER_FK_INCORRECT_OPTION = 1825; -exports.ER_FK_DUP_NAME = 1826; -exports.ER_PASSWORD_FORMAT = 1827; -exports.ER_FK_COLUMN_CANNOT_DROP = 1828; -exports.ER_FK_COLUMN_CANNOT_DROP_CHILD = 1829; -exports.ER_FK_COLUMN_NOT_NULL = 1830; -exports.ER_DUP_INDEX = 1831; -exports.ER_FK_COLUMN_CANNOT_CHANGE = 1832; -exports.ER_FK_COLUMN_CANNOT_CHANGE_CHILD = 1833; -exports.ER_FK_CANNOT_DELETE_PARENT = 1834; -exports.ER_MALFORMED_PACKET = 1835; -exports.ER_READ_ONLY_MODE = 1836; -exports.ER_GTID_NEXT_TYPE_UNDEFINED_GROUP = 1837; -exports.ER_VARIABLE_NOT_SETTABLE_IN_SP = 1838; -exports.ER_CANT_SET_GTID_PURGED_WHEN_GTID_MODE_IS_OFF = 1839; -exports.ER_CANT_SET_GTID_PURGED_WHEN_GTID_EXECUTED_IS_NOT_EMPTY = 1840; -exports.ER_CANT_SET_GTID_PURGED_WHEN_OWNED_GTIDS_IS_NOT_EMPTY = 1841; -exports.ER_GTID_PURGED_WAS_CHANGED = 1842; -exports.ER_GTID_EXECUTED_WAS_CHANGED = 1843; -exports.ER_BINLOG_STMT_MODE_AND_NO_REPL_TABLES = 1844; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED = 1845; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON = 1846; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_COPY = 1847; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_PARTITION = 1848; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FK_RENAME = 1849; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_COLUMN_TYPE = 1850; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FK_CHECK = 1851; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_IGNORE = 1852; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_NOPK = 1853; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_AUTOINC = 1854; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_HIDDEN_FTS = 1855; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_CHANGE_FTS = 1856; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FTS = 1857; -exports.ER_SQL_SLAVE_SKIP_COUNTER_NOT_SETTABLE_IN_GTID_MODE = 1858; -exports.ER_DUP_UNKNOWN_IN_INDEX = 1859; -exports.ER_IDENT_CAUSES_TOO_LONG_PATH = 1860; -exports.ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_NOT_NULL = 1861; -exports.ER_MUST_CHANGE_PASSWORD_LOGIN = 1862; -exports.ER_ROW_IN_WRONG_PARTITION = 1863; -exports.ER_MTS_EVENT_BIGGER_PENDING_JOBS_SIZE_MAX = 1864; -exports.ER_INNODB_NO_FT_USES_PARSER = 1865; -exports.ER_BINLOG_LOGICAL_CORRUPTION = 1866; -exports.ER_WARN_PURGE_LOG_IN_USE = 1867; -exports.ER_WARN_PURGE_LOG_IS_ACTIVE = 1868; -exports.ER_AUTO_INCREMENT_CONFLICT = 1869; -exports.WARN_ON_BLOCKHOLE_IN_RBR = 1870; -exports.ER_SLAVE_MI_INIT_REPOSITORY = 1871; -exports.ER_SLAVE_RLI_INIT_REPOSITORY = 1872; -exports.ER_ACCESS_DENIED_CHANGE_USER_ERROR = 1873; -exports.ER_INNODB_READ_ONLY = 1874; -exports.ER_STOP_SLAVE_SQL_THREAD_TIMEOUT = 1875; -exports.ER_STOP_SLAVE_IO_THREAD_TIMEOUT = 1876; -exports.ER_TABLE_CORRUPT = 1877; -exports.ER_TEMP_FILE_WRITE_FAILURE = 1878; -exports.ER_INNODB_FT_AUX_NOT_HEX_ID = 1879; -exports.ER_OLD_TEMPORALS_UPGRADED = 1880; -exports.ER_INNODB_FORCED_RECOVERY = 1881; -exports.ER_AES_INVALID_IV = 1882; - -// Lookup-by-number table -exports[1] = 'EE_CANTCREATEFILE'; -exports[2] = 'EE_READ'; -exports[3] = 'EE_WRITE'; -exports[4] = 'EE_BADCLOSE'; -exports[5] = 'EE_OUTOFMEMORY'; -exports[6] = 'EE_DELETE'; -exports[7] = 'EE_LINK'; -exports[9] = 'EE_EOFERR'; -exports[10] = 'EE_CANTLOCK'; -exports[11] = 'EE_CANTUNLOCK'; -exports[12] = 'EE_DIR'; -exports[13] = 'EE_STAT'; -exports[14] = 'EE_CANT_CHSIZE'; -exports[15] = 'EE_CANT_OPEN_STREAM'; -exports[16] = 'EE_GETWD'; -exports[17] = 'EE_SETWD'; -exports[18] = 'EE_LINK_WARNING'; -exports[19] = 'EE_OPEN_WARNING'; -exports[20] = 'EE_DISK_FULL'; -exports[21] = 'EE_CANT_MKDIR'; -exports[22] = 'EE_UNKNOWN_CHARSET'; -exports[23] = 'EE_OUT_OF_FILERESOURCES'; -exports[24] = 'EE_CANT_READLINK'; -exports[25] = 'EE_CANT_SYMLINK'; -exports[26] = 'EE_REALPATH'; -exports[27] = 'EE_SYNC'; -exports[28] = 'EE_UNKNOWN_COLLATION'; -exports[29] = 'EE_FILENOTFOUND'; -exports[30] = 'EE_FILE_NOT_CLOSED'; -exports[31] = 'EE_CHANGE_OWNERSHIP'; -exports[32] = 'EE_CHANGE_PERMISSIONS'; -exports[33] = 'EE_CANT_SEEK'; -exports[120] = 'HA_ERR_KEY_NOT_FOUND'; -exports[121] = 'HA_ERR_FOUND_DUPP_KEY'; -exports[122] = 'HA_ERR_INTERNAL_ERROR'; -exports[123] = 'HA_ERR_RECORD_CHANGED'; -exports[124] = 'HA_ERR_WRONG_INDEX'; -exports[126] = 'HA_ERR_CRASHED'; -exports[127] = 'HA_ERR_WRONG_IN_RECORD'; -exports[128] = 'HA_ERR_OUT_OF_MEM'; -exports[130] = 'HA_ERR_NOT_A_TABLE'; -exports[131] = 'HA_ERR_WRONG_COMMAND'; -exports[132] = 'HA_ERR_OLD_FILE'; -exports[133] = 'HA_ERR_NO_ACTIVE_RECORD'; -exports[134] = 'HA_ERR_RECORD_DELETED'; -exports[135] = 'HA_ERR_RECORD_FILE_FULL'; -exports[136] = 'HA_ERR_INDEX_FILE_FULL'; -exports[137] = 'HA_ERR_END_OF_FILE'; -exports[138] = 'HA_ERR_UNSUPPORTED'; -exports[139] = 'HA_ERR_TO_BIG_ROW'; -exports[140] = 'HA_WRONG_CREATE_OPTION'; -exports[141] = 'HA_ERR_FOUND_DUPP_UNIQUE'; -exports[142] = 'HA_ERR_UNKNOWN_CHARSET'; -exports[143] = 'HA_ERR_WRONG_MRG_TABLE_DEF'; -exports[144] = 'HA_ERR_CRASHED_ON_REPAIR'; -exports[145] = 'HA_ERR_CRASHED_ON_USAGE'; -exports[146] = 'HA_ERR_LOCK_WAIT_TIMEOUT'; -exports[147] = 'HA_ERR_LOCK_TABLE_FULL'; -exports[148] = 'HA_ERR_READ_ONLY_TRANSACTION'; -exports[149] = 'HA_ERR_LOCK_DEADLOCK'; -exports[150] = 'HA_ERR_CANNOT_ADD_FOREIGN'; -exports[151] = 'HA_ERR_NO_REFERENCED_ROW'; -exports[152] = 'HA_ERR_ROW_IS_REFERENCED'; -exports[153] = 'HA_ERR_NO_SAVEPOINT'; -exports[154] = 'HA_ERR_NON_UNIQUE_BLOCK_SIZE'; -exports[155] = 'HA_ERR_NO_SUCH_TABLE'; -exports[156] = 'HA_ERR_TABLE_EXIST'; -exports[157] = 'HA_ERR_NO_CONNECTION'; -exports[158] = 'HA_ERR_NULL_IN_SPATIAL'; -exports[159] = 'HA_ERR_TABLE_DEF_CHANGED'; -exports[160] = 'HA_ERR_NO_PARTITION_FOUND'; -exports[161] = 'HA_ERR_RBR_LOGGING_FAILED'; -exports[162] = 'HA_ERR_DROP_INDEX_FK'; -exports[163] = 'HA_ERR_FOREIGN_DUPLICATE_KEY'; -exports[164] = 'HA_ERR_TABLE_NEEDS_UPGRADE'; -exports[165] = 'HA_ERR_TABLE_READONLY'; -exports[166] = 'HA_ERR_AUTOINC_READ_FAILED'; -exports[167] = 'HA_ERR_AUTOINC_ERANGE'; -exports[168] = 'HA_ERR_GENERIC'; -exports[169] = 'HA_ERR_RECORD_IS_THE_SAME'; -exports[170] = 'HA_ERR_LOGGING_IMPOSSIBLE'; -exports[171] = 'HA_ERR_CORRUPT_EVENT'; -exports[172] = 'HA_ERR_NEW_FILE'; -exports[173] = 'HA_ERR_ROWS_EVENT_APPLY'; -exports[174] = 'HA_ERR_INITIALIZATION'; -exports[175] = 'HA_ERR_FILE_TOO_SHORT'; -exports[176] = 'HA_ERR_WRONG_CRC'; -exports[177] = 'HA_ERR_TOO_MANY_CONCURRENT_TRXS'; -exports[178] = 'HA_ERR_NOT_IN_LOCK_PARTITIONS'; -exports[179] = 'HA_ERR_INDEX_COL_TOO_LONG'; -exports[180] = 'HA_ERR_INDEX_CORRUPT'; -exports[181] = 'HA_ERR_UNDO_REC_TOO_BIG'; -exports[182] = 'HA_FTS_INVALID_DOCID'; -exports[183] = 'HA_ERR_TABLE_IN_FK_CHECK'; -exports[184] = 'HA_ERR_TABLESPACE_EXISTS'; -exports[185] = 'HA_ERR_TOO_MANY_FIELDS'; -exports[186] = 'HA_ERR_ROW_IN_WRONG_PARTITION'; -exports[187] = 'HA_ERR_INNODB_READ_ONLY'; -exports[188] = 'HA_ERR_FTS_EXCEED_RESULT_CACHE_LIMIT'; -exports[189] = 'HA_ERR_TEMP_FILE_WRITE_FAILURE'; -exports[190] = 'HA_ERR_INNODB_FORCED_RECOVERY'; -exports[191] = 'HA_ERR_FTS_TOO_MANY_WORDS_IN_PHRASE'; -exports[1000] = 'ER_HASHCHK'; -exports[1001] = 'ER_NISAMCHK'; -exports[1002] = 'ER_NO'; -exports[1003] = 'ER_YES'; -exports[1004] = 'ER_CANT_CREATE_FILE'; -exports[1005] = 'ER_CANT_CREATE_TABLE'; -exports[1006] = 'ER_CANT_CREATE_DB'; -exports[1007] = 'ER_DB_CREATE_EXISTS'; -exports[1008] = 'ER_DB_DROP_EXISTS'; -exports[1009] = 'ER_DB_DROP_DELETE'; -exports[1010] = 'ER_DB_DROP_RMDIR'; -exports[1011] = 'ER_CANT_DELETE_FILE'; -exports[1012] = 'ER_CANT_FIND_SYSTEM_REC'; -exports[1013] = 'ER_CANT_GET_STAT'; -exports[1014] = 'ER_CANT_GET_WD'; -exports[1015] = 'ER_CANT_LOCK'; -exports[1016] = 'ER_CANT_OPEN_FILE'; -exports[1017] = 'ER_FILE_NOT_FOUND'; -exports[1018] = 'ER_CANT_READ_DIR'; -exports[1019] = 'ER_CANT_SET_WD'; -exports[1020] = 'ER_CHECKREAD'; -exports[1021] = 'ER_DISK_FULL'; -exports[1022] = 'ER_DUP_KEY'; -exports[1023] = 'ER_ERROR_ON_CLOSE'; -exports[1024] = 'ER_ERROR_ON_READ'; -exports[1025] = 'ER_ERROR_ON_RENAME'; -exports[1026] = 'ER_ERROR_ON_WRITE'; -exports[1027] = 'ER_FILE_USED'; -exports[1028] = 'ER_FILSORT_ABORT'; -exports[1029] = 'ER_FORM_NOT_FOUND'; -exports[1030] = 'ER_GET_ERRNO'; -exports[1031] = 'ER_ILLEGAL_HA'; -exports[1032] = 'ER_KEY_NOT_FOUND'; -exports[1033] = 'ER_NOT_FORM_FILE'; -exports[1034] = 'ER_NOT_KEYFILE'; -exports[1035] = 'ER_OLD_KEYFILE'; -exports[1036] = 'ER_OPEN_AS_READONLY'; -exports[1037] = 'ER_OUTOFMEMORY'; -exports[1038] = 'ER_OUT_OF_SORTMEMORY'; -exports[1039] = 'ER_UNEXPECTED_EOF'; -exports[1040] = 'ER_CON_COUNT_ERROR'; -exports[1041] = 'ER_OUT_OF_RESOURCES'; -exports[1042] = 'ER_BAD_HOST_ERROR'; -exports[1043] = 'ER_HANDSHAKE_ERROR'; -exports[1044] = 'ER_DBACCESS_DENIED_ERROR'; -exports[1045] = 'ER_ACCESS_DENIED_ERROR'; -exports[1046] = 'ER_NO_DB_ERROR'; -exports[1047] = 'ER_UNKNOWN_COM_ERROR'; -exports[1048] = 'ER_BAD_NULL_ERROR'; -exports[1049] = 'ER_BAD_DB_ERROR'; -exports[1050] = 'ER_TABLE_EXISTS_ERROR'; -exports[1051] = 'ER_BAD_TABLE_ERROR'; -exports[1052] = 'ER_NON_UNIQ_ERROR'; -exports[1053] = 'ER_SERVER_SHUTDOWN'; -exports[1054] = 'ER_BAD_FIELD_ERROR'; -exports[1055] = 'ER_WRONG_FIELD_WITH_GROUP'; -exports[1056] = 'ER_WRONG_GROUP_FIELD'; -exports[1057] = 'ER_WRONG_SUM_SELECT'; -exports[1058] = 'ER_WRONG_VALUE_COUNT'; -exports[1059] = 'ER_TOO_LONG_IDENT'; -exports[1060] = 'ER_DUP_FIELDNAME'; -exports[1061] = 'ER_DUP_KEYNAME'; -exports[1062] = 'ER_DUP_ENTRY'; -exports[1063] = 'ER_WRONG_FIELD_SPEC'; -exports[1064] = 'ER_PARSE_ERROR'; -exports[1065] = 'ER_EMPTY_QUERY'; -exports[1066] = 'ER_NONUNIQ_TABLE'; -exports[1067] = 'ER_INVALID_DEFAULT'; -exports[1068] = 'ER_MULTIPLE_PRI_KEY'; -exports[1069] = 'ER_TOO_MANY_KEYS'; -exports[1070] = 'ER_TOO_MANY_KEY_PARTS'; -exports[1071] = 'ER_TOO_LONG_KEY'; -exports[1072] = 'ER_KEY_COLUMN_DOES_NOT_EXITS'; -exports[1073] = 'ER_BLOB_USED_AS_KEY'; -exports[1074] = 'ER_TOO_BIG_FIELDLENGTH'; -exports[1075] = 'ER_WRONG_AUTO_KEY'; -exports[1076] = 'ER_READY'; -exports[1077] = 'ER_NORMAL_SHUTDOWN'; -exports[1078] = 'ER_GOT_SIGNAL'; -exports[1079] = 'ER_SHUTDOWN_COMPLETE'; -exports[1080] = 'ER_FORCING_CLOSE'; -exports[1081] = 'ER_IPSOCK_ERROR'; -exports[1082] = 'ER_NO_SUCH_INDEX'; -exports[1083] = 'ER_WRONG_FIELD_TERMINATORS'; -exports[1084] = 'ER_BLOBS_AND_NO_TERMINATED'; -exports[1085] = 'ER_TEXTFILE_NOT_READABLE'; -exports[1086] = 'ER_FILE_EXISTS_ERROR'; -exports[1087] = 'ER_LOAD_INFO'; -exports[1088] = 'ER_ALTER_INFO'; -exports[1089] = 'ER_WRONG_SUB_KEY'; -exports[1090] = 'ER_CANT_REMOVE_ALL_FIELDS'; -exports[1091] = 'ER_CANT_DROP_FIELD_OR_KEY'; -exports[1092] = 'ER_INSERT_INFO'; -exports[1093] = 'ER_UPDATE_TABLE_USED'; -exports[1094] = 'ER_NO_SUCH_THREAD'; -exports[1095] = 'ER_KILL_DENIED_ERROR'; -exports[1096] = 'ER_NO_TABLES_USED'; -exports[1097] = 'ER_TOO_BIG_SET'; -exports[1098] = 'ER_NO_UNIQUE_LOGFILE'; -exports[1099] = 'ER_TABLE_NOT_LOCKED_FOR_WRITE'; -exports[1100] = 'ER_TABLE_NOT_LOCKED'; -exports[1101] = 'ER_BLOB_CANT_HAVE_DEFAULT'; -exports[1102] = 'ER_WRONG_DB_NAME'; -exports[1103] = 'ER_WRONG_TABLE_NAME'; -exports[1104] = 'ER_TOO_BIG_SELECT'; -exports[1105] = 'ER_UNKNOWN_ERROR'; -exports[1106] = 'ER_UNKNOWN_PROCEDURE'; -exports[1107] = 'ER_WRONG_PARAMCOUNT_TO_PROCEDURE'; -exports[1108] = 'ER_WRONG_PARAMETERS_TO_PROCEDURE'; -exports[1109] = 'ER_UNKNOWN_TABLE'; -exports[1110] = 'ER_FIELD_SPECIFIED_TWICE'; -exports[1111] = 'ER_INVALID_GROUP_FUNC_USE'; -exports[1112] = 'ER_UNSUPPORTED_EXTENSION'; -exports[1113] = 'ER_TABLE_MUST_HAVE_COLUMNS'; -exports[1114] = 'ER_RECORD_FILE_FULL'; -exports[1115] = 'ER_UNKNOWN_CHARACTER_SET'; -exports[1116] = 'ER_TOO_MANY_TABLES'; -exports[1117] = 'ER_TOO_MANY_FIELDS'; -exports[1118] = 'ER_TOO_BIG_ROWSIZE'; -exports[1119] = 'ER_STACK_OVERRUN'; -exports[1120] = 'ER_WRONG_OUTER_JOIN'; -exports[1121] = 'ER_NULL_COLUMN_IN_INDEX'; -exports[1122] = 'ER_CANT_FIND_UDF'; -exports[1123] = 'ER_CANT_INITIALIZE_UDF'; -exports[1124] = 'ER_UDF_NO_PATHS'; -exports[1125] = 'ER_UDF_EXISTS'; -exports[1126] = 'ER_CANT_OPEN_LIBRARY'; -exports[1127] = 'ER_CANT_FIND_DL_ENTRY'; -exports[1128] = 'ER_FUNCTION_NOT_DEFINED'; -exports[1129] = 'ER_HOST_IS_BLOCKED'; -exports[1130] = 'ER_HOST_NOT_PRIVILEGED'; -exports[1131] = 'ER_PASSWORD_ANONYMOUS_USER'; -exports[1132] = 'ER_PASSWORD_NOT_ALLOWED'; -exports[1133] = 'ER_PASSWORD_NO_MATCH'; -exports[1134] = 'ER_UPDATE_INFO'; -exports[1135] = 'ER_CANT_CREATE_THREAD'; -exports[1136] = 'ER_WRONG_VALUE_COUNT_ON_ROW'; -exports[1137] = 'ER_CANT_REOPEN_TABLE'; -exports[1138] = 'ER_INVALID_USE_OF_NULL'; -exports[1139] = 'ER_REGEXP_ERROR'; -exports[1140] = 'ER_MIX_OF_GROUP_FUNC_AND_FIELDS'; -exports[1141] = 'ER_NONEXISTING_GRANT'; -exports[1142] = 'ER_TABLEACCESS_DENIED_ERROR'; -exports[1143] = 'ER_COLUMNACCESS_DENIED_ERROR'; -exports[1144] = 'ER_ILLEGAL_GRANT_FOR_TABLE'; -exports[1145] = 'ER_GRANT_WRONG_HOST_OR_USER'; -exports[1146] = 'ER_NO_SUCH_TABLE'; -exports[1147] = 'ER_NONEXISTING_TABLE_GRANT'; -exports[1148] = 'ER_NOT_ALLOWED_COMMAND'; -exports[1149] = 'ER_SYNTAX_ERROR'; -exports[1150] = 'ER_DELAYED_CANT_CHANGE_LOCK'; -exports[1151] = 'ER_TOO_MANY_DELAYED_THREADS'; -exports[1152] = 'ER_ABORTING_CONNECTION'; -exports[1153] = 'ER_NET_PACKET_TOO_LARGE'; -exports[1154] = 'ER_NET_READ_ERROR_FROM_PIPE'; -exports[1155] = 'ER_NET_FCNTL_ERROR'; -exports[1156] = 'ER_NET_PACKETS_OUT_OF_ORDER'; -exports[1157] = 'ER_NET_UNCOMPRESS_ERROR'; -exports[1158] = 'ER_NET_READ_ERROR'; -exports[1159] = 'ER_NET_READ_INTERRUPTED'; -exports[1160] = 'ER_NET_ERROR_ON_WRITE'; -exports[1161] = 'ER_NET_WRITE_INTERRUPTED'; -exports[1162] = 'ER_TOO_LONG_STRING'; -exports[1163] = 'ER_TABLE_CANT_HANDLE_BLOB'; -exports[1164] = 'ER_TABLE_CANT_HANDLE_AUTO_INCREMENT'; -exports[1165] = 'ER_DELAYED_INSERT_TABLE_LOCKED'; -exports[1166] = 'ER_WRONG_COLUMN_NAME'; -exports[1167] = 'ER_WRONG_KEY_COLUMN'; -exports[1168] = 'ER_WRONG_MRG_TABLE'; -exports[1169] = 'ER_DUP_UNIQUE'; -exports[1170] = 'ER_BLOB_KEY_WITHOUT_LENGTH'; -exports[1171] = 'ER_PRIMARY_CANT_HAVE_NULL'; -exports[1172] = 'ER_TOO_MANY_ROWS'; -exports[1173] = 'ER_REQUIRES_PRIMARY_KEY'; -exports[1174] = 'ER_NO_RAID_COMPILED'; -exports[1175] = 'ER_UPDATE_WITHOUT_KEY_IN_SAFE_MODE'; -exports[1176] = 'ER_KEY_DOES_NOT_EXITS'; -exports[1177] = 'ER_CHECK_NO_SUCH_TABLE'; -exports[1178] = 'ER_CHECK_NOT_IMPLEMENTED'; -exports[1179] = 'ER_CANT_DO_THIS_DURING_AN_TRANSACTION'; -exports[1180] = 'ER_ERROR_DURING_COMMIT'; -exports[1181] = 'ER_ERROR_DURING_ROLLBACK'; -exports[1182] = 'ER_ERROR_DURING_FLUSH_LOGS'; -exports[1183] = 'ER_ERROR_DURING_CHECKPOINT'; -exports[1184] = 'ER_NEW_ABORTING_CONNECTION'; -exports[1185] = 'ER_DUMP_NOT_IMPLEMENTED'; -exports[1186] = 'ER_FLUSH_MASTER_BINLOG_CLOSED'; -exports[1187] = 'ER_INDEX_REBUILD'; -exports[1188] = 'ER_MASTER'; -exports[1189] = 'ER_MASTER_NET_READ'; -exports[1190] = 'ER_MASTER_NET_WRITE'; -exports[1191] = 'ER_FT_MATCHING_KEY_NOT_FOUND'; -exports[1192] = 'ER_LOCK_OR_ACTIVE_TRANSACTION'; -exports[1193] = 'ER_UNKNOWN_SYSTEM_VARIABLE'; -exports[1194] = 'ER_CRASHED_ON_USAGE'; -exports[1195] = 'ER_CRASHED_ON_REPAIR'; -exports[1196] = 'ER_WARNING_NOT_COMPLETE_ROLLBACK'; -exports[1197] = 'ER_TRANS_CACHE_FULL'; -exports[1198] = 'ER_SLAVE_MUST_STOP'; -exports[1199] = 'ER_SLAVE_NOT_RUNNING'; -exports[1200] = 'ER_BAD_SLAVE'; -exports[1201] = 'ER_MASTER_INFO'; -exports[1202] = 'ER_SLAVE_THREAD'; -exports[1203] = 'ER_TOO_MANY_USER_CONNECTIONS'; -exports[1204] = 'ER_SET_CONSTANTS_ONLY'; -exports[1205] = 'ER_LOCK_WAIT_TIMEOUT'; -exports[1206] = 'ER_LOCK_TABLE_FULL'; -exports[1207] = 'ER_READ_ONLY_TRANSACTION'; -exports[1208] = 'ER_DROP_DB_WITH_READ_LOCK'; -exports[1209] = 'ER_CREATE_DB_WITH_READ_LOCK'; -exports[1210] = 'ER_WRONG_ARGUMENTS'; -exports[1211] = 'ER_NO_PERMISSION_TO_CREATE_USER'; -exports[1212] = 'ER_UNION_TABLES_IN_DIFFERENT_DIR'; -exports[1213] = 'ER_LOCK_DEADLOCK'; -exports[1214] = 'ER_TABLE_CANT_HANDLE_FT'; -exports[1215] = 'ER_CANNOT_ADD_FOREIGN'; -exports[1216] = 'ER_NO_REFERENCED_ROW'; -exports[1217] = 'ER_ROW_IS_REFERENCED'; -exports[1218] = 'ER_CONNECT_TO_MASTER'; -exports[1219] = 'ER_QUERY_ON_MASTER'; -exports[1220] = 'ER_ERROR_WHEN_EXECUTING_COMMAND'; -exports[1221] = 'ER_WRONG_USAGE'; -exports[1222] = 'ER_WRONG_NUMBER_OF_COLUMNS_IN_SELECT'; -exports[1223] = 'ER_CANT_UPDATE_WITH_READLOCK'; -exports[1224] = 'ER_MIXING_NOT_ALLOWED'; -exports[1225] = 'ER_DUP_ARGUMENT'; -exports[1226] = 'ER_USER_LIMIT_REACHED'; -exports[1227] = 'ER_SPECIFIC_ACCESS_DENIED_ERROR'; -exports[1228] = 'ER_LOCAL_VARIABLE'; -exports[1229] = 'ER_GLOBAL_VARIABLE'; -exports[1230] = 'ER_NO_DEFAULT'; -exports[1231] = 'ER_WRONG_VALUE_FOR_VAR'; -exports[1232] = 'ER_WRONG_TYPE_FOR_VAR'; -exports[1233] = 'ER_VAR_CANT_BE_READ'; -exports[1234] = 'ER_CANT_USE_OPTION_HERE'; -exports[1235] = 'ER_NOT_SUPPORTED_YET'; -exports[1236] = 'ER_MASTER_FATAL_ERROR_READING_BINLOG'; -exports[1237] = 'ER_SLAVE_IGNORED_TABLE'; -exports[1238] = 'ER_INCORRECT_GLOBAL_LOCAL_VAR'; -exports[1239] = 'ER_WRONG_FK_DEF'; -exports[1240] = 'ER_KEY_REF_DO_NOT_MATCH_TABLE_REF'; -exports[1241] = 'ER_OPERAND_COLUMNS'; -exports[1242] = 'ER_SUBQUERY_NO_'; -exports[1243] = 'ER_UNKNOWN_STMT_HANDLER'; -exports[1244] = 'ER_CORRUPT_HELP_DB'; -exports[1245] = 'ER_CYCLIC_REFERENCE'; -exports[1246] = 'ER_AUTO_CONVERT'; -exports[1247] = 'ER_ILLEGAL_REFERENCE'; -exports[1248] = 'ER_DERIVED_MUST_HAVE_ALIAS'; -exports[1249] = 'ER_SELECT_REDUCED'; -exports[1250] = 'ER_TABLENAME_NOT_ALLOWED_HERE'; -exports[1251] = 'ER_NOT_SUPPORTED_AUTH_MODE'; -exports[1252] = 'ER_SPATIAL_CANT_HAVE_NULL'; -exports[1253] = 'ER_COLLATION_CHARSET_MISMATCH'; -exports[1254] = 'ER_SLAVE_WAS_RUNNING'; -exports[1255] = 'ER_SLAVE_WAS_NOT_RUNNING'; -exports[1256] = 'ER_TOO_BIG_FOR_UNCOMPRESS'; -exports[1257] = 'ER_ZLIB_Z_MEM_ERROR'; -exports[1258] = 'ER_ZLIB_Z_BUF_ERROR'; -exports[1259] = 'ER_ZLIB_Z_DATA_ERROR'; -exports[1260] = 'ER_CUT_VALUE_GROUP_CONCAT'; -exports[1261] = 'ER_WARN_TOO_FEW_RECORDS'; -exports[1262] = 'ER_WARN_TOO_MANY_RECORDS'; -exports[1263] = 'ER_WARN_NULL_TO_NOTNULL'; -exports[1264] = 'ER_WARN_DATA_OUT_OF_RANGE'; -exports[1265] = 'WARN_DATA_TRUNCATED'; -exports[1266] = 'ER_WARN_USING_OTHER_HANDLER'; -exports[1267] = 'ER_CANT_AGGREGATE_'; -exports[1268] = 'ER_DROP_USER'; -exports[1269] = 'ER_REVOKE_GRANTS'; -exports[1270] = 'ER_CANT_AGGREGATE_'; -exports[1271] = 'ER_CANT_AGGREGATE_NCOLLATIONS'; -exports[1272] = 'ER_VARIABLE_IS_NOT_STRUCT'; -exports[1273] = 'ER_UNKNOWN_COLLATION'; -exports[1274] = 'ER_SLAVE_IGNORED_SSL_PARAMS'; -exports[1275] = 'ER_SERVER_IS_IN_SECURE_AUTH_MODE'; -exports[1276] = 'ER_WARN_FIELD_RESOLVED'; -exports[1277] = 'ER_BAD_SLAVE_UNTIL_COND'; -exports[1278] = 'ER_MISSING_SKIP_SLAVE'; -exports[1279] = 'ER_UNTIL_COND_IGNORED'; -exports[1280] = 'ER_WRONG_NAME_FOR_INDEX'; -exports[1281] = 'ER_WRONG_NAME_FOR_CATALOG'; -exports[1282] = 'ER_WARN_QC_RESIZE'; -exports[1283] = 'ER_BAD_FT_COLUMN'; -exports[1284] = 'ER_UNKNOWN_KEY_CACHE'; -exports[1285] = 'ER_WARN_HOSTNAME_WONT_WORK'; -exports[1286] = 'ER_UNKNOWN_STORAGE_ENGINE'; -exports[1287] = 'ER_WARN_DEPRECATED_SYNTAX'; -exports[1288] = 'ER_NON_UPDATABLE_TABLE'; -exports[1289] = 'ER_FEATURE_DISABLED'; -exports[1290] = 'ER_OPTION_PREVENTS_STATEMENT'; -exports[1291] = 'ER_DUPLICATED_VALUE_IN_TYPE'; -exports[1292] = 'ER_TRUNCATED_WRONG_VALUE'; -exports[1293] = 'ER_TOO_MUCH_AUTO_TIMESTAMP_COLS'; -exports[1294] = 'ER_INVALID_ON_UPDATE'; -exports[1295] = 'ER_UNSUPPORTED_PS'; -exports[1296] = 'ER_GET_ERRMSG'; -exports[1297] = 'ER_GET_TEMPORARY_ERRMSG'; -exports[1298] = 'ER_UNKNOWN_TIME_ZONE'; -exports[1299] = 'ER_WARN_INVALID_TIMESTAMP'; -exports[1300] = 'ER_INVALID_CHARACTER_STRING'; -exports[1301] = 'ER_WARN_ALLOWED_PACKET_OVERFLOWED'; -exports[1302] = 'ER_CONFLICTING_DECLARATIONS'; -exports[1303] = 'ER_SP_NO_RECURSIVE_CREATE'; -exports[1304] = 'ER_SP_ALREADY_EXISTS'; -exports[1305] = 'ER_SP_DOES_NOT_EXIST'; -exports[1306] = 'ER_SP_DROP_FAILED'; -exports[1307] = 'ER_SP_STORE_FAILED'; -exports[1308] = 'ER_SP_LILABEL_MISMATCH'; -exports[1309] = 'ER_SP_LABEL_REDEFINE'; -exports[1310] = 'ER_SP_LABEL_MISMATCH'; -exports[1311] = 'ER_SP_UNINIT_VAR'; -exports[1312] = 'ER_SP_BADSELECT'; -exports[1313] = 'ER_SP_BADRETURN'; -exports[1314] = 'ER_SP_BADSTATEMENT'; -exports[1315] = 'ER_UPDATE_LOG_DEPRECATED_IGNORED'; -exports[1316] = 'ER_UPDATE_LOG_DEPRECATED_TRANSLATED'; -exports[1317] = 'ER_QUERY_INTERRUPTED'; -exports[1318] = 'ER_SP_WRONG_NO_OF_ARGS'; -exports[1319] = 'ER_SP_COND_MISMATCH'; -exports[1320] = 'ER_SP_NORETURN'; -exports[1321] = 'ER_SP_NORETURNEND'; -exports[1322] = 'ER_SP_BAD_CURSOR_QUERY'; -exports[1323] = 'ER_SP_BAD_CURSOR_SELECT'; -exports[1324] = 'ER_SP_CURSOR_MISMATCH'; -exports[1325] = 'ER_SP_CURSOR_ALREADY_OPEN'; -exports[1326] = 'ER_SP_CURSOR_NOT_OPEN'; -exports[1327] = 'ER_SP_UNDECLARED_VAR'; -exports[1328] = 'ER_SP_WRONG_NO_OF_FETCH_ARGS'; -exports[1329] = 'ER_SP_FETCH_NO_DATA'; -exports[1330] = 'ER_SP_DUP_PARAM'; -exports[1331] = 'ER_SP_DUP_VAR'; -exports[1332] = 'ER_SP_DUP_COND'; -exports[1333] = 'ER_SP_DUP_CURS'; -exports[1334] = 'ER_SP_CANT_ALTER'; -exports[1335] = 'ER_SP_SUBSELECT_NYI'; -exports[1336] = 'ER_STMT_NOT_ALLOWED_IN_SF_OR_TRG'; -exports[1337] = 'ER_SP_VARCOND_AFTER_CURSHNDLR'; -exports[1338] = 'ER_SP_CURSOR_AFTER_HANDLER'; -exports[1339] = 'ER_SP_CASE_NOT_FOUND'; -exports[1340] = 'ER_FPARSER_TOO_BIG_FILE'; -exports[1341] = 'ER_FPARSER_BAD_HEADER'; -exports[1342] = 'ER_FPARSER_EOF_IN_COMMENT'; -exports[1343] = 'ER_FPARSER_ERROR_IN_PARAMETER'; -exports[1344] = 'ER_FPARSER_EOF_IN_UNKNOWN_PARAMETER'; -exports[1345] = 'ER_VIEW_NO_EXPLAIN'; -exports[1346] = 'ER_FRM_UNKNOWN_TYPE'; -exports[1347] = 'ER_WRONG_OBJECT'; -exports[1348] = 'ER_NONUPDATEABLE_COLUMN'; -exports[1349] = 'ER_VIEW_SELECT_DERIVED'; -exports[1350] = 'ER_VIEW_SELECT_CLAUSE'; -exports[1351] = 'ER_VIEW_SELECT_VARIABLE'; -exports[1352] = 'ER_VIEW_SELECT_TMPTABLE'; -exports[1353] = 'ER_VIEW_WRONG_LIST'; -exports[1354] = 'ER_WARN_VIEW_MERGE'; -exports[1355] = 'ER_WARN_VIEW_WITHOUT_KEY'; -exports[1356] = 'ER_VIEW_INVALID'; -exports[1357] = 'ER_SP_NO_DROP_SP'; -exports[1358] = 'ER_SP_GOTO_IN_HNDLR'; -exports[1359] = 'ER_TRG_ALREADY_EXISTS'; -exports[1360] = 'ER_TRG_DOES_NOT_EXIST'; -exports[1361] = 'ER_TRG_ON_VIEW_OR_TEMP_TABLE'; -exports[1362] = 'ER_TRG_CANT_CHANGE_ROW'; -exports[1363] = 'ER_TRG_NO_SUCH_ROW_IN_TRG'; -exports[1364] = 'ER_NO_DEFAULT_FOR_FIELD'; -exports[1365] = 'ER_DIVISION_BY_ZERO'; -exports[1366] = 'ER_TRUNCATED_WRONG_VALUE_FOR_FIELD'; -exports[1367] = 'ER_ILLEGAL_VALUE_FOR_TYPE'; -exports[1368] = 'ER_VIEW_NONUPD_CHECK'; -exports[1369] = 'ER_VIEW_CHECK_FAILED'; -exports[1370] = 'ER_PROCACCESS_DENIED_ERROR'; -exports[1371] = 'ER_RELAY_LOG_FAIL'; -exports[1372] = 'ER_PASSWD_LENGTH'; -exports[1373] = 'ER_UNKNOWN_TARGET_BINLOG'; -exports[1374] = 'ER_IO_ERR_LOG_INDEX_READ'; -exports[1375] = 'ER_BINLOG_PURGE_PROHIBITED'; -exports[1376] = 'ER_FSEEK_FAIL'; -exports[1377] = 'ER_BINLOG_PURGE_FATAL_ERR'; -exports[1378] = 'ER_LOG_IN_USE'; -exports[1379] = 'ER_LOG_PURGE_UNKNOWN_ERR'; -exports[1380] = 'ER_RELAY_LOG_INIT'; -exports[1381] = 'ER_NO_BINARY_LOGGING'; -exports[1382] = 'ER_RESERVED_SYNTAX'; -exports[1383] = 'ER_WSAS_FAILED'; -exports[1384] = 'ER_DIFF_GROUPS_PROC'; -exports[1385] = 'ER_NO_GROUP_FOR_PROC'; -exports[1386] = 'ER_ORDER_WITH_PROC'; -exports[1387] = 'ER_LOGGING_PROHIBIT_CHANGING_OF'; -exports[1388] = 'ER_NO_FILE_MAPPING'; -exports[1389] = 'ER_WRONG_MAGIC'; -exports[1390] = 'ER_PS_MANY_PARAM'; -exports[1391] = 'ER_KEY_PART_'; -exports[1392] = 'ER_VIEW_CHECKSUM'; -exports[1393] = 'ER_VIEW_MULTIUPDATE'; -exports[1394] = 'ER_VIEW_NO_INSERT_FIELD_LIST'; -exports[1395] = 'ER_VIEW_DELETE_MERGE_VIEW'; -exports[1396] = 'ER_CANNOT_USER'; -exports[1397] = 'ER_XAER_NOTA'; -exports[1398] = 'ER_XAER_INVAL'; -exports[1399] = 'ER_XAER_RMFAIL'; -exports[1400] = 'ER_XAER_OUTSIDE'; -exports[1401] = 'ER_XAER_RMERR'; -exports[1402] = 'ER_XA_RBROLLBACK'; -exports[1403] = 'ER_NONEXISTING_PROC_GRANT'; -exports[1404] = 'ER_PROC_AUTO_GRANT_FAIL'; -exports[1405] = 'ER_PROC_AUTO_REVOKE_FAIL'; -exports[1406] = 'ER_DATA_TOO_LONG'; -exports[1407] = 'ER_SP_BAD_SQLSTATE'; -exports[1408] = 'ER_STARTUP'; -exports[1409] = 'ER_LOAD_FROM_FIXED_SIZE_ROWS_TO_VAR'; -exports[1410] = 'ER_CANT_CREATE_USER_WITH_GRANT'; -exports[1411] = 'ER_WRONG_VALUE_FOR_TYPE'; -exports[1412] = 'ER_TABLE_DEF_CHANGED'; -exports[1413] = 'ER_SP_DUP_HANDLER'; -exports[1414] = 'ER_SP_NOT_VAR_ARG'; -exports[1415] = 'ER_SP_NO_RETSET'; -exports[1416] = 'ER_CANT_CREATE_GEOMETRY_OBJECT'; -exports[1417] = 'ER_FAILED_ROUTINE_BREAK_BINLOG'; -exports[1418] = 'ER_BINLOG_UNSAFE_ROUTINE'; -exports[1419] = 'ER_BINLOG_CREATE_ROUTINE_NEED_SUPER'; -exports[1420] = 'ER_EXEC_STMT_WITH_OPEN_CURSOR'; -exports[1421] = 'ER_STMT_HAS_NO_OPEN_CURSOR'; -exports[1422] = 'ER_COMMIT_NOT_ALLOWED_IN_SF_OR_TRG'; -exports[1423] = 'ER_NO_DEFAULT_FOR_VIEW_FIELD'; -exports[1424] = 'ER_SP_NO_RECURSION'; -exports[1425] = 'ER_TOO_BIG_SCALE'; -exports[1426] = 'ER_TOO_BIG_PRECISION'; -exports[1427] = 'ER_M_BIGGER_THAN_D'; -exports[1428] = 'ER_WRONG_LOCK_OF_SYSTEM_TABLE'; -exports[1429] = 'ER_CONNECT_TO_FOREIGN_DATA_SOURCE'; -exports[1430] = 'ER_QUERY_ON_FOREIGN_DATA_SOURCE'; -exports[1431] = 'ER_FOREIGN_DATA_SOURCE_DOESNT_EXIST'; -exports[1432] = 'ER_FOREIGN_DATA_STRING_INVALID_CANT_CREATE'; -exports[1433] = 'ER_FOREIGN_DATA_STRING_INVALID'; -exports[1434] = 'ER_CANT_CREATE_FEDERATED_TABLE'; -exports[1435] = 'ER_TRG_IN_WRONG_SCHEMA'; -exports[1436] = 'ER_STACK_OVERRUN_NEED_MORE'; -exports[1437] = 'ER_TOO_LONG_BODY'; -exports[1438] = 'ER_WARN_CANT_DROP_DEFAULT_KEYCACHE'; -exports[1439] = 'ER_TOO_BIG_DISPLAYWIDTH'; -exports[1440] = 'ER_XAER_DUPID'; -exports[1441] = 'ER_DATETIME_FUNCTION_OVERFLOW'; -exports[1442] = 'ER_CANT_UPDATE_USED_TABLE_IN_SF_OR_TRG'; -exports[1443] = 'ER_VIEW_PREVENT_UPDATE'; -exports[1444] = 'ER_PS_NO_RECURSION'; -exports[1445] = 'ER_SP_CANT_SET_AUTOCOMMIT'; -exports[1446] = 'ER_MALFORMED_DEFINER'; -exports[1447] = 'ER_VIEW_FRM_NO_USER'; -exports[1448] = 'ER_VIEW_OTHER_USER'; -exports[1449] = 'ER_NO_SUCH_USER'; -exports[1450] = 'ER_FORBID_SCHEMA_CHANGE'; -exports[1451] = 'ER_ROW_IS_REFERENCED_'; -exports[1452] = 'ER_NO_REFERENCED_ROW_'; -exports[1453] = 'ER_SP_BAD_VAR_SHADOW'; -exports[1454] = 'ER_TRG_NO_DEFINER'; -exports[1455] = 'ER_OLD_FILE_FORMAT'; -exports[1456] = 'ER_SP_RECURSION_LIMIT'; -exports[1457] = 'ER_SP_PROC_TABLE_CORRUPT'; -exports[1458] = 'ER_SP_WRONG_NAME'; -exports[1459] = 'ER_TABLE_NEEDS_UPGRADE'; -exports[1460] = 'ER_SP_NO_AGGREGATE'; -exports[1461] = 'ER_MAX_PREPARED_STMT_COUNT_REACHED'; -exports[1462] = 'ER_VIEW_RECURSIVE'; -exports[1463] = 'ER_NON_GROUPING_FIELD_USED'; -exports[1464] = 'ER_TABLE_CANT_HANDLE_SPKEYS'; -exports[1465] = 'ER_NO_TRIGGERS_ON_SYSTEM_SCHEMA'; -exports[1466] = 'ER_REMOVED_SPACES'; -exports[1467] = 'ER_AUTOINC_READ_FAILED'; -exports[1468] = 'ER_USERNAME'; -exports[1469] = 'ER_HOSTNAME'; -exports[1470] = 'ER_WRONG_STRING_LENGTH'; -exports[1471] = 'ER_NON_INSERTABLE_TABLE'; -exports[1472] = 'ER_ADMIN_WRONG_MRG_TABLE'; -exports[1473] = 'ER_TOO_HIGH_LEVEL_OF_NESTING_FOR_SELECT'; -exports[1474] = 'ER_NAME_BECOMES_EMPTY'; -exports[1475] = 'ER_AMBIGUOUS_FIELD_TERM'; -exports[1476] = 'ER_FOREIGN_SERVER_EXISTS'; -exports[1477] = 'ER_FOREIGN_SERVER_DOESNT_EXIST'; -exports[1478] = 'ER_ILLEGAL_HA_CREATE_OPTION'; -exports[1479] = 'ER_PARTITION_REQUIRES_VALUES_ERROR'; -exports[1480] = 'ER_PARTITION_WRONG_VALUES_ERROR'; -exports[1481] = 'ER_PARTITION_MAXVALUE_ERROR'; -exports[1482] = 'ER_PARTITION_SUBPARTITION_ERROR'; -exports[1483] = 'ER_PARTITION_SUBPART_MIX_ERROR'; -exports[1484] = 'ER_PARTITION_WRONG_NO_PART_ERROR'; -exports[1485] = 'ER_PARTITION_WRONG_NO_SUBPART_ERROR'; -exports[1486] = 'ER_WRONG_EXPR_IN_PARTITION_FUNC_ERROR'; -exports[1487] = 'ER_NO_CONST_EXPR_IN_RANGE_OR_LIST_ERROR'; -exports[1488] = 'ER_FIELD_NOT_FOUND_PART_ERROR'; -exports[1489] = 'ER_LIST_OF_FIELDS_ONLY_IN_HASH_ERROR'; -exports[1490] = 'ER_INCONSISTENT_PARTITION_INFO_ERROR'; -exports[1491] = 'ER_PARTITION_FUNC_NOT_ALLOWED_ERROR'; -exports[1492] = 'ER_PARTITIONS_MUST_BE_DEFINED_ERROR'; -exports[1493] = 'ER_RANGE_NOT_INCREASING_ERROR'; -exports[1494] = 'ER_INCONSISTENT_TYPE_OF_FUNCTIONS_ERROR'; -exports[1495] = 'ER_MULTIPLE_DEF_CONST_IN_LIST_PART_ERROR'; -exports[1496] = 'ER_PARTITION_ENTRY_ERROR'; -exports[1497] = 'ER_MIX_HANDLER_ERROR'; -exports[1498] = 'ER_PARTITION_NOT_DEFINED_ERROR'; -exports[1499] = 'ER_TOO_MANY_PARTITIONS_ERROR'; -exports[1500] = 'ER_SUBPARTITION_ERROR'; -exports[1501] = 'ER_CANT_CREATE_HANDLER_FILE'; -exports[1502] = 'ER_BLOB_FIELD_IN_PART_FUNC_ERROR'; -exports[1503] = 'ER_UNIQUE_KEY_NEED_ALL_FIELDS_IN_PF'; -exports[1504] = 'ER_NO_PARTS_ERROR'; -exports[1505] = 'ER_PARTITION_MGMT_ON_NONPARTITIONED'; -exports[1506] = 'ER_FOREIGN_KEY_ON_PARTITIONED'; -exports[1507] = 'ER_DROP_PARTITION_NON_EXISTENT'; -exports[1508] = 'ER_DROP_LAST_PARTITION'; -exports[1509] = 'ER_COALESCE_ONLY_ON_HASH_PARTITION'; -exports[1510] = 'ER_REORG_HASH_ONLY_ON_SAME_NO'; -exports[1511] = 'ER_REORG_NO_PARAM_ERROR'; -exports[1512] = 'ER_ONLY_ON_RANGE_LIST_PARTITION'; -exports[1513] = 'ER_ADD_PARTITION_SUBPART_ERROR'; -exports[1514] = 'ER_ADD_PARTITION_NO_NEW_PARTITION'; -exports[1515] = 'ER_COALESCE_PARTITION_NO_PARTITION'; -exports[1516] = 'ER_REORG_PARTITION_NOT_EXIST'; -exports[1517] = 'ER_SAME_NAME_PARTITION'; -exports[1518] = 'ER_NO_BINLOG_ERROR'; -exports[1519] = 'ER_CONSECUTIVE_REORG_PARTITIONS'; -exports[1520] = 'ER_REORG_OUTSIDE_RANGE'; -exports[1521] = 'ER_PARTITION_FUNCTION_FAILURE'; -exports[1522] = 'ER_PART_STATE_ERROR'; -exports[1523] = 'ER_LIMITED_PART_RANGE'; -exports[1524] = 'ER_PLUGIN_IS_NOT_LOADED'; -exports[1525] = 'ER_WRONG_VALUE'; -exports[1526] = 'ER_NO_PARTITION_FOR_GIVEN_VALUE'; -exports[1527] = 'ER_FILEGROUP_OPTION_ONLY_ONCE'; -exports[1528] = 'ER_CREATE_FILEGROUP_FAILED'; -exports[1529] = 'ER_DROP_FILEGROUP_FAILED'; -exports[1530] = 'ER_TABLESPACE_AUTO_EXTEND_ERROR'; -exports[1531] = 'ER_WRONG_SIZE_NUMBER'; -exports[1532] = 'ER_SIZE_OVERFLOW_ERROR'; -exports[1533] = 'ER_ALTER_FILEGROUP_FAILED'; -exports[1534] = 'ER_BINLOG_ROW_LOGGING_FAILED'; -exports[1535] = 'ER_BINLOG_ROW_WRONG_TABLE_DEF'; -exports[1536] = 'ER_BINLOG_ROW_RBR_TO_SBR'; -exports[1537] = 'ER_EVENT_ALREADY_EXISTS'; -exports[1538] = 'ER_EVENT_STORE_FAILED'; -exports[1539] = 'ER_EVENT_DOES_NOT_EXIST'; -exports[1540] = 'ER_EVENT_CANT_ALTER'; -exports[1541] = 'ER_EVENT_DROP_FAILED'; -exports[1542] = 'ER_EVENT_INTERVAL_NOT_POSITIVE_OR_TOO_BIG'; -exports[1543] = 'ER_EVENT_ENDS_BEFORE_STARTS'; -exports[1544] = 'ER_EVENT_EXEC_TIME_IN_THE_PAST'; -exports[1545] = 'ER_EVENT_OPEN_TABLE_FAILED'; -exports[1546] = 'ER_EVENT_NEITHER_M_EXPR_NOR_M_AT'; -exports[1547] = 'ER_COL_COUNT_DOESNT_MATCH_CORRUPTED'; -exports[1548] = 'ER_CANNOT_LOAD_FROM_TABLE'; -exports[1549] = 'ER_EVENT_CANNOT_DELETE'; -exports[1550] = 'ER_EVENT_COMPILE_ERROR'; -exports[1551] = 'ER_EVENT_SAME_NAME'; -exports[1552] = 'ER_EVENT_DATA_TOO_LONG'; -exports[1553] = 'ER_DROP_INDEX_FK'; -exports[1554] = 'ER_WARN_DEPRECATED_SYNTAX_WITH_VER'; -exports[1555] = 'ER_CANT_WRITE_LOCK_LOG_TABLE'; -exports[1556] = 'ER_CANT_LOCK_LOG_TABLE'; -exports[1557] = 'ER_FOREIGN_DUPLICATE_KEY'; -exports[1558] = 'ER_COL_COUNT_DOESNT_MATCH_PLEASE_UPDATE'; -exports[1559] = 'ER_TEMP_TABLE_PREVENTS_SWITCH_OUT_OF_RBR'; -exports[1560] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_FORMAT'; -exports[1561] = 'ER_NDB_CANT_SWITCH_BINLOG_FORMAT'; -exports[1562] = 'ER_PARTITION_NO_TEMPORARY'; -exports[1563] = 'ER_PARTITION_CONST_DOMAIN_ERROR'; -exports[1564] = 'ER_PARTITION_FUNCTION_IS_NOT_ALLOWED'; -exports[1565] = 'ER_DDL_LOG_ERROR'; -exports[1566] = 'ER_NULL_IN_VALUES_LESS_THAN'; -exports[1567] = 'ER_WRONG_PARTITION_NAME'; -exports[1568] = 'ER_CANT_CHANGE_TX_CHARACTERISTICS'; -exports[1569] = 'ER_DUP_ENTRY_AUTOINCREMENT_CASE'; -exports[1570] = 'ER_EVENT_MODIFY_QUEUE_ERROR'; -exports[1571] = 'ER_EVENT_SET_VAR_ERROR'; -exports[1572] = 'ER_PARTITION_MERGE_ERROR'; -exports[1573] = 'ER_CANT_ACTIVATE_LOG'; -exports[1574] = 'ER_RBR_NOT_AVAILABLE'; -exports[1575] = 'ER_BASE'; -exports[1576] = 'ER_EVENT_RECURSION_FORBIDDEN'; -exports[1577] = 'ER_EVENTS_DB_ERROR'; -exports[1578] = 'ER_ONLY_INTEGERS_ALLOWED'; -exports[1579] = 'ER_UNSUPORTED_LOG_ENGINE'; -exports[1580] = 'ER_BAD_LOG_STATEMENT'; -exports[1581] = 'ER_CANT_RENAME_LOG_TABLE'; -exports[1582] = 'ER_WRONG_PARAMCOUNT_TO_NATIVE_FCT'; -exports[1583] = 'ER_WRONG_PARAMETERS_TO_NATIVE_FCT'; -exports[1584] = 'ER_WRONG_PARAMETERS_TO_STORED_FCT'; -exports[1585] = 'ER_NATIVE_FCT_NAME_COLLISION'; -exports[1586] = 'ER_DUP_ENTRY_WITH_KEY_NAME'; -exports[1587] = 'ER_BINLOG_PURGE_EMFILE'; -exports[1588] = 'ER_EVENT_CANNOT_CREATE_IN_THE_PAST'; -exports[1589] = 'ER_EVENT_CANNOT_ALTER_IN_THE_PAST'; -exports[1590] = 'ER_SLAVE_INCIDENT'; -exports[1591] = 'ER_NO_PARTITION_FOR_GIVEN_VALUE_SILENT'; -exports[1592] = 'ER_BINLOG_UNSAFE_STATEMENT'; -exports[1593] = 'ER_SLAVE_FATAL_ERROR'; -exports[1594] = 'ER_SLAVE_RELAY_LOG_READ_FAILURE'; -exports[1595] = 'ER_SLAVE_RELAY_LOG_WRITE_FAILURE'; -exports[1596] = 'ER_SLAVE_CREATE_EVENT_FAILURE'; -exports[1597] = 'ER_SLAVE_MASTER_COM_FAILURE'; -exports[1598] = 'ER_BINLOG_LOGGING_IMPOSSIBLE'; -exports[1599] = 'ER_VIEW_NO_CREATION_CTX'; -exports[1600] = 'ER_VIEW_INVALID_CREATION_CTX'; -exports[1601] = 'ER_SR_INVALID_CREATION_CTX'; -exports[1602] = 'ER_TRG_CORRUPTED_FILE'; -exports[1603] = 'ER_TRG_NO_CREATION_CTX'; -exports[1604] = 'ER_TRG_INVALID_CREATION_CTX'; -exports[1605] = 'ER_EVENT_INVALID_CREATION_CTX'; -exports[1606] = 'ER_TRG_CANT_OPEN_TABLE'; -exports[1607] = 'ER_CANT_CREATE_SROUTINE'; -exports[1608] = 'ER_NEVER_USED'; -exports[1609] = 'ER_NO_FORMAT_DESCRIPTION_EVENT_BEFORE_BINLOG_STATEMENT'; -exports[1610] = 'ER_SLAVE_CORRUPT_EVENT'; -exports[1611] = 'ER_LOAD_DATA_INVALID_COLUMN'; -exports[1612] = 'ER_LOG_PURGE_NO_FILE'; -exports[1613] = 'ER_XA_RBTIMEOUT'; -exports[1614] = 'ER_XA_RBDEADLOCK'; -exports[1615] = 'ER_NEED_REPREPARE'; -exports[1616] = 'ER_DELAYED_NOT_SUPPORTED'; -exports[1617] = 'WARN_NO_MASTER_INFO'; -exports[1618] = 'WARN_OPTION_IGNORED'; -exports[1619] = 'WARN_PLUGIN_DELETE_BUILTIN'; -exports[1620] = 'WARN_PLUGIN_BUSY'; -exports[1621] = 'ER_VARIABLE_IS_READONLY'; -exports[1622] = 'ER_WARN_ENGINE_TRANSACTION_ROLLBACK'; -exports[1623] = 'ER_SLAVE_HEARTBEAT_FAILURE'; -exports[1624] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE'; -exports[1625] = 'ER_NDB_REPLICATION_SCHEMA_ERROR'; -exports[1626] = 'ER_CONFLICT_FN_PARSE_ERROR'; -exports[1627] = 'ER_EXCEPTIONS_WRITE_ERROR'; -exports[1628] = 'ER_TOO_LONG_TABLE_COMMENT'; -exports[1629] = 'ER_TOO_LONG_FIELD_COMMENT'; -exports[1630] = 'ER_FUNC_INEXISTENT_NAME_COLLISION'; -exports[1631] = 'ER_DATABASE_NAME'; -exports[1632] = 'ER_TABLE_NAME'; -exports[1633] = 'ER_PARTITION_NAME'; -exports[1634] = 'ER_SUBPARTITION_NAME'; -exports[1635] = 'ER_TEMPORARY_NAME'; -exports[1636] = 'ER_RENAMED_NAME'; -exports[1637] = 'ER_TOO_MANY_CONCURRENT_TRXS'; -exports[1638] = 'WARN_NON_ASCII_SEPARATOR_NOT_IMPLEMENTED'; -exports[1639] = 'ER_DEBUG_SYNC_TIMEOUT'; -exports[1640] = 'ER_DEBUG_SYNC_HIT_LIMIT'; -exports[1641] = 'ER_DUP_SIGNAL_SET'; -exports[1642] = 'ER_SIGNAL_WARN'; -exports[1643] = 'ER_SIGNAL_NOT_FOUND'; -exports[1644] = 'ER_SIGNAL_EXCEPTION'; -exports[1645] = 'ER_RESIGNAL_WITHOUT_ACTIVE_HANDLER'; -exports[1646] = 'ER_SIGNAL_BAD_CONDITION_TYPE'; -exports[1647] = 'WARN_COND_ITEM_TRUNCATED'; -exports[1648] = 'ER_COND_ITEM_TOO_LONG'; -exports[1649] = 'ER_UNKNOWN_LOCALE'; -exports[1650] = 'ER_SLAVE_IGNORE_SERVER_IDS'; -exports[1651] = 'ER_QUERY_CACHE_DISABLED'; -exports[1652] = 'ER_SAME_NAME_PARTITION_FIELD'; -exports[1653] = 'ER_PARTITION_COLUMN_LIST_ERROR'; -exports[1654] = 'ER_WRONG_TYPE_COLUMN_VALUE_ERROR'; -exports[1655] = 'ER_TOO_MANY_PARTITION_FUNC_FIELDS_ERROR'; -exports[1656] = 'ER_MAXVALUE_IN_VALUES_IN'; -exports[1657] = 'ER_TOO_MANY_VALUES_ERROR'; -exports[1658] = 'ER_ROW_SINGLE_PARTITION_FIELD_ERROR'; -exports[1659] = 'ER_FIELD_TYPE_NOT_ALLOWED_AS_PARTITION_FIELD'; -exports[1660] = 'ER_PARTITION_FIELDS_TOO_LONG'; -exports[1661] = 'ER_BINLOG_ROW_ENGINE_AND_STMT_ENGINE'; -exports[1662] = 'ER_BINLOG_ROW_MODE_AND_STMT_ENGINE'; -exports[1663] = 'ER_BINLOG_UNSAFE_AND_STMT_ENGINE'; -exports[1664] = 'ER_BINLOG_ROW_INJECTION_AND_STMT_ENGINE'; -exports[1665] = 'ER_BINLOG_STMT_MODE_AND_ROW_ENGINE'; -exports[1666] = 'ER_BINLOG_ROW_INJECTION_AND_STMT_MODE'; -exports[1667] = 'ER_BINLOG_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE'; -exports[1668] = 'ER_BINLOG_UNSAFE_LIMIT'; -exports[1669] = 'ER_BINLOG_UNSAFE_INSERT_DELAYED'; -exports[1670] = 'ER_BINLOG_UNSAFE_SYSTEM_TABLE'; -exports[1671] = 'ER_BINLOG_UNSAFE_AUTOINC_COLUMNS'; -exports[1672] = 'ER_BINLOG_UNSAFE_UDF'; -exports[1673] = 'ER_BINLOG_UNSAFE_SYSTEM_VARIABLE'; -exports[1674] = 'ER_BINLOG_UNSAFE_SYSTEM_FUNCTION'; -exports[1675] = 'ER_BINLOG_UNSAFE_NONTRANS_AFTER_TRANS'; -exports[1676] = 'ER_MESSAGE_AND_STATEMENT'; -exports[1677] = 'ER_SLAVE_CONVERSION_FAILED'; -exports[1678] = 'ER_SLAVE_CANT_CREATE_CONVERSION'; -exports[1679] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_FORMAT'; -exports[1680] = 'ER_PATH_LENGTH'; -exports[1681] = 'ER_WARN_DEPRECATED_SYNTAX_NO_REPLACEMENT'; -exports[1682] = 'ER_WRONG_NATIVE_TABLE_STRUCTURE'; -exports[1683] = 'ER_WRONG_PERFSCHEMA_USAGE'; -exports[1684] = 'ER_WARN_I_S_SKIPPED_TABLE'; -exports[1685] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_DIRECT'; -exports[1686] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_DIRECT'; -exports[1687] = 'ER_SPATIAL_MUST_HAVE_GEOM_COL'; -exports[1688] = 'ER_TOO_LONG_INDEX_COMMENT'; -exports[1689] = 'ER_LOCK_ABORTED'; -exports[1690] = 'ER_DATA_OUT_OF_RANGE'; -exports[1691] = 'ER_WRONG_SPVAR_TYPE_IN_LIMIT'; -exports[1692] = 'ER_BINLOG_UNSAFE_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE'; -exports[1693] = 'ER_BINLOG_UNSAFE_MIXED_STATEMENT'; -exports[1694] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_SQL_LOG_BIN'; -exports[1695] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_SQL_LOG_BIN'; -exports[1696] = 'ER_FAILED_READ_FROM_PAR_FILE'; -exports[1697] = 'ER_VALUES_IS_NOT_INT_TYPE_ERROR'; -exports[1698] = 'ER_ACCESS_DENIED_NO_PASSWORD_ERROR'; -exports[1699] = 'ER_SET_PASSWORD_AUTH_PLUGIN'; -exports[1700] = 'ER_GRANT_PLUGIN_USER_EXISTS'; -exports[1701] = 'ER_TRUNCATE_ILLEGAL_FK'; -exports[1702] = 'ER_PLUGIN_IS_PERMANENT'; -exports[1703] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MIN'; -exports[1704] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MAX'; -exports[1705] = 'ER_STMT_CACHE_FULL'; -exports[1706] = 'ER_MULTI_UPDATE_KEY_CONFLICT'; -exports[1707] = 'ER_TABLE_NEEDS_REBUILD'; -exports[1708] = 'WARN_OPTION_BELOW_LIMIT'; -exports[1709] = 'ER_INDEX_COLUMN_TOO_LONG'; -exports[1710] = 'ER_ERROR_IN_TRIGGER_BODY'; -exports[1711] = 'ER_ERROR_IN_UNKNOWN_TRIGGER_BODY'; -exports[1712] = 'ER_INDEX_CORRUPT'; -exports[1713] = 'ER_UNDO_RECORD_TOO_BIG'; -exports[1714] = 'ER_BINLOG_UNSAFE_INSERT_IGNORE_SELECT'; -exports[1715] = 'ER_BINLOG_UNSAFE_INSERT_SELECT_UPDATE'; -exports[1716] = 'ER_BINLOG_UNSAFE_REPLACE_SELECT'; -exports[1717] = 'ER_BINLOG_UNSAFE_CREATE_IGNORE_SELECT'; -exports[1718] = 'ER_BINLOG_UNSAFE_CREATE_REPLACE_SELECT'; -exports[1719] = 'ER_BINLOG_UNSAFE_UPDATE_IGNORE'; -exports[1720] = 'ER_PLUGIN_NO_UNINSTALL'; -exports[1721] = 'ER_PLUGIN_NO_INSTALL'; -exports[1722] = 'ER_BINLOG_UNSAFE_WRITE_AUTOINC_SELECT'; -exports[1723] = 'ER_BINLOG_UNSAFE_CREATE_SELECT_AUTOINC'; -exports[1724] = 'ER_BINLOG_UNSAFE_INSERT_TWO_KEYS'; -exports[1725] = 'ER_TABLE_IN_FK_CHECK'; -exports[1726] = 'ER_UNSUPPORTED_ENGINE'; -exports[1727] = 'ER_BINLOG_UNSAFE_AUTOINC_NOT_FIRST'; -exports[1728] = 'ER_CANNOT_LOAD_FROM_TABLE_V'; -exports[1729] = 'ER_MASTER_DELAY_VALUE_OUT_OF_RANGE'; -exports[1730] = 'ER_ONLY_FD_AND_RBR_EVENTS_ALLOWED_IN_BINLOG_STATEMENT'; -exports[1731] = 'ER_PARTITION_EXCHANGE_DIFFERENT_OPTION'; -exports[1732] = 'ER_PARTITION_EXCHANGE_PART_TABLE'; -exports[1733] = 'ER_PARTITION_EXCHANGE_TEMP_TABLE'; -exports[1734] = 'ER_PARTITION_INSTEAD_OF_SUBPARTITION'; -exports[1735] = 'ER_UNKNOWN_PARTITION'; -exports[1736] = 'ER_TABLES_DIFFERENT_METADATA'; -exports[1737] = 'ER_ROW_DOES_NOT_MATCH_PARTITION'; -exports[1738] = 'ER_BINLOG_CACHE_SIZE_GREATER_THAN_MAX'; -exports[1739] = 'ER_WARN_INDEX_NOT_APPLICABLE'; -exports[1740] = 'ER_PARTITION_EXCHANGE_FOREIGN_KEY'; -exports[1741] = 'ER_NO_SUCH_KEY_VALUE'; -exports[1742] = 'ER_RPL_INFO_DATA_TOO_LONG'; -exports[1743] = 'ER_NETWORK_READ_EVENT_CHECKSUM_FAILURE'; -exports[1744] = 'ER_BINLOG_READ_EVENT_CHECKSUM_FAILURE'; -exports[1745] = 'ER_BINLOG_STMT_CACHE_SIZE_GREATER_THAN_MAX'; -exports[1746] = 'ER_CANT_UPDATE_TABLE_IN_CREATE_TABLE_SELECT'; -exports[1747] = 'ER_PARTITION_CLAUSE_ON_NONPARTITIONED'; -exports[1748] = 'ER_ROW_DOES_NOT_MATCH_GIVEN_PARTITION_SET'; -exports[1749] = 'ER_NO_SUCH_PARTITION'; -exports[1750] = 'ER_CHANGE_RPL_INFO_REPOSITORY_FAILURE'; -exports[1751] = 'ER_WARNING_NOT_COMPLETE_ROLLBACK_WITH_CREATED_TEMP_TABLE'; -exports[1752] = 'ER_WARNING_NOT_COMPLETE_ROLLBACK_WITH_DROPPED_TEMP_TABLE'; -exports[1753] = 'ER_MTS_FEATURE_IS_NOT_SUPPORTED'; -exports[1754] = 'ER_MTS_UPDATED_DBS_GREATER_MAX'; -exports[1755] = 'ER_MTS_CANT_PARALLEL'; -exports[1756] = 'ER_MTS_INCONSISTENT_DATA'; -exports[1757] = 'ER_FULLTEXT_NOT_SUPPORTED_WITH_PARTITIONING'; -exports[1758] = 'ER_DA_INVALID_CONDITION_NUMBER'; -exports[1759] = 'ER_INSECURE_PLAIN_TEXT'; -exports[1760] = 'ER_INSECURE_CHANGE_MASTER'; -exports[1761] = 'ER_FOREIGN_DUPLICATE_KEY_WITH_CHILD_INFO'; -exports[1762] = 'ER_FOREIGN_DUPLICATE_KEY_WITHOUT_CHILD_INFO'; -exports[1763] = 'ER_SQLTHREAD_WITH_SECURE_SLAVE'; -exports[1764] = 'ER_TABLE_HAS_NO_FT'; -exports[1765] = 'ER_VARIABLE_NOT_SETTABLE_IN_SF_OR_TRIGGER'; -exports[1766] = 'ER_VARIABLE_NOT_SETTABLE_IN_TRANSACTION'; -exports[1767] = 'ER_GTID_NEXT_IS_NOT_IN_GTID_NEXT_LIST'; -exports[1768] = 'ER_CANT_CHANGE_GTID_NEXT_IN_TRANSACTION_WHEN_GTID_NEXT_LIST_IS_NULL'; -exports[1769] = 'ER_SET_STATEMENT_CANNOT_INVOKE_FUNCTION'; -exports[1770] = 'ER_GTID_NEXT_CANT_BE_AUTOMATIC_IF_GTID_NEXT_LIST_IS_NON_NULL'; -exports[1771] = 'ER_SKIPPING_LOGGED_TRANSACTION'; -exports[1772] = 'ER_MALFORMED_GTID_SET_SPECIFICATION'; -exports[1773] = 'ER_MALFORMED_GTID_SET_ENCODING'; -exports[1774] = 'ER_MALFORMED_GTID_SPECIFICATION'; -exports[1775] = 'ER_GNO_EXHAUSTED'; -exports[1776] = 'ER_BAD_SLAVE_AUTO_POSITION'; -exports[1777] = 'ER_AUTO_POSITION_REQUIRES_GTID_MODE_ON'; -exports[1778] = 'ER_CANT_DO_IMPLICIT_COMMIT_IN_TRX_WHEN_GTID_NEXT_IS_SET'; -exports[1779] = 'ER_GTID_MODE_'; -exports[1780] = 'ER_GTID_MODE_REQUIRES_BINLOG'; -exports[1781] = 'ER_CANT_SET_GTID_NEXT_TO_GTID_WHEN_GTID_MODE_IS_OFF'; -exports[1782] = 'ER_CANT_SET_GTID_NEXT_TO_ANONYMOUS_WHEN_GTID_MODE_IS_ON'; -exports[1783] = 'ER_CANT_SET_GTID_NEXT_LIST_TO_NON_NULL_WHEN_GTID_MODE_IS_OFF'; -exports[1784] = 'ER_FOUND_GTID_EVENT_WHEN_GTID_MODE_IS_OFF'; -exports[1785] = 'ER_GTID_UNSAFE_NON_TRANSACTIONAL_TABLE'; -exports[1786] = 'ER_GTID_UNSAFE_CREATE_SELECT'; -exports[1787] = 'ER_GTID_UNSAFE_CREATE_DROP_TEMPORARY_TABLE_IN_TRANSACTION'; -exports[1788] = 'ER_GTID_MODE_CAN_ONLY_CHANGE_ONE_STEP_AT_A_TIME'; -exports[1789] = 'ER_MASTER_HAS_PURGED_REQUIRED_GTIDS'; -exports[1790] = 'ER_CANT_SET_GTID_NEXT_WHEN_OWNING_GTID'; -exports[1791] = 'ER_UNKNOWN_EXPLAIN_FORMAT'; -exports[1792] = 'ER_CANT_EXECUTE_IN_READ_ONLY_TRANSACTION'; -exports[1793] = 'ER_TOO_LONG_TABLE_PARTITION_COMMENT'; -exports[1794] = 'ER_SLAVE_CONFIGURATION'; -exports[1795] = 'ER_INNODB_FT_LIMIT'; -exports[1796] = 'ER_INNODB_NO_FT_TEMP_TABLE'; -exports[1797] = 'ER_INNODB_FT_WRONG_DOCID_COLUMN'; -exports[1798] = 'ER_INNODB_FT_WRONG_DOCID_INDEX'; -exports[1799] = 'ER_INNODB_ONLINE_LOG_TOO_BIG'; -exports[1800] = 'ER_UNKNOWN_ALTER_ALGORITHM'; -exports[1801] = 'ER_UNKNOWN_ALTER_LOCK'; -exports[1802] = 'ER_MTS_CHANGE_MASTER_CANT_RUN_WITH_GAPS'; -exports[1803] = 'ER_MTS_RECOVERY_FAILURE'; -exports[1804] = 'ER_MTS_RESET_WORKERS'; -exports[1805] = 'ER_COL_COUNT_DOESNT_MATCH_CORRUPTED_V'; -exports[1806] = 'ER_SLAVE_SILENT_RETRY_TRANSACTION'; -exports[1807] = 'ER_DISCARD_FK_CHECKS_RUNNING'; -exports[1808] = 'ER_TABLE_SCHEMA_MISMATCH'; -exports[1809] = 'ER_TABLE_IN_SYSTEM_TABLESPACE'; -exports[1810] = 'ER_IO_READ_ERROR'; -exports[1811] = 'ER_IO_WRITE_ERROR'; -exports[1812] = 'ER_TABLESPACE_MISSING'; -exports[1813] = 'ER_TABLESPACE_EXISTS'; -exports[1814] = 'ER_TABLESPACE_DISCARDED'; -exports[1815] = 'ER_INTERNAL_ERROR'; -exports[1816] = 'ER_INNODB_IMPORT_ERROR'; -exports[1817] = 'ER_INNODB_INDEX_CORRUPT'; -exports[1818] = 'ER_INVALID_YEAR_COLUMN_LENGTH'; -exports[1819] = 'ER_NOT_VALID_PASSWORD'; -exports[1820] = 'ER_MUST_CHANGE_PASSWORD'; -exports[1821] = 'ER_FK_NO_INDEX_CHILD'; -exports[1822] = 'ER_FK_NO_INDEX_PARENT'; -exports[1823] = 'ER_FK_FAIL_ADD_SYSTEM'; -exports[1824] = 'ER_FK_CANNOT_OPEN_PARENT'; -exports[1825] = 'ER_FK_INCORRECT_OPTION'; -exports[1826] = 'ER_FK_DUP_NAME'; -exports[1827] = 'ER_PASSWORD_FORMAT'; -exports[1828] = 'ER_FK_COLUMN_CANNOT_DROP'; -exports[1829] = 'ER_FK_COLUMN_CANNOT_DROP_CHILD'; -exports[1830] = 'ER_FK_COLUMN_NOT_NULL'; -exports[1831] = 'ER_DUP_INDEX'; -exports[1832] = 'ER_FK_COLUMN_CANNOT_CHANGE'; -exports[1833] = 'ER_FK_COLUMN_CANNOT_CHANGE_CHILD'; -exports[1834] = 'ER_FK_CANNOT_DELETE_PARENT'; -exports[1835] = 'ER_MALFORMED_PACKET'; -exports[1836] = 'ER_READ_ONLY_MODE'; -exports[1837] = 'ER_GTID_NEXT_TYPE_UNDEFINED_GROUP'; -exports[1838] = 'ER_VARIABLE_NOT_SETTABLE_IN_SP'; -exports[1839] = 'ER_CANT_SET_GTID_PURGED_WHEN_GTID_MODE_IS_OFF'; -exports[1840] = 'ER_CANT_SET_GTID_PURGED_WHEN_GTID_EXECUTED_IS_NOT_EMPTY'; -exports[1841] = 'ER_CANT_SET_GTID_PURGED_WHEN_OWNED_GTIDS_IS_NOT_EMPTY'; -exports[1842] = 'ER_GTID_PURGED_WAS_CHANGED'; -exports[1843] = 'ER_GTID_EXECUTED_WAS_CHANGED'; -exports[1844] = 'ER_BINLOG_STMT_MODE_AND_NO_REPL_TABLES'; -exports[1845] = 'ER_ALTER_OPERATION_NOT_SUPPORTED'; -exports[1846] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON'; -exports[1847] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_COPY'; -exports[1848] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_PARTITION'; -exports[1849] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FK_RENAME'; -exports[1850] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_COLUMN_TYPE'; -exports[1851] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FK_CHECK'; -exports[1852] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_IGNORE'; -exports[1853] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_NOPK'; -exports[1854] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_AUTOINC'; -exports[1855] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_HIDDEN_FTS'; -exports[1856] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_CHANGE_FTS'; -exports[1857] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_FTS'; -exports[1858] = 'ER_SQL_SLAVE_SKIP_COUNTER_NOT_SETTABLE_IN_GTID_MODE'; -exports[1859] = 'ER_DUP_UNKNOWN_IN_INDEX'; -exports[1860] = 'ER_IDENT_CAUSES_TOO_LONG_PATH'; -exports[1861] = 'ER_ALTER_OPERATION_NOT_SUPPORTED_REASON_NOT_NULL'; -exports[1862] = 'ER_MUST_CHANGE_PASSWORD_LOGIN'; -exports[1863] = 'ER_ROW_IN_WRONG_PARTITION'; -exports[1864] = 'ER_MTS_EVENT_BIGGER_PENDING_JOBS_SIZE_MAX'; -exports[1865] = 'ER_INNODB_NO_FT_USES_PARSER'; -exports[1866] = 'ER_BINLOG_LOGICAL_CORRUPTION'; -exports[1867] = 'ER_WARN_PURGE_LOG_IN_USE'; -exports[1868] = 'ER_WARN_PURGE_LOG_IS_ACTIVE'; -exports[1869] = 'ER_AUTO_INCREMENT_CONFLICT'; -exports[1870] = 'WARN_ON_BLOCKHOLE_IN_RBR'; -exports[1871] = 'ER_SLAVE_MI_INIT_REPOSITORY'; -exports[1872] = 'ER_SLAVE_RLI_INIT_REPOSITORY'; -exports[1873] = 'ER_ACCESS_DENIED_CHANGE_USER_ERROR'; -exports[1874] = 'ER_INNODB_READ_ONLY'; -exports[1875] = 'ER_STOP_SLAVE_SQL_THREAD_TIMEOUT'; -exports[1876] = 'ER_STOP_SLAVE_IO_THREAD_TIMEOUT'; -exports[1877] = 'ER_TABLE_CORRUPT'; -exports[1878] = 'ER_TEMP_FILE_WRITE_FAILURE'; -exports[1879] = 'ER_INNODB_FT_AUX_NOT_HEX_ID'; -exports[1880] = 'ER_OLD_TEMPORALS_UPGRADED'; -exports[1881] = 'ER_INNODB_FORCED_RECOVERY'; -exports[1882] = 'ER_AES_INVALID_IV'; diff --git a/node_modules/mysql/lib/protocol/constants/field_flags.js b/node_modules/mysql/lib/protocol/constants/field_flags.js deleted file mode 100644 index c698da5..0000000 --- a/node_modules/mysql/lib/protocol/constants/field_flags.js +++ /dev/null @@ -1,18 +0,0 @@ -// Manually extracted from mysql-5.5.23/include/mysql_com.h -exports.NOT_NULL_FLAG = 1; /* Field can't be NULL */ -exports.PRI_KEY_FLAG = 2; /* Field is part of a primary key */ -exports.UNIQUE_KEY_FLAG = 4; /* Field is part of a unique key */ -exports.MULTIPLE_KEY_FLAG = 8; /* Field is part of a key */ -exports.BLOB_FLAG = 16; /* Field is a blob */ -exports.UNSIGNED_FLAG = 32; /* Field is unsigned */ -exports.ZEROFILL_FLAG = 64; /* Field is zerofill */ -exports.BINARY_FLAG = 128; /* Field is binary */ - -/* The following are only sent to new clients */ -exports.ENUM_FLAG = 256; /* field is an enum */ -exports.AUTO_INCREMENT_FLAG = 512; /* field is a autoincrement field */ -exports.TIMESTAMP_FLAG = 1024; /* Field is a timestamp */ -exports.SET_FLAG = 2048; /* field is a set */ -exports.NO_DEFAULT_VALUE_FLAG = 4096; /* Field doesn't have default value */ -exports.ON_UPDATE_NOW_FLAG = 8192; /* Field is set to NOW on UPDATE */ -exports.NUM_FLAG = 32768; /* Field is num (for clients) */ diff --git a/node_modules/mysql/lib/protocol/packets/ClientAuthenticationPacket.js b/node_modules/mysql/lib/protocol/packets/ClientAuthenticationPacket.js deleted file mode 100644 index a66d28b..0000000 --- a/node_modules/mysql/lib/protocol/packets/ClientAuthenticationPacket.js +++ /dev/null @@ -1,52 +0,0 @@ -module.exports = ClientAuthenticationPacket; -function ClientAuthenticationPacket(options) { - options = options || {}; - - this.clientFlags = options.clientFlags; - this.maxPacketSize = options.maxPacketSize; - this.charsetNumber = options.charsetNumber; - this.filler = undefined; - this.user = options.user; - this.scrambleBuff = options.scrambleBuff; - this.database = options.database; - this.protocol41 = options.protocol41; -} - -ClientAuthenticationPacket.prototype.parse = function(parser) { - if (this.protocol41) { - this.clientFlags = parser.parseUnsignedNumber(4); - this.maxPacketSize = parser.parseUnsignedNumber(4); - this.charsetNumber = parser.parseUnsignedNumber(1); - this.filler = parser.parseFiller(23); - this.user = parser.parseNullTerminatedString(); - this.scrambleBuff = parser.parseLengthCodedBuffer(); - this.database = parser.parseNullTerminatedString(); - } else { - this.clientFlags = parser.parseUnsignedNumber(2); - this.maxPacketSize = parser.parseUnsignedNumber(3); - this.user = parser.parseNullTerminatedString(); - this.scrambleBuff = parser.parseBuffer(8); - this.database = parser.parseLengthCodedBuffer(); - } -}; - -ClientAuthenticationPacket.prototype.write = function(writer) { - if (this.protocol41) { - writer.writeUnsignedNumber(4, this.clientFlags); - writer.writeUnsignedNumber(4, this.maxPacketSize); - writer.writeUnsignedNumber(1, this.charsetNumber); - writer.writeFiller(23); - writer.writeNullTerminatedString(this.user); - writer.writeLengthCodedBuffer(this.scrambleBuff); - writer.writeNullTerminatedString(this.database); - } else { - writer.writeUnsignedNumber(2, this.clientFlags); - writer.writeUnsignedNumber(3, this.maxPacketSize); - writer.writeNullTerminatedString(this.user); - writer.writeBuffer(this.scrambleBuff); - if (this.database && this.database.length) { - writer.writeFiller(1); - writer.writeBuffer(new Buffer(this.database)); - } - } -}; diff --git a/node_modules/mysql/lib/protocol/packets/ComChangeUserPacket.js b/node_modules/mysql/lib/protocol/packets/ComChangeUserPacket.js deleted file mode 100644 index 3278842..0000000 --- a/node_modules/mysql/lib/protocol/packets/ComChangeUserPacket.js +++ /dev/null @@ -1,26 +0,0 @@ -module.exports = ComChangeUserPacket; -function ComChangeUserPacket(options) { - options = options || {}; - - this.command = 0x11; - this.user = options.user; - this.scrambleBuff = options.scrambleBuff; - this.database = options.database; - this.charsetNumber = options.charsetNumber; -} - -ComChangeUserPacket.prototype.parse = function(parser) { - this.command = parser.parseUnsignedNumber(1); - this.user = parser.parseNullTerminatedString(); - this.scrambleBuff = parser.parseLengthCodedBuffer(); - this.database = parser.parseNullTerminatedString(); - this.charsetNumber = parser.parseUnsignedNumber(1); -}; - -ComChangeUserPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.command); - writer.writeNullTerminatedString(this.user); - writer.writeLengthCodedBuffer(this.scrambleBuff); - writer.writeNullTerminatedString(this.database); - writer.writeUnsignedNumber(2, this.charsetNumber); -}; diff --git a/node_modules/mysql/lib/protocol/packets/ComPingPacket.js b/node_modules/mysql/lib/protocol/packets/ComPingPacket.js deleted file mode 100644 index 359eef5..0000000 --- a/node_modules/mysql/lib/protocol/packets/ComPingPacket.js +++ /dev/null @@ -1,12 +0,0 @@ -module.exports = ComPingPacket; -function ComPingPacket(sql) { - this.command = 0x0e; -} - -ComPingPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.command); -}; - -ComPingPacket.prototype.parse = function(parser) { - this.command = parser.parseUnsignedNumber(1); -}; diff --git a/node_modules/mysql/lib/protocol/packets/ComQueryPacket.js b/node_modules/mysql/lib/protocol/packets/ComQueryPacket.js deleted file mode 100644 index 7ac191f..0000000 --- a/node_modules/mysql/lib/protocol/packets/ComQueryPacket.js +++ /dev/null @@ -1,15 +0,0 @@ -module.exports = ComQueryPacket; -function ComQueryPacket(sql) { - this.command = 0x03; - this.sql = sql; -} - -ComQueryPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.command); - writer.writeString(this.sql); -}; - -ComQueryPacket.prototype.parse = function(parser) { - this.command = parser.parseUnsignedNumber(1); - this.sql = parser.parsePacketTerminatedString(); -}; diff --git a/node_modules/mysql/lib/protocol/packets/ComQuitPacket.js b/node_modules/mysql/lib/protocol/packets/ComQuitPacket.js deleted file mode 100644 index 26a08f8..0000000 --- a/node_modules/mysql/lib/protocol/packets/ComQuitPacket.js +++ /dev/null @@ -1,12 +0,0 @@ -module.exports = ComQuitPacket; -function ComQuitPacket(sql) { - this.command = 0x01; -} - -ComQuitPacket.prototype.parse = function parse(parser) { - this.command = parser.parseUnsignedNumber(1); -}; - -ComQuitPacket.prototype.write = function write(writer) { - writer.writeUnsignedNumber(1, this.command); -}; diff --git a/node_modules/mysql/lib/protocol/packets/ComStatisticsPacket.js b/node_modules/mysql/lib/protocol/packets/ComStatisticsPacket.js deleted file mode 100644 index fe11d18..0000000 --- a/node_modules/mysql/lib/protocol/packets/ComStatisticsPacket.js +++ /dev/null @@ -1,12 +0,0 @@ -module.exports = ComStatisticsPacket; -function ComStatisticsPacket(sql) { - this.command = 0x09; -} - -ComStatisticsPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.command); -}; - -ComStatisticsPacket.prototype.parse = function(parser) { - this.command = parser.parseUnsignedNumber(1); -}; diff --git a/node_modules/mysql/lib/protocol/packets/EmptyPacket.js b/node_modules/mysql/lib/protocol/packets/EmptyPacket.js deleted file mode 100644 index f02189c..0000000 --- a/node_modules/mysql/lib/protocol/packets/EmptyPacket.js +++ /dev/null @@ -1,6 +0,0 @@ -module.exports = EmptyPacket; -function EmptyPacket() { -} - -EmptyPacket.prototype.write = function(writer) { -}; diff --git a/node_modules/mysql/lib/protocol/packets/EofPacket.js b/node_modules/mysql/lib/protocol/packets/EofPacket.js deleted file mode 100644 index b80ca5e..0000000 --- a/node_modules/mysql/lib/protocol/packets/EofPacket.js +++ /dev/null @@ -1,25 +0,0 @@ -module.exports = EofPacket; -function EofPacket(options) { - options = options || {}; - - this.fieldCount = undefined; - this.warningCount = options.warningCount; - this.serverStatus = options.serverStatus; - this.protocol41 = options.protocol41; -} - -EofPacket.prototype.parse = function(parser) { - this.fieldCount = parser.parseUnsignedNumber(1); - if (this.protocol41) { - this.warningCount = parser.parseUnsignedNumber(2); - this.serverStatus = parser.parseUnsignedNumber(2); - } -}; - -EofPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, 0xfe); - if (this.protocol41) { - writer.writeUnsignedNumber(2, this.warningCount); - writer.writeUnsignedNumber(2, this.serverStatus); - } -}; diff --git a/node_modules/mysql/lib/protocol/packets/ErrorPacket.js b/node_modules/mysql/lib/protocol/packets/ErrorPacket.js deleted file mode 100644 index e03de00..0000000 --- a/node_modules/mysql/lib/protocol/packets/ErrorPacket.js +++ /dev/null @@ -1,35 +0,0 @@ -module.exports = ErrorPacket; -function ErrorPacket(options) { - options = options || {}; - - this.fieldCount = options.fieldCount; - this.errno = options.errno; - this.sqlStateMarker = options.sqlStateMarker; - this.sqlState = options.sqlState; - this.message = options.message; -} - -ErrorPacket.prototype.parse = function(parser) { - this.fieldCount = parser.parseUnsignedNumber(1); - this.errno = parser.parseUnsignedNumber(2); - - // sqlStateMarker ('#' = 0x23) indicates error packet format - if (parser.peak() === 0x23) { - this.sqlStateMarker = parser.parseString(1); - this.sqlState = parser.parseString(5); - } - - this.message = parser.parsePacketTerminatedString(); -}; - -ErrorPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, 0xff); - writer.writeUnsignedNumber(2, this.errno); - - if (this.sqlStateMarker) { - writer.writeString(this.sqlStateMarker); - writer.writeString(this.sqlState); - } - - writer.writeString(this.message); -}; diff --git a/node_modules/mysql/lib/protocol/packets/Field.js b/node_modules/mysql/lib/protocol/packets/Field.js deleted file mode 100644 index b686a88..0000000 --- a/node_modules/mysql/lib/protocol/packets/Field.js +++ /dev/null @@ -1,32 +0,0 @@ -var Types = require('../constants/types'); - -module.exports = Field; -function Field(options) { - options = options || {}; - - this.parser = options.parser; - this.packet = options.packet; - this.db = options.packet.db; - this.table = options.packet.table; - this.name = options.packet.name; - this.type = typeToString(options.packet.type); - this.length = options.packet.length; -} - -Field.prototype.string = function () { - return this.parser.parseLengthCodedString(); -}; - -Field.prototype.buffer = function () { - return this.parser.parseLengthCodedBuffer(); -}; - -Field.prototype.geometry = function () { - return this.parser.parseGeometryValue(); -}; - -function typeToString(t) { - for (var k in Types) { - if (Types[k] == t) return k; - } -} diff --git a/node_modules/mysql/lib/protocol/packets/FieldPacket.js b/node_modules/mysql/lib/protocol/packets/FieldPacket.js deleted file mode 100644 index d8fd68f..0000000 --- a/node_modules/mysql/lib/protocol/packets/FieldPacket.js +++ /dev/null @@ -1,93 +0,0 @@ -module.exports = FieldPacket; -function FieldPacket(options) { - options = options || {}; - - this.catalog = options.catalog; - this.db = options.db; - this.table = options.table; - this.orgTable = options.orgTable; - this.name = options.name; - this.orgName = options.orgName; - this.charsetNr = options.charsetNr; - this.length = options.length; - this.type = options.type; - this.flags = options.flags; - this.decimals = options.decimals; - this.default = options.default; - this.zeroFill = options.zeroFill; - this.protocol41 = options.protocol41 -} - -FieldPacket.prototype.parse = function(parser) { - if (this.protocol41) { - this.catalog = parser.parseLengthCodedString(); - this.db = parser.parseLengthCodedString(); - this.table = parser.parseLengthCodedString(); - this.orgTable = parser.parseLengthCodedString(); - this.name = parser.parseLengthCodedString(); - this.orgName = parser.parseLengthCodedString(); - - if (parser.parseLengthCodedNumber() !== 0x0c) { - var err = new TypeError('Received invalid field length'); - err.code = 'PARSER_INVALID_FIELD_LENGTH'; - throw err; - } - - this.charsetNr = parser.parseUnsignedNumber(2); - this.length = parser.parseUnsignedNumber(4); - this.type = parser.parseUnsignedNumber(1); - this.flags = parser.parseUnsignedNumber(2); - this.decimals = parser.parseUnsignedNumber(1); - - var filler = parser.parseBuffer(2); - if (filler[0] !== 0x0 || filler[1] !== 0x0) { - var err = new TypeError('Received invalid filler'); - err.code = 'PARSER_INVALID_FILLER'; - throw err; - } - - // parsed flags - this.zeroFill = (this.flags & 0x0040 ? true : false); - - if (parser.reachedPacketEnd()) { - return; - } - - this.default = parser.parseLengthCodedString(); - } else { - this.table = parser.parseLengthCodedString(); - this.name = parser.parseLengthCodedString(); - this.length = parser.parseUnsignedNumber(parser.parseUnsignedNumber(1)); - this.type = parser.parseUnsignedNumber(parser.parseUnsignedNumber(1)); - } -}; - -FieldPacket.prototype.write = function(writer) { - if (this.protocol41) { - writer.writeLengthCodedString(this.catalog); - writer.writeLengthCodedString(this.db); - writer.writeLengthCodedString(this.table); - writer.writeLengthCodedString(this.orgTable); - writer.writeLengthCodedString(this.name); - writer.writeLengthCodedString(this.orgName); - - writer.writeLengthCodedNumber(0x0c); - writer.writeUnsignedNumber(2, this.charsetNr || 0); - writer.writeUnsignedNumber(4, this.length || 0); - writer.writeUnsignedNumber(1, this.type || 0); - writer.writeUnsignedNumber(2, this.flags || 0); - writer.writeUnsignedNumber(1, this.decimals || 0); - writer.writeFiller(2); - - if (this.default !== undefined) { - writer.writeLengthCodedString(this.default); - } - } else { - writer.writeLengthCodedString(this.table); - writer.writeLengthCodedString(this.name); - writer.writeUnsignedNumber(1, 0x01); - writer.writeUnsignedNumber(1, this.length); - writer.writeUnsignedNumber(1, 0x01); - writer.writeUnsignedNumber(1, this.type); - } -}; diff --git a/node_modules/mysql/lib/protocol/packets/HandshakeInitializationPacket.js b/node_modules/mysql/lib/protocol/packets/HandshakeInitializationPacket.js deleted file mode 100644 index a55372a..0000000 --- a/node_modules/mysql/lib/protocol/packets/HandshakeInitializationPacket.js +++ /dev/null @@ -1,100 +0,0 @@ -var Client = require('../constants/client'); - -module.exports = HandshakeInitializationPacket; -function HandshakeInitializationPacket(options) { - options = options || {}; - - this.protocolVersion = options.protocolVersion; - this.serverVersion = options.serverVersion; - this.threadId = options.threadId; - this.scrambleBuff1 = options.scrambleBuff1; - this.filler1 = options.filler1; - this.serverCapabilities1 = options.serverCapabilities1; - this.serverLanguage = options.serverLanguage; - this.serverStatus = options.serverStatus; - this.serverCapabilities2 = options.serverCapabilities2; - this.scrambleLength = options.scrambleLength; - this.filler2 = options.filler2; - this.scrambleBuff2 = options.scrambleBuff2; - this.filler3 = options.filler3; - this.pluginData = options.pluginData; - this.protocol41 = options.protocol41; - - if (this.protocol41) { - // force set the bit in serverCapabilities1 - this.serverCapabilities1 |= Client.CLIENT_PROTOCOL_41; - } -} - -HandshakeInitializationPacket.prototype.parse = function(parser) { - this.protocolVersion = parser.parseUnsignedNumber(1); - this.serverVersion = parser.parseNullTerminatedString(); - this.threadId = parser.parseUnsignedNumber(4); - this.scrambleBuff1 = parser.parseBuffer(8); - this.filler1 = parser.parseFiller(1); - this.serverCapabilities1 = parser.parseUnsignedNumber(2); - this.serverLanguage = parser.parseUnsignedNumber(1); - this.serverStatus = parser.parseUnsignedNumber(2); - - this.protocol41 = (this.serverCapabilities1 & (1 << 9)) > 0; - - if (this.protocol41) { - this.serverCapabilities2 = parser.parseUnsignedNumber(2); - this.scrambleLength = parser.parseUnsignedNumber(1); - this.filler2 = parser.parseFiller(10); - // scrambleBuff2 should be 0x00 terminated, but sphinx does not do this - // so we assume scrambleBuff2 to be 12 byte and treat the next byte as a - // filler byte. - this.scrambleBuff2 = parser.parseBuffer(12); - this.filler3 = parser.parseFiller(1); - } else { - this.filler2 = parser.parseFiller(13); - } - - if (parser.reachedPacketEnd()) { - return; - } - - // According to the docs this should be 0x00 terminated, but MariaDB does - // not do this, so we assume this string to be packet terminated. - this.pluginData = parser.parsePacketTerminatedString(); - - // However, if there is a trailing '\0', strip it - var lastChar = this.pluginData.length - 1; - if (this.pluginData[lastChar] === '\0') { - this.pluginData = this.pluginData.substr(0, lastChar); - } -}; - -HandshakeInitializationPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.protocolVersion); - writer.writeNullTerminatedString(this.serverVersion); - writer.writeUnsignedNumber(4, this.threadId); - writer.writeBuffer(this.scrambleBuff1); - writer.writeFiller(1); - writer.writeUnsignedNumber(2, this.serverCapabilities1); - writer.writeUnsignedNumber(1, this.serverLanguage); - writer.writeUnsignedNumber(2, this.serverStatus); - if (this.protocol41) { - writer.writeUnsignedNumber(2, this.serverCapabilities2); - writer.writeUnsignedNumber(1, this.scrambleLength); - writer.writeFiller(10); - } - writer.writeNullTerminatedBuffer(this.scrambleBuff2); - - if (this.pluginData !== undefined) { - writer.writeNullTerminatedString(this.pluginData); - } -}; - -HandshakeInitializationPacket.prototype.scrambleBuff = function() { - var buffer = new Buffer(this.scrambleBuff1.length + - (typeof this.scrambleBuff2 != "undefined" ? this.scrambleBuff2.length : 0)); - - this.scrambleBuff1.copy(buffer); - if (typeof this.scrambleBuff2 != "undefined") { - this.scrambleBuff2.copy(buffer, this.scrambleBuff1.length); - } - - return buffer; -}; diff --git a/node_modules/mysql/lib/protocol/packets/LocalDataFilePacket.js b/node_modules/mysql/lib/protocol/packets/LocalDataFilePacket.js deleted file mode 100644 index 8a79a08..0000000 --- a/node_modules/mysql/lib/protocol/packets/LocalDataFilePacket.js +++ /dev/null @@ -1,11 +0,0 @@ -module.exports = LocalDataFilePacket; -/** - * @param {Buffer} data - */ -function LocalDataFilePacket(data) { - this.data = data; -} - -LocalDataFilePacket.prototype.write = function(writer) { - writer.writeBuffer(this.data); -}; diff --git a/node_modules/mysql/lib/protocol/packets/OkPacket.js b/node_modules/mysql/lib/protocol/packets/OkPacket.js deleted file mode 100644 index 0d9a096..0000000 --- a/node_modules/mysql/lib/protocol/packets/OkPacket.js +++ /dev/null @@ -1,41 +0,0 @@ -module.exports = OkPacket; -function OkPacket(options) { - options = options || {}; - - this.fieldCount = undefined; - this.affectedRows = undefined; - this.insertId = undefined; - this.serverStatus = undefined; - this.warningCount = undefined; - this.message = undefined; - this.protocol41 = options.protocol41; -} - -OkPacket.prototype.parse = function(parser) { - this.fieldCount = parser.parseUnsignedNumber(1); - this.affectedRows = parser.parseLengthCodedNumber(); - this.insertId = parser.parseLengthCodedNumber(); - if (this.protocol41) { - this.serverStatus = parser.parseUnsignedNumber(2); - this.warningCount = parser.parseUnsignedNumber(2); - } - this.message = parser.parsePacketTerminatedString(); - this.changedRows = 0; - - var m = this.message.match(/\schanged:\s*(\d+)/i); - - if (m !== null) { - this.changedRows = parseInt(m[1], 10); - } -}; - -OkPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, 0x00); - writer.writeLengthCodedNumber(this.affectedRows || 0); - writer.writeLengthCodedNumber(this.insertId || 0); - if (this.protocol41) { - writer.writeUnsignedNumber(2, this.serverStatus || 0); - writer.writeUnsignedNumber(2, this.warningCount || 0); - } - writer.writeString(this.message); -}; diff --git a/node_modules/mysql/lib/protocol/packets/OldPasswordPacket.js b/node_modules/mysql/lib/protocol/packets/OldPasswordPacket.js deleted file mode 100644 index 1ff78ec..0000000 --- a/node_modules/mysql/lib/protocol/packets/OldPasswordPacket.js +++ /dev/null @@ -1,15 +0,0 @@ -module.exports = OldPasswordPacket; -function OldPasswordPacket(options) { - options = options || {}; - - this.scrambleBuff = options.scrambleBuff; -} - -OldPasswordPacket.prototype.parse = function(parser) { - this.scrambleBuff = parser.parseNullTerminatedBuffer(); -}; - -OldPasswordPacket.prototype.write = function(writer) { - writer.writeBuffer(this.scrambleBuff); - writer.writeFiller(1); -}; diff --git a/node_modules/mysql/lib/protocol/packets/ResultSetHeaderPacket.js b/node_modules/mysql/lib/protocol/packets/ResultSetHeaderPacket.js deleted file mode 100644 index 25b8002..0000000 --- a/node_modules/mysql/lib/protocol/packets/ResultSetHeaderPacket.js +++ /dev/null @@ -1,25 +0,0 @@ -module.exports = ResultSetHeaderPacket; -function ResultSetHeaderPacket(options) { - options = options || {}; - - this.fieldCount = options.fieldCount; - this.extra = options.extra; -} - -ResultSetHeaderPacket.prototype.parse = function(parser) { - this.fieldCount = parser.parseLengthCodedNumber(); - - if (parser.reachedPacketEnd()) return; - - this.extra = (this.fieldCount === null) - ? parser.parsePacketTerminatedString() - : parser.parseLengthCodedNumber(); -}; - -ResultSetHeaderPacket.prototype.write = function(writer) { - writer.writeLengthCodedNumber(this.fieldCount); - - if (this.extra !== undefined) { - writer.writeLengthCodedNumber(this.extra); - } -}; diff --git a/node_modules/mysql/lib/protocol/packets/RowDataPacket.js b/node_modules/mysql/lib/protocol/packets/RowDataPacket.js deleted file mode 100644 index 82fa134..0000000 --- a/node_modules/mysql/lib/protocol/packets/RowDataPacket.js +++ /dev/null @@ -1,120 +0,0 @@ -var Types = require('../constants/types'); -var Charsets = require('../constants/charsets'); -var Field = require('./Field'); -var IEEE_754_BINARY_64_PRECISION = Math.pow(2, 53); - -module.exports = RowDataPacket; -function RowDataPacket() { -} - -Object.defineProperty(RowDataPacket.prototype, 'parse', { - configurable: true, - enumerable: false, - value: parse -}); - -Object.defineProperty(RowDataPacket.prototype, '_typeCast', { - configurable: true, - enumerable: false, - value: typeCast -}); - -function parse(parser, fieldPackets, typeCast, nestTables, connection) { - var self = this; - var next = function () { - return self._typeCast(fieldPacket, parser, connection.config.timezone, connection.config.supportBigNumbers, connection.config.bigNumberStrings, connection.config.dateStrings); - }; - - for (var i = 0; i < fieldPackets.length; i++) { - var fieldPacket = fieldPackets[i]; - var value; - - if (typeof typeCast == "function") { - value = typeCast.apply(connection, [ new Field({ packet: fieldPacket, parser: parser }), next ]); - } else { - value = (typeCast) - ? this._typeCast(fieldPacket, parser, connection.config.timezone, connection.config.supportBigNumbers, connection.config.bigNumberStrings, connection.config.dateStrings) - : ( (fieldPacket.charsetNr === Charsets.BINARY) - ? parser.parseLengthCodedBuffer() - : parser.parseLengthCodedString() ); - } - - if (typeof nestTables == "string" && nestTables.length) { - this[fieldPacket.table + nestTables + fieldPacket.name] = value; - } else if (nestTables) { - this[fieldPacket.table] = this[fieldPacket.table] || {}; - this[fieldPacket.table][fieldPacket.name] = value; - } else { - this[fieldPacket.name] = value; - } - } -} - -function typeCast(field, parser, timeZone, supportBigNumbers, bigNumberStrings, dateStrings) { - var numberString; - - switch (field.type) { - case Types.TIMESTAMP: - case Types.DATE: - case Types.DATETIME: - case Types.NEWDATE: - var dateString = parser.parseLengthCodedString(); - if (dateStrings) { - return dateString; - } - var dt; - - if (dateString === null) { - return null; - } - - var originalString = dateString; - if (field.type === Types.DATE) { - dateString += ' 00:00:00'; - } - - if (timeZone !== 'local') { - dateString += ' ' + timeZone; - } - - dt = new Date(dateString); - if (isNaN(dt.getTime())) { - return originalString; - } - - return dt; - case Types.TINY: - case Types.SHORT: - case Types.LONG: - case Types.INT24: - case Types.YEAR: - case Types.FLOAT: - case Types.DOUBLE: - numberString = parser.parseLengthCodedString(); - return (numberString === null || (field.zeroFill && numberString[0] == "0")) - ? numberString : Number(numberString); - case Types.NEWDECIMAL: - case Types.LONGLONG: - numberString = parser.parseLengthCodedString(); - return (numberString === null || (field.zeroFill && numberString[0] == "0")) - ? numberString - : ((supportBigNumbers && (bigNumberStrings || (Number(numberString) > IEEE_754_BINARY_64_PRECISION))) - ? numberString - : Number(numberString)); - case Types.BIT: - return parser.parseLengthCodedBuffer(); - case Types.STRING: - case Types.VAR_STRING: - case Types.TINY_BLOB: - case Types.MEDIUM_BLOB: - case Types.LONG_BLOB: - case Types.BLOB: - return (field.charsetNr === Charsets.BINARY) - ? parser.parseLengthCodedBuffer() - : parser.parseLengthCodedString(); - case Types.GEOMETRY: - return parser.parseGeometryValue(); - default: - return parser.parseLengthCodedString(); - } -} diff --git a/node_modules/mysql/lib/protocol/packets/SSLRequestPacket.js b/node_modules/mysql/lib/protocol/packets/SSLRequestPacket.js deleted file mode 100644 index a57cfc1..0000000 --- a/node_modules/mysql/lib/protocol/packets/SSLRequestPacket.js +++ /dev/null @@ -1,27 +0,0 @@ -// http://dev.mysql.com/doc/internals/en/ssl.html -// http://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::SSLRequest - -var ClientConstants = require('../constants/client'); - -module.exports = SSLRequestPacket; - -function SSLRequestPacket(options) { - options = options || {}; - this.clientFlags = options.clientFlags | ClientConstants.CLIENT_SSL; - this.maxPacketSize = options.maxPacketSize; - this.charsetNumber = options.charsetNumber; -} - -SSLRequestPacket.prototype.parse = function(parser) { - // TODO: check SSLRequest packet v41 vs pre v41 - this.clientFlags = parser.parseUnsignedNumber(4); - this.maxPacketSize = parser.parseUnsignedNumber(4); - this.charsetNumber = parser.parseUnsignedNumber(1); -}; - -SSLRequestPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(4, this.clientFlags); - writer.writeUnsignedNumber(4, this.maxPacketSize); - writer.writeUnsignedNumber(1, this.charsetNumber); - writer.writeFiller(23); -}; diff --git a/node_modules/mysql/lib/protocol/packets/StatisticsPacket.js b/node_modules/mysql/lib/protocol/packets/StatisticsPacket.js deleted file mode 100644 index 5f70b3b..0000000 --- a/node_modules/mysql/lib/protocol/packets/StatisticsPacket.js +++ /dev/null @@ -1,20 +0,0 @@ -module.exports = StatisticsPacket; -function StatisticsPacket() { - this.message = undefined; -} - -StatisticsPacket.prototype.parse = function(parser) { - this.message = parser.parsePacketTerminatedString(); - - var items = this.message.split(/\s\s/); - for (var i = 0; i < items.length; i++) { - var m = items[i].match(/^(.+)\:\s+(.+)$/); - if (m !== null) { - this[m[1].toLowerCase().replace(/\s/g, '_')] = Number(m[2]); - } - } -}; - -StatisticsPacket.prototype.write = function(writer) { - writer.writeString(this.message); -}; diff --git a/node_modules/mysql/lib/protocol/packets/UseOldPasswordPacket.js b/node_modules/mysql/lib/protocol/packets/UseOldPasswordPacket.js deleted file mode 100644 index d73bf44..0000000 --- a/node_modules/mysql/lib/protocol/packets/UseOldPasswordPacket.js +++ /dev/null @@ -1,14 +0,0 @@ -module.exports = UseOldPasswordPacket; -function UseOldPasswordPacket(options) { - options = options || {}; - - this.firstByte = options.firstByte || 0xfe; -} - -UseOldPasswordPacket.prototype.parse = function(parser) { - this.firstByte = parser.parseUnsignedNumber(1); -}; - -UseOldPasswordPacket.prototype.write = function(writer) { - writer.writeUnsignedNumber(1, this.firstByte); -}; diff --git a/node_modules/mysql/lib/protocol/packets/index.js b/node_modules/mysql/lib/protocol/packets/index.js deleted file mode 100644 index a13d469..0000000 --- a/node_modules/mysql/lib/protocol/packets/index.js +++ /dev/null @@ -1,4 +0,0 @@ -var Elements = module.exports = require('require-all')({ - dirname : __dirname, - filter : /([A-Z].+)\.js$/, -}); diff --git a/node_modules/mysql/lib/protocol/sequences/ChangeUser.js b/node_modules/mysql/lib/protocol/sequences/ChangeUser.js deleted file mode 100644 index e3f0640..0000000 --- a/node_modules/mysql/lib/protocol/sequences/ChangeUser.js +++ /dev/null @@ -1,41 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); -var Auth = require('../Auth'); - -module.exports = ChangeUser; -Util.inherits(ChangeUser, Sequence); -function ChangeUser(options, callback) { - Sequence.call(this, options, callback); - - this._user = options.user; - this._password = options.password; - this._database = options.database; - this._charsetNumber = options.charsetNumber; - this._currentConfig = options.currentConfig; -} - -ChangeUser.prototype.start = function(handshakeInitializationPacket) { - var scrambleBuff = handshakeInitializationPacket.scrambleBuff(); - scrambleBuff = Auth.token(this._password, scrambleBuff); - - var packet = new Packets.ComChangeUserPacket({ - user : this._user, - scrambleBuff : scrambleBuff, - database : this._database, - charsetNumber : this._charsetNumber, - }); - - this._currentConfig.user = this._user; - this._currentConfig.password = this._password; - this._currentConfig.database = this._database; - this._currentConfig.charsetNumber = this._charsetNumber; - - this.emit('packet', packet); -}; - -ChangeUser.prototype['ErrorPacket'] = function(packet) { - var err = this._packetToError(packet); - err.fatal = true; - this.end(err); -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Handshake.js b/node_modules/mysql/lib/protocol/sequences/Handshake.js deleted file mode 100644 index b26988c..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Handshake.js +++ /dev/null @@ -1,104 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); -var Auth = require('../Auth'); -var ClientConstants = require('../constants/client'); - -module.exports = Handshake; -Util.inherits(Handshake, Sequence); -function Handshake(options, callback) { - Sequence.call(this, options, callback); - - options = options || {}; - - this._config = options.config; - this._handshakeInitializationPacket = null; -} - -Handshake.prototype.determinePacket = function(firstByte) { - if (firstByte === 0xff) { - return Packets.ErrorPacket; - } - - if (!this._handshakeInitializationPacket) { - return Packets.HandshakeInitializationPacket; - } - - if (firstByte === 0xfe) { - return Packets.UseOldPasswordPacket; - } -}; - -Handshake.prototype['HandshakeInitializationPacket'] = function(packet) { - this._handshakeInitializationPacket = packet; - - this._config.protocol41 = packet.protocol41; - - var serverSSLSupport = packet.serverCapabilities1 & ClientConstants.CLIENT_SSL; - - if (this._config.ssl) { - if (!serverSSLSupport) { - var err = new Error('Server does not support secure connnection'); - - err.code = 'HANDSHAKE_NO_SSL_SUPPORT'; - err.fatal = true; - - this.end(err); - return; - } - - this._config.clientFlags |= ClientConstants.CLIENT_SSL; - this.emit('packet', new Packets.SSLRequestPacket({ - clientFlags : this._config.clientFlags, - maxPacketSize : this._config.maxPacketSize, - charsetNumber : this._config.charsetNumber - })); - this.emit('start-tls'); - } else { - this._sendCredentials(); - } -}; - -Handshake.prototype._tlsUpgradeCompleteHandler = function() { - this._sendCredentials(); -}; - -Handshake.prototype._sendCredentials = function(serverHello) { - var packet = this._handshakeInitializationPacket; - this.emit('packet', new Packets.ClientAuthenticationPacket({ - clientFlags : this._config.clientFlags, - maxPacketSize : this._config.maxPacketSize, - charsetNumber : this._config.charsetNumber, - user : this._config.user, - scrambleBuff : (packet.protocol41) - ? Auth.token(this._config.password, packet.scrambleBuff()) - : Auth.scramble323(packet.scrambleBuff(), this._config.password), - database : this._config.database, - protocol41 : packet.protocol41 - })); -}; - -Handshake.prototype['UseOldPasswordPacket'] = function(packet) { - if (!this._config.insecureAuth) { - var err = new Error( - 'MySQL server is requesting the old and insecure pre-4.1 auth mechanism.' + - 'Upgrade the user password or use the {insecureAuth: true} option.' - ); - - err.code = 'HANDSHAKE_INSECURE_AUTH'; - err.fatal = true; - - this.end(err); - return; - } - - this.emit('packet', new Packets.OldPasswordPacket({ - scrambleBuff : Auth.scramble323(this._handshakeInitializationPacket.scrambleBuff(), this._config.password), - })); -}; - -Handshake.prototype['ErrorPacket'] = function(packet) { - var err = this._packetToError(packet, true); - err.fatal = true; - this.end(err); -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Ping.js b/node_modules/mysql/lib/protocol/sequences/Ping.js deleted file mode 100644 index b298c92..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Ping.js +++ /dev/null @@ -1,19 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); - -module.exports = Ping; -Util.inherits(Ping, Sequence); - -function Ping(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - Sequence.call(this, options, callback); -} - -Ping.prototype.start = function() { - this.emit('packet', new Packets.ComPingPacket); -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Query.js b/node_modules/mysql/lib/protocol/sequences/Query.js deleted file mode 100644 index 0be2914..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Query.js +++ /dev/null @@ -1,218 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); -var ResultSet = require('../ResultSet'); -var ServerStatus = require('../constants/server_status'); -var fs = require('fs'); -var Readable = require('readable-stream'); - -module.exports = Query; -Util.inherits(Query, Sequence); -function Query(options, callback) { - Sequence.call(this, options, callback); - - this.sql = options.sql; - this.values = options.values; - this.typeCast = (options.typeCast === undefined) - ? true - : options.typeCast; - this.nestTables = options.nestTables || false; - - this._resultSet = null; - this._results = []; - this._fields = []; - this._index = 0; - this._loadError = null; -} - -Query.prototype.start = function() { - this.emit('packet', new Packets.ComQueryPacket(this.sql)); -}; - -Query.prototype.determinePacket = function(firstByte, parser) { - if (firstByte === 0) { - // If we have a resultSet and got one eofPacket - if (this._resultSet && this._resultSet.eofPackets.length === 1) { - // Then this is a RowDataPacket with an empty string in the first column. - // See: https://github.com/felixge/node-mysql/issues/222 - } else if (this._resultSet && this._resultSet.resultSetHeaderPacket - && this._resultSet.resultSetHeaderPacket.fieldCount !== null) { - return Packets.FieldPacket; - } else { - return; - } - } - - if (firstByte === 255) { - return; - } - - // EofPacket's are 5 bytes in mysql >= 4.1 - // This is the only / best way to differentiate their firstByte from a 9 - // byte length coded binary. - if (firstByte === 0xfe && parser.packetLength() < 9) { - return Packets.EofPacket; - } - - if (!this._resultSet) { - return Packets.ResultSetHeaderPacket; - } - - return (this._resultSet.eofPackets.length === 0) - ? Packets.FieldPacket - : Packets.RowDataPacket; -}; - -Query.prototype['OkPacket'] = function(packet) { - // try...finally for exception safety - try { - if (!this._callback) { - this.emit('result', packet, this._index); - } else { - this._results.push(packet); - this._fields.push(undefined); - } - } finally { - this._index++; - this._handleFinalResultPacket(packet); - } -}; - -Query.prototype['ErrorPacket'] = function(packet) { - var err = this._packetToError(packet); - - var results = (this._results.length > 0) - ? this._results - : undefined; - - var fields = (this._fields.length > 0) - ? this._fields - : undefined; - - err.index = this._index; - this.end(err, results, fields); -}; - -Query.prototype['ResultSetHeaderPacket'] = function(packet) { - this._resultSet = new ResultSet(packet); - - // used by LOAD DATA LOCAL INFILE queries - if (packet.fieldCount === null) { - this._sendLocalDataFile(packet.extra); - } -}; - -Query.prototype['FieldPacket'] = function(packet) { - this._resultSet.fieldPackets.push(packet); -}; - -Query.prototype['EofPacket'] = function(packet) { - this._resultSet.eofPackets.push(packet); - - if (this._resultSet.eofPackets.length === 1 && !this._callback) { - this.emit('fields', this._resultSet.fieldPackets, this._index); - } - - if (this._resultSet.eofPackets.length !== 2) { - return; - } - - if (this._callback) { - this._results.push(this._resultSet.rows); - this._fields.push(this._resultSet.fieldPackets); - } - - this._index++; - this._resultSet = null; - this._handleFinalResultPacket(packet); -}; - -Query.prototype._handleFinalResultPacket = function(packet) { - if (packet.serverStatus & ServerStatus.SERVER_MORE_RESULTS_EXISTS) { - return; - } - - var results = (this._results.length > 1) - ? this._results - : this._results[0]; - - var fields = (this._fields.length > 1) - ? this._fields - : this._fields[0]; - - this.end(this._loadError, results, fields); -}; - -Query.prototype['RowDataPacket'] = function(packet, parser, connection) { - packet.parse(parser, this._resultSet.fieldPackets, this.typeCast, this.nestTables, connection); - - if (this._callback) { - this._resultSet.rows.push(packet); - } else { - this.emit('result', packet, this._index); - } -}; - -Query.prototype._sendLocalDataFile = function(path) { - var self = this; - var localStream = fs.createReadStream(path, { - 'flag': 'r', - 'encoding': null, - 'autoClose': true - }); - - - this.on('pause', function () { - localStream.pause(); - }); - - this.on('resume', function () { - localStream.resume(); - }); - - localStream.on('data', function (data) { - self.emit('packet', new Packets.LocalDataFilePacket(data)); - }); - - localStream.on('error', function (err) { - self._loadError = err; - localStream.emit('end'); - }); - - localStream.on('end', function () { - self.emit('packet', new Packets.EmptyPacket()); - }); -}; - -Query.prototype.stream = function(options) { - var self = this, - stream; - - options = options || {}; - options.objectMode = true; - stream = new Readable(options); - - stream._read = function() { - self._connection && self._connection.resume(); - }; - - this.on('result',function(row,i) { - if (!stream.push(row)) self._connection.pause(); - stream.emit('result',row,i); // replicate old emitter - }); - - this.on('error',function(err) { - stream.emit('error',err); // Pass on any errors - }); - - this.on('end', function() { - stream.emit('close'); // notify readers that query has completed - stream.push(null); // pushing null, indicating EOF - }); - - this.on('fields',function(fields,i) { - stream.emit('fields',fields,i); // replicate old emitter - }); - - return stream; -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Quit.js b/node_modules/mysql/lib/protocol/sequences/Quit.js deleted file mode 100644 index 68ed876..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Quit.js +++ /dev/null @@ -1,18 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); - -module.exports = Quit; -Util.inherits(Quit, Sequence); -function Quit(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - Sequence.call(this, options, callback); -} - -Quit.prototype.start = function() { - this.emit('packet', new Packets.ComQuitPacket); -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Sequence.js b/node_modules/mysql/lib/protocol/sequences/Sequence.js deleted file mode 100644 index 9c2f6bf..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Sequence.js +++ /dev/null @@ -1,117 +0,0 @@ -var Util = require('util'); -var EventEmitter = require('events').EventEmitter; -var Packets = require('../packets'); -var ErrorConstants = require('../constants/errors'); - -var listenerCount = EventEmitter.listenerCount - || function(emitter, type){ return emitter.listeners(type).length; }; - -module.exports = Sequence; -Util.inherits(Sequence, EventEmitter); -function Sequence(options, callback) { - if (typeof options === 'function') { - callback = options; - options = {}; - } - - EventEmitter.call(this); - - options = options || {}; - - this._callback = callback; - this._callSite = null; - this._ended = false; - this._timeout = options.timeout; - - // For Timers - this._idleNext = null; - this._idlePrev = null; - this._idleStart = null; - this._idleTimeout = undefined; - this._repeat = null; -} - -Sequence.determinePacket = function(byte) { - switch (byte) { - case 0x00: return Packets.OkPacket; - case 0xfe: return Packets.EofPacket; - case 0xff: return Packets.ErrorPacket; - } -}; - -Sequence.prototype.hasErrorHandler = function() { - return Boolean(this._callback) || listenerCount(this, 'error') > 1; -}; - -Sequence.prototype._packetToError = function(packet) { - var code = ErrorConstants[packet.errno] || 'UNKNOWN_CODE_PLEASE_REPORT'; - var err = new Error(code + ': ' + packet.message); - err.code = code; - err.errno = packet.errno; - err.sqlState = packet.sqlState; - - return err; -}; - -Sequence.prototype._addLongStackTrace = function(err) { - if (!this._callSite) { - return; - } - - var delimiter = '\n --------------------\n' ; - - if (err.stack.indexOf(delimiter) > -1) { - return; - } - - err.stack += delimiter + this._callSite.stack.replace(/.+\n/, ''); -}; - -Sequence.prototype.end = function(err) { - if (this._ended) { - return; - } - - this._ended = true; - - if (err) { - this._addLongStackTrace(err); - } - - // Without this we are leaking memory. This problem was introduced in - // 8189925374e7ce3819bbe88b64c7b15abac96b16. I suspect that the error object - // causes a cyclic reference that the GC does not detect properly, but I was - // unable to produce a standalone version of this leak. This would be a great - // challenge for somebody interested in difficult problems : )! - this._callSite = null; - - // try...finally for exception safety - try { - if (err) { - this.emit('error', err); - } - } finally { - try { - if (this._callback) { - this._callback.apply(this, arguments); - } - } finally { - this.emit('end'); - } - } -}; - -Sequence.prototype['OkPacket'] = function(packet) { - this.end(null, packet); -}; - -Sequence.prototype['ErrorPacket'] = function(packet) { - this.end(this._packetToError(packet)); -}; - -// Implemented by child classes -Sequence.prototype.start = function() {}; - -Sequence.prototype._onTimeout = function _onTimeout() { - this.emit('timeout'); -}; diff --git a/node_modules/mysql/lib/protocol/sequences/Statistics.js b/node_modules/mysql/lib/protocol/sequences/Statistics.js deleted file mode 100644 index 50157ce..0000000 --- a/node_modules/mysql/lib/protocol/sequences/Statistics.js +++ /dev/null @@ -1,28 +0,0 @@ -var Sequence = require('./Sequence'); -var Util = require('util'); -var Packets = require('../packets'); - -module.exports = Statistics; -Util.inherits(Statistics, Sequence); -function Statistics(options, callback) { - if (!callback && typeof options === 'function') { - callback = options; - options = {}; - } - - Sequence.call(this, options, callback); -} - -Statistics.prototype.start = function() { - this.emit('packet', new Packets.ComStatisticsPacket); -}; - -Statistics.prototype['StatisticsPacket'] = function (packet) { - this.end(null, packet); -}; - -Statistics.prototype.determinePacket = function(firstByte, parser) { - if (firstByte === 0x55) { - return Packets.StatisticsPacket; - } -}; diff --git a/node_modules/mysql/lib/protocol/sequences/index.js b/node_modules/mysql/lib/protocol/sequences/index.js deleted file mode 100644 index a13d469..0000000 --- a/node_modules/mysql/lib/protocol/sequences/index.js +++ /dev/null @@ -1,4 +0,0 @@ -var Elements = module.exports = require('require-all')({ - dirname : __dirname, - filter : /([A-Z].+)\.js$/, -}); diff --git a/node_modules/mysql/node_modules/bignumber.js/.npmignore b/node_modules/mysql/node_modules/bignumber.js/.npmignore deleted file mode 100644 index 2a7fbd1..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/.npmignore +++ /dev/null @@ -1,2 +0,0 @@ -test -perf diff --git a/node_modules/mysql/node_modules/bignumber.js/README.md b/node_modules/mysql/node_modules/bignumber.js/README.md deleted file mode 100644 index 3b72ea4..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/README.md +++ /dev/null @@ -1,242 +0,0 @@ -[![Build Status](https://travis-ci.org/MikeMcl/bignumber.js.png)](https://travis-ci.org/MikeMcl/bignumber.js) - -# bignumber.js # - -A JavaScript library for arbitrary-precision decimal and non-decimal arithmetic. - -## Features - - - Faster, smaller, and perhaps easier to use than JavaScript versions of Java's BigDecimal - - 5 KB minified and gzipped - - Simple API but full-featured - - Works with numbers with or without fraction digits in bases from 2 to 64 inclusive - - Replicates the `toExponential`, `toFixed`, `toPrecision` and `toString` methods of JavaScript's Number type - - Includes a `toFraction` and a correctly-rounded `squareRoot` method - - Stores values in an accessible decimal floating point format - - No dependencies - - Comprehensive [documentation](http://mikemcl.github.io/bignumber.js/) and test set - -If an even smaller and simpler library is required see [big.js](https://github.com/MikeMcl/big.js/). -It's half the size but only works with decimal numbers and only has half the methods. -It also does not allow `NaN` or `Infinity`, or have the configuration options of this library. -See also [decimal.js](https://github.com/MikeMcl/decimal.js/). - -## Load - -The library is the single JavaScript file *bignumber.js* (or minified, *bignumber.min.js*). - -It can be loaded via a script tag in an HTML document for the browser - - - -or as a CommonJS, [Node.js](http://nodejs.org) or AMD module using `require`. - -For Node, put the *bignumber.js* file into the same directory as the file that is requiring it and use - - var BigNumber = require('./bignumber.js'); - -or put it in a *node_modules* directory within the directory and use `require('bignumber.js')`. - -The library is also available from the [npm](https://npmjs.org/) registry, so - - $ npm install bignumber.js - -will install this directory in a *node_modules* directory within the current directory. - -To load with AMD loader libraries such as [requireJS](http://requirejs.org/): - - require(['path/to/bignumber'], function(BigNumber) { - // Use BigNumber here in local scope. No global BigNumber. - }); - -## Use - -*In all examples below, `var`, semicolons and `toString` calls are not shown. -If a commented-out value is in quotes it means `toString` has been called on the preceding expression.* - -The library exports a single function: BigNumber, the constructor of BigNumber instances. -It accepts a value of type Number *(up to 15 significant digits only)*, String or BigNumber Object, - - x = new BigNumber(123.4567) - y = BigNumber('123456.7e-3') // 'new' is optional - z = new BigNumber(x) - x.equals(y) && y.equals(z) && x.equals(z) // true - -and a base from 2 to 64 inclusive can be specified. - - x = new BigNumber(1011, 2) // "11" - y = new BigNumber('zz.9', 36) // "1295.25" - z = x.plus(y) // "1306.25" - -A BigNumber is immutable in the sense that it is not changed by its methods. - - 0.3 - 0.1 // 0.19999999999999998 - x = new BigNumber(0.3) - x.minus(0.1) // "0.2" - x // "0.3" - -The methods that return a BigNumber can be chained. - - x.dividedBy(y).plus(z).times(9).floor() - x.times('1.23456780123456789e+9').plus(9876.5432321).dividedBy('4444562598.111772').ceil() - -Method names over 5 letters in length have a shorter alias. - - x.squareRoot().dividedBy(y).toPower(3).equals(x.sqrt().div(y).pow(3)) // true - x.cmp(y.mod(z).neg()) == 1 && x.comparedTo(y.modulo(z).negated()) == 1 // true - -Like JavaScript's Number type, there are `toExponential`, `toFixed` and `toPrecision` methods - - x = new BigNumber(255.5) - x.toExponential(5) // "2.55500e+2" - x.toFixed(5) // "255.50000" - x.toPrecision(5) // "255.50" - x.toNumber() // 255.5 - - and a base can be specified for `toString`. - - x.toString(16) // "ff.8" - -The maximum number of decimal places of, and the rounding mode applied to, the results of operations involving division (i.e. division, square root, base conversion, and negative power operations) is set by a configuration object passed to the `config` method of the `BigNumber` constructor. -The other arithmetic operations always give the exact result. - - BigNumber.config({ DECIMAL_PLACES: 10, ROUNDING_MODE: 4 }) - // Alternatively, BigNumber.config( 10, 4 ); - - x = new BigNumber(2); - y = new BigNumber(3); - z = x.div(y) // "0.6666666667" - z.sqrt() // "0.8164965809" - z.pow(-3) // "3.3749999995" - z.toString(2) // "0.1010101011" - z.times(z) // "0.44444444448888888889" - z.times(z).round(10) // "0.4444444445" - -There is a `toFraction` method with an optional *maximum denominator* argument - - y = new BigNumber(355) - pi = y.dividedBy(113) // "3.1415929204" - pi.toFraction() // [ "7853982301", "2500000000" ] - pi.toFraction(1000) // [ "355", "113" ] - -and `isNaN` and `isFinite` methods, as `NaN` and `Infinity` are valid `BigNumber` values. - - x = new BigNumber(NaN) // "NaN" - y = new BigNumber(Infinity) // "Infinity" - x.isNaN() && !y.isNaN() && !x.isFinite() && !y.isFinite() // true - -The value of a BigNumber is stored in a decimal floating point format in terms of a coefficient, exponent and sign. - - x = new BigNumber(-123.456); - x.c // "1,2,3,4,5,6" coefficient (i.e. significand) - x.e // 2 exponent - x.s // -1 sign - -For futher information see the [API](http://mikemcl.github.io/bignumber.js/) reference from the *doc* folder. - -## Test - -The *test* directory contains the test scripts for each method. - -The tests can be run with Node or a browser. - -For a quick test of all the methods, from a command-line shell at the *test/* directory - - $ node quick-test - -To test a single method in more depth, e.g. - - $ node toFraction - -To test all the methods in more depth - - $ node every-test - -For the browser, see *quick-test.html*, *single-test.html* and *every-test.html* in the *test/browser* directory. - -*bignumber-vs-number.html* enables some of the methods of bignumber.js to be compared with those of JavaScript's Number type. - -## Performance - -The *perf* directory contains two applications and a *lib* directory containing the BigDecimal libraries used by both. - -*bignumber-vs-bigdecimal.html* tests the performance of bignumber.js against the JavaScript translations of two versions of BigDecimal, its use should be more or less self-explanatory. -(The GWT version doesn't work in IE 6.) - -* GWT: java.math.BigDecimal - -* ICU4J: com.ibm.icu.math.BigDecimal - - -The BigDecimal in Node's npm registry is the GWT version. Despite its seeming popularity I have found it to have some serious bugs, see the Node script *perf/lib/bigdecimal_GWT/bugs.js* for examples of flaws in its *remainder*, *divide* and *compareTo* methods. - -*bigtime.js* is a Node command-line application which tests the performance of bignumber.js against the GWT version of BigDecimal from the npm registry. - -For example, to compare the time taken by the bignumber.js `plus` method and the BigDecimal `add` method: - - $ node bigtime plus 10000 40 - -This will time 10000 calls to each, using operands of up to 40 random digits and will check that the results match. - -For help: - - $ node bigtime -h - -See the README in the directory for more information. - -## Build - -I.e. minify. - -For Node, if uglify-js is installed globally ( `npm install uglify-js -g` ) then - - npm run build - -will create *bignumber.min.js*. - -## Feedback - -Open an issue, or email - -Michael -M8ch88l@gmail.com - -Bitcoin donation to: -**1CauoGYrEoJFhcyxGVaiLTE6f3WCaSUjnm** -Thank you - -## Licence - -MIT. - -See LICENCE. - -## Change Log - -####1.4.1 -* 08/06/2014 Amend README. - -####1.4.0 -* 08/05/2014 Added `toNumber`. - -####1.3.0 -* 08/11/2013 Ensure correct rounding of `sqrt` in all, rather than almost all, cases. -* Maximum radix to 64. - -####1.2.1 -* 17/10/2013 Sign of zero when x < 0 and x + (-x) = 0. - -####1.2.0 -* 19/9/2013 Throw Error objects for stack. - -####1.1.1 -* 22/8/2013 Show original value in constructor error message. - -####1.1.0 -* 1/8/2013 Allow numbers with trailing radix point. - -####1.0.1 -* Bugfix: error messages with incorrect method name - -####1.0.0 -* 8/11/2012 Initial release diff --git a/node_modules/mysql/node_modules/bignumber.js/bignumber.js b/node_modules/mysql/node_modules/bignumber.js/bignumber.js deleted file mode 100644 index 9bddb38..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/bignumber.js +++ /dev/null @@ -1,2017 +0,0 @@ -/*! bignumber.js v1.4.1 https://github.com/MikeMcl/bignumber.js/LICENCE */ - -;(function ( global ) { - 'use strict'; - - /* - bignumber.js v1.4.1 - A JavaScript library for arbitrary-precision arithmetic. - https://github.com/MikeMcl/bignumber.js - Copyright (c) 2012 Michael Mclaughlin - MIT Expat Licence - */ - - /*********************************** DEFAULTS ************************************/ - - /* - * The default values below must be integers within the stated ranges (inclusive). - * Most of these values can be changed during run-time using BigNumber.config(). - */ - - /* - * The limit on the value of DECIMAL_PLACES, TO_EXP_NEG, TO_EXP_POS, MIN_EXP, - * MAX_EXP, and the argument to toFixed, toPrecision and toExponential, beyond - * which an exception is thrown (if ERRORS is true). - */ - var MAX = 1E9, // 0 to 1e+9 - - // Limit of magnitude of exponent argument to toPower. - MAX_POWER = 1E6, // 1 to 1e+6 - - // The maximum number of decimal places for operations involving division. - DECIMAL_PLACES = 20, // 0 to MAX - - /* - * The rounding mode used when rounding to the above decimal places, and when - * using toFixed, toPrecision and toExponential, and round (default value). - * UP 0 Away from zero. - * DOWN 1 Towards zero. - * CEIL 2 Towards +Infinity. - * FLOOR 3 Towards -Infinity. - * HALF_UP 4 Towards nearest neighbour. If equidistant, up. - * HALF_DOWN 5 Towards nearest neighbour. If equidistant, down. - * HALF_EVEN 6 Towards nearest neighbour. If equidistant, towards even neighbour. - * HALF_CEIL 7 Towards nearest neighbour. If equidistant, towards +Infinity. - * HALF_FLOOR 8 Towards nearest neighbour. If equidistant, towards -Infinity. - */ - ROUNDING_MODE = 4, // 0 to 8 - - // EXPONENTIAL_AT : [TO_EXP_NEG , TO_EXP_POS] - - // The exponent value at and beneath which toString returns exponential notation. - // Number type: -7 - TO_EXP_NEG = -7, // 0 to -MAX - - // The exponent value at and above which toString returns exponential notation. - // Number type: 21 - TO_EXP_POS = 21, // 0 to MAX - - // RANGE : [MIN_EXP, MAX_EXP] - - // The minimum exponent value, beneath which underflow to zero occurs. - // Number type: -324 (5e-324) - MIN_EXP = -MAX, // -1 to -MAX - - // The maximum exponent value, above which overflow to Infinity occurs. - // Number type: 308 (1.7976931348623157e+308) - MAX_EXP = MAX, // 1 to MAX - - // Whether BigNumber Errors are ever thrown. - // CHANGE parseInt to parseFloat if changing ERRORS to false. - ERRORS = true, // true or false - parse = parseInt, // parseInt or parseFloat - - /***********************************************************************************/ - - P = BigNumber.prototype, - DIGITS = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_', - outOfRange, - id = 0, - isValid = /^-?(\d+(\.\d*)?|\.\d+)(e[+-]?\d+)?$/i, - trim = String.prototype.trim || function () {return this.replace(/^\s+|\s+$/g, '')}, - ONE = BigNumber(1); - - - // CONSTRUCTOR - - - /* - * The exported function. - * Create and return a new instance of a BigNumber object. - * - * n {number|string|BigNumber} A numeric value. - * [b] {number} The base of n. Integer, 2 to 64 inclusive. - */ - function BigNumber( n, b ) { - var e, i, isNum, digits, valid, orig, - x = this; - - // Enable constructor usage without new. - if ( !(x instanceof BigNumber) ) { - return new BigNumber( n, b ) - } - - // Duplicate. - if ( n instanceof BigNumber ) { - id = 0; - - // e is undefined. - if ( b !== e ) { - n += '' - } else { - x['s'] = n['s']; - x['e'] = n['e']; - x['c'] = ( n = n['c'] ) ? n.slice() : n; - return; - } - } - - // If number, check if minus zero. - if ( typeof n != 'string' ) { - n = ( isNum = typeof n == 'number' || - Object.prototype.toString.call(n) == '[object Number]' ) && - n === 0 && 1 / n < 0 ? '-0' : n + ''; - } - - orig = n; - - if ( b === e && isValid.test(n) ) { - - // Determine sign. - x['s'] = n.charAt(0) == '-' ? ( n = n.slice(1), -1 ) : 1; - - // Either n is not a valid BigNumber or a base has been specified. - } else { - - // Enable exponential notation to be used with base 10 argument. - // Ensure return value is rounded to DECIMAL_PLACES as with other bases. - if ( b == 10 ) { - - return setMode( n, DECIMAL_PLACES, ROUNDING_MODE ); - } - - n = trim.call(n).replace( /^\+(?!-)/, '' ); - - x['s'] = n.charAt(0) == '-' ? ( n = n.replace( /^-(?!-)/, '' ), -1 ) : 1; - - if ( b != null ) { - - if ( ( b == (b | 0) || !ERRORS ) && - !( outOfRange = !( b >= 2 && b < 65 ) ) ) { - - digits = '[' + DIGITS.slice( 0, b = b | 0 ) + ']+'; - - // Before non-decimal number validity test and base conversion - // remove the `.` from e.g. '1.', and replace e.g. '.1' with '0.1'. - n = n.replace( /\.$/, '' ).replace( /^\./, '0.' ); - - // Any number in exponential form will fail due to the e+/-. - if ( valid = new RegExp( - '^' + digits + '(?:\\.' + digits + ')?$', b < 37 ? 'i' : '' ).test(n) ) { - - if ( isNum ) { - - if ( n.replace( /^0\.0*|\./, '' ).length > 15 ) { - - // 'new BigNumber() number type has more than 15 significant digits: {n}' - ifExceptionsThrow( orig, 0 ); - } - - // Prevent later check for length on converted number. - isNum = !isNum; - } - n = convert( n, 10, b, x['s'] ); - - } else if ( n != 'Infinity' && n != 'NaN' ) { - - // 'new BigNumber() not a base {b} number: {n}' - ifExceptionsThrow( orig, 1, b ); - n = 'NaN'; - } - } else { - - // 'new BigNumber() base not an integer: {b}' - // 'new BigNumber() base out of range: {b}' - ifExceptionsThrow( b, 2 ); - - // Ignore base. - valid = isValid.test(n); - } - } else { - valid = isValid.test(n); - } - - if ( !valid ) { - - // Infinity/NaN - x['c'] = x['e'] = null; - - // NaN - if ( n != 'Infinity' ) { - - // No exception on NaN. - if ( n != 'NaN' ) { - - // 'new BigNumber() not a number: {n}' - ifExceptionsThrow( orig, 3 ); - } - x['s'] = null; - } - id = 0; - - return; - } - } - - // Decimal point? - if ( ( e = n.indexOf('.') ) > -1 ) { - n = n.replace( '.', '' ); - } - - // Exponential form? - if ( ( i = n.search( /e/i ) ) > 0 ) { - - // Determine exponent. - if ( e < 0 ) { - e = i; - } - e += +n.slice( i + 1 ); - n = n.substring( 0, i ); - - } else if ( e < 0 ) { - - // Integer. - e = n.length; - } - - // Determine leading zeros. - for ( i = 0; n.charAt(i) == '0'; i++ ) { - } - - b = n.length; - - // Disallow numbers with over 15 significant digits if number type. - if ( isNum && b > 15 && n.slice(i).length > 15 ) { - - // 'new BigNumber() number type has more than 15 significant digits: {n}' - ifExceptionsThrow( orig, 0 ); - } - id = 0; - - // Overflow? - if ( ( e -= i + 1 ) > MAX_EXP ) { - - // Infinity. - x['c'] = x['e'] = null; - - // Zero or underflow? - } else if ( i == b || e < MIN_EXP ) { - - // Zero. - x['c'] = [ x['e'] = 0 ]; - } else { - - // Determine trailing zeros. - for ( ; n.charAt(--b) == '0'; ) { - } - - x['e'] = e; - x['c'] = []; - - // Convert string to array of digits (without leading and trailing zeros). - for ( e = 0; i <= b; x['c'][e++] = +n.charAt(i++) ) { - } - } - } - - - // CONSTRUCTOR PROPERTIES/METHODS - - - BigNumber['ROUND_UP'] = 0; - BigNumber['ROUND_DOWN'] = 1; - BigNumber['ROUND_CEIL'] = 2; - BigNumber['ROUND_FLOOR'] = 3; - BigNumber['ROUND_HALF_UP'] = 4; - BigNumber['ROUND_HALF_DOWN'] = 5; - BigNumber['ROUND_HALF_EVEN'] = 6; - BigNumber['ROUND_HALF_CEIL'] = 7; - BigNumber['ROUND_HALF_FLOOR'] = 8; - - - /* - * Configure infrequently-changing library-wide settings. - * - * Accept an object or an argument list, with one or many of the following - * properties or parameters respectively: - * [ DECIMAL_PLACES [, ROUNDING_MODE [, EXPONENTIAL_AT [, RANGE [, ERRORS ]]]]] - * - * E.g. - * BigNumber.config(20, 4) is equivalent to - * BigNumber.config({ DECIMAL_PLACES : 20, ROUNDING_MODE : 4 }) - * Ignore properties/parameters set to null or undefined. - * - * Return an object with the properties current values. - */ - BigNumber['config'] = function () { - var v, p, - i = 0, - r = {}, - a = arguments, - o = a[0], - c = 'config', - inRange = function ( n, lo, hi ) { - return !( ( outOfRange = n < lo || n > hi ) || - parse(n) != n && n !== 0 ); - }, - has = o && typeof o == 'object' - ? function () {if ( o.hasOwnProperty(p) ) return ( v = o[p] ) != null} - : function () {if ( a.length > i ) return ( v = a[i++] ) != null}; - - // [DECIMAL_PLACES] {number} Integer, 0 to MAX inclusive. - if ( has( p = 'DECIMAL_PLACES' ) ) { - - if ( inRange( v, 0, MAX ) ) { - DECIMAL_PLACES = v | 0; - } else { - - // 'config() DECIMAL_PLACES not an integer: {v}' - // 'config() DECIMAL_PLACES out of range: {v}' - ifExceptionsThrow( v, p, c ); - } - } - r[p] = DECIMAL_PLACES; - - // [ROUNDING_MODE] {number} Integer, 0 to 8 inclusive. - if ( has( p = 'ROUNDING_MODE' ) ) { - - if ( inRange( v, 0, 8 ) ) { - ROUNDING_MODE = v | 0; - } else { - - // 'config() ROUNDING_MODE not an integer: {v}' - // 'config() ROUNDING_MODE out of range: {v}' - ifExceptionsThrow( v, p, c ); - } - } - r[p] = ROUNDING_MODE; - - /* - * [EXPONENTIAL_AT] {number|number[]} Integer, -MAX to MAX inclusive or - * [ integer -MAX to 0 inclusive, 0 to MAX inclusive ]. - */ - if ( has( p = 'EXPONENTIAL_AT' ) ) { - - if ( inRange( v, -MAX, MAX ) ) { - TO_EXP_NEG = -( TO_EXP_POS = ~~( v < 0 ? -v : +v ) ); - } else if ( !outOfRange && v && inRange( v[0], -MAX, 0 ) && - inRange( v[1], 0, MAX ) ) { - TO_EXP_NEG = ~~v[0]; - TO_EXP_POS = ~~v[1]; - } else { - - // 'config() EXPONENTIAL_AT not an integer or not [integer, integer]: {v}' - // 'config() EXPONENTIAL_AT out of range or not [negative, positive: {v}' - ifExceptionsThrow( v, p, c, 1 ); - } - } - r[p] = [ TO_EXP_NEG, TO_EXP_POS ]; - - /* - * [RANGE][ {number|number[]} Non-zero integer, -MAX to MAX inclusive or - * [ integer -MAX to -1 inclusive, integer 1 to MAX inclusive ]. - */ - if ( has( p = 'RANGE' ) ) { - - if ( inRange( v, -MAX, MAX ) && ~~v ) { - MIN_EXP = -( MAX_EXP = ~~( v < 0 ? -v : +v ) ); - } else if ( !outOfRange && v && inRange( v[0], -MAX, -1 ) && - inRange( v[1], 1, MAX ) ) { - MIN_EXP = ~~v[0], MAX_EXP = ~~v[1]; - } else { - - // 'config() RANGE not a non-zero integer or not [integer, integer]: {v}' - // 'config() RANGE out of range or not [negative, positive: {v}' - ifExceptionsThrow( v, p, c, 1, 1 ); - } - } - r[p] = [ MIN_EXP, MAX_EXP ]; - - // [ERRORS] {boolean|number} true, false, 1 or 0. - if ( has( p = 'ERRORS' ) ) { - - if ( v === !!v || v === 1 || v === 0 ) { - parse = ( outOfRange = id = 0, ERRORS = !!v ) - ? parseInt - : parseFloat; - } else { - - // 'config() ERRORS not a boolean or binary digit: {v}' - ifExceptionsThrow( v, p, c, 0, 0, 1 ); - } - } - r[p] = ERRORS; - - return r; - }; - - - // PRIVATE FUNCTIONS - - - // Assemble error messages. Throw BigNumber Errors. - function ifExceptionsThrow( arg, i, j, isArray, isRange, isErrors) { - - if ( ERRORS ) { - var error, - method = ['new BigNumber', 'cmp', 'div', 'eq', 'gt', 'gte', 'lt', - 'lte', 'minus', 'mod', 'plus', 'times', 'toFr' - ][ id ? id < 0 ? -id : id : 1 / id < 0 ? 1 : 0 ] + '()', - message = outOfRange ? ' out of range' : ' not a' + - ( isRange ? ' non-zero' : 'n' ) + ' integer'; - - message = ( [ - method + ' number type has more than 15 significant digits', - method + ' not a base ' + j + ' number', - method + ' base' + message, - method + ' not a number' ][i] || - j + '() ' + i + ( isErrors - ? ' not a boolean or binary digit' - : message + ( isArray - ? ' or not [' + ( outOfRange - ? ' negative, positive' - : ' integer, integer' ) + ' ]' - : '' ) ) ) + ': ' + arg; - - outOfRange = id = 0; - error = new Error(message); - error['name'] = 'BigNumber Error'; - - throw error; - } - } - - - /* - * Convert a numeric string of baseIn to a numeric string of baseOut. - */ - function convert( nStr, baseOut, baseIn, sign ) { - var e, dvs, dvd, nArr, fracArr, fracBN; - - // Convert string of base bIn to an array of numbers of baseOut. - // Eg. strToArr('255', 10) where baseOut is 16, returns [15, 15]. - // Eg. strToArr('ff', 16) where baseOut is 10, returns [2, 5, 5]. - function strToArr( str, bIn ) { - var j, - i = 0, - strL = str.length, - arrL, - arr = [0]; - - for ( bIn = bIn || baseIn; i < strL; i++ ) { - - for ( arrL = arr.length, j = 0; j < arrL; arr[j] *= bIn, j++ ) { - } - - for ( arr[0] += DIGITS.indexOf( str.charAt(i) ), j = 0; - j < arr.length; - j++ ) { - - if ( arr[j] > baseOut - 1 ) { - - if ( arr[j + 1] == null ) { - arr[j + 1] = 0; - } - arr[j + 1] += arr[j] / baseOut ^ 0; - arr[j] %= baseOut; - } - } - } - - return arr.reverse(); - } - - // Convert array to string. - // E.g. arrToStr( [9, 10, 11] ) becomes '9ab' (in bases above 11). - function arrToStr( arr ) { - var i = 0, - arrL = arr.length, - str = ''; - - for ( ; i < arrL; str += DIGITS.charAt( arr[i++] ) ) { - } - - return str; - } - - if ( baseIn < 37 ) { - nStr = nStr.toLowerCase(); - } - - /* - * If non-integer convert integer part and fraction part separately. - * Convert the fraction part as if it is an integer than use division to - * reduce it down again to a value less than one. - */ - if ( ( e = nStr.indexOf( '.' ) ) > -1 ) { - - /* - * Calculate the power to which to raise the base to get the number - * to divide the fraction part by after it has been converted as an - * integer to the required base. - */ - e = nStr.length - e - 1; - - // Use toFixed to avoid possible exponential notation. - dvs = strToArr( new BigNumber(baseIn)['pow'](e)['toF'](), 10 ); - - nArr = nStr.split('.'); - - // Convert the base of the fraction part (as integer). - dvd = strToArr( nArr[1] ); - - // Convert the base of the integer part. - nArr = strToArr( nArr[0] ); - - // Result will be a BigNumber with a value less than 1. - fracBN = divide( dvd, dvs, dvd.length - dvs.length, sign, baseOut, - // Is least significant digit of integer part an odd number? - nArr[nArr.length - 1] & 1 ); - - fracArr = fracBN['c']; - - // e can be <= 0 ( if e == 0, fracArr is [0] or [1] ). - if ( e = fracBN['e'] ) { - - // Append zeros according to the exponent of the result. - for ( ; ++e; fracArr.unshift(0) ) { - } - - // Append the fraction part to the converted integer part. - nStr = arrToStr(nArr) + '.' + arrToStr(fracArr); - - // fracArr is [1]. - // Fraction digits rounded up, so increment last digit of integer part. - } else if ( fracArr[0] ) { - - if ( nArr[ e = nArr.length - 1 ] < baseOut - 1 ) { - ++nArr[e]; - nStr = arrToStr(nArr); - } else { - nStr = new BigNumber( arrToStr(nArr), - baseOut )['plus'](ONE)['toS'](baseOut); - } - - // fracArr is [0]. No fraction digits. - } else { - nStr = arrToStr(nArr); - } - } else { - - // Simple integer. Convert base. - nStr = arrToStr( strToArr(nStr) ); - } - - return nStr; - } - - - // Perform division in the specified base. Called by div and convert. - function divide( dvd, dvs, exp, s, base, isOdd ) { - var dvsL, dvsT, next, cmp, remI, - dvsZ = dvs.slice(), - dvdI = dvsL = dvs.length, - dvdL = dvd.length, - rem = dvd.slice( 0, dvsL ), - remL = rem.length, - quo = new BigNumber(ONE), - qc = quo['c'] = [], - qi = 0, - dig = DECIMAL_PLACES + ( quo['e'] = exp ) + 1; - - quo['s'] = s; - s = dig < 0 ? 0 : dig; - - // Add zeros to make remainder as long as divisor. - for ( ; remL++ < dvsL; rem.push(0) ) { - } - - // Create version of divisor with leading zero. - dvsZ.unshift(0); - - do { - - // 'next' is how many times the divisor goes into the current remainder. - for ( next = 0; next < base; next++ ) { - - // Compare divisor and remainder. - if ( dvsL != ( remL = rem.length ) ) { - cmp = dvsL > remL ? 1 : -1; - } else { - for ( remI = -1, cmp = 0; ++remI < dvsL; ) { - - if ( dvs[remI] != rem[remI] ) { - cmp = dvs[remI] > rem[remI] ? 1 : -1; - break; - } - } - } - - // Subtract divisor from remainder (if divisor < remainder). - if ( cmp < 0 ) { - - // Remainder cannot be more than one digit longer than divisor. - // Equalise lengths using divisor with extra leading zero? - for ( dvsT = remL == dvsL ? dvs : dvsZ; remL; ) { - - if ( rem[--remL] < dvsT[remL] ) { - - for ( remI = remL; - remI && !rem[--remI]; - rem[remI] = base - 1 ) { - } - --rem[remI]; - rem[remL] += base; - } - rem[remL] -= dvsT[remL]; - } - for ( ; !rem[0]; rem.shift() ) { - } - } else { - break; - } - } - - // Add the 'next' digit to the result array. - qc[qi++] = cmp ? next : ++next; - - // Update the remainder. - rem[0] && cmp - ? ( rem[remL] = dvd[dvdI] || 0 ) - : ( rem = [ dvd[dvdI] ] ); - - } while ( ( dvdI++ < dvdL || rem[0] != null ) && s-- ); - - // Leading zero? Do not remove if result is simply zero (qi == 1). - if ( !qc[0] && qi != 1 ) { - - // There can't be more than one zero. - --quo['e']; - qc.shift(); - } - - // Round? - if ( qi > dig ) { - rnd( quo, DECIMAL_PLACES, base, isOdd, rem[0] != null ); - } - - // Overflow? - if ( quo['e'] > MAX_EXP ) { - - // Infinity. - quo['c'] = quo['e'] = null; - - // Underflow? - } else if ( quo['e'] < MIN_EXP ) { - - // Zero. - quo['c'] = [quo['e'] = 0]; - } - - return quo; - } - - - /* - * Return a string representing the value of BigNumber n in normal or - * exponential notation rounded to the specified decimal places or - * significant digits. - * Called by toString, toExponential (exp 1), toFixed, and toPrecision (exp 2). - * d is the index (with the value in normal notation) of the digit that may be - * rounded up. - */ - function format( n, d, exp ) { - - // Initially, i is the number of decimal places required. - var i = d - (n = new BigNumber(n))['e'], - c = n['c']; - - // +-Infinity or NaN? - if ( !c ) { - return n['toS'](); - } - - // Round? - if ( c.length > ++d ) { - rnd( n, i, 10 ); - } - - // Recalculate d if toFixed as n['e'] may have changed if value rounded up. - i = c[0] == 0 ? i + 1 : exp ? d : n['e'] + i + 1; - - // Append zeros? - for ( ; c.length < i; c.push(0) ) { - } - i = n['e']; - - /* - * toPrecision returns exponential notation if the number of significant - * digits specified is less than the number of digits necessary to - * represent the integer part of the value in normal notation. - */ - return exp == 1 || exp == 2 && ( --d < i || i <= TO_EXP_NEG ) - - // Exponential notation. - ? ( n['s'] < 0 && c[0] ? '-' : '' ) + ( c.length > 1 - ? ( c.splice( 1, 0, '.' ), c.join('') ) - : c[0] ) + ( i < 0 ? 'e' : 'e+' ) + i - - // Normal notation. - : n['toS'](); - } - - - // Round if necessary. - // Called by divide, format, setMode and sqrt. - function rnd( x, dp, base, isOdd, r ) { - var xc = x['c'], - isNeg = x['s'] < 0, - half = base / 2, - i = x['e'] + dp + 1, - - // 'next' is the digit after the digit that may be rounded up. - next = xc[i], - - /* - * 'more' is whether there are digits after 'next'. - * E.g. - * 0.005 (e = -3) to be rounded to 0 decimal places (dp = 0) gives i = -2 - * The 'next' digit is zero, and there ARE 'more' digits after it. - * 0.5 (e = -1) dp = 0 gives i = 0 - * The 'next' digit is 5 and there are no 'more' digits after it. - */ - more = r || i < 0 || xc[i + 1] != null; - - r = ROUNDING_MODE < 4 - ? ( next != null || more ) && - ( ROUNDING_MODE == 0 || - ROUNDING_MODE == 2 && !isNeg || - ROUNDING_MODE == 3 && isNeg ) - : next > half || next == half && - ( ROUNDING_MODE == 4 || more || - - /* - * isOdd is used in base conversion and refers to the least significant - * digit of the integer part of the value to be converted. The fraction - * part is rounded by this method separately from the integer part. - */ - ROUNDING_MODE == 6 && ( xc[i - 1] & 1 || !dp && isOdd ) || - ROUNDING_MODE == 7 && !isNeg || - ROUNDING_MODE == 8 && isNeg ); - - if ( i < 1 || !xc[0] ) { - xc.length = 0; - xc.push(0); - - if ( r ) { - - // 1, 0.1, 0.01, 0.001, 0.0001 etc. - xc[0] = 1; - x['e'] = -dp; - } else { - - // Zero. - x['e'] = 0; - } - - return x; - } - - // Remove any digits after the required decimal places. - xc.length = i--; - - // Round up? - if ( r ) { - - // Rounding up may mean the previous digit has to be rounded up and so on. - for ( --base; ++xc[i] > base; ) { - xc[i] = 0; - - if ( !i-- ) { - ++x['e']; - xc.unshift(1); - } - } - } - - // Remove trailing zeros. - for ( i = xc.length; !xc[--i]; xc.pop() ) { - } - - return x; - } - - - // Round after setting the appropriate rounding mode. - // Handles ceil, floor and round. - function setMode( x, dp, rm ) { - var r = ROUNDING_MODE; - - ROUNDING_MODE = rm; - x = new BigNumber(x); - x['c'] && rnd( x, dp, 10 ); - ROUNDING_MODE = r; - - return x; - } - - - // PROTOTYPE/INSTANCE METHODS - - - /* - * Return a new BigNumber whose value is the absolute value of this BigNumber. - */ - P['abs'] = P['absoluteValue'] = function () { - var x = new BigNumber(this); - - if ( x['s'] < 0 ) { - x['s'] = 1; - } - - return x; - }; - - - /* - * Return a new BigNumber whose value is the value of this BigNumber - * rounded to a whole number in the direction of Infinity. - */ - P['ceil'] = function () { - return setMode( this, 0, 2 ); - }; - - - /* - * Return - * 1 if the value of this BigNumber is greater than the value of BigNumber(y, b), - * -1 if the value of this BigNumber is less than the value of BigNumber(y, b), - * 0 if they have the same value, - * or null if the value of either is NaN. - */ - P['comparedTo'] = P['cmp'] = function ( y, b ) { - var a, - x = this, - xc = x['c'], - yc = ( id = -id, y = new BigNumber( y, b ) )['c'], - i = x['s'], - j = y['s'], - k = x['e'], - l = y['e']; - - // Either NaN? - if ( !i || !j ) { - return null; - } - - a = xc && !xc[0], b = yc && !yc[0]; - - // Either zero? - if ( a || b ) { - return a ? b ? 0 : -j : i; - } - - // Signs differ? - if ( i != j ) { - return i; - } - - // Either Infinity? - if ( a = i < 0, b = k == l, !xc || !yc ) { - return b ? 0 : !xc ^ a ? 1 : -1; - } - - // Compare exponents. - if ( !b ) { - return k > l ^ a ? 1 : -1; - } - - // Compare digit by digit. - for ( i = -1, - j = ( k = xc.length ) < ( l = yc.length ) ? k : l; - ++i < j; ) { - - if ( xc[i] != yc[i] ) { - return xc[i] > yc[i] ^ a ? 1 : -1; - } - } - // Compare lengths. - return k == l ? 0 : k > l ^ a ? 1 : -1; - }; - - - /* - * n / 0 = I - * n / N = N - * n / I = 0 - * 0 / n = 0 - * 0 / 0 = N - * 0 / N = N - * 0 / I = 0 - * N / n = N - * N / 0 = N - * N / N = N - * N / I = N - * I / n = I - * I / 0 = I - * I / N = N - * I / I = N - * - * Return a new BigNumber whose value is the value of this BigNumber - * divided by the value of BigNumber(y, b), rounded according to - * DECIMAL_PLACES and ROUNDING_MODE. - */ - P['dividedBy'] = P['div'] = function ( y, b ) { - var xc = this['c'], - xe = this['e'], - xs = this['s'], - yc = ( id = 2, y = new BigNumber( y, b ) )['c'], - ye = y['e'], - ys = y['s'], - s = xs == ys ? 1 : -1; - - // Either NaN/Infinity/0? - return !xe && ( !xc || !xc[0] ) || !ye && ( !yc || !yc[0] ) - - // Either NaN? - ? new BigNumber( !xs || !ys || - - // Both 0 or both Infinity? - ( xc ? yc && xc[0] == yc[0] : !yc ) - - // Return NaN. - ? NaN - - // x is 0 or y is Infinity? - : xc && xc[0] == 0 || !yc - - // Return +-0. - ? s * 0 - - // y is 0. Return +-Infinity. - : s / 0 ) - - : divide( xc, yc, xe - ye, s, 10 ); - }; - - - /* - * Return true if the value of this BigNumber is equal to the value of - * BigNumber(n, b), otherwise returns false. - */ - P['equals'] = P['eq'] = function ( n, b ) { - id = 3; - return this['cmp']( n, b ) === 0; - }; - - - /* - * Return a new BigNumber whose value is the value of this BigNumber - * rounded to a whole number in the direction of -Infinity. - */ - P['floor'] = function () { - return setMode( this, 0, 3 ); - }; - - - /* - * Return true if the value of this BigNumber is greater than the value of - * BigNumber(n, b), otherwise returns false. - */ - P['greaterThan'] = P['gt'] = function ( n, b ) { - id = 4; - return this['cmp']( n, b ) > 0; - }; - - - /* - * Return true if the value of this BigNumber is greater than or equal to - * the value of BigNumber(n, b), otherwise returns false. - */ - P['greaterThanOrEqualTo'] = P['gte'] = function ( n, b ) { - id = 5; - return ( b = this['cmp']( n, b ) ) == 1 || b === 0; - }; - - - /* - * Return true if the value of this BigNumber is a finite number, otherwise - * returns false. - */ - P['isFinite'] = P['isF'] = function () { - return !!this['c']; - }; - - - /* - * Return true if the value of this BigNumber is NaN, otherwise returns - * false. - */ - P['isNaN'] = function () { - return !this['s']; - }; - - - /* - * Return true if the value of this BigNumber is negative, otherwise - * returns false. - */ - P['isNegative'] = P['isNeg'] = function () { - return this['s'] < 0; - }; - - - /* - * Return true if the value of this BigNumber is 0 or -0, otherwise returns - * false. - */ - P['isZero'] = P['isZ'] = function () { - return !!this['c'] && this['c'][0] == 0; - }; - - - /* - * Return true if the value of this BigNumber is less than the value of - * BigNumber(n, b), otherwise returns false. - */ - P['lessThan'] = P['lt'] = function ( n, b ) { - id = 6; - return this['cmp']( n, b ) < 0; - }; - - - /* - * Return true if the value of this BigNumber is less than or equal to the - * value of BigNumber(n, b), otherwise returns false. - */ - P['lessThanOrEqualTo'] = P['lte'] = function ( n, b ) { - id = 7; - return ( b = this['cmp']( n, b ) ) == -1 || b === 0; - }; - - - /* - * n - 0 = n - * n - N = N - * n - I = -I - * 0 - n = -n - * 0 - 0 = 0 - * 0 - N = N - * 0 - I = -I - * N - n = N - * N - 0 = N - * N - N = N - * N - I = N - * I - n = I - * I - 0 = I - * I - N = N - * I - I = N - * - * Return a new BigNumber whose value is the value of this BigNumber minus - * the value of BigNumber(y, b). - */ - P['minus'] = function ( y, b ) { - var d, i, j, xLTy, - x = this, - a = x['s']; - - b = ( id = 8, y = new BigNumber( y, b ) )['s']; - - // Either NaN? - if ( !a || !b ) { - return new BigNumber(NaN); - } - - // Signs differ? - if ( a != b ) { - return y['s'] = -b, x['plus'](y); - } - - var xc = x['c'], - xe = x['e'], - yc = y['c'], - ye = y['e']; - - if ( !xe || !ye ) { - - // Either Infinity? - if ( !xc || !yc ) { - return xc ? ( y['s'] = -b, y ) : new BigNumber( yc ? x : NaN ); - } - - // Either zero? - if ( !xc[0] || !yc[0] ) { - - // y is non-zero? - return yc[0] - ? ( y['s'] = -b, y ) - - // x is non-zero? - : new BigNumber( xc[0] - ? x - - // Both are zero. - // IEEE 754 (2008) 6.3: n - n = -0 when rounding to -Infinity - : ROUNDING_MODE == 3 ? -0 : 0 ); - } - } - - // Determine which is the bigger number. - // Prepend zeros to equalise exponents. - if ( xc = xc.slice(), a = xe - ye ) { - d = ( xLTy = a < 0 ) ? ( a = -a, xc ) : ( ye = xe, yc ); - - for ( d.reverse(), b = a; b--; d.push(0) ) { - } - d.reverse(); - } else { - - // Exponents equal. Check digit by digit. - j = ( ( xLTy = xc.length < yc.length ) ? xc : yc ).length; - - for ( a = b = 0; b < j; b++ ) { - - if ( xc[b] != yc[b] ) { - xLTy = xc[b] < yc[b]; - break; - } - } - } - - // x < y? Point xc to the array of the bigger number. - if ( xLTy ) { - d = xc, xc = yc, yc = d; - y['s'] = -y['s']; - } - - /* - * Append zeros to xc if shorter. No need to add zeros to yc if shorter - * as subtraction only needs to start at yc.length. - */ - if ( ( b = -( ( j = xc.length ) - yc.length ) ) > 0 ) { - - for ( ; b--; xc[j++] = 0 ) { - } - } - - // Subtract yc from xc. - for ( b = yc.length; b > a; ){ - - if ( xc[--b] < yc[b] ) { - - for ( i = b; i && !xc[--i]; xc[i] = 9 ) { - } - --xc[i]; - xc[b] += 10; - } - xc[b] -= yc[b]; - } - - // Remove trailing zeros. - for ( ; xc[--j] == 0; xc.pop() ) { - } - - // Remove leading zeros and adjust exponent accordingly. - for ( ; xc[0] == 0; xc.shift(), --ye ) { - } - - /* - * No need to check for Infinity as +x - +y != Infinity && -x - -y != Infinity - * when neither x or y are Infinity. - */ - - // Underflow? - if ( ye < MIN_EXP || !xc[0] ) { - - /* - * Following IEEE 754 (2008) 6.3, - * n - n = +0 but n - n = -0 when rounding towards -Infinity. - */ - if ( !xc[0] ) { - y['s'] = ROUNDING_MODE == 3 ? -1 : 1; - } - - // Result is zero. - xc = [ye = 0]; - } - - return y['c'] = xc, y['e'] = ye, y; - }; - - - /* - * n % 0 = N - * n % N = N - * 0 % n = 0 - * -0 % n = -0 - * 0 % 0 = N - * 0 % N = N - * N % n = N - * N % 0 = N - * N % N = N - * - * Return a new BigNumber whose value is the value of this BigNumber modulo - * the value of BigNumber(y, b). - */ - P['modulo'] = P['mod'] = function ( y, b ) { - var x = this, - xc = x['c'], - yc = ( id = 9, y = new BigNumber( y, b ) )['c'], - i = x['s'], - j = y['s']; - - // Is x or y NaN, or y zero? - b = !i || !j || yc && !yc[0]; - - if ( b || xc && !xc[0] ) { - return new BigNumber( b ? NaN : x ); - } - - x['s'] = y['s'] = 1; - b = y['cmp'](x) == 1; - x['s'] = i, y['s'] = j; - - return b - ? new BigNumber(x) - : ( i = DECIMAL_PLACES, j = ROUNDING_MODE, - DECIMAL_PLACES = 0, ROUNDING_MODE = 1, - x = x['div'](y), - DECIMAL_PLACES = i, ROUNDING_MODE = j, - this['minus']( x['times'](y) ) ); - }; - - - /* - * Return a new BigNumber whose value is the value of this BigNumber - * negated, i.e. multiplied by -1. - */ - P['negated'] = P['neg'] = function () { - var x = new BigNumber(this); - - return x['s'] = -x['s'] || null, x; - }; - - - /* - * n + 0 = n - * n + N = N - * n + I = I - * 0 + n = n - * 0 + 0 = 0 - * 0 + N = N - * 0 + I = I - * N + n = N - * N + 0 = N - * N + N = N - * N + I = N - * I + n = I - * I + 0 = I - * I + N = N - * I + I = I - * - * Return a new BigNumber whose value is the value of this BigNumber plus - * the value of BigNumber(y, b). - */ - P['plus'] = function ( y, b ) { - var d, - x = this, - a = x['s']; - - b = ( id = 10, y = new BigNumber( y, b ) )['s']; - - // Either NaN? - if ( !a || !b ) { - return new BigNumber(NaN); - } - - // Signs differ? - if ( a != b ) { - return y['s'] = -b, x['minus'](y); - } - - var xe = x['e'], - xc = x['c'], - ye = y['e'], - yc = y['c']; - - if ( !xe || !ye ) { - - // Either Infinity? - if ( !xc || !yc ) { - - // Return +-Infinity. - return new BigNumber( a / 0 ); - } - - // Either zero? - if ( !xc[0] || !yc[0] ) { - - // y is non-zero? - return yc[0] - ? y - - // x is non-zero? - : new BigNumber( xc[0] - ? x - - // Both are zero. Return zero. - : a * 0 ); - } - } - - // Prepend zeros to equalise exponents. - // Note: Faster to use reverse then do unshifts. - if ( xc = xc.slice(), a = xe - ye ) { - d = a > 0 ? ( ye = xe, yc ) : ( a = -a, xc ); - - for ( d.reverse(); a--; d.push(0) ) { - } - d.reverse(); - } - - // Point xc to the longer array. - if ( xc.length - yc.length < 0 ) { - d = yc, yc = xc, xc = d; - } - - /* - * Only start adding at yc.length - 1 as the - * further digits of xc can be left as they are. - */ - for ( a = yc.length, b = 0; a; - b = ( xc[--a] = xc[a] + yc[a] + b ) / 10 ^ 0, xc[a] %= 10 ) { - } - - // No need to check for zero, as +x + +y != 0 && -x + -y != 0 - - if ( b ) { - xc.unshift(b); - - // Overflow? (MAX_EXP + 1 possible) - if ( ++ye > MAX_EXP ) { - - // Infinity. - xc = ye = null; - } - } - - // Remove trailing zeros. - for ( a = xc.length; xc[--a] == 0; xc.pop() ) { - } - - return y['c'] = xc, y['e'] = ye, y; - }; - - - /* - * Return a BigNumber whose value is the value of this BigNumber raised to - * the power e. If e is negative round according to DECIMAL_PLACES and - * ROUNDING_MODE. - * - * e {number} Integer, -MAX_POWER to MAX_POWER inclusive. - */ - P['toPower'] = P['pow'] = function ( e ) { - - // e to integer, avoiding NaN or Infinity becoming 0. - var i = e * 0 == 0 ? e | 0 : e, - x = new BigNumber(this), - y = new BigNumber(ONE); - - // Use Math.pow? - // Pass +-Infinity for out of range exponents. - if ( ( ( ( outOfRange = e < -MAX_POWER || e > MAX_POWER ) && - (i = e * 1 / 0) ) || - - /* - * Any exponent that fails the parse becomes NaN. - * - * Include 'e !== 0' because on Opera -0 == parseFloat(-0) is false, - * despite -0 === parseFloat(-0) && -0 == parseFloat('-0') is true. - */ - parse(e) != e && e !== 0 && !(i = NaN) ) && - - // 'pow() exponent not an integer: {e}' - // 'pow() exponent out of range: {e}' - !ifExceptionsThrow( e, 'exponent', 'pow' ) || - - // Pass zero to Math.pow, as any value to the power zero is 1. - !i ) { - - // i is +-Infinity, NaN or 0. - return new BigNumber( Math.pow( x['toS'](), i ) ); - } - - for ( i = i < 0 ? -i : i; ; ) { - - if ( i & 1 ) { - y = y['times'](x); - } - i >>= 1; - - if ( !i ) { - break; - } - x = x['times'](x); - } - - return e < 0 ? ONE['div'](y) : y; - }; - - - /* - * Return a new BigNumber whose value is the value of this BigNumber - * rounded to a maximum of dp decimal places using rounding mode rm, or to - * 0 and ROUNDING_MODE respectively if omitted. - * - * [dp] {number} Integer, 0 to MAX inclusive. - * [rm] {number} Integer, 0 to 8 inclusive. - */ - P['round'] = function ( dp, rm ) { - - dp = dp == null || ( ( ( outOfRange = dp < 0 || dp > MAX ) || - parse(dp) != dp ) && - - // 'round() decimal places out of range: {dp}' - // 'round() decimal places not an integer: {dp}' - !ifExceptionsThrow( dp, 'decimal places', 'round' ) ) - ? 0 - : dp | 0; - - rm = rm == null || ( ( ( outOfRange = rm < 0 || rm > 8 ) || - - // Include '&& rm !== 0' because with Opera -0 == parseFloat(-0) is false. - parse(rm) != rm && rm !== 0 ) && - - // 'round() mode not an integer: {rm}' - // 'round() mode out of range: {rm}' - !ifExceptionsThrow( rm, 'mode', 'round' ) ) - ? ROUNDING_MODE - : rm | 0; - - return setMode( this, dp, rm ); - }; - - - /* - * sqrt(-n) = N - * sqrt( N) = N - * sqrt(-I) = N - * sqrt( I) = I - * sqrt( 0) = 0 - * sqrt(-0) = -0 - * - * Return a new BigNumber whose value is the square root of the value of - * this BigNumber, rounded according to DECIMAL_PLACES and ROUNDING_MODE. - */ - P['squareRoot'] = P['sqrt'] = function () { - var n, r, re, t, - x = this, - c = x['c'], - s = x['s'], - e = x['e'], - dp = DECIMAL_PLACES, - rm = ROUNDING_MODE, - half = new BigNumber('0.5'); - - // Negative/NaN/Infinity/zero? - if ( s !== 1 || !c || !c[0] ) { - - return new BigNumber( !s || s < 0 && ( !c || c[0] ) - ? NaN - : c ? x : 1 / 0 ); - } - - // Initial estimate. - s = Math.sqrt( x['toS']() ); - ROUNDING_MODE = 1; - - /* - Math.sqrt underflow/overflow? - Pass x to Math.sqrt as integer, then adjust the exponent of the result. - */ - if ( s == 0 || s == 1 / 0 ) { - n = c.join(''); - - if ( !( n.length + e & 1 ) ) { - n += '0'; - } - r = new BigNumber( Math.sqrt(n) + '' ); - - // r may still not be finite. - if ( !r['c'] ) { - r['c'] = [1]; - } - r['e'] = ( ( ( e + 1 ) / 2 ) | 0 ) - ( e < 0 || e & 1 ); - } else { - r = new BigNumber( n = s.toString() ); - } - re = r['e']; - s = re + ( DECIMAL_PLACES += 4 ); - - if ( s < 3 ) { - s = 0; - } - e = s; - - // Newton-Raphson iteration. - for ( ; ; ) { - t = r; - r = half['times']( t['plus']( x['div'](t) ) ); - - if ( t['c'].slice( 0, s ).join('') === r['c'].slice( 0, s ).join('') ) { - c = r['c']; - - /* - The exponent of r may here be one less than the final result - exponent (re), e.g 0.0009999 (e-4) --> 0.001 (e-3), so adjust - s so the rounding digits are indexed correctly. - */ - s = s - ( n && r['e'] < re ); - - /* - The 4th rounding digit may be in error by -1 so if the 4 rounding - digits are 9999 or 4999 (i.e. approaching a rounding boundary) - continue the iteration. - */ - if ( c[s] == 9 && c[s - 1] == 9 && c[s - 2] == 9 && - ( c[s - 3] == 9 || n && c[s - 3] == 4 ) ) { - - /* - If 9999 on first run through, check to see if rounding up - gives the exact result as the nines may infinitely repeat. - */ - if ( n && c[s - 3] == 9 ) { - t = r['round']( dp, 0 ); - - if ( t['times'](t)['eq'](x) ) { - ROUNDING_MODE = rm; - DECIMAL_PLACES = dp; - - return t; - } - } - DECIMAL_PLACES += 4; - s += 4; - n = ''; - } else { - - /* - If the rounding digits are null, 0000 or 5000, check for an - exact result. If not, then there are further digits so - increment the 1st rounding digit to ensure correct rounding. - */ - if ( !c[e] && !c[e - 1] && !c[e - 2] && - ( !c[e - 3] || c[e - 3] == 5 ) ) { - - // Truncate to the first rounding digit. - if ( c.length > e - 2 ) { - c.length = e - 2; - } - - if ( !r['times'](r)['eq'](x) ) { - - while ( c.length < e - 3 ) { - c.push(0); - } - c[e - 3]++; - } - } - ROUNDING_MODE = rm; - rnd( r, DECIMAL_PLACES = dp, 10 ); - - return r; - } - } - } - }; - - - /* - * n * 0 = 0 - * n * N = N - * n * I = I - * 0 * n = 0 - * 0 * 0 = 0 - * 0 * N = N - * 0 * I = N - * N * n = N - * N * 0 = N - * N * N = N - * N * I = N - * I * n = I - * I * 0 = N - * I * N = N - * I * I = I - * - * Return a new BigNumber whose value is the value of this BigNumber times - * the value of BigNumber(y, b). - */ - P['times'] = function ( y, b ) { - var c, - x = this, - xc = x['c'], - yc = ( id = 11, y = new BigNumber( y, b ) )['c'], - i = x['e'], - j = y['e'], - a = x['s']; - - y['s'] = a == ( b = y['s'] ) ? 1 : -1; - - // Either NaN/Infinity/0? - if ( !i && ( !xc || !xc[0] ) || !j && ( !yc || !yc[0] ) ) { - - // Either NaN? - return new BigNumber( !a || !b || - - // x is 0 and y is Infinity or y is 0 and x is Infinity? - xc && !xc[0] && !yc || yc && !yc[0] && !xc - - // Return NaN. - ? NaN - - // Either Infinity? - : !xc || !yc - - // Return +-Infinity. - ? y['s'] / 0 - - // x or y is 0. Return +-0. - : y['s'] * 0 ); - } - y['e'] = i + j; - - if ( ( a = xc.length ) < ( b = yc.length ) ) { - c = xc, xc = yc, yc = c, j = a, a = b, b = j; - } - - for ( j = a + b, c = []; j--; c.push(0) ) { - } - - // Multiply! - for ( i = b - 1; i > -1; i-- ) { - - for ( b = 0, j = a + i; - j > i; - b = c[j] + yc[i] * xc[j - i - 1] + b, - c[j--] = b % 10 | 0, - b = b / 10 | 0 ) { - } - - if ( b ) { - c[j] = ( c[j] + b ) % 10; - } - } - - b && ++y['e']; - - // Remove any leading zero. - !c[0] && c.shift(); - - // Remove trailing zeros. - for ( j = c.length; !c[--j]; c.pop() ) { - } - - // No zero check needed as only x * 0 == 0 etc. - - // Overflow? - y['c'] = y['e'] > MAX_EXP - - // Infinity. - ? ( y['e'] = null ) - - // Underflow? - : y['e'] < MIN_EXP - - // Zero. - ? [ y['e'] = 0 ] - - // Neither. - : c; - - return y; - }; - - - /* - * Return a string representing the value of this BigNumber in exponential - * notation to dp fixed decimal places and rounded using ROUNDING_MODE if - * necessary. - * - * [dp] {number} Integer, 0 to MAX inclusive. - */ - P['toExponential'] = P['toE'] = function ( dp ) { - - return format( this, - ( dp == null || ( ( outOfRange = dp < 0 || dp > MAX ) || - - /* - * Include '&& dp !== 0' because with Opera -0 == parseFloat(-0) is - * false, despite -0 == parseFloat('-0') && 0 == -0 being true. - */ - parse(dp) != dp && dp !== 0 ) && - - // 'toE() decimal places not an integer: {dp}' - // 'toE() decimal places out of range: {dp}' - !ifExceptionsThrow( dp, 'decimal places', 'toE' ) ) && this['c'] - ? this['c'].length - 1 - : dp | 0, 1 ); - }; - - - /* - * Return a string representing the value of this BigNumber in normal - * notation to dp fixed decimal places and rounded using ROUNDING_MODE if - * necessary. - * - * Note: as with JavaScript's number type, (-0).toFixed(0) is '0', - * but e.g. (-0.00001).toFixed(0) is '-0'. - * - * [dp] {number} Integer, 0 to MAX inclusive. - */ - P['toFixed'] = P['toF'] = function ( dp ) { - var n, str, d, - x = this; - - if ( !( dp == null || ( ( outOfRange = dp < 0 || dp > MAX ) || - parse(dp) != dp && dp !== 0 ) && - - // 'toF() decimal places not an integer: {dp}' - // 'toF() decimal places out of range: {dp}' - !ifExceptionsThrow( dp, 'decimal places', 'toF' ) ) ) { - d = x['e'] + ( dp | 0 ); - } - - n = TO_EXP_NEG, dp = TO_EXP_POS; - TO_EXP_NEG = -( TO_EXP_POS = 1 / 0 ); - - // Note: str is initially undefined. - if ( d == str ) { - str = x['toS'](); - } else { - str = format( x, d ); - - // (-0).toFixed() is '0', but (-0.1).toFixed() is '-0'. - // (-0).toFixed(1) is '0.0', but (-0.01).toFixed(1) is '-0.0'. - if ( x['s'] < 0 && x['c'] ) { - - // As e.g. -0 toFixed(3), will wrongly be returned as -0.000 from toString. - if ( !x['c'][0] ) { - str = str.replace(/^-/, ''); - - // As e.g. -0.5 if rounded to -0 will cause toString to omit the minus sign. - } else if ( str.indexOf('-') < 0 ) { - str = '-' + str; - } - } - } - TO_EXP_NEG = n, TO_EXP_POS = dp; - - return str; - }; - - - /* - * Return a string array representing the value of this BigNumber as a - * simple fraction with an integer numerator and an integer denominator. - * The denominator will be a positive non-zero value less than or equal to - * the specified maximum denominator. If a maximum denominator is not - * specified, the denominator will be the lowest value necessary to - * represent the number exactly. - * - * [maxD] {number|string|BigNumber} Integer >= 1 and < Infinity. - */ - P['toFraction'] = P['toFr'] = function ( maxD ) { - var q, frac, n0, d0, d2, n, e, - n1 = d0 = new BigNumber(ONE), - d1 = n0 = new BigNumber('0'), - x = this, - xc = x['c'], - exp = MAX_EXP, - dp = DECIMAL_PLACES, - rm = ROUNDING_MODE, - d = new BigNumber(ONE); - - // NaN, Infinity. - if ( !xc ) { - return x['toS'](); - } - - e = d['e'] = xc.length - x['e'] - 1; - - // If max denominator is undefined or null... - if ( maxD == null || - - // or NaN... - ( !( id = 12, n = new BigNumber(maxD) )['s'] || - - // or less than 1, or Infinity... - ( outOfRange = n['cmp'](n1) < 0 || !n['c'] ) || - - // or not an integer... - ( ERRORS && n['e'] < n['c'].length - 1 ) ) && - - // 'toFr() max denominator not an integer: {maxD}' - // 'toFr() max denominator out of range: {maxD}' - !ifExceptionsThrow( maxD, 'max denominator', 'toFr' ) || - - // or greater than the maxD needed to specify the value exactly... - ( maxD = n )['cmp'](d) > 0 ) { - - // d is e.g. 10, 100, 1000, 10000... , n1 is 1. - maxD = e > 0 ? d : n1; - } - - MAX_EXP = 1 / 0; - n = new BigNumber( xc.join('') ); - - for ( DECIMAL_PLACES = 0, ROUNDING_MODE = 1; ; ) { - q = n['div'](d); - d2 = d0['plus']( q['times'](d1) ); - - if ( d2['cmp'](maxD) == 1 ) { - break; - } - - d0 = d1, d1 = d2; - - n1 = n0['plus']( q['times']( d2 = n1 ) ); - n0 = d2; - - d = n['minus']( q['times']( d2 = d ) ); - n = d2; - } - - d2 = maxD['minus'](d0)['div'](d1); - n0 = n0['plus']( d2['times'](n1) ); - d0 = d0['plus']( d2['times'](d1) ); - - n0['s'] = n1['s'] = x['s']; - - DECIMAL_PLACES = e * 2; - ROUNDING_MODE = rm; - - // Determine which fraction is closer to x, n0 / d0 or n1 / d1? - frac = n1['div'](d1)['minus'](x)['abs']()['cmp']( - n0['div'](d0)['minus'](x)['abs']() ) < 1 - ? [ n1['toS'](), d1['toS']() ] - : [ n0['toS'](), d0['toS']() ]; - - return MAX_EXP = exp, DECIMAL_PLACES = dp, frac; - }; - - - /* - * Return a string representing the value of this BigNumber to sd significant - * digits and rounded using ROUNDING_MODE if necessary. - * If sd is less than the number of digits necessary to represent the integer - * part of the value in normal notation, then use exponential notation. - * - * sd {number} Integer, 1 to MAX inclusive. - */ - P['toPrecision'] = P['toP'] = function ( sd ) { - - /* - * ERRORS true: Throw if sd not undefined, null or an integer in range. - * ERRORS false: Ignore sd if not a number or not in range. - * Truncate non-integers. - */ - return sd == null || ( ( ( outOfRange = sd < 1 || sd > MAX ) || - parse(sd) != sd ) && - - // 'toP() precision not an integer: {sd}' - // 'toP() precision out of range: {sd}' - !ifExceptionsThrow( sd, 'precision', 'toP' ) ) - ? this['toS']() - : format( this, --sd | 0, 2 ); - }; - - - /* - * Return a string representing the value of this BigNumber in base b, or - * base 10 if b is omitted. If a base is specified, including base 10, - * round according to DECIMAL_PLACES and ROUNDING_MODE. - * If a base is not specified, and this BigNumber has a positive exponent - * that is equal to or greater than TO_EXP_POS, or a negative exponent equal - * to or less than TO_EXP_NEG, return exponential notation. - * - * [b] {number} Integer, 2 to 64 inclusive. - */ - P['toString'] = P['toS'] = function ( b ) { - var u, str, strL, - x = this, - xe = x['e']; - - // Infinity or NaN? - if ( xe === null ) { - str = x['s'] ? 'Infinity' : 'NaN'; - - // Exponential format? - } else if ( b === u && ( xe <= TO_EXP_NEG || xe >= TO_EXP_POS ) ) { - return format( x, x['c'].length - 1, 1 ); - } else { - str = x['c'].join(''); - - // Negative exponent? - if ( xe < 0 ) { - - // Prepend zeros. - for ( ; ++xe; str = '0' + str ) { - } - str = '0.' + str; - - // Positive exponent? - } else if ( strL = str.length, xe > 0 ) { - - if ( ++xe > strL ) { - - // Append zeros. - for ( xe -= strL; xe-- ; str += '0' ) { - } - } else if ( xe < strL ) { - str = str.slice( 0, xe ) + '.' + str.slice(xe); - } - - // Exponent zero. - } else { - if ( u = str.charAt(0), strL > 1 ) { - str = u + '.' + str.slice(1); - - // Avoid '-0' - } else if ( u == '0' ) { - return u; - } - } - - if ( b != null ) { - - if ( !( outOfRange = !( b >= 2 && b < 65 ) ) && - ( b == (b | 0) || !ERRORS ) ) { - str = convert( str, b | 0, 10, x['s'] ); - - // Avoid '-0' - if ( str == '0' ) { - return str; - } - } else { - - // 'toS() base not an integer: {b}' - // 'toS() base out of range: {b}' - ifExceptionsThrow( b, 'base', 'toS' ); - } - } - - } - - return x['s'] < 0 ? '-' + str : str; - }; - - - /* - * Return the value of this BigNumber converted to a number primitive. - * - */ - P['toNumber'] = P['toN'] = function () { - var x = this; - - // Ensure zero has correct sign. - return +x || ( x['s'] ? 0 * x['s'] : NaN ); - }; - - - /* - * Return as toString, but do not accept a base argument. - */ - P['valueOf'] = function () { - return this['toS'](); - }; - - - // Add aliases for BigDecimal methods. - //P['add'] = P['plus']; - //P['subtract'] = P['minus']; - //P['multiply'] = P['times']; - //P['divide'] = P['div']; - //P['remainder'] = P['mod']; - //P['compareTo'] = P['cmp']; - //P['negate'] = P['neg']; - - - // EXPORT - - - // Node and other CommonJS-like environments that support module.exports. - if ( typeof module !== 'undefined' && module.exports ) { - module.exports = BigNumber; - - //AMD. - } else if ( typeof define == 'function' && define.amd ) { - define( function () { - return BigNumber; - }); - - //Browser. - } else { - global['BigNumber'] = BigNumber; - } - -})( this ); diff --git a/node_modules/mysql/node_modules/bignumber.js/bignumber.min.js b/node_modules/mysql/node_modules/bignumber.js/bignumber.min.js deleted file mode 100644 index c6e985f..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/bignumber.min.js +++ /dev/null @@ -1,2 +0,0 @@ -/*! bignumber.js v1.4.1 https://github.com/MikeMcl/bignumber.js/LICENCE */ -(function(n){"use strict";function t(n,i){var c,l,a,b,w,p,s=this;if(!(s instanceof t))return new t(n,i);if(n instanceof t)if(u=0,i!==c)n+="";else{s.s=n.s;s.e=n.e;s.c=(n=n.c)?n.slice():n;return}if(typeof n!="string"&&(n=(a=typeof n=="number"||Object.prototype.toString.call(n)=="[object Number]")&&n===0&&1/n<0?"-0":n+""),p=n,i===c&&g.test(n))s.s=n.charAt(0)=="-"?(n=n.slice(1),-1):1;else{if(i==10)return k(n,e,r);if(n=rt.call(n).replace(/^\+(?!-)/,""),s.s=n.charAt(0)=="-"?(n=n.replace(/^-(?!-)/,""),-1):1,i!=null?i!=(i|0)&&y||(o=!(i>=2&&i<65))?(f(i,2),w=g.test(n)):(b="["+d.slice(0,i=i|0)+"]+",n=n.replace(/\.$/,"").replace(/^\./,"0."),(w=new RegExp("^"+b+"(?:\\."+b+")?$",i<37?"i":"").test(n))?(a&&(n.replace(/^0\.0*|\./,"").length>15&&f(p,0),a=!a),n=tt(n,10,i,s.s)):n!="Infinity"&&n!="NaN"&&(f(p,1,i),n="NaN")):w=g.test(n),!w){s.c=s.e=null;n!="Infinity"&&(n!="NaN"&&f(p,3),s.s=null);u=0;return}}for((c=n.indexOf("."))>-1&&(n=n.replace(".","")),(l=n.search(/e/i))>0?(c<0&&(c=l),c+=+n.slice(l+1),n=n.substring(0,l)):c<0&&(c=n.length),l=0;n.charAt(l)=="0";l++);if(i=n.length,a&&i>15&&n.slice(l).length>15&&f(p,0),u=0,(c-=l+1)>h)s.c=s.e=null;else if(l==i||ci-1&&(f[u+1]==null&&(f[u+1]=0),f[u+1]+=f[u]/i^0,f[u]%=i)}return f.reverse()}function o(n){for(var t=0,r=n.length,i="";t-1)if(e=n.length-e-1,c=h(new t(r).pow(e).toF(),10),f=n.split("."),l=h(f[1]),f=h(f[0]),a=it(l,c,l.length-c.length,u,i,f[f.length-1]&1),s=a.c,e=a.e){for(;++e;s.unshift(0));n=o(f)+"."+o(s)}else s[0]?f[e=f.length-1]c?1:-1;else for(a=-1,w=0;++as[a]?1:-1;break}if(w<0){for(d=c==y?i:rt;c;){if(s[--c]it&&b(l,e,f,o,s[0]!=null),l.e>h?l.c=l.e=null:l.e++i&&b(n,u,10),u=f[0]==0?u+1:r?i:n.e+u+1;f.length1?(f.splice(1,0,"."),f.join("")):f[0])+(u<0?"e":"e+")+u:n.toS()}function b(n,t,i,u,f){var e=n.c,s=n.s<0,c=i/2,o=n.e+t+1,h=e[o],l=f||o<0||e[o+1]!=null;if(f=r<4?(h!=null||l)&&(r==0||r==2&&!s||r==3&&s):h>c||h==c&&(r==4||l||r==6&&(e[o-1]&1||!t&&u)||r==7&&!s||r==8&&s),o<1||!e[0])return e.length=0,e.push(0),f?(e[0]=1,n.e=-t):n.e=0,n;if(e.length=o--,f)for(--i;++e[o]>i;)e[o]=0,o--||(++n.e,e.unshift(1));for(o=e.length;!e[--o];e.pop());return n}function k(n,i,u){var f=r;return r=u,n=new t(n),n.c&&b(n,i,10),r=f,n}var s=1e9,nt=1e6,e=20,r=4,c=-7,a=21,v=-s,h=s,y=!0,l=parseInt,i=t.prototype,d="0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_",o,u=0,g=/^-?(\d+(\.\d*)?|\.\d+)(e[+-]?\d+)?$/i,rt=String.prototype.trim||function(){return this.replace(/^\s+|\s+$/g,"")},p=t(1);t.ROUND_UP=0;t.ROUND_DOWN=1;t.ROUND_CEIL=2;t.ROUND_FLOOR=3;t.ROUND_HALF_UP=4;t.ROUND_HALF_DOWN=5;t.ROUND_HALF_EVEN=6;t.ROUND_HALF_CEIL=7;t.ROUND_HALF_FLOOR=8;t.config=function(){var n,t,g=0,p={},d=arguments,k=d[0],w="config",i=function(n,t,i){return!((o=ni)||l(n)!=n&&n!==0)},b=k&&typeof k=="object"?function(){if(k.hasOwnProperty(t))return(n=k[t])!=null}:function(){if(d.length>g)return(n=d[g++])!=null};return b(t="DECIMAL_PLACES")&&(i(n,0,s)?e=n|0:f(n,t,w)),p[t]=e,b(t="ROUNDING_MODE")&&(i(n,0,8)?r=n|0:f(n,t,w)),p[t]=r,b(t="EXPONENTIAL_AT")&&(i(n,-s,s)?c=-(a=~~(n<0?-n:+n)):!o&&n&&i(n[0],-s,0)&&i(n[1],0,s)?(c=~~n[0],a=~~n[1]):f(n,t,w,1)),p[t]=[c,a],b(t="RANGE")&&(i(n,-s,s)&&~~n?v=-(h=~~(n<0?-n:+n)):!o&&n&&i(n[0],-s,-1)&&i(n[1],1,s)?(v=~~n[0],h=~~n[1]):f(n,t,w,1,1)),p[t]=[v,h],b(t="ERRORS")&&(n===!!n||n===1||n===0?l=(o=u=0,y=!!n)?parseInt:parseFloat:f(n,t,w,0,0,1)),p[t]=y,p};i.abs=i.absoluteValue=function(){var n=new t(this);return n.s<0&&(n.s=1),n};i.ceil=function(){return k(this,0,2)};i.comparedTo=i.cmp=function(n,i){var f,l=this,e=l.c,o=(u=-u,n=new t(n,i)).c,r=l.s,c=n.s,s=l.e,h=n.e;if(!r||!c)return null;if(f=e&&!e[0],i=o&&!o[0],f||i)return f?i?0:-c:r;if(r!=c)return r;if(f=r<0,i=s==h,!e||!o)return i?0:!e^f?1:-1;if(!i)return s>h^f?1:-1;for(r=-1,c=(s=e.length)<(h=o.length)?s:h;++ro[r]^f?1:-1;return s==h?0:s>h^f?1:-1};i.dividedBy=i.div=function(n,i){var r=this.c,o=this.e,s=this.s,f=(u=2,n=new t(n,i)).c,h=n.e,c=n.s,e=s==c?1:-1;return!o&&(!r||!r[0])||!h&&(!f||!f[0])?new t(!s||!c||(r?f&&r[0]==f[0]:!f)?NaN:r&&r[0]==0||!f?e*0:e/0):it(r,f,o-h,e,10)};i.equals=i.eq=function(n,t){return u=3,this.cmp(n,t)===0};i.floor=function(){return k(this,0,3)};i.greaterThan=i.gt=function(n,t){return u=4,this.cmp(n,t)>0};i.greaterThanOrEqualTo=i.gte=function(n,t){return u=5,(t=this.cmp(n,t))==1||t===0};i.isFinite=i.isF=function(){return!!this.c};i.isNaN=function(){return!this.s};i.isNegative=i.isNeg=function(){return this.s<0};i.isZero=i.isZ=function(){return!!this.c&&this.c[0]==0};i.lessThan=i.lt=function(n,t){return u=6,this.cmp(n,t)<0};i.lessThanOrEqualTo=i.lte=function(n,t){return u=7,(t=this.cmp(n,t))==-1||t===0};i.minus=function(n,i){var h,l,a,y,c=this,o=c.s;if(i=(u=8,n=new t(n,i)).s,!o||!i)return new t(NaN);if(o!=i)return n.s=-i,c.plus(n);var f=c.c,p=c.e,e=n.c,s=n.e;if(!p||!s){if(!f||!e)return f?(n.s=-i,n):new t(e?c:NaN);if(!f[0]||!e[0])return e[0]?(n.s=-i,n):new t(f[0]?c:r==3?-0:0)}if(f=f.slice(),o=p-s){for(h=(y=o<0)?(o=-o,f):(s=p,e),h.reverse(),i=o;i--;h.push(0));h.reverse()}else for(a=((y=f.length0)for(;i--;f[a++]=0);for(i=e.length;i>o;){if(f[--i]0?(s=l,e):(f=-f,r),o.reverse();f--;o.push(0));o.reverse()}for(r.length-e.length<0&&(o=e,e=r,r=o),f=e.length,i=0;f;i=(r[--f]=r[f]+e[f]+i)/10^0,r[f]%=10);for(i&&(r.unshift(i),++s>h&&(r=s=null)),f=r.length;r[--f]==0;r.pop());return n.c=r,n.e=s,n};i.toPower=i.pow=function(n){var i=n*0==0?n|0:n,r=new t(this),u=new t(p);if(((o=n<-nt||n>nt)&&(i=n/0)||l(n)!=n&&n!==0&&!(i=NaN))&&!f(n,"exponent","pow")||!i)return new t(Math.pow(r.toS(),i));for(i=i<0?-i:i;;){if(i&1&&(u=u.times(r)),i>>=1,!i)break;r=r.times(r)}return n<0?p.div(u):u};i.round=function(n,t){return n=n==null||((o=n<0||n>s)||l(n)!=n)&&!f(n,"decimal places","round")?0:n|0,t=t==null||((o=t<0||t>8)||l(t)!=t&&t!==0)&&!f(t,"mode","round")?r:t|0,k(this,n,t)};i.squareRoot=i.sqrt=function(){var o,u,c,s,h=this,n=h.c,i=h.s,f=h.e,l=e,a=r,v=new t("0.5");if(i!==1||!n||!n[0])return new t(!i||i<0&&(!n||n[0])?NaN:n?h:1/0);for(i=Math.sqrt(h.toS()),r=1,i==0||i==1/0?(o=n.join(""),o.length+f&1||(o+="0"),u=new t(Math.sqrt(o)+""),u.c||(u.c=[1]),u.e=((f+1)/2|0)-(f<0||f&1)):u=new t(o=i.toString()),c=u.e,i=c+(e+=4),i<3&&(i=0),f=i;;)if(s=u,u=v.times(s.plus(h.div(s))),s.c.slice(0,i).join("")===u.c.slice(0,i).join(""))if(n=u.c,i=i-(o&&u.ef-2&&(n.length=f-2),!u.times(u).eq(h))){while(n.length-1;s--){for(i=0,r=c+s;r>s;i=f[r]+o[s]*e[r-s-1]+i,f[r--]=i%10|0,i=i/10|0);i&&(f[r]=(f[r]+i)%10)}for(i&&++n.e,f[0]||f.shift(),r=f.length;!f[--r];f.pop());return n.c=n.e>h?n.e=null:n.es)||l(n)!=n&&n!==0)&&!f(n,"decimal places","toE"))&&this.c?this.c.length-1:n|0,1)};i.toFixed=i.toF=function(n){var u,t,r,i=this;return n==null||((o=n<0||n>s)||l(n)!=n&&n!==0)&&!f(n,"decimal places","toF")||(r=i.e+(n|0)),u=c,n=a,c=-(a=1/0),r==t?t=i.toS():(t=w(i,r),i.s<0&&i.c&&(i.c[0]?t.indexOf("-")<0&&(t="-"+t):t=t.replace(/^-/,""))),c=u,a=n,t};i.toFraction=i.toFr=function(n){var k,nt,c,l,i,s,d,a=l=new t(p),v=c=new t("0"),w=this,g=w.c,tt=h,it=e,rt=r,b=new t(p);if(!g)return w.toS();for(d=b.e=g.length-w.e-1,(n==null||(!(u=12,s=new t(n)).s||(o=s.cmp(a)<0||!s.c)||y&&s.e0)&&(n=d>0?b:a),h=1/0,s=new t(g.join("")),e=0,r=1;;){if(k=s.div(b),i=l.plus(k.times(v)),i.cmp(n)==1)break;l=v;v=i;a=c.plus(k.times(i=a));c=i;b=s.minus(k.times(i=b));s=i}return i=n.minus(l).div(v),c=c.plus(i.times(a)),l=l.plus(i.times(v)),c.s=a.s=w.s,e=d*2,r=rt,nt=a.div(v).minus(w).abs().cmp(c.div(l).minus(w).abs())<1?[a.toS(),v.toS()]:[c.toS(),l.toS()],h=tt,e=it,nt};i.toPrecision=i.toP=function(n){return n==null||((o=n<1||n>s)||l(n)!=n)&&!f(n,"precision","toP")?this.toS():w(this,--n|0,2)};i.toString=i.toS=function(n){var u,t,e,r=this,i=r.e;if(i===null)t=r.s?"Infinity":"NaN";else{if(n===u&&(i<=c||i>=a))return w(r,r.c.length-1,1);if(t=r.c.join(""),i<0){for(;++i;t="0"+t);t="0."+t}else if(e=t.length,i>0)if(++i>e)for(i-=e;i--;t+="0");else i1)t=u+"."+t.slice(1);else if(u=="0")return u;if(n!=null)if((o=!(n>=2&&n<65))||n!=(n|0)&&y)f(n,"base","toS");else if(t=tt(t,n|0,10,r.s),t=="0")return t}return r.s<0?"-"+t:t};i.toNumber=i.toN=function(){var n=this;return+n||(n.s?0*n.s:NaN)};i.valueOf=function(){return this.toS()};typeof module!="undefined"&&module.exports?module.exports=t:typeof define=="function"&&define.amd?define(function(){return t}):n.BigNumber=t})(this) \ No newline at end of file diff --git a/node_modules/mysql/node_modules/bignumber.js/doc/API.html b/node_modules/mysql/node_modules/bignumber.js/doc/API.html deleted file mode 100644 index da221ac..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/doc/API.html +++ /dev/null @@ -1,1731 +0,0 @@ - - - - - - - bignumber.js API - - - - -
- - bignumber.js - - CONSTRUCTOR - - - Methods - - - Properties - - - INSTANCE - - Methods - - - Properties - - - Zero, NaN & Infinity - - Errors - - FAQ - -
- -
- -

bignumber.js

- -

A JavaScript library for arbitrary-precision arithmetic.

- -

- Hosted on GitHub. -

- - -

API

- -

- In all examples below, var and semicolons are not shown, and - if a commented-out value is in quotes it means toString has - been called on the preceding expression. -

- - - -

CONSTRUCTOR

- -
- BigNumberBigNumber(value [, base]) ⇒ - BigNumber - -
-
-
value
-
- number|string|BigNumber : See RANGE for - range. -
-
- A numeric value. -
-
- Legitimate values include ±0, - ±Infinity and NaN. -
-
- Values of type number with more than 15 significant digits are - considered invalid as calling toString or - valueOf on such numbers may not result in the intended - value. -
-
- There is no limit to the number of digits of a value of type - string (other than that of JavaScript's maximum array size). -
-
- Decimal string values may be in exponential, as well as normal - (non-exponential) notation. Non-decimal values must be in normal - notation. -
-
- String values in hexadecimal literal form, e.g. '0xff', are - invalid, and string values in octal literal form will be interpreted as - decimals, e.g. '011' is interpreted as 11, not 9. -
-
Values in any base may have fraction digits.
-
- For bases from 10 to 36, lower and/or upper case letters can be used to - represent values from 10 to 35. For bases above 36, a-z - represents values from 10 to 35, A-Z from 36 to 61, and - $ and _ represent 62 and 63 respectively - (this can be changed by ediiting the DIGITS variable near the top of the - source file). -
-
-
-
base
-
- number : integer, 2 to 64 inclusive -
-
The base of value.
-
If base is omitted, or is null or undefined, - base 10 is assumed.
-
-

Returns a new instance of a BigNumber object.

-

- If a base is specified, the value is rounded according to - the current DECIMAL_PLACES and - ROUNDING_MODE settings. - Usefully, this means the decimal places of a decimal value - passed to the constructor can be limited by explicitly specifying base 10. -

-

- See Errors for the treatment of an invalid - value or base. -

- 
-x = new BigNumber(9)                       // '9'
-y = new BigNumber(x)                       // '9'
-BigNumber(435.345)                         // 'new' is optional
-new BigNumber('5032485723458348569331745.33434346346912144534543')
-new BigNumber('4.321e+4')                  // '43210'
-new BigNumber('-735.0918e-430')            // '-7.350918e-428'
-new BigNumber(Infinity)                    // 'Infinity'
-new BigNumber(NaN)                         // 'NaN'
-new BigNumber('.5')                        // '0.5'
-new BigNumber('+2')                        // '2'
-new BigNumber(-10110100.1, 2)              // '-180.5'
-new BigNumber('123412421.234324', 5)       // '607236.557696'
-new BigNumber('ff.8', 16)                  // '255.5'
-
-new BigNumber(9, 2)
-// Throws 'not a base 2 number' if ERRORS is true, otherwise 'NaN'
-
-new BigNumber(96517860459076817.4395)
-// Throws 'number type has more than 15 significant digits'
-// if ERRORS is true, otherwise '96517860459076820'
-
-new BigNumber('blurgh')
-// Throws 'not a number' if ERRORS is true, otherwise 'NaN'
-
-BigNumber.config({DECIMAL_PLACES : 5})
-new BigNumber(1.23456789)                  // '1.23456789'
-new BigNumber(1.23456789, 10)              // '1.23457'
- - -

Methods

-

- The BigNumber constructor has one added method, - config, which configures the library-wide settings for - arithmetic, formatting and errors. -

- -
- configconfig([settings]) ⇒ object -
- - Note: the settings can also be supplied as an argument list, - see below. - -
-
settings
-
object
- -
- An object that contains some or all of the following properties: -
- - - -
DECIMAL_PLACES
-
- number : integer, 0 to 1e+9 - inclusive
- Default value: 20 -
-
- The maximum number of decimal places of the results of - division, square root and base conversion operations, and power - operations with negative exponents.
- I.e. aside from the base conversion which may be involved with any - method that accepts a base argument, the value is only relevant to - the dividedBy, squareRoot and - toPower methods. -
-
- 
BigNumber.config({ DECIMAL_PLACES : 5 })
-BigNumber.config(5)    // equivalent
-
- - - -
ROUNDING_MODE
-
- number : integer, 0 to 8 - inclusive
- Default value: 4 - (ROUND_HALF_UP) -
-
- The rounding mode used in the above operations and by - round, - toExponential, - toFixed and - toPrecision. -
-
- The modes are available as enumerated properties of the BigNumber - constructor. -
-
- 
BigNumber.config({ ROUNDING_MODE : 0 })
-BigNumber.config(null, BigNumber.ROUND_UP)    // equivalent
-
- - - -
EXPONENTIAL_AT
-
- number : integer, magnitude 0 to - 1e+9 inclusive, or
- number[] : [ integer -1e+9 to 0 inclusive, integer 0 to 1e+9 - inclusive ]
- Default value: [-7, 20] -
-
- The exponent value(s) at which toString returns - exponential notation. -
-
- If a single number is assigned, the value is the exponent magnitude. -
- If an array of two numbers is assigned then the first number is the - negative exponent value at and beneath which exponential notation is - used, and the second number is the positive exponent value at and - above which the same. -
-
- For example, to emulate JavaScript numbers in terms of the exponent - values at which they begin to use exponential notation, use - [-7, 20]. -
-
- 
BigNumber.config({ EXPONENTIAL_AT : 2 })
-new BigNumber(12.3)         // '12.3'        e is only 1
-new BigNumber(123)          // '1.23e+2'
-new BigNumber(0.123)        // '0.123'       e is only -1
-new BigNumber(0.0123)       // '1.23e-2'
-
-BigNumber.config({ EXPONENTIAL_AT : [-7, 20] })
-new BigNumber(123456789)    // '123456789'   e is only 8
-new BigNumber(0.000000123)  // '1.23e-7'
-
-// Almost never return exponential notation:
-BigNumber.config({ EXPONENTIAL_AT : 1e+9 })
-
-// Always return exponential notation:
-BigNumber.config({ EXPONENTIAL_AT : 0 })
-
-
- Regardless of the value of EXPONENTIAL_AT, the - toFixed method will always return a value in - normal notation and the toExponential method will - always return a value in exponential form. -
-
- Calling toString with a base argument, e.g. - toString(10), will also always return normal notation. -
- - - -
RANGE
-
- number : integer, magnitude 1 to - 1e+9 inclusive, or
- number[] : [ integer -1e+9 to -1 inclusive, integer 1 to 1e+9 - inclusive ]
- Default value: [-1e+9, 1e+9] -
-
- The exponent value(s) beyond which overflow to Infinity and - underflow to zero occurs. -
-
- If a single number is assigned, it is the maximum exponent - magnitude: values wth a positive exponent of greater magnitude - become Infinity and those with a negative exponent of - greater magnitude become zero. -
- If an array of two numbers is assigned then the first number is the - negative exponent limit and the second number is the positive - exponent limit. -
-
- For example, to emulate JavaScript numbers in terms of the exponent - values at which they become zero and Infinity, use - [-324, 308]. -
-
- 
BigNumber.config({ RANGE : 500 })
-BigNumber.config().RANGE     // [ -500, 500 ]
-new BigNumber('9.999e499')   // '9.999e+499'
-new BigNumber('1e500')       // 'Infinity'
-new BigNumber('1e-499')      // '1e-499'
-new BigNumber('1e-500')      // '0'
-
-BigNumber.config({ RANGE : [-3, 4] })
-new BigNumber(99999)         // '99999'      e is only 4
-new BigNumber(100000)        // 'Infinity'   e is 5
-new BigNumber(0.001)         // '0.01'       e is only -3
-new BigNumber(0.0001)        // '0'          e is -4
-
-
- The largest possible magnitude of a finite BigNumber is
- 9.999...e+1000000000
- The smallest possible magnitude of a non-zero BigNumber is
- 1e-1000000000 -
- - - -
ERRORS
-
- boolean/number : true, false, 1 or 0
- Default value: true -
-
- The value that determines whether BigNumber Errors are thrown.
- If ERRORS is false, this library will not throw errors. -
-
- See Errors. -
-
- 
BigNumber.config({ ERRORS : false })
-
-
-
-
-

-
Returns an object with the above properties and their current - values. -

-

- If the value to be assigned to any of the above properties is - null or undefined it is ignored. See - Errors for the treatment of invalid values. -

- 
-BigNumber.config({
-    DECIMAL_PLACES : 40,
-    ROUNDING_MODE : BigNumber.ROUND_HALF_CEIL,
-    EXPONENTIAL_AT : [-10, 20],
-    RANGE : [-500, 500],
-    ERRORS : true
-});
-
-// Alternatively but equivalently:
-BigNumber.config( 40, 7, [-10, 20], 500, 1 )
-
-obj = BigNumber.config();
-obj.ERRORS       // true
-obj.RANGE        // [-500, 500]
- - - -

Properties

-

- The library's enumerated rounding modes are stored as properties of the - constructor.
- They are not referenced internally by the library itself. -

-

- Rounding modes 0 to 6 (inclusive) are the same as those of Java's - BigDecimal class. -

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
PropertyValueDescription
ROUND_UP0Rounds away from zero
ROUND_DOWN1Rounds towards zero
ROUND_CEIL2Rounds towards Infinity
ROUND_FLOOR3Rounds towards -Infinity
ROUND_HALF_UP4 - Rounds towards nearest neighbour.
- If equidistant, rounds away from zero -
ROUND_HALF_DOWN5 - Rounds towards nearest neighbour.
- If equidistant, rounds towards zero -
ROUND_HALF_EVEN6 - Rounds towards nearest neighbour.
- If equidistant, rounds towards even neighbour -
ROUND_HALF_CEIL7 - Rounds towards nearest neighbour.
- If equidistant, rounds towards Infinity -
ROUND_HALF_FLOOR8 - Rounds towards nearest neighbour.
- If equidistant, rounds towards -Infinity -
- 
-BigNumber.config({ ROUNDING_MODE : BigNumber.ROUND_CEIL })
-BigNumber.config({ ROUNDING_MODE : 2 })     // equivalent
- - -

INSTANCE

- -

Methods

-

- The methods inherited by a BigNumber instance from its constructor's - prototype object. -

-

- A BigNumber is immutable in the sense that it is not changed by its - methods. -

-

- The treatment of ±0, ±Infinity and - NaN is consistent with how JavaScript treats these values. -

-

- Method names over 5 letters in length have a shorter alias (except - valueOf).
- Internally, the library always uses the shorter method names. -

- - - -
- absoluteValue.abs() ⇒ BigNumber -
-

- Returns a BigNumber whose value is the absolute value, i.e. the magnitude, - of this BigNumber. -

- 
-x = new BigNumber(-0.8)
-y = x.absoluteValue()         // '0.8'
-z = y.abs()                   // '0.8'
- - - -
- ceil.ceil() ⇒ BigNumber -
-

- Returns a BigNumber whose value is the value of this BigNumber rounded to - a whole number in the direction of Infinity. -

- 
-x = new BigNumber(1.3)
-x.ceil()                      // '2'
-y = new BigNumber(-1.8)
-y.ceil()                      // '-1'
- - - -
- floor.floor() ⇒ - BigNumber -
-

- Returns a BigNumber whose value is the value of this BigNumber rounded to - a whole number in the direction of -Infinity. -

- 
-x = new BigNumber(1.8)
-x.floor()                     // '1'
-y = new BigNumber(-1.3)
-y.floor()                     // '-2'
- - - -
- negated.neg() ⇒ BigNumber -
-

- Returns a BigNumber whose value is the value of this BigNumber negated, - i.e. multiplied by -1. -

- 
-x = new BigNumber(1.8)
-x.negated()                   // '-1.8'
-y = new BigNumber(-1.3)
-y.neg()                       // '1.3'
- - - -
- squareRoot.sqrt() ⇒ BigNumber -
-

- Returns a BigNumber whose value is the square root of this BigNumber, - correctly rounded according to the current - DECIMAL_PLACES and - ROUNDING_MODE settings. -

- 
-x = new BigNumber(16)
-x.squareRoot()                // '4'
-y = new BigNumber(3)
-y.sqrt()                      // '1.73205080756887729353'
- - - -
- isFinite.isF() ⇒ boolean -
-

- Returns true if the value of this BigNumber is a finite - number, otherwise returns false.
- The only possible non-finite values of a BigNumber are NaN, Infinity and - -Infinity. -

- 
-x = new BigNumber(1)
-x.isFinite()                  // true
-y = new BigNumber(Infinity)
-y.isF()                       // false
-

- Note: The native method isFinite() can be used if - n <= Number.MAX_VALUE. -

- - - -
- isNaN.isNaN() ⇒ boolean -
-

- Returns true if the value of this BigNumber is NaN, otherwise - returns false.
-

- 
-x = new BigNumber(NaN)
-x.isNaN()                     // true
-y = new BigNumber('Infinity')
-y.isNaN()                     // false
-

- Note: The native method isNaN() can also be used. -

- - - -
- isNegative.isNeg() ⇒ boolean -
-

- Returns true if the value of this BigNumber is negative, - otherwise returns false.
-

- 
-x = new BigNumber(-0)
-x.isNegative()                // true
-y = new BigNumber(2)
-y.isNeg                       // false
-

- Note: n < 0 can be used if - n <= -Number.MIN_VALUE. -

- - - -
- isZero.isZ() ⇒ boolean -
-

- Returns true if the value of this BigNumber is zero or minus - zero, otherwise returns false.
-

- 
-x = new BigNumber(-0)
-x.isZero() && x.isNeg()        // true
-y = new BigNumber(Infinity)
-y.isZ()                        // false
-

- Note: n == 0 can be used if - n >= Number.MIN_VALUE. -

- - - -
- comparedTo.cmp(n [, base]) ⇒ number -
-

- n : number|string|BigNumber
- base : number
- - See constructor for further parameter details. - -

- - - - - - - - - - - - - - - - - - - - - -
Returns 
1 - If the value of this BigNumber is greater than the value of n -
-1 - If the value of this BigNumber is less than the value of n -
0If this BigNumber and n have the same value
null - if the value of either this BigNumber or n is - NaN -
- 
-x = new BigNumber(Infinity)
-y = new BigNumber(5)
-x.comparedTo(y)                // 1
-x.comparedTo(x.minus(1))       // 0
-y.cmp(NaN)                     // null
-y.cmp('110', 2)                // -1
- - - -
- dividedBy.div(n [, base]) ⇒ - BigNumber -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns a BigNumber whose value is the value of this BigNumber divided by - n, rounded according to the current - DECIMAL_PLACES and - ROUNDING_MODE settings. -

- 
-x = new BigNumber(355)
-y = new BigNumber(113)
-x.dividedBy(y)             // '3.14159292035398230088'
-x.div(5)                   // '71'
-x.div(47, 16)              // '5'
- - - -
- minus.minus(n [, base]) ⇒ BigNumber -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns a BigNumber whose value is the value of this BigNumber minus - n. -

- 
-0.3 - 0.1                  // 0.19999999999999998
-x = new BigNumber(0.3)
-x.minus(0.1)               // '0.2'
-x.minus(0.6, 20)           // '0'
- - - -
- modulo.mod(n [, base]) ⇒ BigNumber -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns a BigNumber whose value is the value of this BigNumber modulo - n, i.e. the integer remainder of dividing this BigNumber by - n. -

-

- The result will have the same sign as this BigNumber, and it will match - that of JavaScript's % operator (within the limits of its precision) and - BigDecimal's remainder method. -

- 
-1 % 0.9                    // 0.09999999999999998
-x = new BigNumber(1)
-x.modulo(0.9)              // '0.1'
-y = new BigNumber(33)
-y.mod('a', 33)             // '3'
- - - -
- plus.plus(n [, base]) ⇒ BigNumber -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns a BigNumber whose value is the value of this BigNumber plus - n. -

- 
-0.1 + 0.2                       // 0.30000000000000004
-x = new BigNumber(0.1)
-y = x.plus(0.2)                 // '0.3'
-BigNumber(0.7).plus(x).plus(y)  // '1'
-x.plus('0.1', 8)                // '0.225'
- - - -
- times.times(n [, base]) ⇒ BigNumber -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns a BigNumber whose value is the value of this BigNumber times - n. -

- 
-0.6 * 3                         // 1.7999999999999998
-x = new BigNumber(0.6)
-y = x.times(3)                  // '1.8'
-BigNumber('7e+500').times(y)    // '1.26e+501'
-x.times('-a', 16)               // '-6'
- - - -
- toPower.pow(exp) ⇒ BigNumber -
-

- exp : number : integer, -1e+6 to 1e+6 inclusive -

-

- Returns a BigNumber whose value is the value of this BigNumber raised to - the power exp. -

-

- If exp is negative the result is rounded according to the - current DECIMAL_PLACES and - ROUNDING_MODE settings. -

-

- If exp is not an integer or is out of range: -

-

- If ERRORS is true a BigNumber - Error is thrown,
- else if exp is greater than 1e+6, it is interpreted as - Infinity;
- else if exp is less than -1e+6, it is interpreted as - -Infinity;
- else if exp is otherwise a number, it is truncated to an - integer;
- else it is interpreted as NaN. -

-

- Note: High value exponents may cause this method to be slow to return. -

- 
-Math.pow(0.7, 2)             // 0.48999999999999994
-x = new BigNumber(0.7)
-x.toPower(2)                 // '0.49'
-BigNumber(3).pow(-2)         // '0.11111111111111111111'
-
-new BigNumber(123.456).toPower(1000).toString().length     // 5099
-new BigNumber(2).pow(1e+6)   // Time taken (Node.js): 9 minutes 34 secs.
- - - -
- equals.eq(n [, base]) ⇒ boolean -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns true if the value of this BigNumber equals the value - of n, otherwise returns false.
- As with JavaScript, NaN does not equal NaN. -
Note : This method uses the comparedTo method - internally. -

- 
-0 === 1e-324                    // true
-x = new BigNumber(0)
-x.equals('1e-324')              // false
-BigNumber(-0).eq(x)             // true  ( -0 === 0 )
-BigNumber(255).eq('ff', 16)     // true
-
-y = new BigNumber(NaN)
-y.equals(NaN)                   // false
- - - -
- greaterThan.gt(n [, base]) ⇒ - boolean -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns true if the value of this BigNumber is greater than - the value of n, otherwise returns false.
- Note : This method uses the comparedTo method internally. -

- 
-0.1 > (0.3 - 0.2)                           // true
-x = new BigNumber(0.1)
-x.greaterThan(BigNumber(0.3).minus(0.2))    // false
-BigNumber(0).gt(x)                          // false
-BigNumber(11, 3).gt(11.1, 2)                // true
- - - -
- greaterThanOrEqualTo.gte(n [, base]) ⇒ - boolean -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns true if the value of this BigNumber is greater than - or equal to the value of n, otherwise returns - false.
- Note : This method uses the comparedTo method internally. -

- 
-(0.3 - 0.2) >= 0.1                   // false
-x = new BigNumber(0.3).minus(0.2)
-x.greaterThanOrEqualTo(0.1)          // true
-BigNumber(1).gte(x)                  // true
-BigNumber(10, 18).gte('i', 36)       // true
- - - -
- lessThan.lt(n [, base]) ⇒ boolean -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns true if the value of this BigNumber is less than the - value of n, otherwise returns false.
- Note : This method uses the comparedTo method internally. -

- 
-(0.3 - 0.2) < 0.1                    // true
-x = new BigNumber(0.3).minus(0.2)
-x.lessThan(0.1)                      // false
-BigNumber(0).lt(x)                   // true
-BigNumber(11.1, 2).lt(11, 3)         // true
- - - -
- lessThanOrEqualTo.lte(n [, base]) ⇒ - boolean -
-

- n : number|string|BigNumber
- base : number
- See constructor for further parameter details. - -

-

- Returns true if the value of this BigNumber is less than or - equal to the value of n, otherwise returns - false.
- Note : This method uses the comparedTo method internally. -

- 
-0.1 <= (0.3 - 0.2)                                // false
-x = new BigNumber(0.1)
-x.lessThanOrEqualTo(BigNumber(0.3).minus(0.2))    // true
-BigNumber(-1).lte(x)                              // true
-BigNumber(10, 18).lte('i', 36)                    // true
- - - -
- toExponential.toE([decimal_places]) ⇒ - string -
-

- decimal_places : number : integer, 0 to 1e+9 inclusive -

-

- Returns a string representing the value of this BigNumber in exponential - notation to the specified decimal places, i.e with one digit before the - decimal point and decimal_places digits after it. If rounding - is necessary, the current - ROUNDING_MODE is used. -

-

- If the value of this BigNumber in exponential notation has fewer fraction - digits then is specified by decimal_places, the return value - will be appended with zeros accordingly. -

-

- If decimal_places is omitted, or is null or - undefined, the number of digits after the decimal point defaults to the - minimum number of digits necessary to represent the value exactly. -

-

- See Errors for the treatment of other - non-integer or out of range decimal_places values. -

- 
-x = 45.6
-y = new BigNumber(x)
-x.toExponential()         // '4.56e+1'
-y.toExponential()         // '4.56e+1'
-x.toExponential(0)        // '5e+1'
-y.toE(0)                  // '5e+1'
-x.toExponential(1)        // '4.6e+1'
-y.toE(1)                  // '4.6e+1'
-x.toExponential(3)        // '4.560e+1'
-y.toE(3)                  // '4.560e+1'
- - - -
- toFixed.toF([decimal_places]) ⇒ - string -
-

- decimal_places : number : integer, 0 to 1e+9 inclusive -

-

- Returns a string representing the value of this BigNumber in normal - notation to the specified fixed number of decimal places, i.e. with - decimal_places digits after the decimal point. If rounding is - necessary, the current - ROUNDING_MODE setting is used. -

-

- If the value of this BigNumber in normal notation has fewer fraction - digits then is specified by decimal_places, the return value - will be appended with zeros accordingly. -

-

- Unlike Number.prototype.toFixed, which returns - exponential notation if a number is greater or equal to 1021, - this method will always return normal notation. -

-

- If decimal_places is omitted, or is null or - undefined, then the return value is the same as n.toString(). - This is also unlike Number.prototype.toFixed, which returns - the value to zero decimal places. -

-

- See Errors for the treatment of other - non-integer or out of range decimal_places values. -

- 
-x = 45.6
-y = new BigNumber(x)
-x.toFixed()              // '46'
-y.toFixed()              // '45.6'
-y.toF(0)                 // '46'
-x.toFixed(3)             // '45.600'
-y.toF(3)                 // '45.600'
- - - -
toNumber.toN() ⇒ number
-

Returns the value of this BigNumber as a number primitive.

-

- Type coercion with, for example, JavaScript's unary plus operator can alternatively be used, - but then a BigNumber with the value minus zero will convert to positive zero. -

- 
-x = new BigNumber(456.789)
-x.toNumber()                   // 456.789
-+x                             // 456.789
-
-y = new BigNumber('45987349857634085409857349856430985')
-y.toNumber()                   // 4.598734985763409e+34
-
-z = new BigNumber(-0)
-1 / +z                         // Infinity
-1 / z.toNumber()               // -Infinity
- - - -
- toPrecision.toP([significant_figures]) ⇒ - string -
-

- significant_figures : number : integer, 1 to 1e+9 - inclusive -

-

- Returns a string representing the value of this BigNumber to the - specified number of significant digits. If rounding is necessary, the - current ROUNDING_MODE setting is - used. -

-

- If significant_figures is less than the number of digits - necessary to represent the integer part of the value in normal notation, - then exponential notation is used. -

-

- If significant_figures is omitted, or is null or - undefined, then the return value is the same as n.toString(). -

-

- See Errors for the treatment of other - non-integer or out of range significant_figures values. -

- 
-x = 45.6
-y = new BigNumber(x)
-x.toPrecision()           // '45.6'
-y.toPrecision()           // '45.6'
-x.toPrecision(1)          // '5e+1'
-y.toP(1)                  // '5e+1'
-x.toPrecision(5)          // '45.600'
-y.toP(5)                  // '45.600'
- - - -
- toString.toS([base]) ⇒ string -
-

- base : number : integer, 2 to 64 inclusive -

-

- Returns a string representing the value of this BigNumber in the specified - base, or base 10 if base is omitted. For bases above 10, - values from 10 to 35 are represented by a-z (as with - Number.toString), 36 to 61 by A-Z, and 62 and 63 - by $ and _ respectively. -

-

- If a base is specified the value is rounded according to the current - DECIMAL_PLACES - and ROUNDING_MODE settings. -

-

- If a base is not specified, and this BigNumber has a positive - exponent that is equal to or greater than the positive component of the - current EXPONENTIAL_AT setting, - or a negative exponent equal to or less than the negative component of the - setting, then exponential notation is returned. -

-

- If base is null or undefined it is ignored. -
- See Errors for the treatment of other non-integer or - out of range base values. -

- 
-x = new BigNumber(750000)
-x.toString()                    // '750000'
-BigNumber.config({ EXPONENTIAL_AT : 5 })
-x.toString()                    // '7.5e+5'
-
-y = new BigNumber(362.875)
-y.toString(2)                   // '101101010.111'
-y.toString(9)                   // '442.77777777777777777778'
-y.toString(32)                  // 'ba.s'
-
-BigNumber.config({ DECIMAL_PLACES : 4 });
-z = new BigNumber('1.23456789')
-z.toString()                    // '1.23456789'
-z.toString(10)                  // '1.2346'
- - - -
- valueOf.valueOf() ⇒ string -
-

- As toString, but does not accept a base argument. -

- 
-x = new BigNumber('1.777e+457')
-x.valueOf()                      // '1.777e+457'
- - - -
- toFraction.toFr([max_denominator]) ⇒ - [string, string] -
-

- max_denominator : number|string|BigNumber : - integer >= 1 and < Infinity -

-

- Returns a string array representing the value of this BigNumber as a - simple fraction with an integer numerator and an integer denominator. The - denominator will be a positive non-zero value less than or equal to - max_denominator. -

-

- If a maximum denominator is not specified, or is null or - undefined, the denominator will be the lowest value necessary to represent - the number exactly. -

-

- See Errors for the treatment of other non-integer or - out of range max_denominator values. -

- 
-x = new BigNumber(1.75)
-x.toFraction()            // '7, 4'
-
-pi = new BigNumber('3.14159265358')
-pi.toFr()                 // '157079632679,50000000000'
-pi.toFr(100000)           // '312689, 99532'
-pi.toFr(10000)            // '355, 113'
-pi.toFr(100)              // '311, 99'
-pi.toFr(10)               // '22, 7'
-pi.toFr(1)                // '3, 1'
- - - -
- round.round([decimal_places [, rounding_mode]]) - ⇒ BigNumber -
-

- decimal_places : number : integer, 0 to 1e+9 inclusive -
- rounding_mode : number : integer, 0 to 8 inclusive -

-

- Returns a BigNumber whose value is the value of this BigNumber rounded by - the specified rounding_mode to a maximum of - decimal_places digits after the decimal point. -

-

- if decimal_places is omitted, or is null or - undefined, the return value is n rounded to a whole number. -

-

- if rounding_mode is omitted, or is null or - undefined, the current - ROUNDING_MODE setting is used. -

-

- See Errors for the treatment of other - non-integer or out of range decimal_places or - rounding_mode values. -

- 
-x = 1234.56
-Math.round(x)                             // 1235
-
-y = new BigNumber(x)
-y.round()                                 // '1235'
-y.round(1)                                // '1234.6'
-y.round(2)                                // '1234.56'
-y.round(10)                               // '1234.56'
-y.round(0, 1)                             // '1234'
-y.round(0, 6)                             // '1235'
-y.round(1, 1)                             // '1234.5'
-y.round(1, BigNumber.ROUND_HALF_EVEN)     // '1234.6'
-y                                         // '1234.56'
- - - -

Properties

-

- A BigNumber is an object with three properties: -

- - - - - - - - - - - - - - - - - - - - - - - - - -
PropertyDescriptionTypeValue
ccoefficient*number[] Array of single digits
eexponentnumberInteger, -1e+9 to 1e+9 inclusive
ssignnumber-1 or 1
-

*significand

-

- The value of any of the three properties may also be null. -

-

- The value of a BigNumber is stored in a normalised decimal floating point - format which corresponds to the value's toExponential form, - with the decimal point to be positioned after the most significant - (left-most) digit of the coefficient. -

-

- Note that, as with JavaScript numbers, the original exponent and - fractional trailing zeros are not preserved. -

- 
x = new BigNumber(0.123)              // '0.123'
-x.toExponential()                     // '1.23e-1'
-x.c                                   // '1,2,3'
-x.e                                   // -1
-x.s                                   // 1
-
-y = new Number(-123.4567000e+2)       // '-12345.67'
-y.toExponential()                     // '-1.234567e+4'
-z = new BigNumber('-123.4567000e+2')  // '-12345.67'
-z.toExponential()                     // '-1.234567e+4'
-z.c                                   // '1,2,3,4,5,6,7'
-z.e                                   // 4
-z.s                                   // -1
- - -

- A BigNumber is mutable in the sense that the value of its properties can - be changed.
- For example, to rapidly shift a value by a power of 10: -

- 
-x = new BigNumber('1234.000')      // '1234'
-x.toExponential()                  // '1.234e+3'
-x.c                                // '1,2,3,4'
-x.e                                // 3
-
-x.e = -5
-x                                  // '0.00001234'
-

- If changing the coefficient array directly, which is not recommended, be - careful to avoid leading or trailing zeros (unless zero itself is being - represented). -

- - - -

Zero, NaN and Infinity

-

- The table below shows how ±0, NaN and ±Infinity are stored. -

- - - - - - - - - - - - - - - - - - - - - - - - - -
ces
±0[0]0±1
NaNnullnullnull
±Infinitynullnull±1
- 
-x = new Number(-0)      // 0
-1 / x == -Infinity     // true
-
-y = new BigNumber(-0)   // '0'
-y.c                     // '0' ( [0].toString() )
-y.e                     // 0
-y.s                     // -1
- - - -

Errors

-

- The errors that are thrown are generic Error objects with - name BigNumber Error. The table below shows the errors - that may be thrown if ERRORS is true, and the - action taken if ERRORS is false. -

- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
Method(s)ERRORS : true
Throw BigNumber Error		ERRORS : false
Action on invalid argument
- BigNumber
- comparedTo
- dividedBy
- equals
- greaterThan
- greaterThanOrEqualTo
- lessThan
- lessThanOrEqualTo
- minus
- mod
- plus
- times		number type has more than
15 significant digits		Accept.
not a base... numberSubstitute NaN.
base not an integerTruncate to integer.
Ignore if not a number.
base out of rangeIgnore.
not a number*Substitute NaN.
configDECIMAL_PLACES not an integerTruncate to integer.
Ignore if not a number.
DECIMAL_PLACES out of rangeIgnore.
ROUNDING_MODE not an integerTruncate to integer.
Ignore if not a number.
ROUNDING_MODE out of rangeIgnore.
- EXPONENTIAL_AT not an integer
- or not [integer, integer] - 		Truncate to integer(s).
Ignore if not number(s).
- EXPONENTIAL_AT out of range
- or not [negative, positive] - 		Ignore.
- RANGE not a non-zero integer
- or not [integer, integer] - 		Truncate to integer(s).
Ignore if zero or not number(s).
- RANGE out of range
- or not [negative, positive] - 		Ignore.
- ERRORS not a boolean
- or binary digit - 		Ignore.
toPowerexponent not an integerTruncate to integer.
Substitute NaN if not a number.
exponent out of rangeSubstitute ±Infinity. -
rounddecimal places not an integerTruncate to integer.
Ignore if not a number.
decimal places out of rangeIgnore.
mode not an integerTruncate to integer.
Ignore if not a number.
mode out of rangeIgnore.
toExponentialdecimal places not an integerTruncate to integer.
Ignore if not a number.
decimal places out of rangeIgnore.
toFixeddecimal places not an integerTruncate to integer.
Ignore if not a number.
decimal places out of rangeIgnore.
toFractionmax denominator not an integerTruncate to integer.
Ignore if not a number.
max denominator out of rangeIgnore.
toPrecisionprecision not an integerTruncate to integer.
Ignore if not a number.
precision out of rangeIgnore.
toStringbase not an integerTruncate to integer.
Ignore if not a number.
base out of rangeIgnore.
-

- *No error is thrown if the value is NaN or 'NaN' -

-

- The message of a BigNumber Error will also contain the name of the - method from which the error originated. -

-

- To determine if an exception is a BigNumber Error: -

- 
-try {
-    // ...
-} catch (e) {
-    if ( e instanceof Error && e.name == 'BigNumber Error' ) {
-        // ...
-    }
-}
- -

FAQ

-
Why are trailing fractional zeros removed from BigNumbers?
-

- Many arbitrary-precision libraries retain trailing fractional zeros as - they can indicate the precision of a value. This can be useful but the - results of arithmetic operations can be misleading. -

- 
-x = new BigDecimal("1.0")
-y = new BigDecimal("1.1000")
-z = x.add(y)                      // 2.1000
-
-x = new BigDecimal("1.20")
-y = new BigDecimal("3.45000")
-z = x.multiply(y)                 // 4.1400000
-

- To specify the precision of a value is to specify that the value lies - within a certain range. -

-

- In the first example, x has a value of 1.0. The trailing zero - shows the precision of the value, implying that it is in the range 0.95 to - 1.05. Similarly, the precision indicated by the trailing zeros of - y indicates that the value is in the range 1.09995 to - 1.10005. If we add the two lowest values in the ranges we get 0.95 + - 1.09995 = 2.04995 and if we add the two highest values we get 1.05 + - 1.10005 = 2.15005, so the range of the result of the addition implied by - the precision of its operands is 2.04995 to 2.15005. The result given by - BigDecimal of 2.1000 however, indicates that the value is in the range - 2.09995 to 2.10005 and therefore the precision implied by its trailing - zeros is misleading. -

-

- In the second example, the true range is 4.122744 to 4.157256 yet the - BigDecimal answer of 4.1400000 indicates a range of 4.13999995 to - 4.14000005. Again, the precision implied by the trailing zeros is - misleading. -

-

- This library, like binary floating point and most calculators, does not - retain trailing fractional zeros. Instead, the toExponential, - toFixed and toPrecision methods enable trailing - zeros to be added if and when required. -

-
- -
- - - diff --git a/node_modules/mysql/node_modules/bignumber.js/package.json b/node_modules/mysql/node_modules/bignumber.js/package.json deleted file mode 100644 index 228299c..0000000 --- a/node_modules/mysql/node_modules/bignumber.js/package.json +++ /dev/null @@ -1,60 +0,0 @@ -{ - "name": "bignumber.js", - "description": "A library for arbitrary-precision decimal and non-decimal arithmetic", - "version": "1.4.1", - "keywords": [ - "arbitrary", - "precision", - "arithmetic", - "big", - "number", - "decimal", - "float", - "biginteger", - "bigdecimal", - "bignumber", - "bigint", - "bignum" - ], - "repository": { - "type": "git", - "url": "https://github.com/MikeMcl/bignumber.js.git" - }, - "main": "bignumber", - "author": { - "name": "Michael Mclaughlin", - "email": "M8ch88l@gmail.com" - }, - "engines": { - "node": "*" - }, - "license": "MIT", - "scripts": { - "test": "node ./test/every-test.js", - "build": "uglifyjs bignumber.js -c -m -o bignumber.min.js --preamble '/* bignumber.js v1.4.1 https://github.com/MikeMcl/bignumber.js/LICENCE */'" - }, - "bugs": { - "url": "https://github.com/MikeMcl/bignumber.js/issues" - }, - "homepage": "https://github.com/MikeMcl/bignumber.js", - "_id": "bignumber.js@1.4.1", - "dist": { - "shasum": "3d19ac321f8db4ba07aace23ebd4ac976fae6bfa", - "tarball": "http://registry.npmjs.org/bignumber.js/-/bignumber.js-1.4.1.tgz" - }, - "_from": "bignumber.js@1.4.1", - "_npmVersion": "1.4.6", - "_npmUser": { - "name": "mikemcl", - "email": "M8ch88l@gmail.com" - }, - "maintainers": [ - { - "name": "mikemcl", - "email": "M8ch88l@gmail.com" - } - ], - "directories": {}, - "_shasum": "3d19ac321f8db4ba07aace23ebd4ac976fae6bfa", - "_resolved": "https://registry.npmjs.org/bignumber.js/-/bignumber.js-1.4.1.tgz" -} diff --git a/node_modules/mysql/node_modules/readable-stream/.npmignore b/node_modules/mysql/node_modules/readable-stream/.npmignore deleted file mode 100644 index 38344f8..0000000 --- a/node_modules/mysql/node_modules/readable-stream/.npmignore +++ /dev/null @@ -1,5 +0,0 @@ -build/ -test/ -examples/ -fs.js -zlib.js \ No newline at end of file diff --git a/node_modules/mysql/node_modules/readable-stream/README.md b/node_modules/mysql/node_modules/readable-stream/README.md deleted file mode 100644 index e46b823..0000000 --- a/node_modules/mysql/node_modules/readable-stream/README.md +++ /dev/null @@ -1,15 +0,0 @@ -# readable-stream - -***Node-core streams for userland*** - -[![NPM](https://nodei.co/npm/readable-stream.png?downloads=true&downloadRank=true)](https://nodei.co/npm/readable-stream/) -[![NPM](https://nodei.co/npm-dl/readable-stream.png&months=6&height=3)](https://nodei.co/npm/readable-stream/) - -This package is a mirror of the Streams2 and Streams3 implementations in Node-core. - -If you want to guarantee a stable streams base, regardless of what version of Node you, or the users of your libraries are using, use **readable-stream** *only* and avoid the *"stream"* module in Node-core. - -**readable-stream** comes in two major versions, v1.0.x and v1.1.x. The former tracks the Streams2 implementation in Node 0.10, including bug-fixes and minor improvements as they are added. The latter tracks Streams3 as it develops in Node 0.11; we will likely see a v1.2.x branch for Node 0.12. - -**readable-stream** uses proper patch-level versioning so if you pin to `"~1.0.0"` you’ll get the latest Node 0.10 Streams2 implementation, including any fixes and minor non-breaking improvements. The patch-level versions of 1.0.x and 1.1.x should mirror the patch-level versions of Node-core releases. You should prefer the **1.0.x** releases for now and when you’re ready to start using Streams3, pin to `"~1.1.0"` - diff --git a/node_modules/mysql/node_modules/readable-stream/duplex.js b/node_modules/mysql/node_modules/readable-stream/duplex.js deleted file mode 100644 index ca807af..0000000 --- a/node_modules/mysql/node_modules/readable-stream/duplex.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require("./lib/_stream_duplex.js") diff --git a/node_modules/mysql/node_modules/readable-stream/float.patch b/node_modules/mysql/node_modules/readable-stream/float.patch deleted file mode 100644 index b984607..0000000 --- a/node_modules/mysql/node_modules/readable-stream/float.patch +++ /dev/null @@ -1,923 +0,0 @@ -diff --git a/lib/_stream_duplex.js b/lib/_stream_duplex.js -index c5a741c..a2e0d8e 100644 ---- a/lib/_stream_duplex.js -+++ b/lib/_stream_duplex.js -@@ -26,8 +26,8 @@ - - module.exports = Duplex; - var util = require('util'); --var Readable = require('_stream_readable'); --var Writable = require('_stream_writable'); -+var Readable = require('./_stream_readable'); -+var Writable = require('./_stream_writable'); - - util.inherits(Duplex, Readable); - -diff --git a/lib/_stream_passthrough.js b/lib/_stream_passthrough.js -index a5e9864..330c247 100644 ---- a/lib/_stream_passthrough.js -+++ b/lib/_stream_passthrough.js -@@ -25,7 +25,7 @@ - - module.exports = PassThrough; - --var Transform = require('_stream_transform'); -+var Transform = require('./_stream_transform'); - var util = require('util'); - util.inherits(PassThrough, Transform); - -diff --git a/lib/_stream_readable.js b/lib/_stream_readable.js -index 0c3fe3e..90a8298 100644 ---- a/lib/_stream_readable.js -+++ b/lib/_stream_readable.js -@@ -23,10 +23,34 @@ module.exports = Readable; - Readable.ReadableState = ReadableState; - - var EE = require('events').EventEmitter; -+if (!EE.listenerCount) EE.listenerCount = function(emitter, type) { -+ return emitter.listeners(type).length; -+}; -+ -+if (!global.setImmediate) global.setImmediate = function setImmediate(fn) { -+ return setTimeout(fn, 0); -+}; -+if (!global.clearImmediate) global.clearImmediate = function clearImmediate(i) { -+ return clearTimeout(i); -+}; -+ - var Stream = require('stream'); - var util = require('util'); -+if (!util.isUndefined) { -+ var utilIs = require('core-util-is'); -+ for (var f in utilIs) { -+ util[f] = utilIs[f]; -+ } -+} - var StringDecoder; --var debug = util.debuglog('stream'); -+var debug; -+if (util.debuglog) -+ debug = util.debuglog('stream'); -+else try { -+ debug = require('debuglog')('stream'); -+} catch (er) { -+ debug = function() {}; -+} - - util.inherits(Readable, Stream); - -@@ -380,7 +404,7 @@ function chunkInvalid(state, chunk) { - - - function onEofChunk(stream, state) { -- if (state.decoder && !state.ended) { -+ if (state.decoder && !state.ended && state.decoder.end) { - var chunk = state.decoder.end(); - if (chunk && chunk.length) { - state.buffer.push(chunk); -diff --git a/lib/_stream_transform.js b/lib/_stream_transform.js -index b1f9fcc..b0caf57 100644 ---- a/lib/_stream_transform.js -+++ b/lib/_stream_transform.js -@@ -64,8 +64,14 @@ - - module.exports = Transform; - --var Duplex = require('_stream_duplex'); -+var Duplex = require('./_stream_duplex'); - var util = require('util'); -+if (!util.isUndefined) { -+ var utilIs = require('core-util-is'); -+ for (var f in utilIs) { -+ util[f] = utilIs[f]; -+ } -+} - util.inherits(Transform, Duplex); - - -diff --git a/lib/_stream_writable.js b/lib/_stream_writable.js -index ba2e920..f49288b 100644 ---- a/lib/_stream_writable.js -+++ b/lib/_stream_writable.js -@@ -27,6 +27,12 @@ module.exports = Writable; - Writable.WritableState = WritableState; - - var util = require('util'); -+if (!util.isUndefined) { -+ var utilIs = require('core-util-is'); -+ for (var f in utilIs) { -+ util[f] = utilIs[f]; -+ } -+} - var Stream = require('stream'); - - util.inherits(Writable, Stream); -@@ -119,7 +125,7 @@ function WritableState(options, stream) { - function Writable(options) { - // Writable ctor is applied to Duplexes, though they're not - // instanceof Writable, they're instanceof Readable. -- if (!(this instanceof Writable) && !(this instanceof Stream.Duplex)) -+ if (!(this instanceof Writable) && !(this instanceof require('./_stream_duplex'))) - return new Writable(options); - - this._writableState = new WritableState(options, this); -diff --git a/test/simple/test-stream-big-push.js b/test/simple/test-stream-big-push.js -index e3787e4..8cd2127 100644 ---- a/test/simple/test-stream-big-push.js -+++ b/test/simple/test-stream-big-push.js -@@ -21,7 +21,7 @@ - - var common = require('../common'); - var assert = require('assert'); --var stream = require('stream'); -+var stream = require('../../'); - var str = 'asdfasdfasdfasdfasdf'; - - var r = new stream.Readable({ -diff --git a/test/simple/test-stream-end-paused.js b/test/simple/test-stream-end-paused.js -index bb73777..d40efc7 100644 ---- a/test/simple/test-stream-end-paused.js -+++ b/test/simple/test-stream-end-paused.js -@@ -25,7 +25,7 @@ var gotEnd = false; - - // Make sure we don't miss the end event for paused 0-length streams - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - var stream = new Readable(); - var calledRead = false; - stream._read = function() { -diff --git a/test/simple/test-stream-pipe-after-end.js b/test/simple/test-stream-pipe-after-end.js -index b46ee90..0be8366 100644 ---- a/test/simple/test-stream-pipe-after-end.js -+++ b/test/simple/test-stream-pipe-after-end.js -@@ -22,8 +22,8 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('_stream_readable'); --var Writable = require('_stream_writable'); -+var Readable = require('../../lib/_stream_readable'); -+var Writable = require('../../lib/_stream_writable'); - var util = require('util'); - - util.inherits(TestReadable, Readable); -diff --git a/test/simple/test-stream-pipe-cleanup.js b/test/simple/test-stream-pipe-cleanup.js -deleted file mode 100644 -index f689358..0000000 ---- a/test/simple/test-stream-pipe-cleanup.js -+++ /dev/null -@@ -1,122 +0,0 @@ --// Copyright Joyent, Inc. and other Node contributors. --// --// Permission is hereby granted, free of charge, to any person obtaining a --// copy of this software and associated documentation files (the --// "Software"), to deal in the Software without restriction, including --// without limitation the rights to use, copy, modify, merge, publish, --// distribute, sublicense, and/or sell copies of the Software, and to permit --// persons to whom the Software is furnished to do so, subject to the --// following conditions: --// --// The above copyright notice and this permission notice shall be included --// in all copies or substantial portions of the Software. --// --// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS --// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF --// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN --// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, --// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR --// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE --// USE OR OTHER DEALINGS IN THE SOFTWARE. -- --// This test asserts that Stream.prototype.pipe does not leave listeners --// hanging on the source or dest. -- --var common = require('../common'); --var stream = require('stream'); --var assert = require('assert'); --var util = require('util'); -- --function Writable() { -- this.writable = true; -- this.endCalls = 0; -- stream.Stream.call(this); --} --util.inherits(Writable, stream.Stream); --Writable.prototype.end = function() { -- this.endCalls++; --}; -- --Writable.prototype.destroy = function() { -- this.endCalls++; --}; -- --function Readable() { -- this.readable = true; -- stream.Stream.call(this); --} --util.inherits(Readable, stream.Stream); -- --function Duplex() { -- this.readable = true; -- Writable.call(this); --} --util.inherits(Duplex, Writable); -- --var i = 0; --var limit = 100; -- --var w = new Writable(); -- --var r; -- --for (i = 0; i < limit; i++) { -- r = new Readable(); -- r.pipe(w); -- r.emit('end'); --} --assert.equal(0, r.listeners('end').length); --assert.equal(limit, w.endCalls); -- --w.endCalls = 0; -- --for (i = 0; i < limit; i++) { -- r = new Readable(); -- r.pipe(w); -- r.emit('close'); --} --assert.equal(0, r.listeners('close').length); --assert.equal(limit, w.endCalls); -- --w.endCalls = 0; -- --r = new Readable(); -- --for (i = 0; i < limit; i++) { -- w = new Writable(); -- r.pipe(w); -- w.emit('close'); --} --assert.equal(0, w.listeners('close').length); -- --r = new Readable(); --w = new Writable(); --var d = new Duplex(); --r.pipe(d); // pipeline A --d.pipe(w); // pipeline B --assert.equal(r.listeners('end').length, 2); // A.onend, A.cleanup --assert.equal(r.listeners('close').length, 2); // A.onclose, A.cleanup --assert.equal(d.listeners('end').length, 2); // B.onend, B.cleanup --assert.equal(d.listeners('close').length, 3); // A.cleanup, B.onclose, B.cleanup --assert.equal(w.listeners('end').length, 0); --assert.equal(w.listeners('close').length, 1); // B.cleanup -- --r.emit('end'); --assert.equal(d.endCalls, 1); --assert.equal(w.endCalls, 0); --assert.equal(r.listeners('end').length, 0); --assert.equal(r.listeners('close').length, 0); --assert.equal(d.listeners('end').length, 2); // B.onend, B.cleanup --assert.equal(d.listeners('close').length, 2); // B.onclose, B.cleanup --assert.equal(w.listeners('end').length, 0); --assert.equal(w.listeners('close').length, 1); // B.cleanup -- --d.emit('end'); --assert.equal(d.endCalls, 1); --assert.equal(w.endCalls, 1); --assert.equal(r.listeners('end').length, 0); --assert.equal(r.listeners('close').length, 0); --assert.equal(d.listeners('end').length, 0); --assert.equal(d.listeners('close').length, 0); --assert.equal(w.listeners('end').length, 0); --assert.equal(w.listeners('close').length, 0); -diff --git a/test/simple/test-stream-pipe-error-handling.js b/test/simple/test-stream-pipe-error-handling.js -index c5d724b..c7d6b7d 100644 ---- a/test/simple/test-stream-pipe-error-handling.js -+++ b/test/simple/test-stream-pipe-error-handling.js -@@ -21,7 +21,7 @@ - - var common = require('../common'); - var assert = require('assert'); --var Stream = require('stream').Stream; -+var Stream = require('../../').Stream; - - (function testErrorListenerCatches() { - var source = new Stream(); -diff --git a/test/simple/test-stream-pipe-event.js b/test/simple/test-stream-pipe-event.js -index cb9d5fe..56f8d61 100644 ---- a/test/simple/test-stream-pipe-event.js -+++ b/test/simple/test-stream-pipe-event.js -@@ -20,7 +20,7 @@ - // USE OR OTHER DEALINGS IN THE SOFTWARE. - - var common = require('../common'); --var stream = require('stream'); -+var stream = require('../../'); - var assert = require('assert'); - var util = require('util'); - -diff --git a/test/simple/test-stream-push-order.js b/test/simple/test-stream-push-order.js -index f2e6ec2..a5c9bf9 100644 ---- a/test/simple/test-stream-push-order.js -+++ b/test/simple/test-stream-push-order.js -@@ -20,7 +20,7 @@ - // USE OR OTHER DEALINGS IN THE SOFTWARE. - - var common = require('../common.js'); --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - var assert = require('assert'); - - var s = new Readable({ -diff --git a/test/simple/test-stream-push-strings.js b/test/simple/test-stream-push-strings.js -index 06f43dc..1701a9a 100644 ---- a/test/simple/test-stream-push-strings.js -+++ b/test/simple/test-stream-push-strings.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - var util = require('util'); - - util.inherits(MyStream, Readable); -diff --git a/test/simple/test-stream-readable-event.js b/test/simple/test-stream-readable-event.js -index ba6a577..a8e6f7b 100644 ---- a/test/simple/test-stream-readable-event.js -+++ b/test/simple/test-stream-readable-event.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - - (function first() { - // First test, not reading when the readable is added. -diff --git a/test/simple/test-stream-readable-flow-recursion.js b/test/simple/test-stream-readable-flow-recursion.js -index 2891ad6..11689ba 100644 ---- a/test/simple/test-stream-readable-flow-recursion.js -+++ b/test/simple/test-stream-readable-flow-recursion.js -@@ -27,7 +27,7 @@ var assert = require('assert'); - // more data continuously, but without triggering a nextTick - // warning or RangeError. - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - - // throw an error if we trigger a nextTick warning. - process.throwDeprecation = true; -diff --git a/test/simple/test-stream-unshift-empty-chunk.js b/test/simple/test-stream-unshift-empty-chunk.js -index 0c96476..7827538 100644 ---- a/test/simple/test-stream-unshift-empty-chunk.js -+++ b/test/simple/test-stream-unshift-empty-chunk.js -@@ -24,7 +24,7 @@ var assert = require('assert'); - - // This test verifies that stream.unshift(Buffer(0)) or - // stream.unshift('') does not set state.reading=false. --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - - var r = new Readable(); - var nChunks = 10; -diff --git a/test/simple/test-stream-unshift-read-race.js b/test/simple/test-stream-unshift-read-race.js -index 83fd9fa..17c18aa 100644 ---- a/test/simple/test-stream-unshift-read-race.js -+++ b/test/simple/test-stream-unshift-read-race.js -@@ -29,7 +29,7 @@ var assert = require('assert'); - // 3. push() after the EOF signaling null is an error. - // 4. _read() is not called after pushing the EOF null chunk. - --var stream = require('stream'); -+var stream = require('../../'); - var hwm = 10; - var r = stream.Readable({ highWaterMark: hwm }); - var chunks = 10; -@@ -51,7 +51,14 @@ r._read = function(n) { - - function push(fast) { - assert(!pushedNull, 'push() after null push'); -- var c = pos >= data.length ? null : data.slice(pos, pos + n); -+ var c; -+ if (pos >= data.length) -+ c = null; -+ else { -+ if (n + pos > data.length) -+ n = data.length - pos; -+ c = data.slice(pos, pos + n); -+ } - pushedNull = c === null; - if (fast) { - pos += n; -diff --git a/test/simple/test-stream-writev.js b/test/simple/test-stream-writev.js -index 5b49e6e..b5321f3 100644 ---- a/test/simple/test-stream-writev.js -+++ b/test/simple/test-stream-writev.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var stream = require('stream'); -+var stream = require('../../'); - - var queue = []; - for (var decode = 0; decode < 2; decode++) { -diff --git a/test/simple/test-stream2-basic.js b/test/simple/test-stream2-basic.js -index 3814bf0..248c1be 100644 ---- a/test/simple/test-stream2-basic.js -+++ b/test/simple/test-stream2-basic.js -@@ -21,7 +21,7 @@ - - - var common = require('../common.js'); --var R = require('_stream_readable'); -+var R = require('../../lib/_stream_readable'); - var assert = require('assert'); - - var util = require('util'); -diff --git a/test/simple/test-stream2-compatibility.js b/test/simple/test-stream2-compatibility.js -index 6cdd4e9..f0fa84b 100644 ---- a/test/simple/test-stream2-compatibility.js -+++ b/test/simple/test-stream2-compatibility.js -@@ -21,7 +21,7 @@ - - - var common = require('../common.js'); --var R = require('_stream_readable'); -+var R = require('../../lib/_stream_readable'); - var assert = require('assert'); - - var util = require('util'); -diff --git a/test/simple/test-stream2-finish-pipe.js b/test/simple/test-stream2-finish-pipe.js -index 39b274f..006a19b 100644 ---- a/test/simple/test-stream2-finish-pipe.js -+++ b/test/simple/test-stream2-finish-pipe.js -@@ -20,7 +20,7 @@ - // USE OR OTHER DEALINGS IN THE SOFTWARE. - - var common = require('../common.js'); --var stream = require('stream'); -+var stream = require('../../'); - var Buffer = require('buffer').Buffer; - - var r = new stream.Readable(); -diff --git a/test/simple/test-stream2-fs.js b/test/simple/test-stream2-fs.js -deleted file mode 100644 -index e162406..0000000 ---- a/test/simple/test-stream2-fs.js -+++ /dev/null -@@ -1,72 +0,0 @@ --// Copyright Joyent, Inc. and other Node contributors. --// --// Permission is hereby granted, free of charge, to any person obtaining a --// copy of this software and associated documentation files (the --// "Software"), to deal in the Software without restriction, including --// without limitation the rights to use, copy, modify, merge, publish, --// distribute, sublicense, and/or sell copies of the Software, and to permit --// persons to whom the Software is furnished to do so, subject to the --// following conditions: --// --// The above copyright notice and this permission notice shall be included --// in all copies or substantial portions of the Software. --// --// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS --// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF --// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN --// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, --// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR --// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE --// USE OR OTHER DEALINGS IN THE SOFTWARE. -- -- --var common = require('../common.js'); --var R = require('_stream_readable'); --var assert = require('assert'); -- --var fs = require('fs'); --var FSReadable = fs.ReadStream; -- --var path = require('path'); --var file = path.resolve(common.fixturesDir, 'x1024.txt'); -- --var size = fs.statSync(file).size; -- --var expectLengths = [1024]; -- --var util = require('util'); --var Stream = require('stream'); -- --util.inherits(TestWriter, Stream); -- --function TestWriter() { -- Stream.apply(this); -- this.buffer = []; -- this.length = 0; --} -- --TestWriter.prototype.write = function(c) { -- this.buffer.push(c.toString()); -- this.length += c.length; -- return true; --}; -- --TestWriter.prototype.end = function(c) { -- if (c) this.buffer.push(c.toString()); -- this.emit('results', this.buffer); --} -- --var r = new FSReadable(file); --var w = new TestWriter(); -- --w.on('results', function(res) { -- console.error(res, w.length); -- assert.equal(w.length, size); -- var l = 0; -- assert.deepEqual(res.map(function (c) { -- return c.length; -- }), expectLengths); -- console.log('ok'); --}); -- --r.pipe(w); -diff --git a/test/simple/test-stream2-httpclient-response-end.js b/test/simple/test-stream2-httpclient-response-end.js -deleted file mode 100644 -index 15cffc2..0000000 ---- a/test/simple/test-stream2-httpclient-response-end.js -+++ /dev/null -@@ -1,52 +0,0 @@ --// Copyright Joyent, Inc. and other Node contributors. --// --// Permission is hereby granted, free of charge, to any person obtaining a --// copy of this software and associated documentation files (the --// "Software"), to deal in the Software without restriction, including --// without limitation the rights to use, copy, modify, merge, publish, --// distribute, sublicense, and/or sell copies of the Software, and to permit --// persons to whom the Software is furnished to do so, subject to the --// following conditions: --// --// The above copyright notice and this permission notice shall be included --// in all copies or substantial portions of the Software. --// --// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS --// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF --// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN --// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, --// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR --// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE --// USE OR OTHER DEALINGS IN THE SOFTWARE. -- --var common = require('../common.js'); --var assert = require('assert'); --var http = require('http'); --var msg = 'Hello'; --var readable_event = false; --var end_event = false; --var server = http.createServer(function(req, res) { -- res.writeHead(200, {'Content-Type': 'text/plain'}); -- res.end(msg); --}).listen(common.PORT, function() { -- http.get({port: common.PORT}, function(res) { -- var data = ''; -- res.on('readable', function() { -- console.log('readable event'); -- readable_event = true; -- data += res.read(); -- }); -- res.on('end', function() { -- console.log('end event'); -- end_event = true; -- assert.strictEqual(msg, data); -- server.close(); -- }); -- }); --}); -- --process.on('exit', function() { -- assert(readable_event); -- assert(end_event); --}); -- -diff --git a/test/simple/test-stream2-large-read-stall.js b/test/simple/test-stream2-large-read-stall.js -index 2fbfbca..667985b 100644 ---- a/test/simple/test-stream2-large-read-stall.js -+++ b/test/simple/test-stream2-large-read-stall.js -@@ -30,7 +30,7 @@ var PUSHSIZE = 20; - var PUSHCOUNT = 1000; - var HWM = 50; - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - var r = new Readable({ - highWaterMark: HWM - }); -@@ -39,23 +39,23 @@ var rs = r._readableState; - r._read = push; - - r.on('readable', function() { -- console.error('>> readable'); -+ //console.error('>> readable'); - do { -- console.error(' > read(%d)', READSIZE); -+ //console.error(' > read(%d)', READSIZE); - var ret = r.read(READSIZE); -- console.error(' < %j (%d remain)', ret && ret.length, rs.length); -+ //console.error(' < %j (%d remain)', ret && ret.length, rs.length); - } while (ret && ret.length === READSIZE); - -- console.error('<< after read()', -- ret && ret.length, -- rs.needReadable, -- rs.length); -+ //console.error('<< after read()', -+ // ret && ret.length, -+ // rs.needReadable, -+ // rs.length); - }); - - var endEmitted = false; - r.on('end', function() { - endEmitted = true; -- console.error('end'); -+ //console.error('end'); - }); - - var pushes = 0; -@@ -64,11 +64,11 @@ function push() { - return; - - if (pushes++ === PUSHCOUNT) { -- console.error(' push(EOF)'); -+ //console.error(' push(EOF)'); - return r.push(null); - } - -- console.error(' push #%d', pushes); -+ //console.error(' push #%d', pushes); - if (r.push(new Buffer(PUSHSIZE))) - setTimeout(push); - } -diff --git a/test/simple/test-stream2-objects.js b/test/simple/test-stream2-objects.js -index 3e6931d..ff47d89 100644 ---- a/test/simple/test-stream2-objects.js -+++ b/test/simple/test-stream2-objects.js -@@ -21,8 +21,8 @@ - - - var common = require('../common.js'); --var Readable = require('_stream_readable'); --var Writable = require('_stream_writable'); -+var Readable = require('../../lib/_stream_readable'); -+var Writable = require('../../lib/_stream_writable'); - var assert = require('assert'); - - // tiny node-tap lookalike. -diff --git a/test/simple/test-stream2-pipe-error-handling.js b/test/simple/test-stream2-pipe-error-handling.js -index cf7531c..e3f3e4e 100644 ---- a/test/simple/test-stream2-pipe-error-handling.js -+++ b/test/simple/test-stream2-pipe-error-handling.js -@@ -21,7 +21,7 @@ - - var common = require('../common'); - var assert = require('assert'); --var stream = require('stream'); -+var stream = require('../../'); - - (function testErrorListenerCatches() { - var count = 1000; -diff --git a/test/simple/test-stream2-pipe-error-once-listener.js b/test/simple/test-stream2-pipe-error-once-listener.js -index 5e8e3cb..53b2616 100755 ---- a/test/simple/test-stream2-pipe-error-once-listener.js -+++ b/test/simple/test-stream2-pipe-error-once-listener.js -@@ -24,7 +24,7 @@ var common = require('../common.js'); - var assert = require('assert'); - - var util = require('util'); --var stream = require('stream'); -+var stream = require('../../'); - - - var Read = function() { -diff --git a/test/simple/test-stream2-push.js b/test/simple/test-stream2-push.js -index b63edc3..eb2b0e9 100644 ---- a/test/simple/test-stream2-push.js -+++ b/test/simple/test-stream2-push.js -@@ -20,7 +20,7 @@ - // USE OR OTHER DEALINGS IN THE SOFTWARE. - - var common = require('../common.js'); --var stream = require('stream'); -+var stream = require('../../'); - var Readable = stream.Readable; - var Writable = stream.Writable; - var assert = require('assert'); -diff --git a/test/simple/test-stream2-read-sync-stack.js b/test/simple/test-stream2-read-sync-stack.js -index e8a7305..9740a47 100644 ---- a/test/simple/test-stream2-read-sync-stack.js -+++ b/test/simple/test-stream2-read-sync-stack.js -@@ -21,7 +21,7 @@ - - var common = require('../common'); - var assert = require('assert'); --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - var r = new Readable(); - var N = 256 * 1024; - -diff --git a/test/simple/test-stream2-readable-empty-buffer-no-eof.js b/test/simple/test-stream2-readable-empty-buffer-no-eof.js -index cd30178..4b1659d 100644 ---- a/test/simple/test-stream2-readable-empty-buffer-no-eof.js -+++ b/test/simple/test-stream2-readable-empty-buffer-no-eof.js -@@ -22,10 +22,9 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('stream').Readable; -+var Readable = require('../../').Readable; - - test1(); --test2(); - - function test1() { - var r = new Readable(); -@@ -88,31 +87,3 @@ function test1() { - console.log('ok'); - }); - } -- --function test2() { -- var r = new Readable({ encoding: 'base64' }); -- var reads = 5; -- r._read = function(n) { -- if (!reads--) -- return r.push(null); // EOF -- else -- return r.push(new Buffer('x')); -- }; -- -- var results = []; -- function flow() { -- var chunk; -- while (null !== (chunk = r.read())) -- results.push(chunk + ''); -- } -- r.on('readable', flow); -- r.on('end', function() { -- results.push('EOF'); -- }); -- flow(); -- -- process.on('exit', function() { -- assert.deepEqual(results, [ 'eHh4', 'eHg=', 'EOF' ]); -- console.log('ok'); -- }); --} -diff --git a/test/simple/test-stream2-readable-from-list.js b/test/simple/test-stream2-readable-from-list.js -index 7c96ffe..04a96f5 100644 ---- a/test/simple/test-stream2-readable-from-list.js -+++ b/test/simple/test-stream2-readable-from-list.js -@@ -21,7 +21,7 @@ - - var assert = require('assert'); - var common = require('../common.js'); --var fromList = require('_stream_readable')._fromList; -+var fromList = require('../../lib/_stream_readable')._fromList; - - // tiny node-tap lookalike. - var tests = []; -diff --git a/test/simple/test-stream2-readable-legacy-drain.js b/test/simple/test-stream2-readable-legacy-drain.js -index 675da8e..51fd3d5 100644 ---- a/test/simple/test-stream2-readable-legacy-drain.js -+++ b/test/simple/test-stream2-readable-legacy-drain.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var Stream = require('stream'); -+var Stream = require('../../'); - var Readable = Stream.Readable; - - var r = new Readable(); -diff --git a/test/simple/test-stream2-readable-non-empty-end.js b/test/simple/test-stream2-readable-non-empty-end.js -index 7314ae7..c971898 100644 ---- a/test/simple/test-stream2-readable-non-empty-end.js -+++ b/test/simple/test-stream2-readable-non-empty-end.js -@@ -21,7 +21,7 @@ - - var assert = require('assert'); - var common = require('../common.js'); --var Readable = require('_stream_readable'); -+var Readable = require('../../lib/_stream_readable'); - - var len = 0; - var chunks = new Array(10); -diff --git a/test/simple/test-stream2-readable-wrap-empty.js b/test/simple/test-stream2-readable-wrap-empty.js -index 2e5cf25..fd8a3dc 100644 ---- a/test/simple/test-stream2-readable-wrap-empty.js -+++ b/test/simple/test-stream2-readable-wrap-empty.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('_stream_readable'); -+var Readable = require('../../lib/_stream_readable'); - var EE = require('events').EventEmitter; - - var oldStream = new EE(); -diff --git a/test/simple/test-stream2-readable-wrap.js b/test/simple/test-stream2-readable-wrap.js -index 90eea01..6b177f7 100644 ---- a/test/simple/test-stream2-readable-wrap.js -+++ b/test/simple/test-stream2-readable-wrap.js -@@ -22,8 +22,8 @@ - var common = require('../common'); - var assert = require('assert'); - --var Readable = require('_stream_readable'); --var Writable = require('_stream_writable'); -+var Readable = require('../../lib/_stream_readable'); -+var Writable = require('../../lib/_stream_writable'); - var EE = require('events').EventEmitter; - - var testRuns = 0, completedRuns = 0; -diff --git a/test/simple/test-stream2-set-encoding.js b/test/simple/test-stream2-set-encoding.js -index 5d2c32a..685531b 100644 ---- a/test/simple/test-stream2-set-encoding.js -+++ b/test/simple/test-stream2-set-encoding.js -@@ -22,7 +22,7 @@ - - var common = require('../common.js'); - var assert = require('assert'); --var R = require('_stream_readable'); -+var R = require('../../lib/_stream_readable'); - var util = require('util'); - - // tiny node-tap lookalike. -diff --git a/test/simple/test-stream2-transform.js b/test/simple/test-stream2-transform.js -index 9c9ddd8..a0cacc6 100644 ---- a/test/simple/test-stream2-transform.js -+++ b/test/simple/test-stream2-transform.js -@@ -21,8 +21,8 @@ - - var assert = require('assert'); - var common = require('../common.js'); --var PassThrough = require('_stream_passthrough'); --var Transform = require('_stream_transform'); -+var PassThrough = require('../../').PassThrough; -+var Transform = require('../../').Transform; - - // tiny node-tap lookalike. - var tests = []; -diff --git a/test/simple/test-stream2-unpipe-drain.js b/test/simple/test-stream2-unpipe-drain.js -index d66dc3c..365b327 100644 ---- a/test/simple/test-stream2-unpipe-drain.js -+++ b/test/simple/test-stream2-unpipe-drain.js -@@ -22,7 +22,7 @@ - - var common = require('../common.js'); - var assert = require('assert'); --var stream = require('stream'); -+var stream = require('../../'); - var crypto = require('crypto'); - - var util = require('util'); -diff --git a/test/simple/test-stream2-unpipe-leak.js b/test/simple/test-stream2-unpipe-leak.js -index 99f8746..17c92ae 100644 ---- a/test/simple/test-stream2-unpipe-leak.js -+++ b/test/simple/test-stream2-unpipe-leak.js -@@ -22,7 +22,7 @@ - - var common = require('../common.js'); - var assert = require('assert'); --var stream = require('stream'); -+var stream = require('../../'); - - var chunk = new Buffer('hallo'); - -diff --git a/test/simple/test-stream2-writable.js b/test/simple/test-stream2-writable.js -index 704100c..209c3a6 100644 ---- a/test/simple/test-stream2-writable.js -+++ b/test/simple/test-stream2-writable.js -@@ -20,8 +20,8 @@ - // USE OR OTHER DEALINGS IN THE SOFTWARE. - - var common = require('../common.js'); --var W = require('_stream_writable'); --var D = require('_stream_duplex'); -+var W = require('../../').Writable; -+var D = require('../../').Duplex; - var assert = require('assert'); - - var util = require('util'); -diff --git a/test/simple/test-stream3-pause-then-read.js b/test/simple/test-stream3-pause-then-read.js -index b91bde3..2f72c15 100644 ---- a/test/simple/test-stream3-pause-then-read.js -+++ b/test/simple/test-stream3-pause-then-read.js -@@ -22,7 +22,7 @@ - var common = require('../common'); - var assert = require('assert'); - --var stream = require('stream'); -+var stream = require('../../'); - var Readable = stream.Readable; - var Writable = stream.Writable; - diff --git a/node_modules/mysql/node_modules/readable-stream/lib/_stream_duplex.js b/node_modules/mysql/node_modules/readable-stream/lib/_stream_duplex.js deleted file mode 100644 index b513d61..0000000 --- a/node_modules/mysql/node_modules/readable-stream/lib/_stream_duplex.js +++ /dev/null @@ -1,89 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// a duplex stream is just a stream that is both readable and writable. -// Since JS doesn't have multiple prototypal inheritance, this class -// prototypally inherits from Readable, and then parasitically from -// Writable. - -module.exports = Duplex; - -/**/ -var objectKeys = Object.keys || function (obj) { - var keys = []; - for (var key in obj) keys.push(key); - return keys; -} -/**/ - - -/**/ -var util = require('core-util-is'); -util.inherits = require('inherits'); -/**/ - -var Readable = require('./_stream_readable'); -var Writable = require('./_stream_writable'); - -util.inherits(Duplex, Readable); - -forEach(objectKeys(Writable.prototype), function(method) { - if (!Duplex.prototype[method]) - Duplex.prototype[method] = Writable.prototype[method]; -}); - -function Duplex(options) { - if (!(this instanceof Duplex)) - return new Duplex(options); - - Readable.call(this, options); - Writable.call(this, options); - - if (options && options.readable === false) - this.readable = false; - - if (options && options.writable === false) - this.writable = false; - - this.allowHalfOpen = true; - if (options && options.allowHalfOpen === false) - this.allowHalfOpen = false; - - this.once('end', onend); -} - -// the no-half-open enforcer -function onend() { - // if we allow half-open state, or if the writable side ended, - // then we're ok. - if (this.allowHalfOpen || this._writableState.ended) - return; - - // no more data can be written. - // But allow more writes to happen in this tick. - process.nextTick(this.end.bind(this)); -} - -function forEach (xs, f) { - for (var i = 0, l = xs.length; i < l; i++) { - f(xs[i], i); - } -} diff --git a/node_modules/mysql/node_modules/readable-stream/lib/_stream_passthrough.js b/node_modules/mysql/node_modules/readable-stream/lib/_stream_passthrough.js deleted file mode 100644 index 895ca50..0000000 --- a/node_modules/mysql/node_modules/readable-stream/lib/_stream_passthrough.js +++ /dev/null @@ -1,46 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// a passthrough stream. -// basically just the most minimal sort of Transform stream. -// Every written chunk gets output as-is. - -module.exports = PassThrough; - -var Transform = require('./_stream_transform'); - -/**/ -var util = require('core-util-is'); -util.inherits = require('inherits'); -/**/ - -util.inherits(PassThrough, Transform); - -function PassThrough(options) { - if (!(this instanceof PassThrough)) - return new PassThrough(options); - - Transform.call(this, options); -} - -PassThrough.prototype._transform = function(chunk, encoding, cb) { - cb(null, chunk); -}; diff --git a/node_modules/mysql/node_modules/readable-stream/lib/_stream_readable.js b/node_modules/mysql/node_modules/readable-stream/lib/_stream_readable.js deleted file mode 100644 index 19ab358..0000000 --- a/node_modules/mysql/node_modules/readable-stream/lib/_stream_readable.js +++ /dev/null @@ -1,951 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -module.exports = Readable; - -/**/ -var isArray = require('isarray'); -/**/ - - -/**/ -var Buffer = require('buffer').Buffer; -/**/ - -Readable.ReadableState = ReadableState; - -var EE = require('events').EventEmitter; - -/**/ -if (!EE.listenerCount) EE.listenerCount = function(emitter, type) { - return emitter.listeners(type).length; -}; -/**/ - -var Stream = require('stream'); - -/**/ -var util = require('core-util-is'); -util.inherits = require('inherits'); -/**/ - -var StringDecoder; - - -/**/ -var debug = require('util'); -if (debug && debug.debuglog) { - debug = debug.debuglog('stream'); -} else { - debug = function () {}; -} -/**/ - - -util.inherits(Readable, Stream); - -function ReadableState(options, stream) { - var Duplex = require('./_stream_duplex'); - - options = options || {}; - - // the point at which it stops calling _read() to fill the buffer - // Note: 0 is a valid value, means "don't call _read preemptively ever" - var hwm = options.highWaterMark; - var defaultHwm = options.objectMode ? 16 : 16 * 1024; - this.highWaterMark = (hwm || hwm === 0) ? hwm : defaultHwm; - - // cast to ints. - this.highWaterMark = ~~this.highWaterMark; - - this.buffer = []; - this.length = 0; - this.pipes = null; - this.pipesCount = 0; - this.flowing = null; - this.ended = false; - this.endEmitted = false; - this.reading = false; - - // a flag to be able to tell if the onwrite cb is called immediately, - // or on a later tick. We set this to true at first, because any - // actions that shouldn't happen until "later" should generally also - // not happen before the first write call. - this.sync = true; - - // whenever we return null, then we set a flag to say - // that we're awaiting a 'readable' event emission. - this.needReadable = false; - this.emittedReadable = false; - this.readableListening = false; - - - // object stream flag. Used to make read(n) ignore n and to - // make all the buffer merging and length checks go away - this.objectMode = !!options.objectMode; - - if (stream instanceof Duplex) - this.objectMode = this.objectMode || !!options.readableObjectMode; - - // Crypto is kind of old and crusty. Historically, its default string - // encoding is 'binary' so we have to make this configurable. - // Everything else in the universe uses 'utf8', though. - this.defaultEncoding = options.defaultEncoding || 'utf8'; - - // when piping, we only care about 'readable' events that happen - // after read()ing all the bytes and not getting any pushback. - this.ranOut = false; - - // the number of writers that are awaiting a drain event in .pipe()s - this.awaitDrain = 0; - - // if true, a maybeReadMore has been scheduled - this.readingMore = false; - - this.decoder = null; - this.encoding = null; - if (options.encoding) { - if (!StringDecoder) - StringDecoder = require('string_decoder/').StringDecoder; - this.decoder = new StringDecoder(options.encoding); - this.encoding = options.encoding; - } -} - -function Readable(options) { - var Duplex = require('./_stream_duplex'); - - if (!(this instanceof Readable)) - return new Readable(options); - - this._readableState = new ReadableState(options, this); - - // legacy - this.readable = true; - - Stream.call(this); -} - -// Manually shove something into the read() buffer. -// This returns true if the highWaterMark has not been hit yet, -// similar to how Writable.write() returns true if you should -// write() some more. -Readable.prototype.push = function(chunk, encoding) { - var state = this._readableState; - - if (util.isString(chunk) && !state.objectMode) { - encoding = encoding || state.defaultEncoding; - if (encoding !== state.encoding) { - chunk = new Buffer(chunk, encoding); - encoding = ''; - } - } - - return readableAddChunk(this, state, chunk, encoding, false); -}; - -// Unshift should *always* be something directly out of read() -Readable.prototype.unshift = function(chunk) { - var state = this._readableState; - return readableAddChunk(this, state, chunk, '', true); -}; - -function readableAddChunk(stream, state, chunk, encoding, addToFront) { - var er = chunkInvalid(state, chunk); - if (er) { - stream.emit('error', er); - } else if (util.isNullOrUndefined(chunk)) { - state.reading = false; - if (!state.ended) - onEofChunk(stream, state); - } else if (state.objectMode || chunk && chunk.length > 0) { - if (state.ended && !addToFront) { - var e = new Error('stream.push() after EOF'); - stream.emit('error', e); - } else if (state.endEmitted && addToFront) { - var e = new Error('stream.unshift() after end event'); - stream.emit('error', e); - } else { - if (state.decoder && !addToFront && !encoding) - chunk = state.decoder.write(chunk); - - if (!addToFront) - state.reading = false; - - // if we want the data now, just emit it. - if (state.flowing && state.length === 0 && !state.sync) { - stream.emit('data', chunk); - stream.read(0); - } else { - // update the buffer info. - state.length += state.objectMode ? 1 : chunk.length; - if (addToFront) - state.buffer.unshift(chunk); - else - state.buffer.push(chunk); - - if (state.needReadable) - emitReadable(stream); - } - - maybeReadMore(stream, state); - } - } else if (!addToFront) { - state.reading = false; - } - - return needMoreData(state); -} - - - -// if it's past the high water mark, we can push in some more. -// Also, if we have no data yet, we can stand some -// more bytes. This is to work around cases where hwm=0, -// such as the repl. Also, if the push() triggered a -// readable event, and the user called read(largeNumber) such that -// needReadable was set, then we ought to push more, so that another -// 'readable' event will be triggered. -function needMoreData(state) { - return !state.ended && - (state.needReadable || - state.length < state.highWaterMark || - state.length === 0); -} - -// backwards compatibility. -Readable.prototype.setEncoding = function(enc) { - if (!StringDecoder) - StringDecoder = require('string_decoder/').StringDecoder; - this._readableState.decoder = new StringDecoder(enc); - this._readableState.encoding = enc; - return this; -}; - -// Don't raise the hwm > 128MB -var MAX_HWM = 0x800000; -function roundUpToNextPowerOf2(n) { - if (n >= MAX_HWM) { - n = MAX_HWM; - } else { - // Get the next highest power of 2 - n--; - for (var p = 1; p < 32; p <<= 1) n |= n >> p; - n++; - } - return n; -} - -function howMuchToRead(n, state) { - if (state.length === 0 && state.ended) - return 0; - - if (state.objectMode) - return n === 0 ? 0 : 1; - - if (isNaN(n) || util.isNull(n)) { - // only flow one buffer at a time - if (state.flowing && state.buffer.length) - return state.buffer[0].length; - else - return state.length; - } - - if (n <= 0) - return 0; - - // If we're asking for more than the target buffer level, - // then raise the water mark. Bump up to the next highest - // power of 2, to prevent increasing it excessively in tiny - // amounts. - if (n > state.highWaterMark) - state.highWaterMark = roundUpToNextPowerOf2(n); - - // don't have that much. return null, unless we've ended. - if (n > state.length) { - if (!state.ended) { - state.needReadable = true; - return 0; - } else - return state.length; - } - - return n; -} - -// you can override either this method, or the async _read(n) below. -Readable.prototype.read = function(n) { - debug('read', n); - var state = this._readableState; - var nOrig = n; - - if (!util.isNumber(n) || n > 0) - state.emittedReadable = false; - - // if we're doing read(0) to trigger a readable event, but we - // already have a bunch of data in the buffer, then just trigger - // the 'readable' event and move on. - if (n === 0 && - state.needReadable && - (state.length >= state.highWaterMark || state.ended)) { - debug('read: emitReadable', state.length, state.ended); - if (state.length === 0 && state.ended) - endReadable(this); - else - emitReadable(this); - return null; - } - - n = howMuchToRead(n, state); - - // if we've ended, and we're now clear, then finish it up. - if (n === 0 && state.ended) { - if (state.length === 0) - endReadable(this); - return null; - } - - // All the actual chunk generation logic needs to be - // *below* the call to _read. The reason is that in certain - // synthetic stream cases, such as passthrough streams, _read - // may be a completely synchronous operation which may change - // the state of the read buffer, providing enough data when - // before there was *not* enough. - // - // So, the steps are: - // 1. Figure out what the state of things will be after we do - // a read from the buffer. - // - // 2. If that resulting state will trigger a _read, then call _read. - // Note that this may be asynchronous, or synchronous. Yes, it is - // deeply ugly to write APIs this way, but that still doesn't mean - // that the Readable class should behave improperly, as streams are - // designed to be sync/async agnostic. - // Take note if the _read call is sync or async (ie, if the read call - // has returned yet), so that we know whether or not it's safe to emit - // 'readable' etc. - // - // 3. Actually pull the requested chunks out of the buffer and return. - - // if we need a readable event, then we need to do some reading. - var doRead = state.needReadable; - debug('need readable', doRead); - - // if we currently have less than the highWaterMark, then also read some - if (state.length === 0 || state.length - n < state.highWaterMark) { - doRead = true; - debug('length less than watermark', doRead); - } - - // however, if we've ended, then there's no point, and if we're already - // reading, then it's unnecessary. - if (state.ended || state.reading) { - doRead = false; - debug('reading or ended', doRead); - } - - if (doRead) { - debug('do read'); - state.reading = true; - state.sync = true; - // if the length is currently zero, then we *need* a readable event. - if (state.length === 0) - state.needReadable = true; - // call internal read method - this._read(state.highWaterMark); - state.sync = false; - } - - // If _read pushed data synchronously, then `reading` will be false, - // and we need to re-evaluate how much data we can return to the user. - if (doRead && !state.reading) - n = howMuchToRead(nOrig, state); - - var ret; - if (n > 0) - ret = fromList(n, state); - else - ret = null; - - if (util.isNull(ret)) { - state.needReadable = true; - n = 0; - } - - state.length -= n; - - // If we have nothing in the buffer, then we want to know - // as soon as we *do* get something into the buffer. - if (state.length === 0 && !state.ended) - state.needReadable = true; - - // If we tried to read() past the EOF, then emit end on the next tick. - if (nOrig !== n && state.ended && state.length === 0) - endReadable(this); - - if (!util.isNull(ret)) - this.emit('data', ret); - - return ret; -}; - -function chunkInvalid(state, chunk) { - var er = null; - if (!util.isBuffer(chunk) && - !util.isString(chunk) && - !util.isNullOrUndefined(chunk) && - !state.objectMode) { - er = new TypeError('Invalid non-string/buffer chunk'); - } - return er; -} - - -function onEofChunk(stream, state) { - if (state.decoder && !state.ended) { - var chunk = state.decoder.end(); - if (chunk && chunk.length) { - state.buffer.push(chunk); - state.length += state.objectMode ? 1 : chunk.length; - } - } - state.ended = true; - - // emit 'readable' now to make sure it gets picked up. - emitReadable(stream); -} - -// Don't emit readable right away in sync mode, because this can trigger -// another read() call => stack overflow. This way, it might trigger -// a nextTick recursion warning, but that's not so bad. -function emitReadable(stream) { - var state = stream._readableState; - state.needReadable = false; - if (!state.emittedReadable) { - debug('emitReadable', state.flowing); - state.emittedReadable = true; - if (state.sync) - process.nextTick(function() { - emitReadable_(stream); - }); - else - emitReadable_(stream); - } -} - -function emitReadable_(stream) { - debug('emit readable'); - stream.emit('readable'); - flow(stream); -} - - -// at this point, the user has presumably seen the 'readable' event, -// and called read() to consume some data. that may have triggered -// in turn another _read(n) call, in which case reading = true if -// it's in progress. -// However, if we're not ended, or reading, and the length < hwm, -// then go ahead and try to read some more preemptively. -function maybeReadMore(stream, state) { - if (!state.readingMore) { - state.readingMore = true; - process.nextTick(function() { - maybeReadMore_(stream, state); - }); - } -} - -function maybeReadMore_(stream, state) { - var len = state.length; - while (!state.reading && !state.flowing && !state.ended && - state.length < state.highWaterMark) { - debug('maybeReadMore read 0'); - stream.read(0); - if (len === state.length) - // didn't get any data, stop spinning. - break; - else - len = state.length; - } - state.readingMore = false; -} - -// abstract method. to be overridden in specific implementation classes. -// call cb(er, data) where data is <= n in length. -// for virtual (non-string, non-buffer) streams, "length" is somewhat -// arbitrary, and perhaps not very meaningful. -Readable.prototype._read = function(n) { - this.emit('error', new Error('not implemented')); -}; - -Readable.prototype.pipe = function(dest, pipeOpts) { - var src = this; - var state = this._readableState; - - switch (state.pipesCount) { - case 0: - state.pipes = dest; - break; - case 1: - state.pipes = [state.pipes, dest]; - break; - default: - state.pipes.push(dest); - break; - } - state.pipesCount += 1; - debug('pipe count=%d opts=%j', state.pipesCount, pipeOpts); - - var doEnd = (!pipeOpts || pipeOpts.end !== false) && - dest !== process.stdout && - dest !== process.stderr; - - var endFn = doEnd ? onend : cleanup; - if (state.endEmitted) - process.nextTick(endFn); - else - src.once('end', endFn); - - dest.on('unpipe', onunpipe); - function onunpipe(readable) { - debug('onunpipe'); - if (readable === src) { - cleanup(); - } - } - - function onend() { - debug('onend'); - dest.end(); - } - - // when the dest drains, it reduces the awaitDrain counter - // on the source. This would be more elegant with a .once() - // handler in flow(), but adding and removing repeatedly is - // too slow. - var ondrain = pipeOnDrain(src); - dest.on('drain', ondrain); - - function cleanup() { - debug('cleanup'); - // cleanup event handlers once the pipe is broken - dest.removeListener('close', onclose); - dest.removeListener('finish', onfinish); - dest.removeListener('drain', ondrain); - dest.removeListener('error', onerror); - dest.removeListener('unpipe', onunpipe); - src.removeListener('end', onend); - src.removeListener('end', cleanup); - src.removeListener('data', ondata); - - // if the reader is waiting for a drain event from this - // specific writer, then it would cause it to never start - // flowing again. - // So, if this is awaiting a drain, then we just call it now. - // If we don't know, then assume that we are waiting for one. - if (state.awaitDrain && - (!dest._writableState || dest._writableState.needDrain)) - ondrain(); - } - - src.on('data', ondata); - function ondata(chunk) { - debug('ondata'); - var ret = dest.write(chunk); - if (false === ret) { - debug('false write response, pause', - src._readableState.awaitDrain); - src._readableState.awaitDrain++; - src.pause(); - } - } - - // if the dest has an error, then stop piping into it. - // however, don't suppress the throwing behavior for this. - function onerror(er) { - debug('onerror', er); - unpipe(); - dest.removeListener('error', onerror); - if (EE.listenerCount(dest, 'error') === 0) - dest.emit('error', er); - } - // This is a brutally ugly hack to make sure that our error handler - // is attached before any userland ones. NEVER DO THIS. - if (!dest._events || !dest._events.error) - dest.on('error', onerror); - else if (isArray(dest._events.error)) - dest._events.error.unshift(onerror); - else - dest._events.error = [onerror, dest._events.error]; - - - - // Both close and finish should trigger unpipe, but only once. - function onclose() { - dest.removeListener('finish', onfinish); - unpipe(); - } - dest.once('close', onclose); - function onfinish() { - debug('onfinish'); - dest.removeListener('close', onclose); - unpipe(); - } - dest.once('finish', onfinish); - - function unpipe() { - debug('unpipe'); - src.unpipe(dest); - } - - // tell the dest that it's being piped to - dest.emit('pipe', src); - - // start the flow if it hasn't been started already. - if (!state.flowing) { - debug('pipe resume'); - src.resume(); - } - - return dest; -}; - -function pipeOnDrain(src) { - return function() { - var state = src._readableState; - debug('pipeOnDrain', state.awaitDrain); - if (state.awaitDrain) - state.awaitDrain--; - if (state.awaitDrain === 0 && EE.listenerCount(src, 'data')) { - state.flowing = true; - flow(src); - } - }; -} - - -Readable.prototype.unpipe = function(dest) { - var state = this._readableState; - - // if we're not piping anywhere, then do nothing. - if (state.pipesCount === 0) - return this; - - // just one destination. most common case. - if (state.pipesCount === 1) { - // passed in one, but it's not the right one. - if (dest && dest !== state.pipes) - return this; - - if (!dest) - dest = state.pipes; - - // got a match. - state.pipes = null; - state.pipesCount = 0; - state.flowing = false; - if (dest) - dest.emit('unpipe', this); - return this; - } - - // slow case. multiple pipe destinations. - - if (!dest) { - // remove all. - var dests = state.pipes; - var len = state.pipesCount; - state.pipes = null; - state.pipesCount = 0; - state.flowing = false; - - for (var i = 0; i < len; i++) - dests[i].emit('unpipe', this); - return this; - } - - // try to find the right one. - var i = indexOf(state.pipes, dest); - if (i === -1) - return this; - - state.pipes.splice(i, 1); - state.pipesCount -= 1; - if (state.pipesCount === 1) - state.pipes = state.pipes[0]; - - dest.emit('unpipe', this); - - return this; -}; - -// set up data events if they are asked for -// Ensure readable listeners eventually get something -Readable.prototype.on = function(ev, fn) { - var res = Stream.prototype.on.call(this, ev, fn); - - // If listening to data, and it has not explicitly been paused, - // then call resume to start the flow of data on the next tick. - if (ev === 'data' && false !== this._readableState.flowing) { - this.resume(); - } - - if (ev === 'readable' && this.readable) { - var state = this._readableState; - if (!state.readableListening) { - state.readableListening = true; - state.emittedReadable = false; - state.needReadable = true; - if (!state.reading) { - var self = this; - process.nextTick(function() { - debug('readable nexttick read 0'); - self.read(0); - }); - } else if (state.length) { - emitReadable(this, state); - } - } - } - - return res; -}; -Readable.prototype.addListener = Readable.prototype.on; - -// pause() and resume() are remnants of the legacy readable stream API -// If the user uses them, then switch into old mode. -Readable.prototype.resume = function() { - var state = this._readableState; - if (!state.flowing) { - debug('resume'); - state.flowing = true; - if (!state.reading) { - debug('resume read 0'); - this.read(0); - } - resume(this, state); - } - return this; -}; - -function resume(stream, state) { - if (!state.resumeScheduled) { - state.resumeScheduled = true; - process.nextTick(function() { - resume_(stream, state); - }); - } -} - -function resume_(stream, state) { - state.resumeScheduled = false; - stream.emit('resume'); - flow(stream); - if (state.flowing && !state.reading) - stream.read(0); -} - -Readable.prototype.pause = function() { - debug('call pause flowing=%j', this._readableState.flowing); - if (false !== this._readableState.flowing) { - debug('pause'); - this._readableState.flowing = false; - this.emit('pause'); - } - return this; -}; - -function flow(stream) { - var state = stream._readableState; - debug('flow', state.flowing); - if (state.flowing) { - do { - var chunk = stream.read(); - } while (null !== chunk && state.flowing); - } -} - -// wrap an old-style stream as the async data source. -// This is *not* part of the readable stream interface. -// It is an ugly unfortunate mess of history. -Readable.prototype.wrap = function(stream) { - var state = this._readableState; - var paused = false; - - var self = this; - stream.on('end', function() { - debug('wrapped end'); - if (state.decoder && !state.ended) { - var chunk = state.decoder.end(); - if (chunk && chunk.length) - self.push(chunk); - } - - self.push(null); - }); - - stream.on('data', function(chunk) { - debug('wrapped data'); - if (state.decoder) - chunk = state.decoder.write(chunk); - if (!chunk || !state.objectMode && !chunk.length) - return; - - var ret = self.push(chunk); - if (!ret) { - paused = true; - stream.pause(); - } - }); - - // proxy all the other methods. - // important when wrapping filters and duplexes. - for (var i in stream) { - if (util.isFunction(stream[i]) && util.isUndefined(this[i])) { - this[i] = function(method) { return function() { - return stream[method].apply(stream, arguments); - }}(i); - } - } - - // proxy certain important events. - var events = ['error', 'close', 'destroy', 'pause', 'resume']; - forEach(events, function(ev) { - stream.on(ev, self.emit.bind(self, ev)); - }); - - // when we try to consume some more bytes, simply unpause the - // underlying stream. - self._read = function(n) { - debug('wrapped _read', n); - if (paused) { - paused = false; - stream.resume(); - } - }; - - return self; -}; - - - -// exposed for testing purposes only. -Readable._fromList = fromList; - -// Pluck off n bytes from an array of buffers. -// Length is the combined lengths of all the buffers in the list. -function fromList(n, state) { - var list = state.buffer; - var length = state.length; - var stringMode = !!state.decoder; - var objectMode = !!state.objectMode; - var ret; - - // nothing in the list, definitely empty. - if (list.length === 0) - return null; - - if (length === 0) - ret = null; - else if (objectMode) - ret = list.shift(); - else if (!n || n >= length) { - // read it all, truncate the array. - if (stringMode) - ret = list.join(''); - else - ret = Buffer.concat(list, length); - list.length = 0; - } else { - // read just some of it. - if (n < list[0].length) { - // just take a part of the first list item. - // slice is the same for buffers and strings. - var buf = list[0]; - ret = buf.slice(0, n); - list[0] = buf.slice(n); - } else if (n === list[0].length) { - // first list is a perfect match - ret = list.shift(); - } else { - // complex case. - // we have enough to cover it, but it spans past the first buffer. - if (stringMode) - ret = ''; - else - ret = new Buffer(n); - - var c = 0; - for (var i = 0, l = list.length; i < l && c < n; i++) { - var buf = list[0]; - var cpy = Math.min(n - c, buf.length); - - if (stringMode) - ret += buf.slice(0, cpy); - else - buf.copy(ret, c, 0, cpy); - - if (cpy < buf.length) - list[0] = buf.slice(cpy); - else - list.shift(); - - c += cpy; - } - } - } - - return ret; -} - -function endReadable(stream) { - var state = stream._readableState; - - // If we get here before consuming all the bytes, then that is a - // bug in node. Should never happen. - if (state.length > 0) - throw new Error('endReadable called on non-empty stream'); - - if (!state.endEmitted) { - state.ended = true; - process.nextTick(function() { - // Check that we didn't get one last unshift. - if (!state.endEmitted && state.length === 0) { - state.endEmitted = true; - stream.readable = false; - stream.emit('end'); - } - }); - } -} - -function forEach (xs, f) { - for (var i = 0, l = xs.length; i < l; i++) { - f(xs[i], i); - } -} - -function indexOf (xs, x) { - for (var i = 0, l = xs.length; i < l; i++) { - if (xs[i] === x) return i; - } - return -1; -} diff --git a/node_modules/mysql/node_modules/readable-stream/lib/_stream_transform.js b/node_modules/mysql/node_modules/readable-stream/lib/_stream_transform.js deleted file mode 100644 index 905c5e4..0000000 --- a/node_modules/mysql/node_modules/readable-stream/lib/_stream_transform.js +++ /dev/null @@ -1,209 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - - -// a transform stream is a readable/writable stream where you do -// something with the data. Sometimes it's called a "filter", -// but that's not a great name for it, since that implies a thing where -// some bits pass through, and others are simply ignored. (That would -// be a valid example of a transform, of course.) -// -// While the output is causally related to the input, it's not a -// necessarily symmetric or synchronous transformation. For example, -// a zlib stream might take multiple plain-text writes(), and then -// emit a single compressed chunk some time in the future. -// -// Here's how this works: -// -// The Transform stream has all the aspects of the readable and writable -// stream classes. When you write(chunk), that calls _write(chunk,cb) -// internally, and returns false if there's a lot of pending writes -// buffered up. When you call read(), that calls _read(n) until -// there's enough pending readable data buffered up. -// -// In a transform stream, the written data is placed in a buffer. When -// _read(n) is called, it transforms the queued up data, calling the -// buffered _write cb's as it consumes chunks. If consuming a single -// written chunk would result in multiple output chunks, then the first -// outputted bit calls the readcb, and subsequent chunks just go into -// the read buffer, and will cause it to emit 'readable' if necessary. -// -// This way, back-pressure is actually determined by the reading side, -// since _read has to be called to start processing a new chunk. However, -// a pathological inflate type of transform can cause excessive buffering -// here. For example, imagine a stream where every byte of input is -// interpreted as an integer from 0-255, and then results in that many -// bytes of output. Writing the 4 bytes {ff,ff,ff,ff} would result in -// 1kb of data being output. In this case, you could write a very small -// amount of input, and end up with a very large amount of output. In -// such a pathological inflating mechanism, there'd be no way to tell -// the system to stop doing the transform. A single 4MB write could -// cause the system to run out of memory. -// -// However, even in such a pathological case, only a single written chunk -// would be consumed, and then the rest would wait (un-transformed) until -// the results of the previous transformed chunk were consumed. - -module.exports = Transform; - -var Duplex = require('./_stream_duplex'); - -/**/ -var util = require('core-util-is'); -util.inherits = require('inherits'); -/**/ - -util.inherits(Transform, Duplex); - - -function TransformState(options, stream) { - this.afterTransform = function(er, data) { - return afterTransform(stream, er, data); - }; - - this.needTransform = false; - this.transforming = false; - this.writecb = null; - this.writechunk = null; -} - -function afterTransform(stream, er, data) { - var ts = stream._transformState; - ts.transforming = false; - - var cb = ts.writecb; - - if (!cb) - return stream.emit('error', new Error('no writecb in Transform class')); - - ts.writechunk = null; - ts.writecb = null; - - if (!util.isNullOrUndefined(data)) - stream.push(data); - - if (cb) - cb(er); - - var rs = stream._readableState; - rs.reading = false; - if (rs.needReadable || rs.length < rs.highWaterMark) { - stream._read(rs.highWaterMark); - } -} - - -function Transform(options) { - if (!(this instanceof Transform)) - return new Transform(options); - - Duplex.call(this, options); - - this._transformState = new TransformState(options, this); - - // when the writable side finishes, then flush out anything remaining. - var stream = this; - - // start out asking for a readable event once data is transformed. - this._readableState.needReadable = true; - - // we have implemented the _read method, and done the other things - // that Readable wants before the first _read call, so unset the - // sync guard flag. - this._readableState.sync = false; - - this.once('prefinish', function() { - if (util.isFunction(this._flush)) - this._flush(function(er) { - done(stream, er); - }); - else - done(stream); - }); -} - -Transform.prototype.push = function(chunk, encoding) { - this._transformState.needTransform = false; - return Duplex.prototype.push.call(this, chunk, encoding); -}; - -// This is the part where you do stuff! -// override this function in implementation classes. -// 'chunk' is an input chunk. -// -// Call `push(newChunk)` to pass along transformed output -// to the readable side. You may call 'push' zero or more times. -// -// Call `cb(err)` when you are done with this chunk. If you pass -// an error, then that'll put the hurt on the whole operation. If you -// never call cb(), then you'll never get another chunk. -Transform.prototype._transform = function(chunk, encoding, cb) { - throw new Error('not implemented'); -}; - -Transform.prototype._write = function(chunk, encoding, cb) { - var ts = this._transformState; - ts.writecb = cb; - ts.writechunk = chunk; - ts.writeencoding = encoding; - if (!ts.transforming) { - var rs = this._readableState; - if (ts.needTransform || - rs.needReadable || - rs.length < rs.highWaterMark) - this._read(rs.highWaterMark); - } -}; - -// Doesn't matter what the args are here. -// _transform does all the work. -// That we got here means that the readable side wants more data. -Transform.prototype._read = function(n) { - var ts = this._transformState; - - if (!util.isNull(ts.writechunk) && ts.writecb && !ts.transforming) { - ts.transforming = true; - this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform); - } else { - // mark that we need a transform, so that any data that comes in - // will get processed, now that we've asked for it. - ts.needTransform = true; - } -}; - - -function done(stream, er) { - if (er) - return stream.emit('error', er); - - // if there's nothing in the write buffer, then that means - // that nothing more will ever be provided - var ws = stream._writableState; - var ts = stream._transformState; - - if (ws.length) - throw new Error('calling transform done when ws.length != 0'); - - if (ts.transforming) - throw new Error('calling transform done when still transforming'); - - return stream.push(null); -} diff --git a/node_modules/mysql/node_modules/readable-stream/lib/_stream_writable.js b/node_modules/mysql/node_modules/readable-stream/lib/_stream_writable.js deleted file mode 100644 index db8539c..0000000 --- a/node_modules/mysql/node_modules/readable-stream/lib/_stream_writable.js +++ /dev/null @@ -1,477 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// A bit simpler than readable streams. -// Implement an async ._write(chunk, cb), and it'll handle all -// the drain event emission and buffering. - -module.exports = Writable; - -/**/ -var Buffer = require('buffer').Buffer; -/**/ - -Writable.WritableState = WritableState; - - -/**/ -var util = require('core-util-is'); -util.inherits = require('inherits'); -/**/ - -var Stream = require('stream'); - -util.inherits(Writable, Stream); - -function WriteReq(chunk, encoding, cb) { - this.chunk = chunk; - this.encoding = encoding; - this.callback = cb; -} - -function WritableState(options, stream) { - var Duplex = require('./_stream_duplex'); - - options = options || {}; - - // the point at which write() starts returning false - // Note: 0 is a valid value, means that we always return false if - // the entire buffer is not flushed immediately on write() - var hwm = options.highWaterMark; - var defaultHwm = options.objectMode ? 16 : 16 * 1024; - this.highWaterMark = (hwm || hwm === 0) ? hwm : defaultHwm; - - // object stream flag to indicate whether or not this stream - // contains buffers or objects. - this.objectMode = !!options.objectMode; - - if (stream instanceof Duplex) - this.objectMode = this.objectMode || !!options.writableObjectMode; - - // cast to ints. - this.highWaterMark = ~~this.highWaterMark; - - this.needDrain = false; - // at the start of calling end() - this.ending = false; - // when end() has been called, and returned - this.ended = false; - // when 'finish' is emitted - this.finished = false; - - // should we decode strings into buffers before passing to _write? - // this is here so that some node-core streams can optimize string - // handling at a lower level. - var noDecode = options.decodeStrings === false; - this.decodeStrings = !noDecode; - - // Crypto is kind of old and crusty. Historically, its default string - // encoding is 'binary' so we have to make this configurable. - // Everything else in the universe uses 'utf8', though. - this.defaultEncoding = options.defaultEncoding || 'utf8'; - - // not an actual buffer we keep track of, but a measurement - // of how much we're waiting to get pushed to some underlying - // socket or file. - this.length = 0; - - // a flag to see when we're in the middle of a write. - this.writing = false; - - // when true all writes will be buffered until .uncork() call - this.corked = 0; - - // a flag to be able to tell if the onwrite cb is called immediately, - // or on a later tick. We set this to true at first, because any - // actions that shouldn't happen until "later" should generally also - // not happen before the first write call. - this.sync = true; - - // a flag to know if we're processing previously buffered items, which - // may call the _write() callback in the same tick, so that we don't - // end up in an overlapped onwrite situation. - this.bufferProcessing = false; - - // the callback that's passed to _write(chunk,cb) - this.onwrite = function(er) { - onwrite(stream, er); - }; - - // the callback that the user supplies to write(chunk,encoding,cb) - this.writecb = null; - - // the amount that is being written when _write is called. - this.writelen = 0; - - this.buffer = []; - - // number of pending user-supplied write callbacks - // this must be 0 before 'finish' can be emitted - this.pendingcb = 0; - - // emit prefinish if the only thing we're waiting for is _write cbs - // This is relevant for synchronous Transform streams - this.prefinished = false; - - // True if the error was already emitted and should not be thrown again - this.errorEmitted = false; -} - -function Writable(options) { - var Duplex = require('./_stream_duplex'); - - // Writable ctor is applied to Duplexes, though they're not - // instanceof Writable, they're instanceof Readable. - if (!(this instanceof Writable) && !(this instanceof Duplex)) - return new Writable(options); - - this._writableState = new WritableState(options, this); - - // legacy. - this.writable = true; - - Stream.call(this); -} - -// Otherwise people can pipe Writable streams, which is just wrong. -Writable.prototype.pipe = function() { - this.emit('error', new Error('Cannot pipe. Not readable.')); -}; - - -function writeAfterEnd(stream, state, cb) { - var er = new Error('write after end'); - // TODO: defer error events consistently everywhere, not just the cb - stream.emit('error', er); - process.nextTick(function() { - cb(er); - }); -} - -// If we get something that is not a buffer, string, null, or undefined, -// and we're not in objectMode, then that's an error. -// Otherwise stream chunks are all considered to be of length=1, and the -// watermarks determine how many objects to keep in the buffer, rather than -// how many bytes or characters. -function validChunk(stream, state, chunk, cb) { - var valid = true; - if (!util.isBuffer(chunk) && - !util.isString(chunk) && - !util.isNullOrUndefined(chunk) && - !state.objectMode) { - var er = new TypeError('Invalid non-string/buffer chunk'); - stream.emit('error', er); - process.nextTick(function() { - cb(er); - }); - valid = false; - } - return valid; -} - -Writable.prototype.write = function(chunk, encoding, cb) { - var state = this._writableState; - var ret = false; - - if (util.isFunction(encoding)) { - cb = encoding; - encoding = null; - } - - if (util.isBuffer(chunk)) - encoding = 'buffer'; - else if (!encoding) - encoding = state.defaultEncoding; - - if (!util.isFunction(cb)) - cb = function() {}; - - if (state.ended) - writeAfterEnd(this, state, cb); - else if (validChunk(this, state, chunk, cb)) { - state.pendingcb++; - ret = writeOrBuffer(this, state, chunk, encoding, cb); - } - - return ret; -}; - -Writable.prototype.cork = function() { - var state = this._writableState; - - state.corked++; -}; - -Writable.prototype.uncork = function() { - var state = this._writableState; - - if (state.corked) { - state.corked--; - - if (!state.writing && - !state.corked && - !state.finished && - !state.bufferProcessing && - state.buffer.length) - clearBuffer(this, state); - } -}; - -function decodeChunk(state, chunk, encoding) { - if (!state.objectMode && - state.decodeStrings !== false && - util.isString(chunk)) { - chunk = new Buffer(chunk, encoding); - } - return chunk; -} - -// if we're already writing something, then just put this -// in the queue, and wait our turn. Otherwise, call _write -// If we return false, then we need a drain event, so set that flag. -function writeOrBuffer(stream, state, chunk, encoding, cb) { - chunk = decodeChunk(state, chunk, encoding); - if (util.isBuffer(chunk)) - encoding = 'buffer'; - var len = state.objectMode ? 1 : chunk.length; - - state.length += len; - - var ret = state.length < state.highWaterMark; - // we must ensure that previous needDrain will not be reset to false. - if (!ret) - state.needDrain = true; - - if (state.writing || state.corked) - state.buffer.push(new WriteReq(chunk, encoding, cb)); - else - doWrite(stream, state, false, len, chunk, encoding, cb); - - return ret; -} - -function doWrite(stream, state, writev, len, chunk, encoding, cb) { - state.writelen = len; - state.writecb = cb; - state.writing = true; - state.sync = true; - if (writev) - stream._writev(chunk, state.onwrite); - else - stream._write(chunk, encoding, state.onwrite); - state.sync = false; -} - -function onwriteError(stream, state, sync, er, cb) { - if (sync) - process.nextTick(function() { - state.pendingcb--; - cb(er); - }); - else { - state.pendingcb--; - cb(er); - } - - stream._writableState.errorEmitted = true; - stream.emit('error', er); -} - -function onwriteStateUpdate(state) { - state.writing = false; - state.writecb = null; - state.length -= state.writelen; - state.writelen = 0; -} - -function onwrite(stream, er) { - var state = stream._writableState; - var sync = state.sync; - var cb = state.writecb; - - onwriteStateUpdate(state); - - if (er) - onwriteError(stream, state, sync, er, cb); - else { - // Check if we're actually ready to finish, but don't emit yet - var finished = needFinish(stream, state); - - if (!finished && - !state.corked && - !state.bufferProcessing && - state.buffer.length) { - clearBuffer(stream, state); - } - - if (sync) { - process.nextTick(function() { - afterWrite(stream, state, finished, cb); - }); - } else { - afterWrite(stream, state, finished, cb); - } - } -} - -function afterWrite(stream, state, finished, cb) { - if (!finished) - onwriteDrain(stream, state); - state.pendingcb--; - cb(); - finishMaybe(stream, state); -} - -// Must force callback to be called on nextTick, so that we don't -// emit 'drain' before the write() consumer gets the 'false' return -// value, and has a chance to attach a 'drain' listener. -function onwriteDrain(stream, state) { - if (state.length === 0 && state.needDrain) { - state.needDrain = false; - stream.emit('drain'); - } -} - - -// if there's something in the buffer waiting, then process it -function clearBuffer(stream, state) { - state.bufferProcessing = true; - - if (stream._writev && state.buffer.length > 1) { - // Fast case, write everything using _writev() - var cbs = []; - for (var c = 0; c < state.buffer.length; c++) - cbs.push(state.buffer[c].callback); - - // count the one we are adding, as well. - // TODO(isaacs) clean this up - state.pendingcb++; - doWrite(stream, state, true, state.length, state.buffer, '', function(err) { - for (var i = 0; i < cbs.length; i++) { - state.pendingcb--; - cbs[i](err); - } - }); - - // Clear buffer - state.buffer = []; - } else { - // Slow case, write chunks one-by-one - for (var c = 0; c < state.buffer.length; c++) { - var entry = state.buffer[c]; - var chunk = entry.chunk; - var encoding = entry.encoding; - var cb = entry.callback; - var len = state.objectMode ? 1 : chunk.length; - - doWrite(stream, state, false, len, chunk, encoding, cb); - - // if we didn't call the onwrite immediately, then - // it means that we need to wait until it does. - // also, that means that the chunk and cb are currently - // being processed, so move the buffer counter past them. - if (state.writing) { - c++; - break; - } - } - - if (c < state.buffer.length) - state.buffer = state.buffer.slice(c); - else - state.buffer.length = 0; - } - - state.bufferProcessing = false; -} - -Writable.prototype._write = function(chunk, encoding, cb) { - cb(new Error('not implemented')); - -}; - -Writable.prototype._writev = null; - -Writable.prototype.end = function(chunk, encoding, cb) { - var state = this._writableState; - - if (util.isFunction(chunk)) { - cb = chunk; - chunk = null; - encoding = null; - } else if (util.isFunction(encoding)) { - cb = encoding; - encoding = null; - } - - if (!util.isNullOrUndefined(chunk)) - this.write(chunk, encoding); - - // .end() fully uncorks - if (state.corked) { - state.corked = 1; - this.uncork(); - } - - // ignore unnecessary end() calls. - if (!state.ending && !state.finished) - endWritable(this, state, cb); -}; - - -function needFinish(stream, state) { - return (state.ending && - state.length === 0 && - !state.finished && - !state.writing); -} - -function prefinish(stream, state) { - if (!state.prefinished) { - state.prefinished = true; - stream.emit('prefinish'); - } -} - -function finishMaybe(stream, state) { - var need = needFinish(stream, state); - if (need) { - if (state.pendingcb === 0) { - prefinish(stream, state); - state.finished = true; - stream.emit('finish'); - } else - prefinish(stream, state); - } - return need; -} - -function endWritable(stream, state, cb) { - state.ending = true; - finishMaybe(stream, state); - if (cb) { - if (state.finished) - process.nextTick(cb); - else - stream.once('finish', cb); - } - state.ended = true; -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/README.md b/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/README.md deleted file mode 100644 index 5a76b41..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/README.md +++ /dev/null @@ -1,3 +0,0 @@ -# core-util-is - -The `util.is*` functions introduced in Node v0.12. diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/float.patch b/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/float.patch deleted file mode 100644 index a06d5c0..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/float.patch +++ /dev/null @@ -1,604 +0,0 @@ -diff --git a/lib/util.js b/lib/util.js -index a03e874..9074e8e 100644 ---- a/lib/util.js -+++ b/lib/util.js -@@ -19,430 +19,6 @@ - // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE - // USE OR OTHER DEALINGS IN THE SOFTWARE. - --var formatRegExp = /%[sdj%]/g; --exports.format = function(f) { -- if (!isString(f)) { -- var objects = []; -- for (var i = 0; i < arguments.length; i++) { -- objects.push(inspect(arguments[i])); -- } -- return objects.join(' '); -- } -- -- var i = 1; -- var args = arguments; -- var len = args.length; -- var str = String(f).replace(formatRegExp, function(x) { -- if (x === '%%') return '%'; -- if (i >= len) return x; -- switch (x) { -- case '%s': return String(args[i++]); -- case '%d': return Number(args[i++]); -- case '%j': -- try { -- return JSON.stringify(args[i++]); -- } catch (_) { -- return '[Circular]'; -- } -- default: -- return x; -- } -- }); -- for (var x = args[i]; i < len; x = args[++i]) { -- if (isNull(x) || !isObject(x)) { -- str += ' ' + x; -- } else { -- str += ' ' + inspect(x); -- } -- } -- return str; --}; -- -- --// Mark that a method should not be used. --// Returns a modified function which warns once by default. --// If --no-deprecation is set, then it is a no-op. --exports.deprecate = function(fn, msg) { -- // Allow for deprecating things in the process of starting up. -- if (isUndefined(global.process)) { -- return function() { -- return exports.deprecate(fn, msg).apply(this, arguments); -- }; -- } -- -- if (process.noDeprecation === true) { -- return fn; -- } -- -- var warned = false; -- function deprecated() { -- if (!warned) { -- if (process.throwDeprecation) { -- throw new Error(msg); -- } else if (process.traceDeprecation) { -- console.trace(msg); -- } else { -- console.error(msg); -- } -- warned = true; -- } -- return fn.apply(this, arguments); -- } -- -- return deprecated; --}; -- -- --var debugs = {}; --var debugEnviron; --exports.debuglog = function(set) { -- if (isUndefined(debugEnviron)) -- debugEnviron = process.env.NODE_DEBUG || ''; -- set = set.toUpperCase(); -- if (!debugs[set]) { -- if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { -- var pid = process.pid; -- debugs[set] = function() { -- var msg = exports.format.apply(exports, arguments); -- console.error('%s %d: %s', set, pid, msg); -- }; -- } else { -- debugs[set] = function() {}; -- } -- } -- return debugs[set]; --}; -- -- --/** -- * Echos the value of a value. Trys to print the value out -- * in the best way possible given the different types. -- * -- * @param {Object} obj The object to print out. -- * @param {Object} opts Optional options object that alters the output. -- */ --/* legacy: obj, showHidden, depth, colors*/ --function inspect(obj, opts) { -- // default options -- var ctx = { -- seen: [], -- stylize: stylizeNoColor -- }; -- // legacy... -- if (arguments.length >= 3) ctx.depth = arguments[2]; -- if (arguments.length >= 4) ctx.colors = arguments[3]; -- if (isBoolean(opts)) { -- // legacy... -- ctx.showHidden = opts; -- } else if (opts) { -- // got an "options" object -- exports._extend(ctx, opts); -- } -- // set default options -- if (isUndefined(ctx.showHidden)) ctx.showHidden = false; -- if (isUndefined(ctx.depth)) ctx.depth = 2; -- if (isUndefined(ctx.colors)) ctx.colors = false; -- if (isUndefined(ctx.customInspect)) ctx.customInspect = true; -- if (ctx.colors) ctx.stylize = stylizeWithColor; -- return formatValue(ctx, obj, ctx.depth); --} --exports.inspect = inspect; -- -- --// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics --inspect.colors = { -- 'bold' : [1, 22], -- 'italic' : [3, 23], -- 'underline' : [4, 24], -- 'inverse' : [7, 27], -- 'white' : [37, 39], -- 'grey' : [90, 39], -- 'black' : [30, 39], -- 'blue' : [34, 39], -- 'cyan' : [36, 39], -- 'green' : [32, 39], -- 'magenta' : [35, 39], -- 'red' : [31, 39], -- 'yellow' : [33, 39] --}; -- --// Don't use 'blue' not visible on cmd.exe --inspect.styles = { -- 'special': 'cyan', -- 'number': 'yellow', -- 'boolean': 'yellow', -- 'undefined': 'grey', -- 'null': 'bold', -- 'string': 'green', -- 'date': 'magenta', -- // "name": intentionally not styling -- 'regexp': 'red' --}; -- -- --function stylizeWithColor(str, styleType) { -- var style = inspect.styles[styleType]; -- -- if (style) { -- return '\u001b[' + inspect.colors[style][0] + 'm' + str + -- '\u001b[' + inspect.colors[style][1] + 'm'; -- } else { -- return str; -- } --} -- -- --function stylizeNoColor(str, styleType) { -- return str; --} -- -- --function arrayToHash(array) { -- var hash = {}; -- -- array.forEach(function(val, idx) { -- hash[val] = true; -- }); -- -- return hash; --} -- -- --function formatValue(ctx, value, recurseTimes) { -- // Provide a hook for user-specified inspect functions. -- // Check that value is an object with an inspect function on it -- if (ctx.customInspect && -- value && -- isFunction(value.inspect) && -- // Filter out the util module, it's inspect function is special -- value.inspect !== exports.inspect && -- // Also filter out any prototype objects using the circular check. -- !(value.constructor && value.constructor.prototype === value)) { -- var ret = value.inspect(recurseTimes, ctx); -- if (!isString(ret)) { -- ret = formatValue(ctx, ret, recurseTimes); -- } -- return ret; -- } -- -- // Primitive types cannot have properties -- var primitive = formatPrimitive(ctx, value); -- if (primitive) { -- return primitive; -- } -- -- // Look up the keys of the object. -- var keys = Object.keys(value); -- var visibleKeys = arrayToHash(keys); -- -- if (ctx.showHidden) { -- keys = Object.getOwnPropertyNames(value); -- } -- -- // Some type of object without properties can be shortcutted. -- if (keys.length === 0) { -- if (isFunction(value)) { -- var name = value.name ? ': ' + value.name : ''; -- return ctx.stylize('[Function' + name + ']', 'special'); -- } -- if (isRegExp(value)) { -- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); -- } -- if (isDate(value)) { -- return ctx.stylize(Date.prototype.toString.call(value), 'date'); -- } -- if (isError(value)) { -- return formatError(value); -- } -- } -- -- var base = '', array = false, braces = ['{', '}']; -- -- // Make Array say that they are Array -- if (isArray(value)) { -- array = true; -- braces = ['[', ']']; -- } -- -- // Make functions say that they are functions -- if (isFunction(value)) { -- var n = value.name ? ': ' + value.name : ''; -- base = ' [Function' + n + ']'; -- } -- -- // Make RegExps say that they are RegExps -- if (isRegExp(value)) { -- base = ' ' + RegExp.prototype.toString.call(value); -- } -- -- // Make dates with properties first say the date -- if (isDate(value)) { -- base = ' ' + Date.prototype.toUTCString.call(value); -- } -- -- // Make error with message first say the error -- if (isError(value)) { -- base = ' ' + formatError(value); -- } -- -- if (keys.length === 0 && (!array || value.length == 0)) { -- return braces[0] + base + braces[1]; -- } -- -- if (recurseTimes < 0) { -- if (isRegExp(value)) { -- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); -- } else { -- return ctx.stylize('[Object]', 'special'); -- } -- } -- -- ctx.seen.push(value); -- -- var output; -- if (array) { -- output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); -- } else { -- output = keys.map(function(key) { -- return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); -- }); -- } -- -- ctx.seen.pop(); -- -- return reduceToSingleString(output, base, braces); --} -- -- --function formatPrimitive(ctx, value) { -- if (isUndefined(value)) -- return ctx.stylize('undefined', 'undefined'); -- if (isString(value)) { -- var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') -- .replace(/'/g, "\\'") -- .replace(/\\"/g, '"') + '\''; -- return ctx.stylize(simple, 'string'); -- } -- if (isNumber(value)) { -- // Format -0 as '-0'. Strict equality won't distinguish 0 from -0, -- // so instead we use the fact that 1 / -0 < 0 whereas 1 / 0 > 0 . -- if (value === 0 && 1 / value < 0) -- return ctx.stylize('-0', 'number'); -- return ctx.stylize('' + value, 'number'); -- } -- if (isBoolean(value)) -- return ctx.stylize('' + value, 'boolean'); -- // For some reason typeof null is "object", so special case here. -- if (isNull(value)) -- return ctx.stylize('null', 'null'); --} -- -- --function formatError(value) { -- return '[' + Error.prototype.toString.call(value) + ']'; --} -- -- --function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { -- var output = []; -- for (var i = 0, l = value.length; i < l; ++i) { -- if (hasOwnProperty(value, String(i))) { -- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, -- String(i), true)); -- } else { -- output.push(''); -- } -- } -- keys.forEach(function(key) { -- if (!key.match(/^\d+$/)) { -- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, -- key, true)); -- } -- }); -- return output; --} -- -- --function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { -- var name, str, desc; -- desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; -- if (desc.get) { -- if (desc.set) { -- str = ctx.stylize('[Getter/Setter]', 'special'); -- } else { -- str = ctx.stylize('[Getter]', 'special'); -- } -- } else { -- if (desc.set) { -- str = ctx.stylize('[Setter]', 'special'); -- } -- } -- if (!hasOwnProperty(visibleKeys, key)) { -- name = '[' + key + ']'; -- } -- if (!str) { -- if (ctx.seen.indexOf(desc.value) < 0) { -- if (isNull(recurseTimes)) { -- str = formatValue(ctx, desc.value, null); -- } else { -- str = formatValue(ctx, desc.value, recurseTimes - 1); -- } -- if (str.indexOf('\n') > -1) { -- if (array) { -- str = str.split('\n').map(function(line) { -- return ' ' + line; -- }).join('\n').substr(2); -- } else { -- str = '\n' + str.split('\n').map(function(line) { -- return ' ' + line; -- }).join('\n'); -- } -- } -- } else { -- str = ctx.stylize('[Circular]', 'special'); -- } -- } -- if (isUndefined(name)) { -- if (array && key.match(/^\d+$/)) { -- return str; -- } -- name = JSON.stringify('' + key); -- if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { -- name = name.substr(1, name.length - 2); -- name = ctx.stylize(name, 'name'); -- } else { -- name = name.replace(/'/g, "\\'") -- .replace(/\\"/g, '"') -- .replace(/(^"|"$)/g, "'"); -- name = ctx.stylize(name, 'string'); -- } -- } -- -- return name + ': ' + str; --} -- -- --function reduceToSingleString(output, base, braces) { -- var numLinesEst = 0; -- var length = output.reduce(function(prev, cur) { -- numLinesEst++; -- if (cur.indexOf('\n') >= 0) numLinesEst++; -- return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; -- }, 0); -- -- if (length > 60) { -- return braces[0] + -- (base === '' ? '' : base + '\n ') + -- ' ' + -- output.join(',\n ') + -- ' ' + -- braces[1]; -- } -- -- return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; --} -- -- - // NOTE: These type checking functions intentionally don't use `instanceof` - // because it is fragile and can be easily faked with `Object.create()`. - function isArray(ar) { -@@ -522,166 +98,10 @@ function isPrimitive(arg) { - exports.isPrimitive = isPrimitive; - - function isBuffer(arg) { -- return arg instanceof Buffer; -+ return Buffer.isBuffer(arg); - } - exports.isBuffer = isBuffer; - - function objectToString(o) { - return Object.prototype.toString.call(o); --} -- -- --function pad(n) { -- return n < 10 ? '0' + n.toString(10) : n.toString(10); --} -- -- --var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', -- 'Oct', 'Nov', 'Dec']; -- --// 26 Feb 16:19:34 --function timestamp() { -- var d = new Date(); -- var time = [pad(d.getHours()), -- pad(d.getMinutes()), -- pad(d.getSeconds())].join(':'); -- return [d.getDate(), months[d.getMonth()], time].join(' '); --} -- -- --// log is just a thin wrapper to console.log that prepends a timestamp --exports.log = function() { -- console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); --}; -- -- --/** -- * Inherit the prototype methods from one constructor into another. -- * -- * The Function.prototype.inherits from lang.js rewritten as a standalone -- * function (not on Function.prototype). NOTE: If this file is to be loaded -- * during bootstrapping this function needs to be rewritten using some native -- * functions as prototype setup using normal JavaScript does not work as -- * expected during bootstrapping (see mirror.js in r114903). -- * -- * @param {function} ctor Constructor function which needs to inherit the -- * prototype. -- * @param {function} superCtor Constructor function to inherit prototype from. -- */ --exports.inherits = function(ctor, superCtor) { -- ctor.super_ = superCtor; -- ctor.prototype = Object.create(superCtor.prototype, { -- constructor: { -- value: ctor, -- enumerable: false, -- writable: true, -- configurable: true -- } -- }); --}; -- --exports._extend = function(origin, add) { -- // Don't do anything if add isn't an object -- if (!add || !isObject(add)) return origin; -- -- var keys = Object.keys(add); -- var i = keys.length; -- while (i--) { -- origin[keys[i]] = add[keys[i]]; -- } -- return origin; --}; -- --function hasOwnProperty(obj, prop) { -- return Object.prototype.hasOwnProperty.call(obj, prop); --} -- -- --// Deprecated old stuff. -- --exports.p = exports.deprecate(function() { -- for (var i = 0, len = arguments.length; i < len; ++i) { -- console.error(exports.inspect(arguments[i])); -- } --}, 'util.p: Use console.error() instead'); -- -- --exports.exec = exports.deprecate(function() { -- return require('child_process').exec.apply(this, arguments); --}, 'util.exec is now called `child_process.exec`.'); -- -- --exports.print = exports.deprecate(function() { -- for (var i = 0, len = arguments.length; i < len; ++i) { -- process.stdout.write(String(arguments[i])); -- } --}, 'util.print: Use console.log instead'); -- -- --exports.puts = exports.deprecate(function() { -- for (var i = 0, len = arguments.length; i < len; ++i) { -- process.stdout.write(arguments[i] + '\n'); -- } --}, 'util.puts: Use console.log instead'); -- -- --exports.debug = exports.deprecate(function(x) { -- process.stderr.write('DEBUG: ' + x + '\n'); --}, 'util.debug: Use console.error instead'); -- -- --exports.error = exports.deprecate(function(x) { -- for (var i = 0, len = arguments.length; i < len; ++i) { -- process.stderr.write(arguments[i] + '\n'); -- } --}, 'util.error: Use console.error instead'); -- -- --exports.pump = exports.deprecate(function(readStream, writeStream, callback) { -- var callbackCalled = false; -- -- function call(a, b, c) { -- if (callback && !callbackCalled) { -- callback(a, b, c); -- callbackCalled = true; -- } -- } -- -- readStream.addListener('data', function(chunk) { -- if (writeStream.write(chunk) === false) readStream.pause(); -- }); -- -- writeStream.addListener('drain', function() { -- readStream.resume(); -- }); -- -- readStream.addListener('end', function() { -- writeStream.end(); -- }); -- -- readStream.addListener('close', function() { -- call(); -- }); -- -- readStream.addListener('error', function(err) { -- writeStream.end(); -- call(err); -- }); -- -- writeStream.addListener('error', function(err) { -- readStream.destroy(); -- call(err); -- }); --}, 'util.pump(): Use readableStream.pipe() instead'); -- -- --var uv; --exports._errnoException = function(err, syscall) { -- if (isUndefined(uv)) uv = process.binding('uv'); -- var errname = uv.errname(err); -- var e = new Error(syscall + ' ' + errname); -- e.code = errname; -- e.errno = errname; -- e.syscall = syscall; -- return e; --}; -+} \ No newline at end of file diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/lib/util.js b/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/lib/util.js deleted file mode 100644 index 9074e8e..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/lib/util.js +++ /dev/null @@ -1,107 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// NOTE: These type checking functions intentionally don't use `instanceof` -// because it is fragile and can be easily faked with `Object.create()`. -function isArray(ar) { - return Array.isArray(ar); -} -exports.isArray = isArray; - -function isBoolean(arg) { - return typeof arg === 'boolean'; -} -exports.isBoolean = isBoolean; - -function isNull(arg) { - return arg === null; -} -exports.isNull = isNull; - -function isNullOrUndefined(arg) { - return arg == null; -} -exports.isNullOrUndefined = isNullOrUndefined; - -function isNumber(arg) { - return typeof arg === 'number'; -} -exports.isNumber = isNumber; - -function isString(arg) { - return typeof arg === 'string'; -} -exports.isString = isString; - -function isSymbol(arg) { - return typeof arg === 'symbol'; -} -exports.isSymbol = isSymbol; - -function isUndefined(arg) { - return arg === void 0; -} -exports.isUndefined = isUndefined; - -function isRegExp(re) { - return isObject(re) && objectToString(re) === '[object RegExp]'; -} -exports.isRegExp = isRegExp; - -function isObject(arg) { - return typeof arg === 'object' && arg !== null; -} -exports.isObject = isObject; - -function isDate(d) { - return isObject(d) && objectToString(d) === '[object Date]'; -} -exports.isDate = isDate; - -function isError(e) { - return isObject(e) && - (objectToString(e) === '[object Error]' || e instanceof Error); -} -exports.isError = isError; - -function isFunction(arg) { - return typeof arg === 'function'; -} -exports.isFunction = isFunction; - -function isPrimitive(arg) { - return arg === null || - typeof arg === 'boolean' || - typeof arg === 'number' || - typeof arg === 'string' || - typeof arg === 'symbol' || // ES6 symbol - typeof arg === 'undefined'; -} -exports.isPrimitive = isPrimitive; - -function isBuffer(arg) { - return Buffer.isBuffer(arg); -} -exports.isBuffer = isBuffer; - -function objectToString(o) { - return Object.prototype.toString.call(o); -} \ No newline at end of file diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/package.json b/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/package.json deleted file mode 100644 index 390312c..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/package.json +++ /dev/null @@ -1,38 +0,0 @@ -{ - "name": "core-util-is", - "version": "1.0.1", - "description": "The `util.is*` functions introduced in Node v0.12.", - "main": "lib/util.js", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/core-util-is" - }, - "keywords": [ - "util", - "isBuffer", - "isArray", - "isNumber", - "isString", - "isRegExp", - "isThis", - "isThat", - "polyfill" - ], - "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me", - "url": "http://blog.izs.me/" - }, - "license": "MIT", - "bugs": { - "url": "https://github.com/isaacs/core-util-is/issues" - }, - "readme": "# core-util-is\n\nThe `util.is*` functions introduced in Node v0.12.\n", - "readmeFilename": "README.md", - "homepage": "https://github.com/isaacs/core-util-is", - "_id": "core-util-is@1.0.1", - "_shasum": "6b07085aef9a3ccac6ee53bf9d3df0c1521a5538", - "_from": "core-util-is@~1.0.0", - "_resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.1.tgz", - "scripts": {} -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/util.js b/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/util.js deleted file mode 100644 index 007fa10..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/core-util-is/util.js +++ /dev/null @@ -1,106 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// NOTE: These type checking functions intentionally don't use `instanceof` -// because it is fragile and can be easily faked with `Object.create()`. -function isArray(ar) { - return Array.isArray(ar); -} -exports.isArray = isArray; - -function isBoolean(arg) { - return typeof arg === 'boolean'; -} -exports.isBoolean = isBoolean; - -function isNull(arg) { - return arg === null; -} -exports.isNull = isNull; - -function isNullOrUndefined(arg) { - return arg == null; -} -exports.isNullOrUndefined = isNullOrUndefined; - -function isNumber(arg) { - return typeof arg === 'number'; -} -exports.isNumber = isNumber; - -function isString(arg) { - return typeof arg === 'string'; -} -exports.isString = isString; - -function isSymbol(arg) { - return typeof arg === 'symbol'; -} -exports.isSymbol = isSymbol; - -function isUndefined(arg) { - return arg === void 0; -} -exports.isUndefined = isUndefined; - -function isRegExp(re) { - return isObject(re) && objectToString(re) === '[object RegExp]'; -} -exports.isRegExp = isRegExp; - -function isObject(arg) { - return typeof arg === 'object' && arg !== null; -} -exports.isObject = isObject; - -function isDate(d) { - return isObject(d) && objectToString(d) === '[object Date]'; -} -exports.isDate = isDate; - -function isError(e) { - return isObject(e) && objectToString(e) === '[object Error]'; -} -exports.isError = isError; - -function isFunction(arg) { - return typeof arg === 'function'; -} -exports.isFunction = isFunction; - -function isPrimitive(arg) { - return arg === null || - typeof arg === 'boolean' || - typeof arg === 'number' || - typeof arg === 'string' || - typeof arg === 'symbol' || // ES6 symbol - typeof arg === 'undefined'; -} -exports.isPrimitive = isPrimitive; - -function isBuffer(arg) { - return arg instanceof Buffer; -} -exports.isBuffer = isBuffer; - -function objectToString(o) { - return Object.prototype.toString.call(o); -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/LICENSE b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/LICENSE deleted file mode 100644 index dea3013..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/LICENSE +++ /dev/null @@ -1,16 +0,0 @@ -The ISC License - -Copyright (c) Isaac Z. Schlueter - -Permission to use, copy, modify, and/or distribute this software for any -purpose with or without fee is hereby granted, provided that the above -copyright notice and this permission notice appear in all copies. - -THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH -REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND -FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, -INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM -LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR -OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR -PERFORMANCE OF THIS SOFTWARE. - diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/README.md b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/README.md deleted file mode 100644 index b1c5665..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/README.md +++ /dev/null @@ -1,42 +0,0 @@ -Browser-friendly inheritance fully compatible with standard node.js -[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). - -This package exports standard `inherits` from node.js `util` module in -node environment, but also provides alternative browser-friendly -implementation through [browser -field](https://gist.github.com/shtylman/4339901). Alternative -implementation is a literal copy of standard one located in standalone -module to avoid requiring of `util`. It also has a shim for old -browsers with no `Object.create` support. - -While keeping you sure you are using standard `inherits` -implementation in node.js environment, it allows bundlers such as -[browserify](https://github.com/substack/node-browserify) to not -include full `util` package to your client code if all you need is -just `inherits` function. It worth, because browser shim for `util` -package is large and `inherits` is often the single function you need -from it. - -It's recommended to use this package instead of -`require('util').inherits` for any code that has chances to be used -not only in node.js but in browser too. - -## usage - -```js -var inherits = require('inherits'); -// then use exactly as the standard one -``` - -## note on version ~1.0 - -Version ~1.0 had completely different motivation and is not compatible -neither with 2.0 nor with standard node.js `inherits`. - -If you are using version ~1.0 and planning to switch to ~2.0, be -careful: - -* new version uses `super_` instead of `super` for referencing - superclass -* new version overwrites current prototype while old one preserves any - existing fields on it diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits.js b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits.js deleted file mode 100644 index 29f5e24..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require('util').inherits diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits_browser.js b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits_browser.js deleted file mode 100644 index c1e78a7..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/inherits_browser.js +++ /dev/null @@ -1,23 +0,0 @@ -if (typeof Object.create === 'function') { - // implementation from standard node.js 'util' module - module.exports = function inherits(ctor, superCtor) { - ctor.super_ = superCtor - ctor.prototype = Object.create(superCtor.prototype, { - constructor: { - value: ctor, - enumerable: false, - writable: true, - configurable: true - } - }); - }; -} else { - // old school shim for old browsers - module.exports = function inherits(ctor, superCtor) { - ctor.super_ = superCtor - var TempCtor = function () {} - TempCtor.prototype = superCtor.prototype - ctor.prototype = new TempCtor() - ctor.prototype.constructor = ctor - } -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/package.json b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/package.json deleted file mode 100644 index c532ca6..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/package.json +++ /dev/null @@ -1,33 +0,0 @@ -{ - "name": "inherits", - "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", - "version": "2.0.1", - "keywords": [ - "inheritance", - "class", - "klass", - "oop", - "object-oriented", - "inherits", - "browser", - "browserify" - ], - "main": "./inherits.js", - "browser": "./inherits_browser.js", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/inherits" - }, - "license": "ISC", - "scripts": { - "test": "node test" - }, - "readme": "Browser-friendly inheritance fully compatible with standard node.js\n[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor).\n\nThis package exports standard `inherits` from node.js `util` module in\nnode environment, but also provides alternative browser-friendly\nimplementation through [browser\nfield](https://gist.github.com/shtylman/4339901). Alternative\nimplementation is a literal copy of standard one located in standalone\nmodule to avoid requiring of `util`. It also has a shim for old\nbrowsers with no `Object.create` support.\n\nWhile keeping you sure you are using standard `inherits`\nimplementation in node.js environment, it allows bundlers such as\n[browserify](https://github.com/substack/node-browserify) to not\ninclude full `util` package to your client code if all you need is\njust `inherits` function. It worth, because browser shim for `util`\npackage is large and `inherits` is often the single function you need\nfrom it.\n\nIt's recommended to use this package instead of\n`require('util').inherits` for any code that has chances to be used\nnot only in node.js but in browser too.\n\n## usage\n\n```js\nvar inherits = require('inherits');\n// then use exactly as the standard one\n```\n\n## note on version ~1.0\n\nVersion ~1.0 had completely different motivation and is not compatible\nneither with 2.0 nor with standard node.js `inherits`.\n\nIf you are using version ~1.0 and planning to switch to ~2.0, be\ncareful:\n\n* new version uses `super_` instead of `super` for referencing\n superclass\n* new version overwrites current prototype while old one preserves any\n existing fields on it\n", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/isaacs/inherits/issues" - }, - "homepage": "https://github.com/isaacs/inherits", - "_id": "inherits@2.0.1", - "_from": "inherits@~2.0.1" -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/test.js b/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/test.js deleted file mode 100644 index fc53012..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/inherits/test.js +++ /dev/null @@ -1,25 +0,0 @@ -var inherits = require('./inherits.js') -var assert = require('assert') - -function test(c) { - assert(c.constructor === Child) - assert(c.constructor.super_ === Parent) - assert(Object.getPrototypeOf(c) === Child.prototype) - assert(Object.getPrototypeOf(Object.getPrototypeOf(c)) === Parent.prototype) - assert(c instanceof Child) - assert(c instanceof Parent) -} - -function Child() { - Parent.call(this) - test(this) -} - -function Parent() {} - -inherits(Child, Parent) - -var c = new Child -test(c) - -console.log('ok') diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/README.md b/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/README.md deleted file mode 100644 index 052a62b..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/README.md +++ /dev/null @@ -1,54 +0,0 @@ - -# isarray - -`Array#isArray` for older browsers. - -## Usage - -```js -var isArray = require('isarray'); - -console.log(isArray([])); // => true -console.log(isArray({})); // => false -``` - -## Installation - -With [npm](http://npmjs.org) do - -```bash -$ npm install isarray -``` - -Then bundle for the browser with -[browserify](https://github.com/substack/browserify). - -With [component](http://component.io) do - -```bash -$ component install juliangruber/isarray -``` - -## License - -(MIT) - -Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> - -Permission is hereby granted, free of charge, to any person obtaining a copy of -this software and associated documentation files (the "Software"), to deal in -the Software without restriction, including without limitation the rights to -use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies -of the Software, and to permit persons to whom the Software is furnished to do -so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -SOFTWARE. diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/build/build.js b/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/build/build.js deleted file mode 100644 index ec58596..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/build/build.js +++ /dev/null @@ -1,209 +0,0 @@ - -/** - * Require the given path. - * - * @param {String} path - * @return {Object} exports - * @api public - */ - -function require(path, parent, orig) { - var resolved = require.resolve(path); - - // lookup failed - if (null == resolved) { - orig = orig || path; - parent = parent || 'root'; - var err = new Error('Failed to require "' + orig + '" from "' + parent + '"'); - err.path = orig; - err.parent = parent; - err.require = true; - throw err; - } - - var module = require.modules[resolved]; - - // perform real require() - // by invoking the module's - // registered function - if (!module.exports) { - module.exports = {}; - module.client = module.component = true; - module.call(this, module.exports, require.relative(resolved), module); - } - - return module.exports; -} - -/** - * Registered modules. - */ - -require.modules = {}; - -/** - * Registered aliases. - */ - -require.aliases = {}; - -/** - * Resolve `path`. - * - * Lookup: - * - * - PATH/index.js - * - PATH.js - * - PATH - * - * @param {String} path - * @return {String} path or null - * @api private - */ - -require.resolve = function(path) { - if (path.charAt(0) === '/') path = path.slice(1); - var index = path + '/index.js'; - - var paths = [ - path, - path + '.js', - path + '.json', - path + '/index.js', - path + '/index.json' - ]; - - for (var i = 0; i < paths.length; i++) { - var path = paths[i]; - if (require.modules.hasOwnProperty(path)) return path; - } - - if (require.aliases.hasOwnProperty(index)) { - return require.aliases[index]; - } -}; - -/** - * Normalize `path` relative to the current path. - * - * @param {String} curr - * @param {String} path - * @return {String} - * @api private - */ - -require.normalize = function(curr, path) { - var segs = []; - - if ('.' != path.charAt(0)) return path; - - curr = curr.split('/'); - path = path.split('/'); - - for (var i = 0; i < path.length; ++i) { - if ('..' == path[i]) { - curr.pop(); - } else if ('.' != path[i] && '' != path[i]) { - segs.push(path[i]); - } - } - - return curr.concat(segs).join('/'); -}; - -/** - * Register module at `path` with callback `definition`. - * - * @param {String} path - * @param {Function} definition - * @api private - */ - -require.register = function(path, definition) { - require.modules[path] = definition; -}; - -/** - * Alias a module definition. - * - * @param {String} from - * @param {String} to - * @api private - */ - -require.alias = function(from, to) { - if (!require.modules.hasOwnProperty(from)) { - throw new Error('Failed to alias "' + from + '", it does not exist'); - } - require.aliases[to] = from; -}; - -/** - * Return a require function relative to the `parent` path. - * - * @param {String} parent - * @return {Function} - * @api private - */ - -require.relative = function(parent) { - var p = require.normalize(parent, '..'); - - /** - * lastIndexOf helper. - */ - - function lastIndexOf(arr, obj) { - var i = arr.length; - while (i--) { - if (arr[i] === obj) return i; - } - return -1; - } - - /** - * The relative require() itself. - */ - - function localRequire(path) { - var resolved = localRequire.resolve(path); - return require(resolved, parent, path); - } - - /** - * Resolve relative to the parent. - */ - - localRequire.resolve = function(path) { - var c = path.charAt(0); - if ('/' == c) return path.slice(1); - if ('.' == c) return require.normalize(p, path); - - // resolve deps by returning - // the dep in the nearest "deps" - // directory - var segs = parent.split('/'); - var i = lastIndexOf(segs, 'deps') + 1; - if (!i) i = 0; - path = segs.slice(0, i + 1).join('/') + '/deps/' + path; - return path; - }; - - /** - * Check if module is defined at `path`. - */ - - localRequire.exists = function(path) { - return require.modules.hasOwnProperty(localRequire.resolve(path)); - }; - - return localRequire; -}; -require.register("isarray/index.js", function(exports, require, module){ -module.exports = Array.isArray || function (arr) { - return Object.prototype.toString.call(arr) == '[object Array]'; -}; - -}); -require.alias("isarray/index.js", "isarray/index.js"); - diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/component.json b/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/component.json deleted file mode 100644 index 9e31b68..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/component.json +++ /dev/null @@ -1,19 +0,0 @@ -{ - "name" : "isarray", - "description" : "Array#isArray for older browsers", - "version" : "0.0.1", - "repository" : "juliangruber/isarray", - "homepage": "https://github.com/juliangruber/isarray", - "main" : "index.js", - "scripts" : [ - "index.js" - ], - "dependencies" : {}, - "keywords": ["browser","isarray","array"], - "author": { - "name": "Julian Gruber", - "email": "mail@juliangruber.com", - "url": "http://juliangruber.com" - }, - "license": "MIT" -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/index.js b/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/index.js deleted file mode 100644 index 5f5ad45..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/index.js +++ /dev/null @@ -1,3 +0,0 @@ -module.exports = Array.isArray || function (arr) { - return Object.prototype.toString.call(arr) == '[object Array]'; -}; diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/package.json b/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/package.json deleted file mode 100644 index fc7904b..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/isarray/package.json +++ /dev/null @@ -1,54 +0,0 @@ -{ - "name": "isarray", - "description": "Array#isArray for older browsers", - "version": "0.0.1", - "repository": { - "type": "git", - "url": "git://github.com/juliangruber/isarray.git" - }, - "homepage": "https://github.com/juliangruber/isarray", - "main": "index.js", - "scripts": { - "test": "tap test/*.js" - }, - "dependencies": {}, - "devDependencies": { - "tap": "*" - }, - "keywords": [ - "browser", - "isarray", - "array" - ], - "author": { - "name": "Julian Gruber", - "email": "mail@juliangruber.com", - "url": "http://juliangruber.com" - }, - "license": "MIT", - "readme": "\n# isarray\n\n`Array#isArray` for older browsers.\n\n## Usage\n\n```js\nvar isArray = require('isarray');\n\nconsole.log(isArray([])); // => true\nconsole.log(isArray({})); // => false\n```\n\n## Installation\n\nWith [npm](http://npmjs.org) do\n\n```bash\n$ npm install isarray\n```\n\nThen bundle for the browser with\n[browserify](https://github.com/substack/browserify).\n\nWith [component](http://component.io) do\n\n```bash\n$ component install juliangruber/isarray\n```\n\n## License\n\n(MIT)\n\nCopyright (c) 2013 Julian Gruber <julian@juliangruber.com>\n\nPermission is hereby granted, free of charge, to any person obtaining a copy of\nthis software and associated documentation files (the \"Software\"), to deal in\nthe Software without restriction, including without limitation the rights to\nuse, copy, modify, merge, publish, distribute, sublicense, and/or sell copies\nof the Software, and to permit persons to whom the Software is furnished to do\nso, subject to the following conditions:\n\nThe above copyright notice and this permission notice shall be included in all\ncopies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\nIMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\nFITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\nAUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\nLIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\nOUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE\nSOFTWARE.\n", - "readmeFilename": "README.md", - "_id": "isarray@0.0.1", - "dist": { - "shasum": "8a18acfca9a8f4177e09abfc6038939b05d1eedf", - "tarball": "http://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz" - }, - "_from": "isarray@0.0.1", - "_npmVersion": "1.2.18", - "_npmUser": { - "name": "juliangruber", - "email": "julian@juliangruber.com" - }, - "maintainers": [ - { - "name": "juliangruber", - "email": "julian@juliangruber.com" - } - ], - "directories": {}, - "_shasum": "8a18acfca9a8f4177e09abfc6038939b05d1eedf", - "_resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz", - "bugs": { - "url": "https://github.com/juliangruber/isarray/issues" - } -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/.npmignore b/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/.npmignore deleted file mode 100644 index 206320c..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/.npmignore +++ /dev/null @@ -1,2 +0,0 @@ -build -test diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/README.md b/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/README.md deleted file mode 100644 index 4d2aa00..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/README.md +++ /dev/null @@ -1,7 +0,0 @@ -**string_decoder.js** (`require('string_decoder')`) from Node.js core - -Copyright Joyent, Inc. and other Node contributors. See LICENCE file for details. - -Version numbers match the versions found in Node core, e.g. 0.10.24 matches Node 0.10.24, likewise 0.11.10 matches Node 0.11.10. **Prefer the stable version over the unstable.** - -The *build/* directory contains a build script that will scrape the source from the [joyent/node](https://github.com/joyent/node) repo given a specific Node version. \ No newline at end of file diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/index.js b/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/index.js deleted file mode 100644 index b00e54f..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/index.js +++ /dev/null @@ -1,221 +0,0 @@ -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -var Buffer = require('buffer').Buffer; - -var isBufferEncoding = Buffer.isEncoding - || function(encoding) { - switch (encoding && encoding.toLowerCase()) { - case 'hex': case 'utf8': case 'utf-8': case 'ascii': case 'binary': case 'base64': case 'ucs2': case 'ucs-2': case 'utf16le': case 'utf-16le': case 'raw': return true; - default: return false; - } - } - - -function assertEncoding(encoding) { - if (encoding && !isBufferEncoding(encoding)) { - throw new Error('Unknown encoding: ' + encoding); - } -} - -// StringDecoder provides an interface for efficiently splitting a series of -// buffers into a series of JS strings without breaking apart multi-byte -// characters. CESU-8 is handled as part of the UTF-8 encoding. -// -// @TODO Handling all encodings inside a single object makes it very difficult -// to reason about this code, so it should be split up in the future. -// @TODO There should be a utf8-strict encoding that rejects invalid UTF-8 code -// points as used by CESU-8. -var StringDecoder = exports.StringDecoder = function(encoding) { - this.encoding = (encoding || 'utf8').toLowerCase().replace(/[-_]/, ''); - assertEncoding(encoding); - switch (this.encoding) { - case 'utf8': - // CESU-8 represents each of Surrogate Pair by 3-bytes - this.surrogateSize = 3; - break; - case 'ucs2': - case 'utf16le': - // UTF-16 represents each of Surrogate Pair by 2-bytes - this.surrogateSize = 2; - this.detectIncompleteChar = utf16DetectIncompleteChar; - break; - case 'base64': - // Base-64 stores 3 bytes in 4 chars, and pads the remainder. - this.surrogateSize = 3; - this.detectIncompleteChar = base64DetectIncompleteChar; - break; - default: - this.write = passThroughWrite; - return; - } - - // Enough space to store all bytes of a single character. UTF-8 needs 4 - // bytes, but CESU-8 may require up to 6 (3 bytes per surrogate). - this.charBuffer = new Buffer(6); - // Number of bytes received for the current incomplete multi-byte character. - this.charReceived = 0; - // Number of bytes expected for the current incomplete multi-byte character. - this.charLength = 0; -}; - - -// write decodes the given buffer and returns it as JS string that is -// guaranteed to not contain any partial multi-byte characters. Any partial -// character found at the end of the buffer is buffered up, and will be -// returned when calling write again with the remaining bytes. -// -// Note: Converting a Buffer containing an orphan surrogate to a String -// currently works, but converting a String to a Buffer (via `new Buffer`, or -// Buffer#write) will replace incomplete surrogates with the unicode -// replacement character. See https://codereview.chromium.org/121173009/ . -StringDecoder.prototype.write = function(buffer) { - var charStr = ''; - // if our last write ended with an incomplete multibyte character - while (this.charLength) { - // determine how many remaining bytes this buffer has to offer for this char - var available = (buffer.length >= this.charLength - this.charReceived) ? - this.charLength - this.charReceived : - buffer.length; - - // add the new bytes to the char buffer - buffer.copy(this.charBuffer, this.charReceived, 0, available); - this.charReceived += available; - - if (this.charReceived < this.charLength) { - // still not enough chars in this buffer? wait for more ... - return ''; - } - - // remove bytes belonging to the current character from the buffer - buffer = buffer.slice(available, buffer.length); - - // get the character that was split - charStr = this.charBuffer.slice(0, this.charLength).toString(this.encoding); - - // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character - var charCode = charStr.charCodeAt(charStr.length - 1); - if (charCode >= 0xD800 && charCode <= 0xDBFF) { - this.charLength += this.surrogateSize; - charStr = ''; - continue; - } - this.charReceived = this.charLength = 0; - - // if there are no more bytes in this buffer, just emit our char - if (buffer.length === 0) { - return charStr; - } - break; - } - - // determine and set charLength / charReceived - this.detectIncompleteChar(buffer); - - var end = buffer.length; - if (this.charLength) { - // buffer the incomplete character bytes we got - buffer.copy(this.charBuffer, 0, buffer.length - this.charReceived, end); - end -= this.charReceived; - } - - charStr += buffer.toString(this.encoding, 0, end); - - var end = charStr.length - 1; - var charCode = charStr.charCodeAt(end); - // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character - if (charCode >= 0xD800 && charCode <= 0xDBFF) { - var size = this.surrogateSize; - this.charLength += size; - this.charReceived += size; - this.charBuffer.copy(this.charBuffer, size, 0, size); - buffer.copy(this.charBuffer, 0, 0, size); - return charStr.substring(0, end); - } - - // or just emit the charStr - return charStr; -}; - -// detectIncompleteChar determines if there is an incomplete UTF-8 character at -// the end of the given buffer. If so, it sets this.charLength to the byte -// length that character, and sets this.charReceived to the number of bytes -// that are available for this character. -StringDecoder.prototype.detectIncompleteChar = function(buffer) { - // determine how many bytes we have to check at the end of this buffer - var i = (buffer.length >= 3) ? 3 : buffer.length; - - // Figure out if one of the last i bytes of our buffer announces an - // incomplete char. - for (; i > 0; i--) { - var c = buffer[buffer.length - i]; - - // See http://en.wikipedia.org/wiki/UTF-8#Description - - // 110XXXXX - if (i == 1 && c >> 5 == 0x06) { - this.charLength = 2; - break; - } - - // 1110XXXX - if (i <= 2 && c >> 4 == 0x0E) { - this.charLength = 3; - break; - } - - // 11110XXX - if (i <= 3 && c >> 3 == 0x1E) { - this.charLength = 4; - break; - } - } - this.charReceived = i; -}; - -StringDecoder.prototype.end = function(buffer) { - var res = ''; - if (buffer && buffer.length) - res = this.write(buffer); - - if (this.charReceived) { - var cr = this.charReceived; - var buf = this.charBuffer; - var enc = this.encoding; - res += buf.slice(0, cr).toString(enc); - } - - return res; -}; - -function passThroughWrite(buffer) { - return buffer.toString(this.encoding); -} - -function utf16DetectIncompleteChar(buffer) { - this.charReceived = buffer.length % 2; - this.charLength = this.charReceived ? 2 : 0; -} - -function base64DetectIncompleteChar(buffer) { - this.charReceived = buffer.length % 3; - this.charLength = this.charReceived ? 3 : 0; -} diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/package.json b/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/package.json deleted file mode 100644 index a8c586b..0000000 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/package.json +++ /dev/null @@ -1,54 +0,0 @@ -{ - "name": "string_decoder", - "version": "0.10.31", - "description": "The string_decoder module from Node core", - "main": "index.js", - "dependencies": {}, - "devDependencies": { - "tap": "~0.4.8" - }, - "scripts": { - "test": "tap test/simple/*.js" - }, - "repository": { - "type": "git", - "url": "git://github.com/rvagg/string_decoder.git" - }, - "homepage": "https://github.com/rvagg/string_decoder", - "keywords": [ - "string", - "decoder", - "browser", - "browserify" - ], - "license": "MIT", - "gitHead": "d46d4fd87cf1d06e031c23f1ba170ca7d4ade9a0", - "bugs": { - "url": "https://github.com/rvagg/string_decoder/issues" - }, - "_id": "string_decoder@0.10.31", - "_shasum": "62e203bc41766c6c28c9fc84301dab1c5310fa94", - "_from": "string_decoder@~0.10.x", - "_npmVersion": "1.4.23", - "_npmUser": { - "name": "rvagg", - "email": "rod@vagg.org" - }, - "maintainers": [ - { - "name": "substack", - "email": "mail@substack.net" - }, - { - "name": "rvagg", - "email": "rod@vagg.org" - } - ], - "dist": { - "shasum": "62e203bc41766c6c28c9fc84301dab1c5310fa94", - "tarball": "http://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/node_modules/mysql/node_modules/readable-stream/package.json b/node_modules/mysql/node_modules/readable-stream/package.json deleted file mode 100644 index bd72748..0000000 --- a/node_modules/mysql/node_modules/readable-stream/package.json +++ /dev/null @@ -1,70 +0,0 @@ -{ - "name": "readable-stream", - "version": "1.1.13", - "description": "Streams3, a user-land copy of the stream library from Node.js v0.11.x", - "main": "readable.js", - "dependencies": { - "core-util-is": "~1.0.0", - "isarray": "0.0.1", - "string_decoder": "~0.10.x", - "inherits": "~2.0.1" - }, - "devDependencies": { - "tap": "~0.2.6" - }, - "scripts": { - "test": "tap test/simple/*.js" - }, - "repository": { - "type": "git", - "url": "git://github.com/isaacs/readable-stream" - }, - "keywords": [ - "readable", - "stream", - "pipe" - ], - "browser": { - "util": false - }, - "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me", - "url": "http://blog.izs.me/" - }, - "license": "MIT", - "gitHead": "3b672fd7ae92acf5b4ffdbabf74b372a0a56b051", - "bugs": { - "url": "https://github.com/isaacs/readable-stream/issues" - }, - "homepage": "https://github.com/isaacs/readable-stream", - "_id": "readable-stream@1.1.13", - "_shasum": "f6eef764f514c89e2b9e23146a75ba106756d23e", - "_from": "readable-stream@1.1.13", - "_npmVersion": "1.4.23", - "_npmUser": { - "name": "rvagg", - "email": "rod@vagg.org" - }, - "maintainers": [ - { - "name": "isaacs", - "email": "i@izs.me" - }, - { - "name": "tootallnate", - "email": "nathan@tootallnate.net" - }, - { - "name": "rvagg", - "email": "rod@vagg.org" - } - ], - "dist": { - "shasum": "f6eef764f514c89e2b9e23146a75ba106756d23e", - "tarball": "http://registry.npmjs.org/readable-stream/-/readable-stream-1.1.13.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.1.13.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/node_modules/mysql/node_modules/readable-stream/passthrough.js b/node_modules/mysql/node_modules/readable-stream/passthrough.js deleted file mode 100644 index 27e8d8a..0000000 --- a/node_modules/mysql/node_modules/readable-stream/passthrough.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require("./lib/_stream_passthrough.js") diff --git a/node_modules/mysql/node_modules/readable-stream/readable.js b/node_modules/mysql/node_modules/readable-stream/readable.js deleted file mode 100644 index 09b8bf5..0000000 --- a/node_modules/mysql/node_modules/readable-stream/readable.js +++ /dev/null @@ -1,7 +0,0 @@ -exports = module.exports = require('./lib/_stream_readable.js'); -exports.Stream = require('stream'); -exports.Readable = exports; -exports.Writable = require('./lib/_stream_writable.js'); -exports.Duplex = require('./lib/_stream_duplex.js'); -exports.Transform = require('./lib/_stream_transform.js'); -exports.PassThrough = require('./lib/_stream_passthrough.js'); diff --git a/node_modules/mysql/node_modules/readable-stream/transform.js b/node_modules/mysql/node_modules/readable-stream/transform.js deleted file mode 100644 index 5d482f0..0000000 --- a/node_modules/mysql/node_modules/readable-stream/transform.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require("./lib/_stream_transform.js") diff --git a/node_modules/mysql/node_modules/readable-stream/writable.js b/node_modules/mysql/node_modules/readable-stream/writable.js deleted file mode 100644 index e1e9efd..0000000 --- a/node_modules/mysql/node_modules/readable-stream/writable.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require("./lib/_stream_writable.js") diff --git a/node_modules/mysql/node_modules/require-all/.npmignore b/node_modules/mysql/node_modules/require-all/.npmignore deleted file mode 100644 index b95d33c..0000000 --- a/node_modules/mysql/node_modules/require-all/.npmignore +++ /dev/null @@ -1,2 +0,0 @@ -*.un~ -node_modules/ \ No newline at end of file diff --git a/node_modules/mysql/node_modules/require-all/License b/node_modules/mysql/node_modules/require-all/License deleted file mode 100644 index 143bad2..0000000 --- a/node_modules/mysql/node_modules/require-all/License +++ /dev/null @@ -1,19 +0,0 @@ -Copyright (c) 2012 Felix Geisendörfer (felix@debuggable.com) and contributors - - Permission is hereby granted, free of charge, to any person obtaining a copy - of this software and associated documentation files (the "Software"), to deal - in the Software without restriction, including without limitation the rights - to use, copy, modify, merge, publish, distribute, sublicense, and/or sell - copies of the Software, and to permit persons to whom the Software is - furnished to do so, subject to the following conditions: - - The above copyright notice and this permission notice shall be included in - all copies or substantial portions of the Software. - - THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR - IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, - FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE - AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER - LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, - OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN - THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/mysql/node_modules/require-all/Readme.md b/node_modules/mysql/node_modules/require-all/Readme.md deleted file mode 100644 index fce0a7b..0000000 --- a/node_modules/mysql/node_modules/require-all/Readme.md +++ /dev/null @@ -1,25 +0,0 @@ -# require-all - -An easy way to require all files within a directory. - -## Usage - -```js -var controllers = require('require-all')({ - dirname : __dirname + '/controllers', - filter : /(.+Controller)\.js$/, - excludeDirs : /^\.(git|svn)$/ -}); - -// controllers now is an object with references to all modules matching the filter -// for example: -// { HomeController: function HomeController() {...}, ...} -``` - -## Advanced usage - -If your objective is to simply require all .js and .json files in a directory you can just pass a string to require-all: - -``` js -var libs = require('require-all')(__dirname + '/lib'); -``` diff --git a/node_modules/mysql/node_modules/require-all/index.js b/node_modules/mysql/node_modules/require-all/index.js deleted file mode 100644 index b7e1d04..0000000 --- a/node_modules/mysql/node_modules/require-all/index.js +++ /dev/null @@ -1,40 +0,0 @@ -var fs = require('fs'); - -module.exports = function requireAll(options) { - if (typeof options === 'string') { - options = { - dirname: options, - filter: /(.+)\.js(on)?$/, - excludeDirs: /^\.(git|svn)$/ - }; - } - - var files = fs.readdirSync(options.dirname); - var modules = {}; - - function excludeDirectory(dirname) { - return options.excludeDirs && dirname.match(options.excludeDirs); - } - - files.forEach(function (file) { - var filepath = options.dirname + '/' + file; - if (fs.statSync(filepath).isDirectory()) { - - if (excludeDirectory(file)) return; - - modules[file] = requireAll({ - dirname: filepath, - filter: options.filter, - excludeDirs: options.excludeDirs - }); - - } else { - var match = file.match(options.filter); - if (!match) return; - - modules[match[1]] = require(filepath); - } - }); - - return modules; -}; diff --git a/node_modules/mysql/node_modules/require-all/package.json b/node_modules/mysql/node_modules/require-all/package.json deleted file mode 100644 index c7667e8..0000000 --- a/node_modules/mysql/node_modules/require-all/package.json +++ /dev/null @@ -1,65 +0,0 @@ -{ - "author": { - "name": "Felix Geisendörfer", - "email": "felix@debuggable.com", - "url": "http://debuggable.com/" - }, - "name": "require-all", - "description": "An easy way to require all files within a directory.", - "version": "0.0.8", - "scripts": { - "test": "node test/test.js" - }, - "repository": { - "type": "git", - "url": "git://github.com/felixge/node-require-all.git" - }, - "licenses": [ - { - "type": "MIT", - "url": "https://github.com/felixge/node-require-all/blob/master/License" - } - ], - "main": "./index", - "engines": { - "node": "*" - }, - "dependencies": {}, - "devDependencies": { - "semver": "~2.1.0" - }, - "optionalDependencies": {}, - "readme": "# require-all\n\nAn easy way to require all files within a directory.\n\n## Usage\n\n```js\nvar controllers = require('require-all')({\n dirname : __dirname + '/controllers',\n filter : /(.+Controller)\\.js$/,\n excludeDirs : /^\\.(git|svn)$/\n});\n\n// controllers now is an object with references to all modules matching the filter\n// for example:\n// { HomeController: function HomeController() {...}, ...}\n```\n\n## Advanced usage\n\nIf your objective is to simply require all .js and .json files in a directory you can just pass a string to require-all:\n\n``` js\nvar libs = require('require-all')(__dirname + '/lib');\n```\n", - "readmeFilename": "Readme.md", - "bugs": { - "url": "https://github.com/felixge/node-require-all/issues" - }, - "_id": "require-all@0.0.8", - "dist": { - "shasum": "a7d4307d90e422fcb9f04af018c149920074e4b3", - "tarball": "http://registry.npmjs.org/require-all/-/require-all-0.0.8.tgz" - }, - "_from": "require-all@0.0.8", - "_npmVersion": "1.2.32", - "_npmUser": { - "name": "dscape", - "email": "nunojobpinto@gmail.com" - }, - "maintainers": [ - { - "name": "felixge", - "email": "felix@debuggable.com" - }, - { - "name": "thlorenz", - "email": "thlorenz@gmx.de" - }, - { - "name": "dscape", - "email": "nunojobpinto@gmail.com" - } - ], - "directories": {}, - "_shasum": "a7d4307d90e422fcb9f04af018c149920074e4b3", - "_resolved": "https://registry.npmjs.org/require-all/-/require-all-0.0.8.tgz" -} diff --git a/node_modules/mysql/node_modules/require-all/test/controllers/main-Controller.js b/node_modules/mysql/node_modules/require-all/test/controllers/main-Controller.js deleted file mode 100644 index 355ce40..0000000 --- a/node_modules/mysql/node_modules/require-all/test/controllers/main-Controller.js +++ /dev/null @@ -1,4 +0,0 @@ -exports.index = 1; -exports.show = 2; -exports.add = 3; -exports.edit = 4; diff --git a/node_modules/mysql/node_modules/require-all/test/controllers/notthis.js b/node_modules/mysql/node_modules/require-all/test/controllers/notthis.js deleted file mode 100644 index 8ac88c5..0000000 --- a/node_modules/mysql/node_modules/require-all/test/controllers/notthis.js +++ /dev/null @@ -1 +0,0 @@ -exports.yes = 'no'; diff --git a/node_modules/mysql/node_modules/require-all/test/controllers/other-Controller.js b/node_modules/mysql/node_modules/require-all/test/controllers/other-Controller.js deleted file mode 100644 index aec8f24..0000000 --- a/node_modules/mysql/node_modules/require-all/test/controllers/other-Controller.js +++ /dev/null @@ -1,2 +0,0 @@ -exports.index = 1; -exports.show = 'nothing' diff --git a/node_modules/mysql/node_modules/require-all/test/filterdir/root.js b/node_modules/mysql/node_modules/require-all/test/filterdir/root.js deleted file mode 100644 index c9fd536..0000000 --- a/node_modules/mysql/node_modules/require-all/test/filterdir/root.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = { guten: 'tag' }; diff --git a/node_modules/mysql/node_modules/require-all/test/filterdir/sub/hello.js b/node_modules/mysql/node_modules/require-all/test/filterdir/sub/hello.js deleted file mode 100644 index 0174eea..0000000 --- a/node_modules/mysql/node_modules/require-all/test/filterdir/sub/hello.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = { guten: 'abend' }; diff --git a/node_modules/mysql/node_modules/require-all/test/mydir/foo.js b/node_modules/mysql/node_modules/require-all/test/mydir/foo.js deleted file mode 100644 index cb1c2c0..0000000 --- a/node_modules/mysql/node_modules/require-all/test/mydir/foo.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = 'bar'; diff --git a/node_modules/mysql/node_modules/require-all/test/mydir/hello.js b/node_modules/mysql/node_modules/require-all/test/mydir/hello.js deleted file mode 100644 index b1d17c1..0000000 --- a/node_modules/mysql/node_modules/require-all/test/mydir/hello.js +++ /dev/null @@ -1,2 +0,0 @@ -exports.world = true; -exports.universe = 42; diff --git a/node_modules/mysql/node_modules/require-all/test/mydir/sub/config.json b/node_modules/mysql/node_modules/require-all/test/mydir/sub/config.json deleted file mode 100644 index d2b5939..0000000 --- a/node_modules/mysql/node_modules/require-all/test/mydir/sub/config.json +++ /dev/null @@ -1,4 +0,0 @@ -{ - "settingA": "A", - "settingB": "B" -} diff --git a/node_modules/mysql/node_modules/require-all/test/mydir/sub/no.2js b/node_modules/mysql/node_modules/require-all/test/mydir/sub/no.2js deleted file mode 100644 index ec01c2c..0000000 --- a/node_modules/mysql/node_modules/require-all/test/mydir/sub/no.2js +++ /dev/null @@ -1 +0,0 @@ -module.exports = true; diff --git a/node_modules/mysql/node_modules/require-all/test/mydir/sub/yes.js b/node_modules/mysql/node_modules/require-all/test/mydir/sub/yes.js deleted file mode 100644 index ec01c2c..0000000 --- a/node_modules/mysql/node_modules/require-all/test/mydir/sub/yes.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = true; diff --git a/node_modules/mysql/node_modules/require-all/test/test.js b/node_modules/mysql/node_modules/require-all/test/test.js deleted file mode 100644 index 6c086c4..0000000 --- a/node_modules/mysql/node_modules/require-all/test/test.js +++ /dev/null @@ -1,82 +0,0 @@ -var assert = require('assert'); -var semver = require('semver'); -var requireAll = require('..'); - -var controllers = requireAll({ - dirname: __dirname + '/controllers', - filter: /(.+Controller)\.js$/ -}); - -assert.deepEqual(controllers, { - 'main-Controller': { - index: 1, - show: 2, - add: 3, - edit: 4 - }, - - 'other-Controller': { - index: 1, - show: 'nothing' - } -}); - -// -// requiring json only became an option in 0.6+ -// -if (semver.gt(process.version, 'v0.6.0')) { - var mydir = requireAll({ - dirname: __dirname + '/mydir', - filter: /(.+)\.(js|json)$/ - }); - - var mydir_contents = { - foo: 'bar', - hello: { - world: true, - universe: 42 - }, - sub: { - config: { - settingA: 'A', - settingB: 'B' - }, - yes: true - } - }; - - assert.deepEqual(mydir, mydir_contents); - - var defaults = requireAll(__dirname + '/mydir'); - - assert.deepEqual(defaults, mydir_contents); -} - -var unfiltered = requireAll({ - dirname: __dirname + '/filterdir', - filter: /(.+)\.js$/ -}); - -assert(unfiltered['.svn']); -assert(unfiltered.root); -assert(unfiltered.sub); - -var excludedSvn = requireAll({ - dirname: __dirname + '/filterdir', - filter: /(.+)\.js$/, - excludeDirs: /^\.svn$/ -}); - -assert.equal(excludedSvn['.svn'], undefined); -assert.ok(excludedSvn.root); -assert.ok(excludedSvn.sub); - -var excludedSvnAndSub = requireAll({ - dirname: __dirname + '/filterdir', - filter: /(.+)\.js$/, - excludeDirs: /^(\.svn|sub)$/ -}); - -assert.equal(excludedSvnAndSub['.svn'], undefined); -assert.ok(excludedSvnAndSub.root); -assert.equal(excludedSvnAndSub.sub, undefined); diff --git a/node_modules/mysql/package.json b/node_modules/mysql/package.json deleted file mode 100644 index 41f8f53..0000000 --- a/node_modules/mysql/package.json +++ /dev/null @@ -1,106 +0,0 @@ -{ - "name": "mysql", - "description": "A node.js driver for mysql. It is written in JavaScript, does not require compiling, and is 100% MIT licensed.", - "version": "2.5.0", - "license": "MIT", - "author": { - "name": "Felix Geisendörfer", - "email": "felix@debuggable.com", - "url": "http://debuggable.com/" - }, - "contributors": [ - { - "name": "Andrey Sidorov", - "email": "sidorares@yandex.ru" - }, - { - "name": "Douglas Christopher Wilson", - "email": "doug@somethingdoug.com" - }, - { - "name": "Diogo Resende", - "email": "dresende@thinkdigital.pt" - } - ], - "homepage": "https://github.com/felixge/node-mysql", - "repository": { - "type": "git", - "url": "https://github.com/felixge/node-mysql" - }, - "dependencies": { - "bignumber.js": "1.4.1", - "readable-stream": "~1.1.13", - "require-all": "0.0.8" - }, - "devDependencies": { - "istanbul": "0.3.2", - "rimraf": "2.2.8", - "mkdirp": "0.5.0", - "urun": "0.0.8", - "utest": "0.0.8" - }, - "engines": { - "node": ">= 0.6" - }, - "scripts": { - "test": "node test/run.js", - "test-cov": "node test/run-cov.js", - "test-travis": "node test/run-cov.js lcovonly" - }, - "gitHead": "a4dd3dc5df997093c574300f39a8a4b2a24b34a1", - "bugs": { - "url": "https://github.com/felixge/node-mysql/issues" - }, - "_id": "mysql@2.5.0", - "_shasum": "48557327576f2308729bb3d4a16dd1d3f76ee1d4", - "_from": "mysql@2.5.0", - "_npmVersion": "1.4.21", - "_npmUser": { - "name": "dougwilson", - "email": "doug@somethingdoug.com" - }, - "maintainers": [ - { - "name": "felixge", - "email": "felix@debuggable.com" - }, - { - "name": "egorfine", - "email": "me@egorfine.com" - }, - { - "name": "dresende", - "email": "dresende@thinkdigital.pt" - }, - { - "name": "femto113", - "email": "ken.woodruff@gmail.com" - }, - { - "name": "nate.lillich", - "email": "nate@lifewanted.com" - }, - { - "name": "tolgaek", - "email": "tolga.ekmen@gmail.com" - }, - { - "name": "sidorares", - "email": "sidorares@yandex.com" - }, - { - "name": "seanmonstar", - "email": "sean.monstar@gmail.com" - }, - { - "name": "dougwilson", - "email": "doug@somethingdoug.com" - } - ], - "dist": { - "shasum": "48557327576f2308729bb3d4a16dd1d3f76ee1d4", - "tarball": "http://registry.npmjs.org/mysql/-/mysql-2.5.0.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/mysql/-/mysql-2.5.0.tgz" -} diff --git a/node_modules/mysql2/.npmignore b/node_modules/mysql2/.npmignore new file mode 100644 index 0000000..59ee676 --- /dev/null +++ b/node_modules/mysql2/.npmignore @@ -0,0 +1,17 @@ +lib-cov +*.seed +*.log +*.csv +*.dat +*.out +*.pid +*.gz +.DS_Store + +tmp +pids +logs + +node_modules +npm-debug.log + diff --git a/node_modules/mysql2/.travis.yml b/node_modules/mysql2/.travis.yml new file mode 100644 index 0000000..10288b8 --- /dev/null +++ b/node_modules/mysql2/.travis.yml @@ -0,0 +1,7 @@ +language: node_js +before_script: + - mysql -e 'create database if not exists test;' +node_js: + - "0.8" + - "0.10" + - "0.11" diff --git a/node_modules/mysql2/Changelog.md b/node_modules/mysql2/Changelog.md new file mode 100644 index 0000000..aa84625 --- /dev/null +++ b/node_modules/mysql2/Changelog.md @@ -0,0 +1,135 @@ +Backlog: + - Multiple results support in binary protocol #27 + - Apply timezone from config to DATETIME values with no tz #15 + - custom typeCast handlers in generated parser #39 + +HEAD + +0.12.5 - 30/07/2014 + - add 'execute' pool method similar to Pool##query #114 + - more debug output behind debug flag + +0.12.4 - 17/07/2014 + - 'debug' connection option now result in lots of + debug output #112 #77 + - send corectly compression flag if compression is on #102 + + +0.12.3 - 11/07/2014 + - fix node 0.8 - incompatible dependency version + +0.12.2 - 11/07/2014 + + - output milliseconds in date type #107 + - deserialise length coded int with > 24 bit numbers + to js int / float (and not throw "Bignts not supported") #108 + - support for Bigint numbers in insertId + +0.12.1 - 30/04/2014 + + - 'dateStrings' connection option support #99 + - use anonymous function for packet routing instead + of .bind() 3-5% speed improvement + - GEOMETRY type support in bimary protocol #97 + +0.12.0 - 29/04/2014 + + - route connection time errors from handshke command to + connection #96 + + - support for nestTables and rowsAsArray options in query() + and execute() #95, #94 + + - bugfix: date as parameter in prepared statement, + day of week was used incorrectly + instead of day of month #89 ab28dfca839728dfe40d941091902185d7c19b57 + + - GEOMETRY type support ported from node-mysql #93 ebd30fd12b3b7f53d97b9d09f947b12f61e0c2c5 + +0.11.8 + + - add DATE type support #84 1d49651d8e40bf43b79937d9de9b2909126b892c + - faster DATE parsing in text protocol cdfed2881462798bd85fbf906ea604875a3bd625 + + +0.11.7 + - initial implementaion of binlog protocol #83 #78 c8d45da6fc13a56d95ce6d57c3c8aa9524548770 + - interpret null DOUBLE values as null instead 0 #85 4c03b23f30949be0608d9543d69243944d79bb4a + - use srcEscape for null values (bunary parser) ef50bcafa452588eda4a40037b41f6b961085046 + +0.11.6 + - minor cleanups + +0.11.5 + - fix for non-utf strings serialisation (binary protocol only) cf9594aaab5b3d51a112bd1f43b39a55f508eef7 + +0.11.4 + - support YEAR type in prepared statements a0f33b5a4de4529130b3c4137f7a1dd3c02aed9e + +0.11.3 + - add transaction helpers #56, #76 cc0a9f9b721900d3a22c7fc84a5244c74cd33dd5 + +0.11.2 + + - wrap callbacks in nextTick for exception safety b73ac9868804b603a0ab6df6129cf3682476d118 + - domains support #73 36cba61359c83018a847ac4e7748d920b6f863c4 + +0.11.1 + + - buxfix: connection.connect callback was called more than once + #72 0352eefdafc0986f1ec79c0ce285f722ca12af16 + +0.11.0 + - Bundle Amazon RDS cert and allow to connect using e6af097b5facc089f1999c1fb076ada0ce2e7e99 + 'Amazon RDS' as ssl value + +0.10.7 + + - Amazon RDS+ssl example and public CA cert 709394a4afbbaf0500439e72caec5d37e949fe26 + - pool updated from node-mysql #71, #68, #61 db561dbe10a55bb0f9893eb0e2c4b429edd6ee3a + +0.10.6 + - handle TIMESTAMP type #59 6dd6fc82d95a16e18092c4db4e8da225b37e9314 + - rename pool's connection.end() to connection.release() #53 c63b2442e3c0fb5ea3953725ba9c1b3e08b2b831 + +0.10.5 + + - node-mysql compatibility: remove 'number of results in response' + callback argument (Brian White) #46 40af0530403a3892743d32974055c5ea23cbd3ec + - node 0.11 (use on('data') instead of ondata ) 39906c78b85a77e468694814a50f99714d7bbbd6 + - fix again ssl (#41) 713051bf997a186774b618cde583707320a1d551 + +0.10.4 + - node-mysql compatibility: remove 'number of results in response' + callback argument (Brian White) #45 c9cb926360da5e4028f7d2f83f4b4e94897cd8b8 + - 'resultIndex' parameter for non-multiple results query 8879bdde397b6cd730d234383fa322becd1134de + +0.10.3 + - various ssl fixes and refactoring (ssl was broken for some time) 213d375f7263cb6f5e724fdac3ea156ccee4bbd4 + - Server protocol: handle null values serialisation + (Michael Muturi Njonge) #36 831b2a100795f36649f0c3d79b7839a95f771a05 + +0.10.2 + - return DECIMAL and NEWDECIMAL as string in binary prot #40 969fba6ff1dbf14d53d3efc9f94083b8306cf0b5 + +0.10.1 + - Added ping command #38 cbca8648d1282fb57e55b3735c3b4d9a46d89d7b + +0.9.2 + - correctly parse NULL result for string and number #35 0a4ac65ec812f75861dc00c9243921d5d6602914 + - do not pollute global namespace from evaled parser #11 4b6ddaf0f70150945d0fea804db9106f343a0e51 + +0.9.1 + - PoolClaster ported from node-mysql #34 + +0.8.21 + - Fix in error message parsing (Noam Wasersprung) #31 6cc80a67eaa3baac7dd8eee7182c9eb00977e81a + - return insert/delete header for insert/delete commands #32 72aa8fe70981d7410a10edb9d7921e5d6ce1d3ca + +0.8.20 + - Make packet parser work with 0.11 ondata(buffer) with no start,end 9005fd1 + - Allow to use Date-like objects as date parameters (Amir Livneh) 6138dad0581fd5e2c45e1ce0b999e334db8979cf + +0.8.19 + - Multiple results support in text protocol #15 4812adaf1aa5b1dfa775a6cf0fa3bae54a7827d0 + - Use connection flags from createConnection parameters/url string 9218f055ceeb95ae7205348e06c07b89b799d031 diff --git a/node_modules/mysql/License b/node_modules/mysql2/License similarity index 92% rename from node_modules/mysql/License rename to node_modules/mysql2/License index c7ff12a..51c1bf4 100644 --- a/node_modules/mysql/License +++ b/node_modules/mysql2/License @@ -1,4 +1,4 @@ -Copyright (c) 2012 Felix Geisendörfer (felix@debuggable.com) and contributors +Copyright (c) 2013 Andrey Sidorov (sidorares@yandex.ru) and contributors Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal diff --git a/node_modules/mysql2/README.md b/node_modules/mysql2/README.md new file mode 100644 index 0000000..6f606b3 --- /dev/null +++ b/node_modules/mysql2/README.md @@ -0,0 +1,244 @@ +#node-mysql2 + +[![Build Status](https://secure.travis-ci.org/sidorares/node-mysql2.png)](http://travis-ci.org/sidorares/node-mysql2) [![](https://gemnasium.com/sidorares/node-mysql2.png)](https://gemnasium.com/npms/mysql2) [TODO](https://github.com/cainus/node-coveralls): [![](https://coveralls.io/repos/sidorares/node-mysql2/badge.png)](https://coveralls.io/r/sidorares/node-mysql2) + + +Mysql client for node.js. Written in native JavaScript and aims to be mostly api compatible with [node-mysql](https://github.com/felixge/node-mysql) + +[![NPM](https://nodei.co/npm/mysql2.png?downloads=true&stars=true)](https://nodei.co/npm/mysql2/) +[![NPM](https://nodei.co/npm-dl/mysql2.png?months=6)](https://nodei.co/npm/mysql2/) + +## Features + + In addition to client-side query/escape and connection pooling + + - MySQL server API for proxies and mocks + - SSL and compression + - prepared statements + - binlog protocol client + +## Documentation + +See [node-mysql](https://github.com/felixge/node-mysql) documentation. If you see api incompatibilities, please report via github issue. + +## Known incompatibilities with node-mysql + +All numeric types converted to numbers. In contrast to node-mysql `zeroFill` flag is ignored in type conversion +You need to check corresponding field zeroFill flag and convert to string manually if this is of importance to you. + +DECIMAL and NEWDECIMAL types always returned as string + +## Known not yet supported features + +`LOAD DATA INFILE` and `SELECT INTO OUTFILE` +`client.changeUser()` + +## Examples + +Simple select: + +```js +var mysql = require('mysql2'); +var connection = mysql.createConnection({ user: 'test', database: 'test'}); + +connection.query('SELECT 1+1 as test1', function(err, rows) { + // +}); +``` + +Prepared statement and parameters: + +```js +var mysql = require('mysql2'); +var connection = mysql.createConnection({ user: 'test', database: 'test'}); + +connection.execute('SELECT 1+? as test1', [10], function(err, rows) { + // +}); +``` + +Connecting over encrypted connection: + +```js +var fs = require('fs'); +var mysql = require('mysql2'); +var connection = mysql.createConnection({ + user: 'test', + database: 'test', + ssl: { + key: fs.readFileSync('./certs/client-key.pem'), + cert: fs.readFileSync('./certs/client-cert.pem') + } +}); +connection.query('SELECT 1+1 as test1', console.log); +``` + +You can use 'Amazon RDS' string as value to ssl property to connect to Amazon RDS mysql over ssl (in that case http://s3.amazonaws.com/rds-downloads/mysql-ssl-ca-cert.pem CA cert is used) + +``` +var mysql = require('mysql2'); +var connection = mysql.createConnection({ + user: 'foo', + password: 'bar', + host: 'db.id.ap-southeast-2.rds.amazonaws.com', + ssl: 'Amazon RDS' +}); + +conn.query('show status like \'Ssl_cipher\'', function(err, res) { + console.log(err, res); + conn.end(); +}); +``` +Receiving rows as array of columns instead of hash with column name as key: + +```js +var options = {sql: 'select A,B,C,D from foo', rowsAsArray: true}; +connection.query(options, function(err, results) { + /* results will be an array of arrays like this now: + [[ + 'field A value', + 'field B value', + 'field C value', + 'field D value', + ], ...] + */ +}); + +``` + +Connecting using custom stream: + +```js +var net = require('net'); +var mysql = require('mysql2'); +var shape = require('shaper'); +var connection = mysql.createConnection({ + user: 'test', + database: 'test', + stream: net.connect('/tmp/mysql.sock').pipe(shape(10)) // emulate 10 bytes/sec link +}); +connection.query('SELECT 1+1 as test1', console.log); +``` + +Simple mysql proxy server: + +```js +var mysql = require('mysql2'); + +var server = mysql.createServer(); +server.listen(3307); +server.on('connection', function(conn) { + console.log('connection'); + + conn.serverHandshake({ + protocolVersion: 10, + serverVersion: 'node.js rocks', + connectionId: 1234, + statusFlags: 2, + characterSet: 8, + capabilityFlags: 0xffffff + }); + + conn.on('field_list', function(table, fields) { + console.log('field list:', table, fields); + conn.writeEof(); + }); + + var remote = mysql.createConnection({user: 'root', database: 'dbname', host:'server.example.com', password: 'secret'}); + + conn.on('query', function(sql) { + console.log('proxying query:' + sql); + remote.query(sql, function(err) { // overloaded args, either (err, result :object) + // or (err, rows :array, columns :array) + if (Array.isArray(arguments[1])) { + // response to a 'select', 'show' or similar + var rows = arguments[1], columns = arguments[2]; + console.log('rows', rows); + console.log('columns', columns); + conn.writeTextResult(rows, columns); + } else { + // response to an 'insert', 'update' or 'delete' + var result = arguments[1]; + console.log('result', result); + conn.writeOk(result); + } + }); + }); + + conn.on('end', remote.end.bind(remote)); +}); +``` +## MySQL Server API + +### Server + + * **createServer()** - creates server instance + * **Server.listen** - listen port / unix socket (same arguments as [net.Server.listen](http://nodejs.org/api/net.html#net_server_listen_port_host_backlog_callback)) + +events: + + * **connect** - new incoming connection. + +### Connection + + * **serverHandshake({serverVersion, protocolVersion, connectionId, statusFlags, characterSet, capabilityFlags})** - send server handshake initialisation packet, wait handshake response and start listening for commands + * **writeOk({affectedRows: num, insertId: num})** - send [OK packet](http://dev.mysql.com/doc/internals/en/overview.html#packet-OK_Packet) to client + * **writeEof(warnings, statusFlags)** - send EOF packet + * **writeTextResult(rows, fields)** - write query result to client. Rows and fields are in the same format as in `connection.query` callback. + * **writeColumns(fields)** - write fields + EOF packets. + * **writeTextRow(row)** - write array (not hash!) ov values as result row + * TODO: binary protocol + +events: + + * **query(sql)** - query from client + + +## License + + MIT + +## Acknowledgements + + - Internal protocol is written from scratch using my experience with [mysql-native](https://github.com/sidorares/nodejs-mysql-native) + - constants, sql parameters interpolation, pool, connection config class taken from [node-mysql](https://github.com/felixge/node-mysql) (I tried to preserve git history) + - SSL upgrade code based on @TooTallNate [code](https://gist.github.com/TooTallNate/848444) + - Secure connection / compressed connection api flags compatible to [mariasql](https://github.com/mscdex/node-mariasql/) client. + - [contributors](https://github.com/sidorares/node-mysql2/graphs/contributors) + +## Benchmarks + - see [node-mysql-benchmarks](https://github.com/mscdex/node-mysql-benchmarks) + - try to run example [benchmarks](https://github.com/sidorares/node-mysql2/tree/master/benchmarks) on your system + +## Examples using MySQL server API: + + - [Mysql-pg-proxy](https://github.com/sidorares/mysql-pg-proxy) - mysql to postgres proxy server. + - [Mysqlite.js](https://github.com/sidorares/mysqlite.js) - mysql server with JS-only (emscripten compiled) sqlite backend. + - [sql-engine](https://github.com/eugeneware/sql-engine) - mysql server with leveldb backend. + +## See also: + + - [wire protocol documentation](http://dev.mysql.com/doc/internals/en/client-server-protocol.html) + - [node-mysql](https://github.com/felixge/node-mysql) - most popular node.js mysql client library + - [node-mariasql](https://github.com/mscdex/node-mariasql/) - bindings to libmariasql. One of the fastest clients + - [node-libmysqlclident](https://github.com/Sannis/node-mysql-libmysqlclient) - bindings to libmysqlclient + - [mysql-co](https://github.com/sidorares/mysql-co) - wrappers to use mysql2 with generators and [co library](https://github.com/visionmedia/co) + - [mysql-utilities](https://github.com/tshemsedinov/node-mysql-utilities) - useful utilities on top of mysql connection + +## Contributing + +Feel free to create pull requests. +TODO in order of importance: + + - node-mysql api incompatibility fixes + - documentation + - tests + - benchmarks + - bug fixes + - TODOs in source code + - performance improvements + - features + +## Features TODO + - more server side commands support (binary protocol, etc) + - named parameters interpolarion into unnamed parameters translation for prepared statements diff --git a/node_modules/mysql2/benchmarks/FB/create.sql b/node_modules/mysql2/benchmarks/FB/create.sql new file mode 100644 index 0000000..258bfe6 --- /dev/null +++ b/node_modules/mysql2/benchmarks/FB/create.sql @@ -0,0 +1,58 @@ +# create benchmark user +GRANT ALL ON *.* TO 'benchmarkdbuser'@'%' IDENTIFIED BY 'benchmarkdbpass'; + +# modified from SO answer http://stackoverflow.com/questions/5125096/for-loop-in-mysql +DROP DATABASE IF EXISTS hello_world; +CREATE DATABASE hello_world; +USE hello_world; + +DROP TABLE IF EXISTS World; +CREATE TABLE World ( + id int(10) unsigned NOT NULL auto_increment, + randomNumber int NOT NULL default 0, + PRIMARY KEY (id) +) +ENGINE=INNODB; + +DROP PROCEDURE IF EXISTS load_data; + +DELIMITER # +CREATE PROCEDURE load_data() +BEGIN + +declare v_max int unsigned default 10000; +declare v_counter int unsigned default 0; + + TRUNCATE TABLE World; + START TRANSACTION; + while v_counter < v_max do + INSERT INTO World (randomNumber) VALUES ( floor(0 + (rand() * 10000)) ); + SET v_counter=v_counter+1; + end while; + commit; +END # + +DELIMITER ; + +CALL load_data(); + +DROP TABLE IF EXISTS Fortune; +CREATE TABLE Fortune ( + id int(10) unsigned NOT NULL auto_increment, + message varchar(2048) CHARACTER SET 'utf8' NOT NULL, + PRIMARY KEY (id) +) +ENGINE=INNODB; + +INSERT INTO Fortune (message) VALUES ('fortune: No such file or directory'); +INSERT INTO Fortune (message) VALUES ('A computer scientist is someone who fixes things that aren''t broken.'); +INSERT INTO Fortune (message) VALUES ('After enough decimal places, nobody gives a damn.'); +INSERT INTO Fortune (message) VALUES ('A bad random number generator: 1, 1, 1, 1, 1, 4.33e+67, 1, 1, 1'); +INSERT INTO Fortune (message) VALUES ('A computer program does what you tell it to do, not what you want it to do.'); +INSERT INTO Fortune (message) VALUES ('Emacs is a nice operating system, but I prefer UNIX. — Tom Christaensen'); +INSERT INTO Fortune (message) VALUES ('Any program that runs right is obsolete.'); +INSERT INTO Fortune (message) VALUES ('A list is only as strong as its weakest link. — Donald Knuth'); +INSERT INTO Fortune (message) VALUES ('Feature: A bug with seniority.'); +INSERT INTO Fortune (message) VALUES ('Computers make very fast, very accurate mistakes.'); +INSERT INTO Fortune (message) VALUES (''); +INSERT INTO Fortune (message) VALUES ('フレームワークのベンチマーク'); diff --git a/node_modules/mysql2/benchmarks/FB/fortunes.jade b/node_modules/mysql2/benchmarks/FB/fortunes.jade new file mode 100644 index 0000000..31e1864 --- /dev/null +++ b/node_modules/mysql2/benchmarks/FB/fortunes.jade @@ -0,0 +1,10 @@ +!!! 5 +html + head + title Fortunes + body + table + for fortune in fortunes + tr + td= fortune.id + td= fortune.message diff --git a/node_modules/mysql2/benchmarks/FB/hello.js b/node_modules/mysql2/benchmarks/FB/hello.js new file mode 100644 index 0000000..318e271 --- /dev/null +++ b/node_modules/mysql2/benchmarks/FB/hello.js @@ -0,0 +1,292 @@ +var cluster = require('cluster'); +var numCPUs = require('os').cpus().length; + +if(cluster.isMaster) { + // Fork workers. + for (var i = 0; i < numCPUs; i++) { + cluster.fork(); + } + + cluster.on('exit', function(worker, code, signal) { + console.log('worker ' + worker.pid + ' died'); + }); + + return; +} + +var http = require('http'); +var url = require('url'); +var libmysql = require('mysql-libmysqlclient').createConnectionSync(); +var mysql2 = require('../..'); +var mysql = require('mysql'); +var mariasql = require('mariasql'); +var async = require('async'); +var Mapper = require('mapper'); +var jade = require('jade'); +var fs = require('fs'); +var connMap = { user: 'root', password: '', database: 'hello_world', host: 'localhost' }; + +Mapper.connect(connMap, {verbose: false, strict: false}); +var World = Mapper.map("World", "id", "randomNumber"); + +var template = jade.compile(fs.readFileSync('./fortunes.jade')); + +libmysql.connectSync('localhost', 'root', '', 'hello_world'); +pool2 = mysql2.createPool(connMap); +pool1 = mysql.createPool(connMap); +mysql2conn = mysql2.createConnection(connMap); +mysql1conn = mysql.createConnection(connMap); +mariaconn = new mariasql(); +mariaconn.connect({ + host: connMap.host, + user: connMap.user, + password: connMap.password, + db: connMap.database +}); + +function getRandomNumber() { + return Math.floor(Math.random() * 10000) + 1; +} + +function sequelizeQuery(callback) { + World.findById(getRandomNumber(), function (err, world) { + callback(null, world); + }); +} + +function handlePrepared(req, res) { + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var results = []; + for (var i=0; i < queries; ++i) { + mysql2conn.execute("SELECT * FROM world WHERE id = ?", [getRandomNumber()], function (err, rows) { + results.push(rows[0]); + if (results.length == queries) + res.end(JSON.stringify(results)); + }); + } +} + +function handleMysqlIsh(conn, req, res) { + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + //pool.getConnection(function(err, conn) { + //console.log(conn, conn.query, '==============='); + var results = []; + for (var i=0; i < queries; ++i) { + mysql2conn.query("SELECT * FROM world WHERE id = ?", [getRandomNumber()], function (err, rows) { + results.push(rows[0]); + if (results.length == queries) + res.end(JSON.stringify(results)); + }); + } + //}); +} + +function handleMysqlIshPool(pool, req, res) { + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var results = []; + for (var i=0; i < queries; ++i) { + pool.getConnection(function(err, conn) { + mysql2conn.query("SELECT * FROM world WHERE id = " + getRandomNumber(), function (err, rows) { + results.push(rows[0]); + if (results.length == queries) + res.end(JSON.stringify(results)); + }); + }); + } +} + +function handleMaria(req, res) +{ + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var results = []; + for (var i=0; i < queries; ++i) { + mariaconn.query("SELECT * FROM world WHERE id = :id", { id: getRandomNumber() } ) + .on('result', function (dbres) { + dbres.on('row', function(row) { + results.push(row); + if (results.length == queries) + res.end(JSON.stringify(results)); + }); + }); + } +} + +function fortuneMysql(conn, res) { + var fortunes = []; + res.writeHead(200, {'Content-Type': 'text/html'}); + conn.query('select * from Fortune', function(err, fortunes) { + fortunes.push({id: 0, message: "Additional fortune added at request time."}); + fortunes.sort(sortFortunes); + res.end(template({fortunes: fortunes})); + }); +} + +function fortuneMaria(res) { + fortunes = []; + res.writeHead(200, {'Content-Type': 'text/html'}); + mariaconn.query("SELECT * from Fortune") + .on('result', function (dbres) { + dbres.on('row', function(row) { fortunes.push(row); }); + dbres.on('end', function() { + fortunes.push({id: 0, message: "Additional fortune added at request time."}); + fortunes.sort(sortFortunes); + res.end(template({fortunes: fortunes})); + }); + }); +} + +function sortFortunes(a, b) { + return (a.message < b.message) ? -1 : (a.message > b.message) ? 1 : 0; +} + +http.createServer(function (req, res) { + // JSON response object + var hello = {message: "Hello, world"}; + + var path = url.parse(req.url).pathname; + + switch (path) { + case '/json': + // JSON Response Test + res.writeHead(200, {'Content-Type': 'application/json; charset=UTF-8'}); + // Write JSON object to response + res.end(JSON.stringify(hello)); + break; + + case '/mysql-orm': + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var queryFunctions = new Array(queries); + + for (var i = 0; i < queries; i += 1) { + queryFunctions[i] = sequelizeQuery; + } + + res.writeHead(200, {'Content-Type': 'application/json'}); + + async.parallel(queryFunctions, function(err, results) { + res.end(JSON.stringify(results)); + }); + break; + + case '/mysql': + res.writeHead(200, {'Content-Type': 'application/json'}); + + function libmysqlQuery(callback) { + libmysql.query("SELECT * FROM world WHERE id = " + getRandomNumber(), function (err, res) { + if (err) { + throw err; + } + + res.fetchAll(function(err, rows) { + if (err) { + throw err; + } + + res.freeSync(); + callback(null, rows[0]); + }); + }); + } + + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var queryFunctions = new Array(queries); + + for (var i = 0; i < queries; i += 1) { + queryFunctions[i] = libmysqlQuery; + } + async.parallel(queryFunctions, function(err, results) { + if (err) { + res.writeHead(500); + return res.end('MYSQL CONNECTION ERROR.'); + } + res.end(JSON.stringify(results)); + }); + break; + + case '/mysql2': + handleMysqlIsh(mysql2conn, req, res); + break; + + case '/fortunes-mysql2': + fortuneMysql(mysql2conn, res); + break; + + case '/fortunes-mysql1': + fortuneMysql(mysql1conn, res); + break; + + case '/fortunes-maria': + fortuneMaria(res); + break; + + case '/mysql2pool': + handleMysqlIshPool(pool2, req, res); + break; + + case '/mysql2ps': + handlePrepared(req, res); + break; + + case '/mysql1': + handleMysqlIsh(mysql1conn, req, res); + break; + + case '/maria': + handleMaria(req, res); + break; + + case '/update': + res.writeHead(200, {'Content-Type': 'application/json'}); + + function libmysqlQuery(callback) { + libmysql.query("SELECT * FROM world WHERE id = " + getRandomNumber(), function (err, res) { + if (err) { + throw err; + } + + res.fetchAll(function(err, rows) { + if (err) { + throw err; + } + + res.freeSync(); + + rows[0].randomNumber = getRandomNumber(); + libmysql.query("UPDATE World SET randomNumber = " + rows[0].randomNumber + " WHERE id = " + rows[0]['id'], function (err, res) { + if (err) { + throw err; + } + }); + callback(null, rows[0]); + }); + }); + } + + var values = url.parse(req.url, true); + var queries = values.query.queries || 1; + var queryFunctions = new Array(queries); + + for (var i = 0; i < queries; i += 1) { + queryFunctions[i] = libmysqlQuery; + } + async.parallel(queryFunctions, function(err, results) { + if (err) { + res.writeHead(500); + return res.end('MYSQL CONNECTION ERROR.'); + } + res.end(JSON.stringify(results)); + }); + break; + + default: + // File not found handler + res.writeHead(404, {'Content-Type': 'text/html; charset=UTF-8'}); + res.end("NOT IMPLEMENTED"); + } +}).listen(8080); diff --git a/node_modules/mysql2/benchmarks/FB/package.json b/node_modules/mysql2/benchmarks/FB/package.json new file mode 100644 index 0000000..e501365 --- /dev/null +++ b/node_modules/mysql2/benchmarks/FB/package.json @@ -0,0 +1,14 @@ +{ + "name": "application-name", + "version": "0.0.1", + "private": true, + "dependencies": { + "async": "0.2.5", + "mysql-libmysqlclient": "1.5.2", + "mysql2": "0.7.0", + "mariasql": "0.1.18", + "mapper": "0.2.4-pre", + "jade": "~0.30.0" + }, + "main": "hello.js" +} diff --git a/node_modules/mysql2/benchmarks/bench-fake-server-maria.js b/node_modules/mysql2/benchmarks/bench-fake-server-maria.js new file mode 100644 index 0000000..d167cbe --- /dev/null +++ b/node_modules/mysql2/benchmarks/bench-fake-server-maria.js @@ -0,0 +1,63 @@ +var common = require('../test/common'); + + var Client = require('mariasql'); + var connection = new Client(); + connection.connect({ + host: '127.0.0.1', + port: 3333, + user: 'root', + password: '', + db: 'test' + }); + + +var assert = require('assert'); + +function benchmarkSelect(numLeft, callback) { + numRows = 0; + var q = connection.query('select 1+1 as qqq'); + q.on('result', function(res) { + //console.log("result!"); + //console.log(res); + + res.on('row', function(r) { + //console.log(r); + numRows++; + }); + + res.on('end', function() { + if (numLeft > 1) + benchmarkSelect(numLeft-1, callback); + else + callback(numRows); + }); + }); +} + +function benchmarkSelects(n, cb) { + var numSelects = 100; + var start = process.hrtime(); + benchmarkSelect(numSelects, function(rowsPerQuery) { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(' rows: ' + numSelects*1e9/diff + ' results/sec, ' + rowsPerQuery*numSelects*1e9/diff + ' rows/sec'); + if (n > 1) + benchmarkSelects(n - 1, cb); + else + cb(); + }); +} + +module.exports = function(done) { + console.log('connected'); + var testStart = process.hrtime(); + benchmarkSelects(5, function() { + var testEnd = process.hrtime(); + console.log('total time: ', common.hrdiff(testStart, testEnd)/1e9 ); + connection.end(); + if (done) + done(); + }); +}; + +connection.on('connect', module.exports); diff --git a/node_modules/mysql2/benchmarks/bench-fake-server.js b/node_modules/mysql2/benchmarks/bench-fake-server.js new file mode 100644 index 0000000..a4b5cb5 --- /dev/null +++ b/node_modules/mysql2/benchmarks/bench-fake-server.js @@ -0,0 +1,60 @@ +var common = require('../test/common'); +var connection = common.createConnection(); +var assert = require('assert'); + +// ==== simple pool === +var connections = new Array(10); +for (var i=0; i < connections.length; ++i) + connections[i] = common.createConnection(); +var currConn = 0; +function next() { + currConn++; + if (currConn == connections.length) + currConn = 0; + connection = connections[currConn]; +} +// ====================== + +function benchmarkSelect(numLeft, callback) { + //connection.query('query from fake server fixture', function(err, result) { + + // comment if no pool: + next(); + + var rows = 0; + var q = connection.query('query from fake server fixture'); + q.on('result', function() { rows++; }); + q.on('end', function() { + if (numLeft > 1) + benchmarkSelect(numLeft-1, callback); + else + callback(rows); + }); +} + +function benchmarkSelects(n, cb) { + var numSelects = 100000; + var start = process.hrtime(); + benchmarkSelect(numSelects, function(rowsPerQuery) { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(' rows: ' + numSelects*1e9/diff + ' results/sec, ' + rowsPerQuery*numSelects*1e9/diff + ' rows/sec'); + if (n > 1) + benchmarkSelects(n - 1, cb); + else + cb(); + }); +} + +module.exports = function(done) { + var testStart = process.hrtime(); + benchmarkSelects(5, function() { + var testEnd = process.hrtime(); + console.log('total time: ', common.hrdiff(testStart, testEnd)/1e9 ); + connection.end(); + if (done) + done(); + }); +}; + + module.exports(); diff --git a/node_modules/mysql2/benchmarks/bench-insert-select-parallel.js b/node_modules/mysql2/benchmarks/bench-insert-select-parallel.js new file mode 100644 index 0000000..e9a9d52 --- /dev/null +++ b/node_modules/mysql2/benchmarks/bench-insert-select-parallel.js @@ -0,0 +1,80 @@ +var common = require('../test/common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var table = 'insert_test'; +//var text = "本日は晴天なり"; +var text = "test abc xyz"; +connection.query('drop table ' + table).on('error', function() {}); +connection.query([ + 'CREATE TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255) NOT NULL,', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +function benchmarkInsert(numLeft, callback) { + connection.query('INSERT INTO ' + table + ' SET title="' + text + '"', function(err, result) { + if (err) throw err; + if (numLeft > 1) + benchmarkInsert(numLeft-1, callback); + else + callback(); + }); +} + +function benchmarkInserts(n, cb) { + var numInsert = 50000; + var start = process.hrtime(); + benchmarkInsert(numInsert, function() { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(numInsert*1e9/diff + ' inserts/sec'); + if (n > 1) + benchmarkInserts(n - 1, cb); + else + cb(); + }); +} + +function benchmarkParallelSelects(n, size, cb) { + var start = process.hrtime(); + var numRunning = 0; + + function commandDone() { + console.log(numRunning); + numRunning--; + if (numRunning > 0) + return; + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(size + ' rows: ' + n*1e9/diff + ' results/sec, ' + size*n*1e9/diff + ' rows/sec'); + cb(); + } + + var connections = new Array(n); + for (var i=0; i < n; ++i) + { + numRunning++; + connections[i] = common.createConnection(); + var cmd = connections[i].execute('select * from ' + table + ' limit ' + size, []); + cmd.on('end', commandDone); + } +} + +module.exports = function(done) { + var testStart = process.hrtime(); + benchmarkInserts(1, function() { + benchmarkParallelSelects(8, 50000, function() { + var testEnd = process.hrtime(); + console.log('total time: ', common.hrdiff(testStart, testEnd)/1e9 ); + if (done) + done(); + }); + }); +}; + +if (require.main === module) { + module.exports(); +} diff --git a/node_modules/mysql2/benchmarks/bench-insert-select-prepared.js b/node_modules/mysql2/benchmarks/bench-insert-select-prepared.js new file mode 100644 index 0000000..5715ec5 --- /dev/null +++ b/node_modules/mysql2/benchmarks/bench-insert-select-prepared.js @@ -0,0 +1,83 @@ +var common = require('../test/common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var table = 'insert_test'; +//var text = "本日は晴天なり"; +var text = "test abc xyz"; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +function benchmarkInsert(numLeft, callback) { + connection.execute('INSERT INTO ' + table + ' SET title="' + text + '"', [], function(err, result) { + if (err) throw err; + if (numLeft > 1) + benchmarkInsert(numLeft-1, callback); + else + callback(); + }); +} + +function benchmarkInserts(n, cb) { + var numInsert = 10000; + var start = process.hrtime(); + benchmarkInsert(numInsert, function() { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(numInsert*1e9/diff + ' inserts/sec'); + if (n > 1) + benchmarkInserts(n - 1, cb); + else + cb(); + }); +} + +function benchmarkSelect(numLeft, numSelect, callback) { + connection.execute('select * from ' + table + ' limit ' + numSelect, [], function(err, result) { + if (err) throw err; + if (numLeft > 1) + benchmarkSelect(numLeft-1, numSelect, callback); + else + callback(); + }); +} + +function benchmarkSelects(n, size, cb) { + var numSelects = 100; + var start = process.hrtime(); + benchmarkSelect(numSelects, size, function() { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(size + ' rows: ' + numSelects*1e9/diff + ' results/sec, ' + size*numSelects*1e9/diff + ' rows/sec'); + if (n > 1) + benchmarkSelects(n - 1, size, cb); + else + cb(); + }); +} + +module.exports = function(done) { + var testStart = process.hrtime(); + benchmarkInserts(1, function() { + benchmarkSelects(5, 100, function() { + benchmarkSelects(10, 1000, function() { + benchmarkSelects(2, 50000, function() { + var testEnd = process.hrtime(); + console.log('total time: ', common.hrdiff(testStart, testEnd)/1e9 ); + connection.end(); + if (done) + done(); + }); + }); + }); + }); +}; + +if (require.main === module) { + module.exports(); +} diff --git a/node_modules/mysql2/benchmarks/bench-insert-select.js b/node_modules/mysql2/benchmarks/bench-insert-select.js new file mode 100644 index 0000000..e1910e1 --- /dev/null +++ b/node_modules/mysql2/benchmarks/bench-insert-select.js @@ -0,0 +1,82 @@ +var common = require('../test/common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var table = 'insert_test'; +var text = "本日は晴天なり"; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +function benchmarkInsert(numLeft, callback) { + connection.query('INSERT INTO ' + table + ' SET title="' + text + '"', function(err, result) { + if (err) throw err; + if (numLeft > 1) + benchmarkInsert(numLeft-1, callback); + else + callback(); + }); +} + +function benchmarkInserts(n, cb) { + var numInsert = 10000; + var start = process.hrtime(); + benchmarkInsert(numInsert, function() { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(numInsert*1e9/diff + ' inserts/sec'); + if (n > 1) + benchmarkInserts(n - 1, cb); + else + cb(); + }); +} + +function benchmarkSelect(numLeft, numSelect, callback) { + connection.query('select * from ' + table + ' limit ' + numSelect, function(err, result) { + if (err) throw err; + if (numLeft > 1) + benchmarkSelect(numLeft-1, numSelect, callback); + else + callback(); + }); +} + +function benchmarkSelects(n, size, cb) { + var numSelects = 100; + var start = process.hrtime(); + benchmarkSelect(numSelects, size, function() { + var end = process.hrtime(); + var diff = common.hrdiff(start, end); + console.log(size + ' rows: ' + numSelects*1e9/diff + ' results/sec, ' + size*numSelects*1e9/diff + ' rows/sec'); + if (n > 1) + benchmarkSelects(n - 1, size, cb); + else + cb(); + }); +} + +module.exports = function(done) { + var testStart = process.hrtime(); + benchmarkInserts(5, function() { + benchmarkSelects(5, 10000, function() { + benchmarkSelects(10, 1000, function() { + benchmarkSelects(2, 50000, function() { + var testEnd = process.hrtime(); + console.log('total time: ', common.hrdiff(testStart, testEnd)/1e9 ); + connection.end(); + if (done) + done(); + }); + }); + }); + }); +}; + +if (require.main === module) { + module.exports(); +} diff --git a/node_modules/mysql2/benchmarks/benchmark-query.js b/node_modules/mysql2/benchmarks/benchmark-query.js new file mode 100644 index 0000000..7ce15f8 --- /dev/null +++ b/node_modules/mysql2/benchmarks/benchmark-query.js @@ -0,0 +1,34 @@ +var assert = require('assert'); +var createConnection = require('../test/common').createConnection; + +var sql = process.argv[2]; + +(function(cb) { + var db = createConnection(); + + var left = 10000; + var start = Date.now(); + var prev1000 = start; + function bench() + { + db.query(sql).on('end', function(err, res) { + left--; + if (left % 1000 === 0) + { + var curTime = Date.now(); + var last1000time = curTime - prev1000; + prev1000 = curTime; + console.error( (1000000/last1000time) + ' req/sec' ); + } + + if (left > 0) + bench(); + else { + console.error( 10000000/(Date.now() - start) + ' req/sec (average 10000 reqs)'); + db.end(); + if (cb) cb(); + } + }); + } + bench(); +})(); diff --git a/node_modules/mysql2/benchmarks/benchmark-server.js b/node_modules/mysql2/benchmarks/benchmark-server.js new file mode 100644 index 0000000..d05b3b1 --- /dev/null +++ b/node_modules/mysql2/benchmarks/benchmark-server.js @@ -0,0 +1,72 @@ +var mysql = require('../index.js'); +var flags = require('../lib/constants/client'); +var Packets = require('../lib/packets/index.js'); +var Packet = require('../lib/packets/packet'); + +function prepareReply(columns, row, n) { + var length = 0; + var rsHeader = Packets.ResultSetHeader.toPacket(columns.length); + length += rsHeader.length(); + var columnPackets = []; + columns.forEach(function(column) { + var packet = Packets.ColumnDefinition.toPacket(column); + length += packet.length(); + columnPackets.push(packet); + }); + var eof = Packets.EOF.toPacket(); + length += 2*eof.length(); + var rowPacket = Packets.TextRow.toPacket(row); + length += n*rowPacket.length(); + + var replyBuffer = new Buffer(length); + var offset = 0; + var id = 1; + function add(packet) { + packet.writeHeader(id); + id = id + 1; + packet.buffer.copy(replyBuffer, offset); + offset += packet.length(); + } + + var i; + add(rsHeader); + for (i=0; i < columns.length; ++i) + add(columnPackets[i]); + add(eof); + for (i=0; i < n; ++i) + add(rowPacket); + add(eof); + + return replyBuffer; +} + +var buff = prepareReply([{ + catalog: 'def', + schema: 'test', + table: 'test_table', + orgTable: 'test_table', + name: 'beta', + orgName: 'beta', + characterSet: 33, + columnLength: 384, + columnType: 3, //253, + flags: 0, + decimals: 0 + }], ['12345'], 1); + +var server = mysql.createServer(); +server.listen('/tmp/mybench3.sock'); +server.on('connection', function(conn) { + conn.serverHandshake({ + protocolVersion: 10, + serverVersion: 'node.js rocks', + connectionId: 1234, + statusFlags: 2, + characterSet: 8, + capabilityFlags: 0xffffff + }); + conn.on('query', function(query) { + //console.log(query); + conn.write(buff); + }); +}); diff --git a/node_modules/mysql2/benchmarks/http-select-and-render.js b/node_modules/mysql2/benchmarks/http-select-and-render.js new file mode 100644 index 0000000..bfb9252 --- /dev/null +++ b/node_modules/mysql2/benchmarks/http-select-and-render.js @@ -0,0 +1,39 @@ +var http = require('http'); +var fs = require('fs'); +var common = require('../test/common'); +var url = require('url'); + +var conn = common.createConnection(); +var render = common.createTemplate(); +var port = process.env.PORT; + +http.createServer(function(req, res) { + var q = url.parse(req.url, true); + if (q.pathname == '/render') { + + var sql = q.query.q; + var n = q.query.n; + var rowsTotal = []; + var doQueries = function(number) { + if (number === 0) { + var body = render({ records: rowsTotal}); + res.writeHead(200, { + 'Content-Length': body.length, + 'Content-Type': 'text/html' } + ); + res.end(body); + } else { + conn.query(sql, function(err, rows) { + // TODO: handle error + rowsTotal = rowsTotal.concat(rows); + doQueries(number-1); + }); + } + }; + doQueries(n); + + } else { + res.writeHead(404); + res.end(); + } +}).listen(port || 1234); diff --git a/node_modules/mysql2/benchmarks/httperf.sh b/node_modules/mysql2/benchmarks/httperf.sh new file mode 100644 index 0000000..85630ef --- /dev/null +++ b/node_modules/mysql2/benchmarks/httperf.sh @@ -0,0 +1 @@ +httperf --port=1234 --uri='/render?q=select%20*%20from%20foos%20limit%205,10000&n=2' --num-conns=10 --num-calls=2 rate=100 diff --git a/node_modules/mysql2/benchmarks/ping-pong-client.js b/node_modules/mysql2/benchmarks/ping-pong-client.js new file mode 100644 index 0000000..64a6717 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ping-pong-client.js @@ -0,0 +1,18 @@ +var net = require('net'); +var count = 0; +var byte = new Buffer([0x33]); +function pong() +{ + count++; + this.write(byte); +} + +var c = net.connect(3334); +c.setNoDelay(true); +c.ondata = pong; +pong.apply(c); + +setInterval(function() { + console.log(count); + count = 0; +}, 1000); diff --git a/node_modules/mysql2/benchmarks/ping-pong-server.js b/node_modules/mysql2/benchmarks/ping-pong-server.js new file mode 100644 index 0000000..7eb9071 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ping-pong-server.js @@ -0,0 +1,12 @@ +var net = require('net'); + +var byte = new Buffer([0x33]); +function pong() +{ + this.write(byte); +} + +net.createServer(function(s) { + s.setNoDelay(true); + s.ondata = pong; +}).listen(3334); diff --git a/node_modules/mysql2/benchmarks/ping-pong-uv.js b/node_modules/mysql2/benchmarks/ping-pong-uv.js new file mode 100644 index 0000000..973284c --- /dev/null +++ b/node_modules/mysql2/benchmarks/ping-pong-uv.js @@ -0,0 +1,30 @@ +var count = 0; +var byte = new Buffer([0x33]); + +function ping(buffer, offset, length) { + count++; + pong(this); +} + +function noop() {} +function pong(sock) +{ + var writeReq = sock.writeBuffer(byte); + writeReq.oncomplete = noop; +} + +var port = 3334; +var TCP = process.binding('tcp_wrap').TCP; +var client = new TCP(); +var req = client.connect('127.0.0.1', port); +req.oncomplete = function() { + console.log('connected'); + pong(client); +}; +client.onread = ping; +client.readStart(); + +setInterval(function() { + console.log(count); + count = 0; +}, 1000); diff --git a/node_modules/mysql2/benchmarks/ruby-mysql2/bench.rb b/node_modules/mysql2/benchmarks/ruby-mysql2/bench.rb new file mode 100644 index 0000000..beb0682 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ruby-mysql2/bench.rb @@ -0,0 +1,29 @@ +require 'rubygems' +require 'benchmark' +require 'mysql2' +require 'haml' + +number_of = 1 +database = 'test' +sql = "SELECT * FROM mysql2_test LIMIT 1" + +Benchmark.bmbm do |x| + mysql2 = Mysql2::Client.new(:host => "localhost", :username => "root") + mysql2.query "USE #{database}" + x.report "Mysql2 (cast: true)" do + number_of.times do + mysql2_result = mysql2.query sql, :symbolize_keys => true, :cast => true + puts haml :index, :locals => { :rows => mysqql2_result } + end + end + + x.report "Mysql2 (cast: false)" do + number_of.times do + mysql2_result = mysql2.query sql, :symbolize_keys => true, :cast => false + mysql2_result.each do |res| + # puts res.inspect + end + end + end + +end diff --git a/node_modules/mysql2/benchmarks/ruby-mysql2/benchmark-query.js b/node_modules/mysql2/benchmarks/ruby-mysql2/benchmark-query.js new file mode 100644 index 0000000..4e16cd5 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ruby-mysql2/benchmark-query.js @@ -0,0 +1,56 @@ +var assert = require('assert'); +var createConnection = require('../../test/common').createConnection; + +var sql = process.argv[2]; +var starthr = process.hrtime(); +var haml = require('hamljs'); +var fs = require('fs'); + +var render = haml.compile(fs.readFileSync('./views/index.haml')); + +l = 0; +var rowsReceived = 0; +var numRequests = 0; + +(function(cb) { + var db = createConnection(); + + var left = 1; + + var start = Date.now(); + var prev1000 = start; + function bench() + { + //db.query(sql).on('end', function(err, res) { + db.query(sql, function(err, res) { + //db.execute(sql, function(err, res) { + + rowsReceived += res.length; + numRequests++; + + l += render({results: res}).length; + console.log(render({results: res})); + + left--; + if (left % 1000 === 0) + { + var curTime = Date.now(); + var last1000time = curTime - prev1000; + prev1000 = curTime; + console.error( (1000000/last1000time) + ' req/sec' ); + } + + if (left > 0) + bench(); + else { + console.error( numRequests *1000/(Date.now() - start) + ' req/sec (average 10000 reqs)'); + console.error( rowsReceived*1000/(Date.now() - start) + ' row/sec (average 10000 reqs)'); + db.end(); + if (cb) cb(); + console.log(process.hrtime(starthr)); + console.log(l); + } + }); + } + bench(); +})(); diff --git a/node_modules/mysql2/benchmarks/ruby-mysql2/populate.js b/node_modules/mysql2/benchmarks/ruby-mysql2/populate.js new file mode 100644 index 0000000..64afb36 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ruby-mysql2/populate.js @@ -0,0 +1,82 @@ +var common = require('../../test/common'); +var connection = common.createConnection(); +var assert = require('assert'); +var Faker = require('charlatan'); +var fs = require('fs'); + +var createSql = fs.readFileSync('./schema.sql').toString(); + +// use seed to make it consistent between runs +// copy-paste from http://stackoverflow.com/questions/521295/javascript-random-seeds + +var m_w = 123456789; +var m_z = 987654321; +var mask = 0xffffffff; + +// Takes any integer +function seed(i) { + m_w = i; +} + +// Returns number between 0 (inclusive) and 1.0 (exclusive), +// just like Math.random(). +function rand() +{ + m_z = (36969 * (m_z & 65535) + (m_z >> 16)) & mask; + m_w = (18000 * (m_w & 65535) + (m_w >> 16)) & mask; + var result = ((m_z << 16) + m_w) & mask; + result /= 4294967296; + return result + 0.5; +} + +seed(123); + +connection.query(createSql); +connection.query("DELETE FROM mysql2_test"); + +function insertRow(r) { + connection.query("INSERT INTO mysql2_test SET ? ", r); +} + +var num_rows = 10000; + +var five_words, twenty5_paragraphs; +for (var i = 0; i < num_rows; ++i) +{ + five_words = Faker.Lorem.words(1 + rand(4)).join(' ').slice(0, 10); + twenty5_paragraphs = Faker.Lorem.paragraphs(1 + rand(24)).join(' '); + insertRow({ + bit_test: 1, + tiny_int_test: rand(128), + small_int_test: rand(32767), + medium_int_test: rand(8388607), + int_test: rand(2147483647), + big_int_test: rand(9223372036854775807), + float_test: rand(32767)/1.87, + float_zero_test: 0.0, + double_test: rand(8388607)/1.87, + decimal_test: rand(8388607)/1.87, + decimal_zero_test: 0, + date_test: '2010-4-4', + date_time_test: '2010-4-4 11:44:00', + timestamp_test: '2010-4-4 11:44:00', + time_test: '11:44:00', + year_test: 14, + char_test: five_words, + varchar_test: five_words, + binary_test: five_words, + varbinary_test: five_words, + tiny_blob_test: five_words, + tiny_text_test: Faker.Lorem.paragraph(rand(5)), + blob_test: twenty5_paragraphs, + text_test: twenty5_paragraphs, + medium_blob_test: twenty5_paragraphs, + medium_text_test: twenty5_paragraphs, + long_blob_test: twenty5_paragraphs, + long_text_test: twenty5_paragraphs, + enum_test: ['val1', 'val2'][rand(2)], + set_test: ['val1', 'val2', 'val1,val2'][rand(3)] + }); +} + +connection.end(); diff --git a/node_modules/mysql2/benchmarks/ruby-mysql2/schema.sql b/node_modules/mysql2/benchmarks/ruby-mysql2/schema.sql new file mode 100644 index 0000000..541a122 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ruby-mysql2/schema.sql @@ -0,0 +1,33 @@ + CREATE TABLE IF NOT EXISTS mysql2_test ( + null_test VARCHAR(10), + bit_test BIT, + tiny_int_test TINYINT, + small_int_test SMALLINT, + medium_int_test MEDIUMINT, + int_test INT, + big_int_test BIGINT, + float_test FLOAT(10,3), + float_zero_test FLOAT(10,3), + double_test DOUBLE(10,3), + decimal_test DECIMAL(10,3), + decimal_zero_test DECIMAL(10,3), + date_test DATE, + date_time_test DATETIME, + timestamp_test TIMESTAMP, + time_test TIME, + year_test YEAR(4), + char_test CHAR(10), + varchar_test VARCHAR(10), + binary_test BINARY(10), + varbinary_test VARBINARY(10), + tiny_blob_test TINYBLOB, + tiny_text_test TINYTEXT, + blob_test BLOB, + text_test TEXT, + medium_blob_test MEDIUMBLOB, + medium_text_test MEDIUMTEXT, + long_blob_test LONGBLOB, + long_text_test LONGTEXT, + enum_test ENUM('val1', 'val2'), + set_test SET('val1', 'val2') + ) DEFAULT CHARSET=utf8 diff --git a/node_modules/mysql2/benchmarks/ruby-mysql2/views/index.haml b/node_modules/mysql2/benchmarks/ruby-mysql2/views/index.haml new file mode 100644 index 0000000..d958d89 --- /dev/null +++ b/node_modules/mysql2/benchmarks/ruby-mysql2/views/index.haml @@ -0,0 +1,41 @@ +!!! +%html + %head + %title table dump goes here + %body + %h1 data data + %table + %tbody + - each row in results + %tr + %td= row.null_test + %td= row.bit_test + %td= row.tiny_int_test + %td= row.small_int_test + %td= row.medium_int_test + %td= row.int_test + %td= row.big_int_test + %td= row.float_test + %td= row.float_zero_test + %td= row.double_test + %td= row.decimal_test + %td= row.decimal_zero_test + %td= row.date_test + %td= row.date_time_test + %td= row.timestamp_test + %td= row.time_test + %td= row.year_test + %td= row.char_test + %td= row.varchar_test + %td= row.binary_test + %td= row.varbinary_test + %td= row.tiny_blob_test + %td= row.tiny_text_test + %td= row.blob_test + %td= row.text_test + %td= row.medium_blob_test + %td= row.medium_text_test + %td= row.long_blob_test + %td= row.long_text_test + %td= row.enum_test + %td= row.set_test diff --git a/node_modules/mysql2/benchmarks/test-benchmark-select-1.js b/node_modules/mysql2/benchmarks/test-benchmark-select-1.js new file mode 100644 index 0000000..842771c --- /dev/null +++ b/node_modules/mysql2/benchmarks/test-benchmark-select-1.js @@ -0,0 +1,32 @@ +var assert = require('assert'); +var createConnection = require('../common').createConnection; + +(function(cb) { + var db = createConnection(); + + var left = 10000; + var start = Date.now(); + var prev1000 = start; + function bench() + { + db.query('select 1').on('end', function(err, res) { + left--; + if (left % 1000 === 0) + { + var curTime = Date.now(); + var last1000time = curTime - prev1000; + prev1000 = curTime; + console.error( (1000000/last1000time) + ' req/sec' ); + } + + if (left > 0) + bench(); + else { + console.error( 10000000/(Date.now() - start) + ' req/sec (average 10000 reqs)'); + db.end(); + if (cb) cb(); + } + }); + } + bench(); +})(); diff --git a/node_modules/mysql2/debug.md b/node_modules/mysql2/debug.md new file mode 100644 index 0000000..e63acbf --- /dev/null +++ b/node_modules/mysql2/debug.md @@ -0,0 +1,39 @@ +# Debugging driver issues + +You can enable debug output using `debug` config option: + +```js +var conn = mysql.createConnection({ + port: 3306, + host: '1.2.3.4', + debug: true // <--- +} +``` +Also you can make additional information available during initialization if you +sert enfironment variable `NODE_DEBUG` + +## Interpreting debug log + +``` +Add command: Connection +Add command: query + ==> Connection#handshakeInit(0,,78) + <== Connection#handshakeInit(1,HandshakeResponse,67) + ==> Connection#handshakeResult(2,maybeOK,7) +Sending query command: select * from mil limit 10 + <== query#start(0,Query,31) + ==> query#resultsetHeader(1,,1) + ==> query#readField(2,,36) + ==> query#fieldsEOF(3,EOF,5) + ==> query#row(4,,2) + ==> query#row(5,,2) + ==> query#row(6,,2) + ==> query#row(7,,2) + ==> query#row(8,,2) + ==> query#row(9,,2) + ==> query#row(10,,2) + ==> query#row(11,,2) + ==> query#row(12,,2) + ==> query#row(13,,3) + ==> query#row(14,EOF,5) + ``` diff --git a/node_modules/mysql2/dump.rdb b/node_modules/mysql2/dump.rdb new file mode 100644 index 0000000..e17870c Binary files /dev/null and b/node_modules/mysql2/dump.rdb differ diff --git a/node_modules/mysql2/examples/binlog-watcher.js b/node_modules/mysql2/examples/binlog-watcher.js new file mode 100644 index 0000000..dcb4b08 --- /dev/null +++ b/node_modules/mysql2/examples/binlog-watcher.js @@ -0,0 +1,16 @@ +var mysql = require('../test/common').createConnection(); +var through2 = require('through2'); + +var binlogStream = mysql.createBinlogStream({ + serverId: 123, // slave ID, first field in "show slave hosts" sql response + // you can also specify slave host, username, password and port + masterId: 0, + filename: 'mysql-bin.000007', + binlogPos: 120, + flags: 1, // 1 = "non-blocking mode" +}); + +binlogStream.pipe(through2.obj(function(obj, enc, next) { + console.log(obj); + next(); +})); diff --git a/node_modules/mysql2/examples/execute.js b/node_modules/mysql2/examples/execute.js new file mode 100644 index 0000000..5590541 --- /dev/null +++ b/node_modules/mysql2/examples/execute.js @@ -0,0 +1,5 @@ +var mysql = require('../test/common').createConnection(); +mysql.execute("select ?+1 as qqq, ? as rrr, ? as yyy", [1, null, 3], function(err, rows, fields) { +//mysql.execute("select ?+?+? as qqq, ? as rrr", [1, 2, 5, "test"], function(err, rows, fields) { + console.log(err, rows, fields); +}); diff --git a/node_modules/mysql2/examples/mysqlproxy.js b/node_modules/mysql2/examples/mysqlproxy.js new file mode 100644 index 0000000..eeaa776 --- /dev/null +++ b/node_modules/mysql2/examples/mysqlproxy.js @@ -0,0 +1,45 @@ +var mysql = require('../index.js'); + +var server = mysql.createServer(); +server.listen(3307); +server.on('connection', function(conn) { + console.log('connection'); + + conn.serverHandshake({ + protocolVersion: 10, + serverVersion: 'node.js rocks', + connectionId: 1234, + statusFlags: 2, + characterSet: 8, + capabilityFlags: 0xffffff + }); + + conn.on('field_list', function(table, fields) { + console.log('field list:', table, fields); + conn.writeEof(); + }); + + var remote = mysql.createConnection({user: 'root', database: 'dbname', host:'server.example.com', password: 'secret'}); + + conn.on('query', function(sql) { + console.log('proxying query:' + sql); + remote.query(sql, function(err) { // overloaded args, either (err, result :object) + // or (err, rows :array, columns :array) + if (Array.isArray(arguments[1])) { + // response to a 'select', 'show' or similar + var rows = arguments[1], columns = arguments[2]; + console.log('rows', rows); + console.log('columns', columns); + conn.writeTextResult(rows, columns); + } else { + // response to an 'insert', 'update' or 'delete' + var result = arguments[1]; + console.log('result', result); + conn.writeOk(result); + } + }); + }); + + conn.on('end', remote.end.bind(remote)); +}); + diff --git a/node_modules/mysql2/examples/pool-test.js b/node_modules/mysql2/examples/pool-test.js new file mode 100644 index 0000000..aa13446 --- /dev/null +++ b/node_modules/mysql2/examples/pool-test.js @@ -0,0 +1,12 @@ +var pool = require('../test/common').createPool(); + +setInterval(function() { +for (var i=0; i < 5; ++i) { + pool.getConnection(function(err, db) { + db.query("select sleep(0.5) as qqq", function(err, rows, fields) { + console.log(rows, fields); + db.end(); + }); + }); +} +}, 1000); diff --git a/node_modules/mysql2/examples/server.js b/node_modules/mysql2/examples/server.js new file mode 100644 index 0000000..db95785 --- /dev/null +++ b/node_modules/mysql2/examples/server.js @@ -0,0 +1,41 @@ +var mysql = require('../index.js'); +var flags = require('../lib/constants/client'); + +var server = mysql.createServer(); +server.listen(3333); +server.on('connection', function(conn) { + // we can deny connection here: + // conn.writeError({ message: 'secret', errno: 123 }); + conn.serverHandshake({ + protocolVersion: 10, + serverVersion: '5.6.10', //'node.js rocks', + connectionId: 1234, + statusFlags: 2, + characterSet: 8, + capabilityFlags: 0xffffff + }); + + conn.on('field_list', function(table, fields) { + console.log('FIELD LIST:', table, fields); + conn.writeEof(); + }); + + conn.on('query', function(query) { + conn.writeColumns([{ + catalog: 'def', + schema: 'test', + table: 'test_table', + orgTable: 'test_table', + name: 'beta', + orgName: 'beta', + characterSet: 33, + columnLength: 384, + columnType: 253, + flags: 0, + decimals: 0 + }]); + conn.writeTextRow(['test тест テスト փորձարկում পরীক্ষা kiểm tra ']); + conn.writeTextRow(['ტესტი પરીક્ષણ מבחן פּרובירן اختبار परीक्षण']); + conn.writeEof(); + }); +}); diff --git a/node_modules/mysql2/examples/simple-select.js b/node_modules/mysql2/examples/simple-select.js new file mode 100644 index 0000000..df47d38 --- /dev/null +++ b/node_modules/mysql2/examples/simple-select.js @@ -0,0 +1,5 @@ +var mysql = require('../test/common').createConnection(); + +mysql.query("select * from foos limit 10", function(err, rows, fields) { + console.log(rows, fields); +}); diff --git a/node_modules/mysql2/examples/sprocedure.js b/node_modules/mysql2/examples/sprocedure.js new file mode 100644 index 0000000..73fd4bf --- /dev/null +++ b/node_modules/mysql2/examples/sprocedure.js @@ -0,0 +1,11 @@ +var mysql = require('../test/common').createConnection(); +//var create_proc = "mysql.query('DROP PROCEDURE IF EXISTS p; CREATE PROCEDURE p(IN i INT) BEGIN SELECT i as f; END;');"; +var create_proc = "CREATE PROCEDURE `get_user1`(IN supplied_user_id INT) BEGIN select * from mil1 ua where ua.id = supplied_user_id; END"; +mysql.query(create_proc, function(err, rows, fields) { + console.log('Error:', err, rows, fields); +}); + +mysql.execute('CALL get_user1(?)', [ 1 ], function (err, rows) { + console.log(JSON.stringify(err, rows, null, 2)); + mysql.end(); +}); diff --git a/node_modules/mysql2/examples/ssl/certs/ca-cert.pem b/node_modules/mysql2/examples/ssl/certs/ca-cert.pem new file mode 100644 index 0000000..6e0a83b --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/ca-cert.pem @@ -0,0 +1,22 @@ +-----BEGIN CERTIFICATE----- +MIIDtTCCAp2gAwIBAgIJALO3/a+fdsicMA0GCSqGSIb3DQEBBQUAMEUxCzAJBgNV +BAYTAkFVMRMwEQYDVQQIEwpTb21lLVN0YXRlMSEwHwYDVQQKExhJbnRlcm5ldCBX +aWRnaXRzIFB0eSBMdGQwHhcNMTMwNDMwMDEzNTUwWhcNMTYwMTI1MDEzNTUwWjBF +MQswCQYDVQQGEwJBVTETMBEGA1UECBMKU29tZS1TdGF0ZTEhMB8GA1UEChMYSW50 +ZXJuZXQgV2lkZ2l0cyBQdHkgTHRkMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB +CgKCAQEAxFrsDfgxd5fb053eVqZ1a+iVVxoOkTl9f97BhIuUp3GE82UBMXQdL4Ec +gc3oQ56dEokvz9ghYn60cUBaH5sVjzm3qO3HYsHhA/nYoVa7U9TrSGhv3hWyqo48 +wWKHBYea325tcO2h9QanLFsnc1aauv8qGeWoa91lrfsT9G3nFdpiw587Nk+7NkKR +MhEbAf84qoTmcxo6hqOrqEZwhIozuiF0+oNNfj/Tmcd5517WJfWLAHjLPpBmc7Yw +vJqYqk7OK/BkX6NVx8OxcxcejvuosoZRbVK3Tuk+5N2AddncxU5Eq2kGVr890xTg +ZVwUFF4TRkenDKe3ez2DvlRDnuFzjQIDAQABo4GnMIGkMB0GA1UdDgQWBBQd7DqN +xTmSuT3f82DP13asHrqHIjB1BgNVHSMEbjBsgBQd7DqNxTmSuT3f82DP13asHrqH +IqFJpEcwRTELMAkGA1UEBhMCQVUxEzARBgNVBAgTClNvbWUtU3RhdGUxITAfBgNV +BAoTGEludGVybmV0IFdpZGdpdHMgUHR5IEx0ZIIJALO3/a+fdsicMAwGA1UdEwQF +MAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAA9+kUPZ7PfvD0SkgMnGXqnL2EPUPsgo +bRwciPx5E/SqoEczfYip+IcWAxRnifkFGXAzBq6w3GmGaJqG95vV5noj+md7KE2m +t8dxwGlOYP2H0oEubfrz6AHOcMDF68N2hmA4K0zj+Ag9XCJxN41vzaPgLuvNmDqB +O16Qh47CNoKtpEFZ4g6Yp3rErzhGVSLgLh2NmDzi6Vd78mmy454euLDTcbCnlKsA +kXvt8KCYacYNNV0m8mLYqPylJUZNvtFE4mAo35Uzbw6NawkWd+Aqx8UJCsQDhWWw +5T+24NcfiAs+Wqg3UvuzXlOZB721nmqgIYIcjyumMewGE/y1xLschIQ= +-----END CERTIFICATE----- diff --git a/node_modules/mysql2/examples/ssl/certs/ca-key.pem b/node_modules/mysql2/examples/ssl/certs/ca-key.pem new file mode 100644 index 0000000..76ba872 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/ca-key.pem @@ -0,0 +1,27 @@ +-----BEGIN RSA PRIVATE KEY----- +MIIEpAIBAAKCAQEAxFrsDfgxd5fb053eVqZ1a+iVVxoOkTl9f97BhIuUp3GE82UB +MXQdL4Ecgc3oQ56dEokvz9ghYn60cUBaH5sVjzm3qO3HYsHhA/nYoVa7U9TrSGhv +3hWyqo48wWKHBYea325tcO2h9QanLFsnc1aauv8qGeWoa91lrfsT9G3nFdpiw587 +Nk+7NkKRMhEbAf84qoTmcxo6hqOrqEZwhIozuiF0+oNNfj/Tmcd5517WJfWLAHjL +PpBmc7YwvJqYqk7OK/BkX6NVx8OxcxcejvuosoZRbVK3Tuk+5N2AddncxU5Eq2kG +Vr890xTgZVwUFF4TRkenDKe3ez2DvlRDnuFzjQIDAQABAoIBAQDDQW7PDWmTdU1C +CBCatfi6D5TCAsVNoI+t4kMpnOt7/qSorF4dYUvMe2VvpuQ6qbWkQwtqcY/xM/IX +VFjKaRttS4XY1GqbSBSMMZ08AtVRLb+yRzhG7ei3Na4w19tQomJdoJ/v1j5hO/Zt +Y0+9n/dJ0Id7LSbn7Ec6VRyoyckrrjmikw/y91UU/Xi3u2/64rJY+vbH2h090Ztg +MNt39v+VbengJ4vS/VbDk6qPv4CGUYWYfbz4ekRK0/xLWKW9vAu8KcN1iewmEyeH +W16686qKrhwDlCXYpZcTBnHB+QCxNfPRFJpfXzXSTCTY9aId79skCnEzBlUshKrV +6mYzlFcBAoGBAPIn62Gc7uRWCQkQaP05pjI4/v0I8ggvVfDwAyxY7QowLQXRT49O +zohCLtJFYN5Zd01hAgdrNl6QdtBF+rQEoKFKMRY8BI8G+lz6KHX5K37mAip/VjIl +a6sUUKu5lYOPqouDuAPoO1VRWulVPOx18/8s+vtk9OV3M+01vMBewXptAoGBAM+U +rx5Plg7qBPtLGTXCTbUHcvKKY2HdUHlzJjj8zcV8e6012GWcRblL4XmaxZTpS177 +JIDBPuhXDKjUwYemV1VBQlvh94f1ArDgh9+MEdYypYPvRDAzOg+Q3EGBW11zfYF9 +EqiWFud4vSZ4zFQgeg3cfCRIsXXfc3CDpzeV+CmhAoGBAJGeM8ulRXsFybUrqxbr +vedhouSipnkJjhKvIhle+FwyEED5V3CEIWqK8gD8O346KqXbeg7gB/fhw7EHA/WQ ++s9DADWwrcUcmx2iSQZ4ahGLWy4XGMxa+F4Of1xk42YT1KjE8rlWw6dQnuzFlzdS +zwFaGStn0GTUw+MXd4Pu90YZAoGAWlPS2Be9roO64zbMo44HjmzNYilCEcXiTNcE +nOu1BuiiUL8LiTu1Q2p3lRj6PVA/Ufdq7PQqUaP/iD/8bvC9NAYPwDfWJL1DDIDH +30juQg0L5Rtqyqaf70IT9hU6ErI8vOoWAnI9SUBK3sDV+Q2gzwNQqeFQB4DSlPVV +AGUr9cECgYARilqjaF8Ns3ilS3r3IEZ8I2wPAei/P9PCtkwkUsVpZ2+/SHxFAJkf +CaPVXdHMHkRXQUf1a+fAEYWiDnFnTaWXg/HyCt1V+Rr7g5eXsN+GwoeQ5Rywzi7m +K6atiYVINfvpNcN73dO7mB4jXgTNCh0K8ru9lf2nKgPzjd0muNDBww== +-----END RSA PRIVATE KEY----- diff --git a/node_modules/mysql2/examples/ssl/certs/client-cert.pem b/node_modules/mysql2/examples/ssl/certs/client-cert.pem new file mode 100644 index 0000000..288be5c --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/client-cert.pem @@ -0,0 +1,19 @@ +-----BEGIN CERTIFICATE----- +MIIC/jCCAeYCAQEwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQVUxEzARBgNV +BAgTClNvbWUtU3RhdGUxITAfBgNVBAoTGEludGVybmV0IFdpZGdpdHMgUHR5IEx0 +ZDAeFw0xMzA0MzAwMTM1NTVaFw0xNjAxMjUwMTM1NTVaMEUxCzAJBgNVBAYTAkFV +MRMwEQYDVQQIEwpTb21lLVN0YXRlMSEwHwYDVQQKExhJbnRlcm5ldCBXaWRnaXRz +IFB0eSBMdGQwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCa+f+OWaOI +1W6HaBZ5Ch0fW9SKrv7Uz/mzAAGFer7+0KNF7JC0/WtK1lz0oBuYqt6wZQmIO0at +6RP55Uxyj5Zf8C2jyHPU2iAUYcV/QTBXw0JNXCV0v+NeNjmh7/Tngj5l7nfdebLz +4oooQ3OlN3wbbHSd4UNmMhCQKNVFGS3nOp1q7C3QXuJJuq5zOXE6T6DO43zLo3HG +JEGjtkXA8oFWW2wIKrhxJlNLxaW70UrLMxBCLJ2hI0MITYsYSA5aPw+EZ0rrkGc9 +qaagpWYR7Yu//i78XOK1p8wgtZTlHY4akWMCRMUEkcKpiMLxrTyBijG/4jrYuxdJ ++ZnIYWKkjYevAgMBAAEwDQYJKoZIhvcNAQEFBQADggEBAEl6Yw2X2tJhHV8Wut+1 +YWXYuuYV/JbPx1KJLWl78eFnnZfzdCkSzywv9ThW2xSehIH2anfb8HxrvypVa1/r +EUcgy8kMzoa9ZcPXs0Ol/hCEsYYQZ/rXgXtPjaIb92kznKXhLckAKpChx8LxeSYc +TZ6DVdhT+sWwSy/DetzavAq8QGFRyYL88bxibSgiBGRw7i5sWk5/T6dpx322MbtK +FMPv3K5Mt0b3eBsegcjTvFqJAPBADB/WVLUsp+ESruFTcWGf8H91aoiWhZspEHjt +j2XD/nlkC44t3RU8YNx2jAxj9HhG7QHfwsY9CDSwmnKtpUhvGUrGkp98Q/dUMbds +NP0= +-----END CERTIFICATE----- diff --git a/node_modules/mysql2/examples/ssl/certs/client-key.pem b/node_modules/mysql2/examples/ssl/certs/client-key.pem new file mode 100644 index 0000000..d6134fd --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/client-key.pem @@ -0,0 +1,27 @@ +-----BEGIN RSA PRIVATE KEY----- +MIIEowIBAAKCAQEAmvn/jlmjiNVuh2gWeQodH1vUiq7+1M/5swABhXq+/tCjReyQ +tP1rStZc9KAbmKresGUJiDtGrekT+eVMco+WX/Ato8hz1NogFGHFf0EwV8NCTVwl +dL/jXjY5oe/054I+Ze533Xmy8+KKKENzpTd8G2x0neFDZjIQkCjVRRkt5zqdauwt +0F7iSbquczlxOk+gzuN8y6NxxiRBo7ZFwPKBVltsCCq4cSZTS8Wlu9FKyzMQQiyd +oSNDCE2LGEgOWj8PhGdK65BnPammoKVmEe2Lv/4u/FzitafMILWU5R2OGpFjAkTF +BJHCqYjC8a08gYoxv+I62LsXSfmZyGFipI2HrwIDAQABAoIBAQCXqKrEHUiB8Yu2 +is/jJ1iUhYMbLGFI1TXgS9MxUotyRa5iET0TQSQsGlbhNYWMAzrlmBqZ7JggPIVF ++XS0b3uS6zFepB1mYQcfqwZgn+S1HenWVqR4+geA/MOti2s42yZBDfrTC/Np43mc +KVYUipWzKJF+pyET805uJOeANUHMkvP6So066akZgi+bAdIpNu0hvvq04KUbPNfE +c4XdT7CKZnNSHhgfXBLN+H10wfIKnL916qJtOaRERZmM/M/LQRJRrSZTTKZWwMHg +5eBdYLI3+/eYeNriLlWVAEMXuUN7TueJFzePuTe5TRdVHkHbBvQTliIvr+udu4MV +FGMTrfchAoGBAMjUuoF8X5dPtu3eHCrGsg787hPdSn9jDhOYoKKTAj8Ft7Rnl5X3 +twLfeTtBhrPpo0KYOYkO2bETb0xXp1hUAfOGTl/jy1LREqHUxKPnaEpO5CbJMzwq +rhAIR4ZgQcqxHkBbUJd+lLptnWbw9LxiysEVrHwRyKH39ZdbJTM4KZU3AoGBAMWM +mJRhYbPpiDLRiskFqEou9qU+zjq1RlbI6fWoz5+8K6A3zfBHE1J1ZvqF6tvOeoDx +HLY5vIwlIKy8XwmTwUQvd9TTuRD+ZnY9gUoPgDhEK8fSJeSb2OqZyKBwATM7Q9Cn +5pyTOsTkmlm4AKpczoAJ3WUmRmvYeT+uGfXU611JAoGAGEkJKKFWmeCM2WTTeSS/ +4WoajBJlcNQUnrAFNMOcMOzLEyi3vu3Olq1ZZp384QKuuF3aD0XZcz1LZyruVJMM +DVu/XH8aVjBsFV+6S6uvA9VYZ4xLAsqSc+PcalZ3fkA+zT99lmQ7LfQVZZ5bqfA0 +Xnb1fadU4KkwbJYcAH6ZIK8CgYAVVp14kZhDHbuXeajbE+BcuvvrV4BhOQlzAFq9 +LVHX+DRiJwT4qkS9CG9qKiL3QTNcUC8Aw/XI0Y3Y+rPtTed3XQU9mO0Jl+ErbnNT +s57u9PYhrGJpcigZFyljoxWOGh22IRy41vJnKCZAAK8Zt9KaY/ZlIaBDr+tQ5JZr +Rmdx+QKBgAI/n9g6Gf32skdVsM8ydyZbmUmU2EarGPLKtwv6rDljZekrX+ZQouJU +Wh0Wl7BZGoWScJGlcuNoeewalGY/GrAavaN0YvoyhCkIbeD/B53/bzsMTUvnDHk4 +sxT7ieigYTYabCbpr+g1687ydpEoU7GopE6u3xlmuhj3+HoR825c +-----END RSA PRIVATE KEY----- diff --git a/node_modules/mysql2/examples/ssl/certs/client-req.pem b/node_modules/mysql2/examples/ssl/certs/client-req.pem new file mode 100644 index 0000000..9229af3 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/client-req.pem @@ -0,0 +1,16 @@ +-----BEGIN CERTIFICATE REQUEST----- +MIICijCCAXICAQAwRTELMAkGA1UEBhMCQVUxEzARBgNVBAgTClNvbWUtU3RhdGUx +ITAfBgNVBAoTGEludGVybmV0IFdpZGdpdHMgUHR5IEx0ZDCCASIwDQYJKoZIhvcN +AQEBBQADggEPADCCAQoCggEBAJr5/45Zo4jVbodoFnkKHR9b1Iqu/tTP+bMAAYV6 +vv7Qo0XskLT9a0rWXPSgG5iq3rBlCYg7Rq3pE/nlTHKPll/wLaPIc9TaIBRhxX9B +MFfDQk1cJXS/4142OaHv9OeCPmXud915svPiiihDc6U3fBtsdJ3hQ2YyEJAo1UUZ +Lec6nWrsLdBe4km6rnM5cTpPoM7jfMujccYkQaO2RcDygVZbbAgquHEmU0vFpbvR +SsszEEIsnaEjQwhNixhIDlo/D4RnSuuQZz2ppqClZhHti7/+Lvxc4rWnzCC1lOUd +jhqRYwJExQSRwqmIwvGtPIGKMb/iOti7F0n5mchhYqSNh68CAwEAAaAAMA0GCSqG +SIb3DQEBBQUAA4IBAQATmAC1QQqi5DWnhtHhKCFORpclZLwNqQJR+wpMZ00Ajt3r ++jSJo/1j9Ecys1niia79y6iyiTqTJDVEmkP+9Wmgols1bMMYZIcbnb09m1G4kCuJ +Axg6ktJ/Dt5R5Gp3JiejBdimAwUJq1gZ7ywcXeV0LnZVpPBz1J1cfWkfP3vMcbqv +qufWq1JOQK0VxfhQqay0CZK4+LCoMaEgWPJCZoC7Eqw5KQKEBERhwETGYHF7wlgG +lqEgWL+aym5su+EW8nFRLJ8pdr9CW+pTaYZw28w34oIx8PYUNgwJ5uIawqZA7IuZ +dST/6A4nD04kJcs7KnPbLCRpRyvdqHiy+7xBd9SJ +-----END CERTIFICATE REQUEST----- diff --git a/node_modules/mysql2/examples/ssl/certs/mkcerts.sh b/node_modules/mysql2/examples/ssl/certs/mkcerts.sh new file mode 100644 index 0000000..7e2d9fc --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/mkcerts.sh @@ -0,0 +1,6 @@ +openssl genrsa 2048 > ca-key.pem +openssl req -new -x509 -nodes -days 1000 -key ca-key.pem > ca-cert.pem +openssl req -newkey rsa:2048 -days 1000 -nodes -keyout server-key.pem > server-req.pem +openssl x509 -req -in server-req.pem -days 1000 -CA ca-cert.pem -CAkey ca-key.pem -set_serial 01 > server-cert.pem +openssl req -newkey rsa:2048 -days 1000 -nodes -keyout client-key.pem > client-req.pem +openssl x509 -req -in client-req.pem -days 1000 -CA ca-cert.pem -CAkey ca-key.pem -set_serial 01 > client-cert.pem diff --git a/node_modules/mysql2/examples/ssl/certs/server-cert.pem b/node_modules/mysql2/examples/ssl/certs/server-cert.pem new file mode 100644 index 0000000..94b495b --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/server-cert.pem @@ -0,0 +1,19 @@ +-----BEGIN CERTIFICATE----- +MIIC/jCCAeYCAQEwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQVUxEzARBgNV +BAgTClNvbWUtU3RhdGUxITAfBgNVBAoTGEludGVybmV0IFdpZGdpdHMgUHR5IEx0 +ZDAeFw0xMzA0MzAwMTM1NTJaFw0xNjAxMjUwMTM1NTJaMEUxCzAJBgNVBAYTAkFV +MRMwEQYDVQQIEwpTb21lLVN0YXRlMSEwHwYDVQQKExhJbnRlcm5ldCBXaWRnaXRz +IFB0eSBMdGQwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCqqHgScXj4 +koJQeURbPss1yAqiByb4Ub/ggNP4+ZQXdoXX+kBKoCXstPHvNwBQlg+m8a4g/x9g +Vj0gKL2nEo+CcIyNHjea728n1xTBHlpSesWqDsbdSMD6sgDl07hCVS4QAjt8a521 +pf4kKbv44Wa9ntpGPmLX7BFxLyN8LBsfTa+noYKxlQK9WJAbP7oL5bza4Uf84Iwg +BEXkku7RRyw48S9RFIEMjIIyUvhS1YIJW57F9rcqaMerdd5BQYcgzpfESbtayWkJ +Es89TgbvoD5njii7EFGgCB5DQfCbgOImJPRHNPHYj4iqGXitFKZO6uxUCyceodxV +KOM/LKZvJKFNAgMBAAEwDQYJKoZIhvcNAQEFBQADggEBALSFOwPrNEyQg1Wp/WkW +BJACqNsnWJKnackSfjS6N4GwH8MOQgAgRwXx3RgpOHUgTnt6KiEQMI40tuHXU8A9 +JNC9XdX7x/EEqny+ZCpVd4P5CzXAJEiZ63WtmEUnjBRQiFxBsgh88cUnXFfIAGEa +jgudFMmVS/tz+UQgciu2FAWkfcCPH1z3fUmxBjrcX9iOCuJXohk2G7qmawfpCkaW +RFo6dBl3u8sEo5+/KeFtl0EmLRD9yMOx1XPoT9oVcpis/XxTkvPxS7hAHHc5ZIBq +w8f5NX/7jTiHJI4k1/mfyrDJMCwJPMzRlTppKSdwEylII5b8SmAaGjGvOiNi/7EX +v90= +-----END CERTIFICATE----- diff --git a/node_modules/mysql2/examples/ssl/certs/server-key.pem b/node_modules/mysql2/examples/ssl/certs/server-key.pem new file mode 100644 index 0000000..c24f872 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/server-key.pem @@ -0,0 +1,27 @@ +-----BEGIN RSA PRIVATE KEY----- +MIIEpAIBAAKCAQEAqqh4EnF4+JKCUHlEWz7LNcgKogcm+FG/4IDT+PmUF3aF1/pA +SqAl7LTx7zcAUJYPpvGuIP8fYFY9ICi9pxKPgnCMjR43mu9vJ9cUwR5aUnrFqg7G +3UjA+rIA5dO4QlUuEAI7fGudtaX+JCm7+OFmvZ7aRj5i1+wRcS8jfCwbH02vp6GC +sZUCvViQGz+6C+W82uFH/OCMIARF5JLu0UcsOPEvURSBDIyCMlL4UtWCCVuexfa3 +KmjHq3XeQUGHIM6XxEm7WslpCRLPPU4G76A+Z44ouxBRoAgeQ0Hwm4DiJiT0RzTx +2I+Iqhl4rRSmTursVAsnHqHcVSjjPyymbyShTQIDAQABAoIBAHMqu9UedJezL3Ql +UicNik9iDyLnFrpvWMClz+bubq0i1BI7lJWH2/AQ8FAR2wmHK0rrQCqOYNs/d4Kz +W8Fa+jP5xjAZm0bYnDfTovLsi+Grbqdjz3pX9bt40rhGl8tT9oDhMMm3SjfirE41 +R+AeJJqEkCLlSQkUC3VJbXYHwcnuJhkVVxsRtNeIE9d5DSOoXuPjAnQjmS5zUBLz +JlA2a5bTLeENfcUL8Jr7WhxWIyIAFBY4ewpg7sbVmMnir3VD315OeowYMQpk/AaC +AiwDA1kJCYoKUCAuizSAS3I5WNFeqZfbhWskdct6MphcMrMsLWvqLtXvLImU+lgX +Z9rJHDUCgYEA1R3+p8WQ/YKppJb/klRMtWLnXHLlTan2YfDxmcLGC9zHro24uAL3 +SpuXivKzSKX8BGA+9lzSnWndX7PK5fi2UMnMAxNNE6Cxu0S+yjras92B+DMjiPRf +lk7trtyXhYjoxPQE8cCxfbKkl6uLYCKyi9JQwygyOPhEUDkZRcyNVusCgYEAzP9W +zqALi7ay0Dizu5ZXRsehQKw4ElMuvHHjt4r16aW7pe8ydqkmsm3Qk8VwfblqZFyU +ndSzWU+SguuD2pUz5re6wLKrZFIicirNS6m88AmCjTUQ5W+FBHpvkQCQWsN5ykfy +KAdfEJlZoInLYdU9Z1GueUk/4EBpToNFz7kzSqcCgYEAlrebvPLP0zlw1+Gh5M6R +YUYM8SigWgh1IlbPxjok7Ya6AQxhMmGGmdDnn3B8skgQrteSL5D9si2ITYJNX85A +wWm1SgeAXv0qNJIti7+Lo+BnZixkWRrZ7ubq2NtQnTNxyrf4NzBbVdXc6RZ8fwSK +2K9oRlxLCFcrmMCIywAahPkCgYEAwK0mTCNFdtYLj4Yb+K6/7Xjo6T51nVOt09U/ +8V2c8TSjAL2oMrud8YshxiKHLsQ9aYNS9F3dDI6r6H2wepxOIgaCc2f7i9lfIutz +9i/ds8dce5hq/xsobSMfBa0AAS9Fo4in5FO5WIKqKSgajyO8CQZO9RSSAxbHY9Ii +pbEusnUCgYBzVXEFSload51C82XgvwjwcayrKrGBq+5/K/N5xMGBxuObu2vWA3ks +MSTU2tXUiwpApY51v+88JGBHwI6+3EGRGEow09S0MlsHxjAG+MCz5Fj+nhoIJk78 +I/E+FGjJW+otrrz8rLi8bz+t3QTtB7rTiKMMpmIIIwG8OacUQPr82g== +-----END RSA PRIVATE KEY----- diff --git a/node_modules/mysql2/examples/ssl/certs/server-req.pem b/node_modules/mysql2/examples/ssl/certs/server-req.pem new file mode 100644 index 0000000..5d44838 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/certs/server-req.pem @@ -0,0 +1,16 @@ +-----BEGIN CERTIFICATE REQUEST----- +MIICijCCAXICAQAwRTELMAkGA1UEBhMCQVUxEzARBgNVBAgTClNvbWUtU3RhdGUx +ITAfBgNVBAoTGEludGVybmV0IFdpZGdpdHMgUHR5IEx0ZDCCASIwDQYJKoZIhvcN +AQEBBQADggEPADCCAQoCggEBAKqoeBJxePiSglB5RFs+yzXICqIHJvhRv+CA0/j5 +lBd2hdf6QEqgJey08e83AFCWD6bxriD/H2BWPSAovacSj4JwjI0eN5rvbyfXFMEe +WlJ6xaoOxt1IwPqyAOXTuEJVLhACO3xrnbWl/iQpu/jhZr2e2kY+YtfsEXEvI3ws +Gx9Nr6ehgrGVAr1YkBs/ugvlvNrhR/zgjCAEReSS7tFHLDjxL1EUgQyMgjJS+FLV +gglbnsX2typox6t13kFBhyDOl8RJu1rJaQkSzz1OBu+gPmeOKLsQUaAIHkNB8JuA +4iYk9Ec08diPiKoZeK0Upk7q7FQLJx6h3FUo4z8spm8koU0CAwEAAaAAMA0GCSqG +SIb3DQEBBQUAA4IBAQCDtIfTr/LmuFYkuxt1bPj79AOmbONQrwOFP6szeBL44jJf +jaIH4gDWy70zhaZ4FmnskV4TbdEK5ENoW2Rif87JGex2yL+vzdKigRX0TzUYFA0x +IqzR/sx0iMV3EsW3qYPRq/QJErvD5rL1KA6J+nHMeZiRFRF34XaoVHk4zaFDM+J5 +rjMy8GnRS7lqBe31zuqLfU2I9Bwq2InpYMw1Pf+boarZiIwmfMtiHbb5Aap1lMh0 +u1WKfiuB6CqXtyXFJR5PJTwO581yuINByzKlZZyXUpP4MbargPc5f1thf3tKndgB +3GG1gmMsl/cUQ7XBdBH2WXCuipt0mflWj8qKylUA +-----END CERTIFICATE REQUEST----- diff --git a/node_modules/mysql2/examples/ssl/client-flags.sh b/node_modules/mysql2/examples/ssl/client-flags.sh new file mode 100644 index 0000000..04e1cf2 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/client-flags.sh @@ -0,0 +1 @@ +mysql --ssl-key=certs/client-key.pem --ssl-cert=certs/client-cert.pem -h 127.0.0.1 -P 3307 diff --git a/node_modules/mysql2/examples/ssl/rds-ssl.js b/node_modules/mysql2/examples/ssl/rds-ssl.js new file mode 100644 index 0000000..4454d3d --- /dev/null +++ b/node_modules/mysql2/examples/ssl/rds-ssl.js @@ -0,0 +1,16 @@ +var fs = require('fs'); +var mysql = require('../../index.js'); + +var conn = mysql.createConnection({ + user: process.env.USER, + password: process.env.PASSWORD, + database: process.env.DB, + host: process.env.HOST, + port: 3306, + ssl: 'Amazon RDS' +}); + +conn.query('show status like \'Ssl_cipher\'', function(err, res) { + console.log(err, res); + conn.end(); +}); diff --git a/node_modules/mysql2/examples/ssl/select-over-ssl.js b/node_modules/mysql2/examples/ssl/select-over-ssl.js new file mode 100644 index 0000000..d0a1e99 --- /dev/null +++ b/node_modules/mysql2/examples/ssl/select-over-ssl.js @@ -0,0 +1,21 @@ +var fs = require('fs'); +var mysql = require('../../index.js'); +var conn = mysql.createConnection({ + user: 'root', + password: '', + database: 'test', + host: '127.0.0.1', + port: '3306', + ssl: { + //key: fs.readFileSync('./certs/client-key.pem'), + //cert: fs.readFileSync('./certs/client-cert.pem') + ca: fs.readFileSync('./certs/ca-cert.pem') + } +}); + +conn.query('select 1+1 as test', function(err, res) { + console.log(res); + conn.query('select repeat("a", 100) as test', function(err, res) { + console.log(res); + }); +}); diff --git a/node_modules/mysql2/fixtures/mysql-ssl-ca-cert.pem b/node_modules/mysql2/fixtures/mysql-ssl-ca-cert.pem new file mode 100644 index 0000000..8b54fd2 --- /dev/null +++ b/node_modules/mysql2/fixtures/mysql-ssl-ca-cert.pem @@ -0,0 +1,20 @@ +-----BEGIN CERTIFICATE----- +MIIDQzCCAqygAwIBAgIJAOd1tlfiGoEoMA0GCSqGSIb3DQEBBQUAMHUxCzAJBgNV +BAYTAlVTMRMwEQYDVQQIEwpXYXNoaW5ndG9uMRAwDgYDVQQHEwdTZWF0dGxlMRMw +EQYDVQQKEwpBbWF6b24uY29tMQwwCgYDVQQLEwNSRFMxHDAaBgNVBAMTE2F3cy5h +bWF6b24uY29tL3Jkcy8wHhcNMTAwNDA1MjI0NDMxWhcNMTUwNDA0MjI0NDMxWjB1 +MQswCQYDVQQGEwJVUzETMBEGA1UECBMKV2FzaGluZ3RvbjEQMA4GA1UEBxMHU2Vh +dHRsZTETMBEGA1UEChMKQW1hem9uLmNvbTEMMAoGA1UECxMDUkRTMRwwGgYDVQQD +ExNhd3MuYW1hem9uLmNvbS9yZHMvMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKB +gQDKhXGU7tizxUR5WaFoMTFcxNxa05PEjZaIOEN5ctkWrqYSRov0/nOMoZjqk8bC +med9vPFoQGD0OTakPs0jVe3wwmR735hyVwmKIPPsGlaBYj1O6llIpZeQVyupNx56 +UzqtiLaDzh1KcmfqP3qP2dInzBfJQKjiRudo1FWnpPt33QIDAQABo4HaMIHXMB0G +A1UdDgQWBBT/H3x+cqSkR/ePSIinPtc4yWKe3DCBpwYDVR0jBIGfMIGcgBT/H3x+ +cqSkR/ePSIinPtc4yWKe3KF5pHcwdTELMAkGA1UEBhMCVVMxEzARBgNVBAgTCldh +c2hpbmd0b24xEDAOBgNVBAcTB1NlYXR0bGUxEzARBgNVBAoTCkFtYXpvbi5jb20x +DDAKBgNVBAsTA1JEUzEcMBoGA1UEAxMTYXdzLmFtYXpvbi5jb20vcmRzL4IJAOd1 +tlfiGoEoMAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADgYEAvguZy/BDT66x +GfgnJlyQwnFSeVLQm9u/FIvz4huGjbq9dqnD6h/Gm56QPFdyMEyDiZWaqY6V08lY +LTBNb4kcIc9/6pc0/ojKciP5QJRm6OiZ4vgG05nF4fYjhU7WClUx7cxq1fKjNc2J +UCmmYqgiVkAGWRETVo+byOSDZ4swb10= +-----END CERTIFICATE----- diff --git a/node_modules/mysql2/index.js b/node_modules/mysql2/index.js new file mode 100644 index 0000000..a3e80f9 --- /dev/null +++ b/node_modules/mysql2/index.js @@ -0,0 +1,33 @@ +var Connection = require('./lib/connection.js'); +var ConnectionConfig = require('./lib/connection_config.js'); +var SqlString = require('./lib/sql_string.js'); + +module.exports.createConnection = function(opts) { + return new Connection({config: new ConnectionConfig(opts)}); +}; + +module.exports.connect = module.exports.createConnection; + +module.exports.Connection = Connection; +module.exports.Types = require('./lib/constants/types.js'); + +module.exports.createPool = function(config) { + var PoolConfig = require('./lib/pool_config.js'); + var Pool = require('./lib/pool.js'); + return new Pool({config: new PoolConfig(config)}); +}; + +exports.createPoolCluster = function(config) { + var PoolConfig = require('./lib/pool_config.js'); + var PoolCluster = require('./lib/pool_cluster.js'); + return new PoolCluster(config); +}; + +module.exports.createServer = function() { + var Server = require('./lib/server.js'); + return new Server(); +}; + +exports.escape = SqlString.escape; +exports.escapeId = SqlString.escapeId; +exports.format = SqlString.format; diff --git a/node_modules/mysql2/inflate-test.js b/node_modules/mysql2/inflate-test.js new file mode 100644 index 0000000..e984fb6 --- /dev/null +++ b/node_modules/mysql2/inflate-test.js @@ -0,0 +1,3 @@ +var b = new Buffer('23 30 38 53 30 31 55 6e 6b 6e 6f 77 6e 20 63 6f 6d 6d 61 6e 64'.replace(/ /g, ''), 'hex'); +require('zlib').inflateRaw(b, console.log); +debugger diff --git a/node_modules/mysql2/lib/commands/binlog_dump.js b/node_modules/mysql2/lib/commands/binlog_dump.js new file mode 100644 index 0000000..6812c2b --- /dev/null +++ b/node_modules/mysql2/lib/commands/binlog_dump.js @@ -0,0 +1,104 @@ +var Command = require('./command'); +var util = require('util'); +var CommandCode = require('../constants/commands'); +var Packets = require('../packets'); + +function BinlogDump(opts) +{ + Command.call(this); + //this.onResult = callback; + this.opts = opts; +} +util.inherits(BinlogDump, Command); + +BinlogDump.prototype.start = function(packet, connection) { + var packet = new Packets.BinlogDump(this.opts); + connection.writePacket(packet.toPacket(1)); + return BinlogDump.prototype.binlogData; +}; + +function BinlogEventHeader(packet) { + this.timestamp = packet.readInt32(); + this.eventType = packet.readInt8(); + this.serverId = packet.readInt32(); + this.eventSize = packet.readInt32(); + this.logPos = packet.readInt32(); + this.flags = packet.readInt16(); +} + +function RotateEvent(packet) { + this.pposition = packet.readInt32(); + // TODO: read uint64 here + var positionDword2 = packet.readInt32(); + this.nextBinlog = packet.readString(); + this.name = 'RotateEvent'; +} + +function FormatDescriptionEvent(packet) { + this.binlogVersion = packet.readInt16(); + this.serverVersion = packet.readString(50).replace(/\u0000.*/, ''); + this.createTimestamp = packet.readInt32(); + this.eventHeaderLength = packet.readInt8(); // should be 19 + this.eventsLength = packet.readBuffer(); + this.name = 'FormatDescriptionEvent'; +} + +function QueryEvent(packet) { + + var parseStatusVars = require('../packets/binlog_query_statusvars.js'); + + this.slaveProxyId = packet.readInt32(); + this.executionTime = packet.readInt32(); + var schemaLength = packet.readInt8(); + this.errorCode = packet.readInt16(); + var statusVarsLength = packet.readInt16(); + var statusVars = packet.readBuffer(statusVarsLength); + + this.schema = packet.readString(schemaLength); + packet.readInt8(); // should be zero + this.statusVars = parseStatusVars(statusVars); + + this.query = packet.readString(); + this.name = 'QueryEvent'; +} + +function XidEvent(packet) { + this.binlogVersion = packet.readInt16(); + this.xid = packet.readInt64(); + this.name = 'XidEvent'; +} + +var eventParsers = []; + +eventParsers[2] = QueryEvent; +eventParsers[4] = RotateEvent; +eventParsers[15] = FormatDescriptionEvent; +eventParsers[16] = XidEvent; + +BinlogDump.prototype.binlogData = function(packet) { + // ok - continue consuming events + // error - error + // eof - end of binlog + if (packet.isEOF()) { + this.emit('eof'); + return null; + } + + // binlog event header + var ok = packet.readInt8(); + var header = new BinlogEventHeader(packet); + var EventParser = eventParsers[header.eventType]; + var event; + if (EventParser) + event = new EventParser(packet); + else { + event = { + name: 'UNKNOWN' + } + } + event.header = header; + this.emit('event', event); + return BinlogDump.prototype.binlogData; +}; + +module.exports = BinlogDump; diff --git a/node_modules/mysql2/lib/commands/client_handshake.js b/node_modules/mysql2/lib/commands/client_handshake.js new file mode 100644 index 0000000..9427612 --- /dev/null +++ b/node_modules/mysql2/lib/commands/client_handshake.js @@ -0,0 +1,98 @@ +var Command = require('./command'); +var Packets = require('../packets/index.js'); +var util = require('util'); +var ClientConstants = require('../constants/client'); + +function ClientHandshake(clientFlags) +{ + this.handshake = null; + this.clientFlags = clientFlags; + Command.call(this); +} +util.inherits(ClientHandshake, Command); + +ClientHandshake.prototype.start = function() { + return ClientHandshake.prototype.handshakeInit; +}; + +ClientHandshake.prototype.sendSSLRequest = function(connection) { + var sslRequest = new Packets.SSLRequest(this.clientFlags); + connection.writePacket(sslRequest.toPacket()); +}; + +function flagNames(flags) { + var res = []; + for (var c in ClientConstants) { + if (flags & ClientConstants[c]) + res.push(c.replace(/_/g, ' ').toLowerCase()); + } + return res; +} + +ClientHandshake.prototype.sendCredentials = function(connection, packetIndex) { + if (connection.config.debug) { + console.log('Sending handshake packet: flags:%d=(%s)', this.clientFlags, + flagNames(this.clientFlags).join(', ')); + } + var handshakeResponse = new Packets.HandshakeResponse({ + flags : this.clientFlags, + password: connection.config.password, + user : connection.config.user, + database: connection.config.database, + charsetNumber: connection.config.charsetNumber, + authPluginData1: this.handshake.authPluginData1, + authPluginData2: this.handshake.authPluginData2, + compress: connection.config.compress + }); + connection.writePacket(handshakeResponse.toPacket()); +}; + +ClientHandshake.prototype.handshakeInit = function(helloPacket, connection) { + var command = this; + + this.on('connect', function(connArgs) { + connection.emit('connect', connArgs); + }); + this.on('error', function(err) { + connection._protocolError = err; + connection.emit('error', err); + }); + this.handshake = Packets.Handshake.fromPacket(helloPacket); + if (connection.config.debug) { + console.log('Server hello packet: capability flags:%d=(%s)', this.handshake.capabilityFlags, + flagNames(this.handshake.capabilityFlags).join(', ')); + } + connection.serverCapabilityFlags = this.handshake.capabilityFlags; + connection.connectionId = this.handshake.connectionId; + var serverSSLSupport = this.handshake.capabilityFlags & ClientConstants.SSL; + + // use compression only if requested by client and supported by server + connection.config.compress = connection.config.compress && (this.handshake.capabilityFlags & ClientConstants.COMPRESS); + this.clientFlags = this.clientFlags | connection.config.compress; + + if (connection.config.ssl) { + if (!serverSSLSupport) + throw new Error('Server does not support secure connnection'); + // send ssl upgrade request and immediately upgrade connection to secure + this.clientFlags |= ClientConstants.SSL; + this.sendSSLRequest(connection); + connection.startTLS(function() { + // after connection is secure + command.sendCredentials(connection, 2); + }); + } else { + this.sendCredentials(connection, 1); + } + return ClientHandshake.prototype.handshakeResult; +}; + +ClientHandshake.prototype.handshakeResult = function(okPacket, connection) { + // error is already checked in base class. Done auth. + connection.authorized = true; + if (connection.config.compress) + connection.packetParser.onPacket = connection.handleCompressedPacket.bind(connection); + // TODO any useful information in ok packet to pass as argument? + connection.emit('connect', true); + return null; +}; +module.exports = ClientHandshake; diff --git a/node_modules/mysql2/lib/commands/command.js b/node_modules/mysql2/lib/commands/command.js new file mode 100644 index 0000000..62dd0bc --- /dev/null +++ b/node_modules/mysql2/lib/commands/command.js @@ -0,0 +1,43 @@ +var EventEmitter = require('events').EventEmitter; +var util = require('util'); + +function Command() { + EventEmitter.call(this); + this.next = null; +} +util.inherits(Command, EventEmitter); + +// slow. debug only +Command.prototype.stateName = function() { + var state = this.next; + for (i in this) + if (this[i] == state && i != 'next') + return i; +}; + +Command.prototype.execute = function(packet, connection) { + // TODO: hack + if (!this.next) { + this.next = this.start; + } + + if (packet && packet.isError()) { + var err = packet.asError(); + if (this.onResult) + this.onResult(err); + else + this.emit('error', err); + return true; + } + + // TODO: don't return anything from execute, it's ugly and error-prone. Listen for 'end' event in connection + this.next = this.next(packet, connection); + if (this.next) { + return false; + } else { + this.emit('end'); + return true; + } +}; + +module.exports = Command; diff --git a/node_modules/mysql2/lib/commands/execute.js b/node_modules/mysql2/lib/commands/execute.js new file mode 100644 index 0000000..ae1f14f --- /dev/null +++ b/node_modules/mysql2/lib/commands/execute.js @@ -0,0 +1,189 @@ +var Command = require('./command'); +var Packets = require('../packets/index.js'); +var util = require('util'); +var compileParser = require('../compile_binary_parser'); + +function Execute(options, callback) +{ + Command.call(this); + this.query = options.sql; + + this.onResult = callback; // TODO check felixge multi-result api + this.fieldCount = 0; + this.parameterCount = 0; + this.fields = []; + this.parameterDefinitions = []; + + this.resultFields = []; + this.resultFieldCount = 0; + this.insertId = 0; + + this.parameters = options.values; + this.rows = []; + this.statementInfo = null; + this.options = options; +} +util.inherits(Execute, Command); + +Execute.prototype.start = function(packet, connection) { + var cachedStatement = connection.statements[statementKey(this.query, this.options)]; + if (!cachedStatement) { // prepare first + connection.writePacket(new Packets.PrepareStatement(this.query).toPacket(1)); + } else { + this.statementInfo = cachedStatement; + return this.doExecute(connection); + } + return Execute.prototype.prepareHeader; +}; + +function PreparedStatementInfo(id) { + this.id = id; + this.parser = null; +} + +Execute.prototype.prepareHeader = function(packet, connection) { + var header = new Packets.PreparedStatementHeader(packet); + this.fieldCount = header.fieldCount; + this.parameterCount = header.parameterCount; + this.statementInfo = new PreparedStatementInfo(header.id); + + connection.statements[statementKey(this.query, this.options)] = this.statementInfo; + if (this.parameterCount > 0) + return Execute.prototype.readParameter; + else if (this.fieldCount > 0) + return Execute.prototype.readField; + else + return this.doExecute(connection); +}; + +Execute.prototype.readParameter = function(packet, connection) { + var def = new Packets.ColumnDefinition(packet); + this.parameterDefinitions.push(def); + if (this.parameterDefinitions.length == this.parameterCount) + return Execute.prototype.parametersEOF; + return this.readParameter; +}; + +function statementKey(query, options) { + return (typeof options.nestTables) + + '/' + options.nestTables + '/' + options.rowsAsHash + + query; +} + +// TODO: move to connection.js? +function getFieldsKey(fields, options) { + var res = (typeof options.nestTables) + '/' + options.nestTables + '/' + options.rowsAsHash; + for (var i=0; i < fields.length; ++i) + res += '/' + fields[i].name + ':' + fields[i].columnType + ':' + fields[i].flags; + return res; +} + +Execute.prototype.readField = function(packet, connection) { + var def = new Packets.ColumnDefinition(packet); + this.fields.push(def); + var parserKey = ''; + + // TODO: api to allow to flag "I'm not going to change schema for this statement" + // this way we can ignore column definitions in binary response and use + // definition from prepare phase. Note that it's what happens currently + // e.i if you do execute("select * from foo") and later add/remove/rename rows to foo + // (without reconnecting) you are in trouble + + if (this.fields.length == this.fieldCount) { + if (!this.statementInfo.parser) { + // compile row parser + parserKey = getFieldsKey(this.fields, this.options); + // try cached first + this.statementInfo.fields = this.fields; + this.statementInfo.parser = connection.binaryProtocolParsers[parserKey]; + if (!this.statementInfo.parser) { + this.statementInfo.parser = compileParser(this.fields, this.options, connection.config); + connection.binaryProtocolParsers[parserKey] = this.statementInfo.parser; + } + } + return Execute.prototype.fieldsEOF; + } + return Execute.prototype.readField; +}; + +Execute.prototype.parametersEOF = function(packet, connection) { + // check EOF + if (!packet.isEOF()) + throw "Expected EOF packet"; + if (this.fieldCount > 0) + return Execute.prototype.readField; + else + return this.doExecute(connection); +}; + +Execute.prototype.fieldsEOF = function(packet, connection) { + // check EOF + if (!packet.isEOF()) + throw "Expected EOF packet"; + return this.doExecute(connection); +}; + +Execute.prototype.doExecute = function(connection) +{ + connection.sequenceId = 0; + var executePacket = new Packets.Execute(this.statementInfo.id, this.parameters); + connection.writePacket(executePacket.toPacket(1)); + return Execute.prototype.resultsetHeader; +}; + +Execute.prototype.resultsetHeader = function(packet) { + var self = this; + var header = new Packets.ResultSetHeader(packet); + this.resultFieldCount = header.fieldCount; + this.insertId = header.insertId; + if (this.resultFieldCount === 0) { + if (this.onResult) + process.nextTick(function() { + self.onResult(null, header, []); + }); + return null; + } + return Execute.prototype.readResultField; +}; + +Execute.prototype.readResultField = function(packet) { + var def; + if (this.statementInfo.parser) // ignore result fields definition, we are reusing fields from prepare response + this.resultFields.push(null); + else { + def = new Packets.ColumnDefinition(packet); + this.resultFields.push(def); + } + if (this.resultFields.length == this.resultFieldCount) { + return Execute.prototype.resultFieldsEOF; + } + return Execute.prototype.readResultField; +}; + +Execute.prototype.resultFieldsEOF = function(packet) { + // check EOF + if (!packet.isEOF()) + throw "Expected EOF packet"; + return Execute.prototype.row; +}; + +Execute.prototype.row = function(packet) +{ + var self = this; + // TODO: refactor to share code with Query::row + if (packet.isEOF()) { + if (this.onResult) + process.nextTick(function() { + self.onResult(null, self.rows, self.statementInfo.fields); + }) + return null; + } + var r = new this.statementInfo.parser(packet); + if (this.onResult) + this.rows.push(r); + else + this.emit('result', r); + return Execute.prototype.row; +}; + +module.exports = Execute; diff --git a/node_modules/mysql2/lib/commands/index.js b/node_modules/mysql2/lib/commands/index.js new file mode 100644 index 0000000..dd984d4 --- /dev/null +++ b/node_modules/mysql2/lib/commands/index.js @@ -0,0 +1,4 @@ +"client_handshake server_handshake query execute ping register_slave binlog_dump".split(' ').forEach(function(name) { + var ctor = require('./' + name); + module.exports[ctor.name] = ctor; +}); diff --git a/node_modules/mysql2/lib/commands/ping.js b/node_modules/mysql2/lib/commands/ping.js new file mode 100644 index 0000000..531c227 --- /dev/null +++ b/node_modules/mysql2/lib/commands/ping.js @@ -0,0 +1,30 @@ +var Command = require('./command'); +var util = require('util'); +var CommandCode = require('../constants/commands'); +var Packet = require('../packets/packet'); + +// TODO: time statistics? +// usefull for queue size and network latency monitoring +// store created,sent,reply timestamps + +function Ping(callback) +{ + Command.call(this); + this.onResult = callback; +} +util.inherits(Ping, Command); + +Ping.prototype.start = function(packet, connection) { + var ping = new Packet(0, new Buffer([0, 0, 0, 0, CommandCode.PING])); + connection.writePacket(ping); + return Ping.prototype.pingResponse; +}; + +Ping.prototype.pingResponse = function(packet) { + // TODO: check it's OK packet. error check already done in caller + if (this.onResult) + process.nextTick(this.onResult.bind(this)); + return null; +}; + +module.exports = Ping; diff --git a/node_modules/mysql2/lib/commands/query.js b/node_modules/mysql2/lib/commands/query.js new file mode 100644 index 0000000..71fdf17 --- /dev/null +++ b/node_modules/mysql2/lib/commands/query.js @@ -0,0 +1,150 @@ +var Command = require('./command'); +var Packets = require('../packets/index.js'); +var util = require('util'); +var compileParser = require('../compile_text_parser.js'); +var ServerStatus = require('../constants/server_status.js'); + +function Query(sql, options, callback) +{ + Command.call(this); + this.query = sql; + this.options = options; + this.onResult = callback; + this._fieldCount = 0; + this._rowParser = null; + this._fields = []; + this._rows = []; + this._receivedFieldsCount = 0; + this._resultIndex = 0; +} +util.inherits(Query, Command); + +Query.prototype.start = function(packet, connection) { + if (connection.config.debug) { + console.log(' Sending query command: %s', this.query); + } + var cmdPacket = new Packets.Query(this.query); + connection.writePacket(cmdPacket.toPacket(1)); + return Query.prototype.resultsetHeader; +}; + +Query.prototype.done = function() { + var self = this; + if (this.onResult) { + var rows, fields; + if (this._resultIndex === 0) { + rows = this._rows[0]; + fields = this._fields[0]; + } else { + rows = this._rows; + fields = this._fields; + } + if (fields) { + process.nextTick(function() { + self.onResult(null, rows, fields); + }); + } else { + process.nextTick(function() { + self.onResult(null, rows); + }); + } + } + return null; +}; + +Query.prototype.resultsetHeader = function(packet, connection) { + var rs = new Packets.ResultSetHeader(packet, connection.config.bigNumberStrings); + this._fieldCount = rs.fieldCount; + if (connection.config.debug) { + console.log(' Resultset header received, expecting ' + rs.fieldCount + ' column definition packets'); + } + if (this._fieldCount === 0) { + this._rows.push(rs); + this._fields.push(void(0)); + this.emit('result', rs, this._resultIndex); + this.emit('fields', void(0), this._resultIndex); + if (rs.serverStatus & ServerStatus.SERVER_MORE_RESULTS_EXISTS) { + this._resultIndex++; + return Query.prototype.resultsetHeader; + } + return this.done(); + } + + this._receivedFieldsCount = 0; + this._rows.push([]); + this._fields.push([]); + return Query.prototype.readField; +}; + +// TODO: move to connection.js ? +function getFieldsKey(fields, options) { + var res = (typeof options.nestTables) + '/' + options.nestTables + '/' + options.rowsAsHash; + for (var i=0; i < fields.length; ++i) + res += '/' + fields[i].name + ':' + fields[i].columnType + ':' + fields[i].flags; + return res; +} + +Query.prototype.readField = function(packet, connection) { + + this._receivedFieldsCount++; + + // Often there is much more data in the column definition than in the row itself + // If you set manually _fields[0] to array of ColumnDefinition's (from previous call) + // you can 'cache' result of parsing. Field packets still received, but ignored in that case + // this is the reason _receivedFieldsCount exist (otherwise we could just use current length of fields array) + + if (this._fields[this._resultIndex].length != this._fieldCount) { + var field = new Packets.ColumnDefinition(packet); + this._fields[this._resultIndex].push(field); + if (connection.config.debug) { + console.log(' Column definition:'); + console.log(' name: ' + field.name); + console.log(' type: ' + field.columnType); + console.log(' flags: ' + field.flags); + } + } + + // last field received + if (this._receivedFieldsCount == this._fieldCount) { + var fields = this._fields[this._resultIndex]; + this.emit('fields', fields, this._resultIndex); + var parserKey = getFieldsKey(fields, this.options); + this.rowParser = connection.textProtocolParsers[parserKey]; + if (!this.rowParser) { + this.rowParser = compileParser(fields, this.options, connection.config); + connection.textProtocolParsers[parserKey] = this.rowParser; + } + return Query.prototype.fieldsEOF; + } + return Query.prototype.readField; +}; + +Query.prototype.fieldsEOF = function(packet) { + // check EOF + if (!packet.isEOF()) + throw "Expected EOF packet"; // !!!TODO don't crash if there is a protocol error + return Query.prototype.row; +}; + +Query.prototype.row = function(packet) +{ + if (packet.isEOF()) { + var status = packet.eofStatusFlags(); + var moreResults = packet.eofStatusFlags() & ServerStatus.SERVER_MORE_RESULTS_EXISTS; + if (moreResults) { + this._resultIndex++; + return Query.prototype.resultsetHeader; + } + return this.done(); + } + + var row = new this.rowParser(packet); + if (this.onResult) + this._rows[this._resultIndex].push(row); + else + this.emit('result', row, this._resultIndex); + + return Query.prototype.row; +}; + +module.exports = Query; diff --git a/node_modules/mysql2/lib/commands/register_slave.js b/node_modules/mysql2/lib/commands/register_slave.js new file mode 100644 index 0000000..19304f6 --- /dev/null +++ b/node_modules/mysql2/lib/commands/register_slave.js @@ -0,0 +1,26 @@ +var Command = require('./command'); +var util = require('util'); +var CommandCode = require('../constants/commands'); +var Packets = require('../packets'); + +function RegisterSlave(opts, callback) +{ + Command.call(this); + this.onResult = callback; + this.opts = opts; +} +util.inherits(RegisterSlave, Command); + +RegisterSlave.prototype.start = function(packet, connection) { + var packet = new Packets.RegisterSlave(this.opts); + connection.writePacket(packet.toPacket(1)); + return RegisterSlave.prototype.registerResponse; +}; + +RegisterSlave.prototype.registerResponse = function(packet) { + if (this.onResult) + process.nextTick(this.onResult.bind(this)); + return null; +}; + +module.exports = RegisterSlave; \ No newline at end of file diff --git a/node_modules/mysql2/lib/commands/server_handshake.js b/node_modules/mysql2/lib/commands/server_handshake.js new file mode 100644 index 0000000..46de993 --- /dev/null +++ b/node_modules/mysql2/lib/commands/server_handshake.js @@ -0,0 +1,98 @@ +var Command = require('./command'); +var Packets = require('../packets/index.js'); +var util = require('util'); +var ClientConstants = require('../constants/client'); +var CommandCode = require('../constants/commands'); + +function ServerHandshake(args) +{ + Command.call(this); + this.args = args; + /* + this.protocolVersion = args.protocolVersion || 10; + this.serverVersion = args.serverVersion; + this.connectionId = args.connectionId, + this.statusFlags = args.statusFlags, + this.characterSet = args.characterSet, + this.capabilityFlags = args.capabilityFlags || 512; + */ +} +util.inherits(ServerHandshake, Command); + +ServerHandshake.prototype.start = function(packet, connection) { + var serverHelloPacket = new Packets.Handshake(this.args); + serverHelloPacket.setScrambleData(function(err) { + connection.writePacket(serverHelloPacket.toPacket(0)); + }); + return ServerHandshake.prototype.readClientReply; +}; + +ServerHandshake.prototype.readClientReply = function(packet, connection) { + // TODO connection.writeOk(); + var ok = new Buffer([0x07, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00]); + connection.write(ok); + return ServerHandshake.prototype.dispatchCommands; +}; + +ServerHandshake.prototype.dispatchCommands = function(packet, connection) { + // command from client to server + var commandCode = packet.readInt8(); + switch (commandCode) { + case CommandCode.QUIT: + connection.stream.end(); + break; + case CommandCode.INIT_DB: + var schemaName = packet.readString(); + connection.emit('init_db', schemaName); + connection.writeOk(); + break; + case CommandCode.PING: + // allow custom ping response (delayed/incorrect/etc) + // if no listeners, respond with OK + if (connection.listeners('ping').length === 0) { + connection.writeOk(); + } else { + connection.emit('ping'); + } + break; + case CommandCode.QUERY: + var query = packet.readString(); + connection.emit('query', query); + break; + case CommandCode.FIELD_LIST: + var table = packet.readNullTerminatedString(); + var fields = packet.readString(); + connection.emit('field_list', table, fields); + break; + default: + console.log('Unknown command:', commandCode); + } + return ServerHandshake.prototype.dispatchCommands; +}; + +module.exports = ServerHandshake; + +// TODO: implement server-side 4.1 authentication +/* +4.1 authentication: (http://bazaar.launchpad.net/~mysql/mysql-server/5.5/view/head:/sql/password.c) + + SERVER: public_seed=create_random_string() + send(public_seed) + + CLIENT: recv(public_seed) + hash_stage1=sha1("password") + hash_stage2=sha1(hash_stage1) + reply=xor(hash_stage1, sha1(public_seed,hash_stage2) + + // this three steps are done in scramble() + + send(reply) + + + SERVER: recv(reply) + hash_stage1=xor(reply, sha1(public_seed,hash_stage2)) + candidate_hash2=sha1(hash_stage1) + check(candidate_hash2==hash_stage2) + +server stores sha1(sha1(password)) ( hash_stag2) +*/ diff --git a/node_modules/mysql2/lib/compile_binary_parser.js b/node_modules/mysql2/lib/compile_binary_parser.js new file mode 100644 index 0000000..725b49d --- /dev/null +++ b/node_modules/mysql2/lib/compile_binary_parser.js @@ -0,0 +1,132 @@ +var FieldFlags = require('./constants/field_flags'); +var Charsets = require('./constants/charsets'); +var Types = require('./constants/types'); +var vm = require('vm'); +var srcEscape = require('./helpers').srcEscape; + +var typeNames = []; +for (var t in Types) { + typeNames[Types[t]] = t; +} + +function compile(fields, options, config) { + var result = []; + var i=0; + var nullBitmapLength = Math.floor((fields.length + 7 + 2) / 8); + result.push('(function(){ return function BinaryRow(packet) {'); + + if (options.rowsAsArray) + result.push(' var result = new Array(' + fields.length + ')'); + + var resultTables = {}; + var resultTablesArray = []; + + if (options.nestTables === true) { + for (i = 0; i < fields.length; i++) { + resultTables[fields[i].table] = 1; + } + resultTablesArray = Object.keys(resultTables); + for (i = 0; i < resultTablesArray.length; i++) { + result.push(' this[' + srcEscape(resultTablesArray[i]) + '] = {};'); + } + } + + result.push(' var statusByte = packet.readInt8();'); + for (i=0; i < nullBitmapLength; ++i) + result.push(' var nullBitmaskByte' + i + ' = packet.readInt8();'); + + var lvalue = ''; + var currentFieldNullBit = 4; + var nullByteIndex = 0; + var fieldName = ''; + var tableName = ''; + + for (i = 0; i < fields.length; i++) { + fieldName = srcEscape(fields[i].name); + result.push(' // ' + fieldName + ': '+ typeNames[fields[i].columnType]); + + if (typeof options.nestTables == 'string') { + tableName = srcEscape(fields[i].table); + lvalue = [' this[', srcEscape(fields[i].table + options.nestTables + fields[i].name), ']'].join(''); + } else if (options.nestTables === true) { + tableName = srcEscape(fields[i].table); + lvalue = [' this[', tableName, '][', fieldName, ']'].join(''); + } else if (options.rowsAsArray) { + lvalue = ' result[' + i.toString(10) + ']'; + } else + lvalue = ' this[' + srcEscape(fields[i].name) + ']'; + + if (fields[i].flags & FieldFlags.NOT_NULL) { // don't need to check null bitmap if field can't be null. + result.push(lvalue + ' = ' + readCodeFor(fields[i], config)); + } else if (fields[i].columnType == Types.NULL) { + result.push(lvalue + ' = null;'); + } else { + result.push(' if (nullBitmaskByte' + nullByteIndex + ' & ' + currentFieldNullBit + ')'); + result.push(' ' + lvalue + ' = null;'); + result.push(' else'); + result.push(' ' + lvalue + ' = ' + readCodeFor(fields[i], config)); + } + currentFieldNullBit *= 2; + if (currentFieldNullBit == 0x100) + { + currentFieldNullBit = 1; + nullByteIndex++; + } + } + + if (options.rowsAsArray) + result.push(' return result;'); + + result.push('}; })()'); + var src = result.join('\n'); + if (config.debug) { + console.log('Compiled text protocol row parser:'); + var cardinal = require('cardinal'); + console.log(cardinal.highlight(src)); + } + return vm.runInThisContext(src); +} + +function readCodeFor(field, config) { + var unsigned = field.flags & FieldFlags.UNSIGNED; + switch(field.columnType) { + case Types.TINY: + return unsigned ? "packet.readInt8();" : "packet.readSInt8();"; + case Types.SHORT: + return unsigned ? "packet.readInt16();" : "packet.readSInt16();"; + case Types.LONG: + case Types.INT24: // in binary protocol int24 is encoded in 4 bytes int32 + return unsigned ? "packet.readInt32();" : "packet.readSInt32();"; + case Types.YEAR: + return "packet.readInt16()"; + case Types.FLOAT: + return "packet.readFloat();"; + case Types.DOUBLE: + return "packet.readDouble();"; + case Types.NULL: + return "null;"; + case Types.DATE: + case Types.DATETIME: + case Types.TIMESTAMP: + case Types.NEWDATE: + if (config.dateStrings) + return "packet.readDateTimeString();"; + return "packet.readDateTime();"; + case Types.TIME: + return "packet.readTimeString()"; + case Types.DECIMAL: + case Types.NEWDECIMAL: + return "packet.readLengthCodedString();"; + case Types.GEOMETRY: + return "packet.parseGeometryValue();"; + case Types.LONGLONG: // TODO: 8 bytes. Implement as two 4 bytes read for now (it's out of JavaScript int precision!) + return unsigned ? "packet.readInt64();" : "packet.readSInt64();"; + default: + if (field.characterSet == Charsets.BINARY) + return "packet.readLengthCodedBuffer();"; + else + return "packet.readLengthCodedString();"; + } +} + +module.exports = compile; diff --git a/node_modules/mysql2/lib/compile_text_parser.js b/node_modules/mysql2/lib/compile_text_parser.js new file mode 100644 index 0000000..6ec1365 --- /dev/null +++ b/node_modules/mysql2/lib/compile_text_parser.js @@ -0,0 +1,104 @@ +var Types = require('./constants/types'); +var Charsets = require('./constants/charsets'); +var vm = require('vm'); +var srcEscape = require('./helpers').srcEscape; + +var typeNames = []; +for (var t in Types) { + typeNames[Types[t]] = t; +} + +function compile(fields, options, config) { + + var result = []; + var i=0; + var lvalue = ''; + + result.push('(function() { return function TextRow(packet) {'); + if (options.rowsAsArray) + result.push(' var result = new Array(' + fields.length + ')'); + + var resultTables = {}; + var resultTablesArray = []; + + if (options.nestTables === true) { + for (i = 0; i < fields.length; i++) { + resultTables[fields[i].table] = 1; + } + resultTablesArray = Object.keys(resultTables); + for (i = 0; i < resultTablesArray.length; i++) { + result.push(' this[' + srcEscape(resultTablesArray[i]) + '] = {};'); + } + } + + var fieldName = ''; + var tableName = ''; + for (i = 0; i < fields.length; i++) { + fieldName = srcEscape(fields[i].name); + result.push(' // ' + fieldName + ': '+ typeNames[fields[i].columnType]); + if (typeof options.nestTables == 'string') { + tableName = srcEscape(fields[i].table); + lvalue = [' this[', srcEscape(fields[i].table + options.nestTables + fields[i].name), ']'].join(''); + } else if (options.nestTables === true) { + tableName = srcEscape(fields[i].table); + lvalue = [' this[', tableName, '][', fieldName, ']'].join(''); + } else if (options.rowsAsArray) { + lvalue = ' result[' + i.toString(10) + ']'; + } else + lvalue = ' this[' + srcEscape(fields[i].name) + ']'; + result.push(lvalue + ' = ' + readCodeFor(fields[i].columnType, fields[i].characterSet, config)); + } + + if (options.rowsAsArray) + result.push(' return result;'); + + result.push('};})()'); + var src = result.join('\n'); + if (config.debug) { + console.log(' Compiled text protocol row parser:\n\n'); + var cardinal = require('cardinal'); + console.log(cardinal.highlight(src) + '\n\n'); + } + return vm.runInThisContext(src); +} + +function readCodeFor(type, charset, config) { + switch(type) { + case Types.TINY: + case Types.SHORT: + case Types.LONG: + case Types.INT24: + case Types.YEAR: + case Types.LONG: + case Types.LONGLONG: + return "packet.parseLengthCodedInt();"; + case Types.FLOAT: + case Types.DOUBLE: + return "packet.parseLengthCodedFloat();"; + case Types.NULL: + return "null; packet.skip(1);"; + case Types.DECIMAL: + case Types.NEWDECIMAL: + return "packet.readLengthCodedString(); //" + type + ' ' + charset; + case Types.DATE: + if (config.dateStrings) + return "packet.readLengthCodedString()"; + return "packet.parseDate();"; + case Types.DATETIME: + case Types.TIMESTAMP: + if (config.dateStrings) + return "packet.readLengthCodedString()"; + return "packet.parseDateTime();"; + case Types.TIME: + return "packet.readLengthCodedString()"; + case Types.GEOMETRY: + return "packet.parseGeometryValue();"; + default: + if (charset == Charsets.BINARY) + return "packet.readLengthCodedBuffer();"; + else + return "packet.readLengthCodedString(); //" + type + ' ' + charset; + } +} + +module.exports = compile; diff --git a/node_modules/mysql2/lib/connection.js b/node_modules/mysql2/lib/connection.js new file mode 100644 index 0000000..4926441 --- /dev/null +++ b/node_modules/mysql2/lib/connection.js @@ -0,0 +1,510 @@ +var net = require('net'); +var util = require('util'); +var EventEmitter = require('events').EventEmitter; +var Queue = require('fastqueue'); + +var PacketParser = require('./packet_parser'); +var Packet = require('./packets/packet'); +var Packets = require('./packets/index.js'); +var Commands = require('./commands/index.js'); +var SqlString = require('./sql_string'); + +var _connectionId = 0; + +function Connection(opts) +{ + EventEmitter.call(this); + this.config = opts.config; + + // TODO: fill defaults + // if no params, connect to /var/lib/mysql/mysql.sock ( /tmp/mysql.sock on OSX ) + // if host is given, connect to host:3306 + + // TODO: use `/usr/local/mysql/bin/mysql_config --socket` output? as default socketPath + // if there is no host/port and no socketPath parameters? + + if (!opts.config.stream) { + if (opts.config.socketPath) + this.stream = net.connect(opts.config.socketPath); + else + this.stream = net.connect(opts.config.port, opts.config.host); + } else { + this.stream = opts.config.stream; + } + this._internalId = _connectionId++; + + this._commands = new Queue(); + this._command = null; + + this.statements = {}; + + // TODO: make it lru cache + // https://github.com/mercadolibre/node-simple-lru-cache + // or https://github.com/rsms/js-lru + // or https://github.com/monsur/jscache + // or https://github.com/isaacs/node-lru-cache + // + // key is field.name + ':' + field.columnType + ':' field.flags + '/' + this.textProtocolParsers = {}; + + // TODO: not sure if cache should be separate (same key as with textProtocolParsers) + // or part of prepared statements cache (key is sql query) + this.binaryProtocolParsers = {}; + + this.serverCapabilityFlags = 0; + this.authorized = false; + + var connection = this; + this.sequenceId = 0; + + this.stream.on('error', function(err) { + connection.emit('error', err); + }); + + // big TODO: benchmark if it all worth using 'ondata' and onPacket callbacks directly + // compositing streams would be much more easier. + // also, look for existing length-prefixed streams to reuse instead of packet_parser + // https://github.com/squaremo/node-spb - currently only fixed 4 byte prefix + // ...? + + // see https://gist.github.com/khoomeister/4985691#use-that-instead-of-bind + this.packetParser = new PacketParser(function(p) { connection.handlePacket(p) }); + + // TODO: this code used to be an optimized version of handler + // DOES NOT WORK IN NODE 11 + // TODO: measure if we actually get something here + // if yes, re-enable for node 10 + //if (this.stream instanceof net.Stream) { + // this.stream.ondata = function(data, start, end) { + // connection.packetParser.execute(data, start, end); + // }; + //} else { + this.stream.on('data', function(data) { + connection.packetParser.execute(data, 0, data.length); + }); + //} + this._protocolError = null; + this.stream.on('end', function() { + // we need to set this flag everywhere where we want connaction to close + if (connection._closing) + return; + + if (!connection._protocolError) // no particular error message before disconnect + connection._protocolError = 'PROTOCOL_CONNECTION_LOST' + var err = new Error('Connection lost: The server closed the connection.'); + err.fatal = true; + err.code = connection._protocolError; + connection.emit('error', err); + + }); + var handshakeCommand; + if (!this.config.isServer) { + handshakeCommand = new Commands.ClientHandshake(this.config.clientFlags); + handshakeCommand.on('error', function(e) { connection.emit('error', e); }); + this.addCommand(handshakeCommand); + } +} +util.inherits(Connection, EventEmitter); + +Connection.prototype.write = function(buffer) { + this.stream.write(buffer); +}; + +// TODO: replace function in runtime instead of having if() here +// Needs benchmark. +Connection.prototype.writePacket = function(packet) { + packet.writeHeader(this.sequenceId); + if (this.config.debug) { + console.log(this._internalId + ' ' + this.connectionId + ' <== ' + this._command._commandName + '#' + this._command.stateName() + '(' + [this.sequenceId, packet._name, packet.length()].join(',') + ')'); + } + this.sequenceId++; + if (this.sequenceId == 256) + this.sequenceId = 0 + if (!this.config.compress || !this.authorized) { + this.write(packet.buffer); + } else { + var packetLen = packet.length(); + var compressHeader = new Buffer(7); + + // TODO: currently all outgoing packets are sent uncompressed (header + deflated length=0 as uncompressed flag) + // Need to implement deflation of outgoing packet. Also need to decide when not to compress small packets + // http://dev.mysql.com/doc/internals/en/compression.html#uncompressed-payload suggest not to compress packets less than 50 bytes + + // Write uncompressed packet + compressHeader.fill(0); + compressHeader.writeUInt8(packetLen & 0xff, 0); + compressHeader.writeUInt16LE(packetLen >> 8, 1); + this.write(compressHeader); + this.write(packet.buffer); + } +}; + +Connection.prototype.startTLS = function(onSecure) { + var connection = this; + var crypto = require('crypto'); + var tls = require('tls'); + var config = this.config; + var stream = this.stream; + + // special case for Amazon RDS: use http://s3.amazonaws.com/rds-downloads/mysql-ssl-ca-cert.pem CA cert if ssl option set to "Amazon RDS" + if (config.ssl === 'Amazon RDS') { + var fs = require('fs'); + var path = require('path'); + fs.readFile(path.resolve(__dirname, '../fixtures/mysql-ssl-ca-cert.pem'), function(err, ca) { + if (err) throw err; + config.ssl = { ca: ca }; + after(); + }); + } else + after(); + + function after() { + var credentials = crypto.createCredentials({ + key: config.ssl.key, + cert: config.ssl.cert, + passphrase: config.ssl.passphrase, + ca: config.ssl.ca + }); + var securePair = tls.createSecurePair(credentials, false); + if (stream.ondata) + stream.ondata = null; + stream.removeAllListeners('data'); + stream.pipe(securePair.encrypted); + securePair.encrypted.pipe(stream); + securePair.cleartext.on('data', function(data) { + connection.packetParser.execute(data.parent, data.offset, data.offset + data.length); + }); + connection.write = function(buffer) { + securePair.cleartext.write(buffer); + }; + securePair.on('secure', onSecure); + } +}; + +// TODO: this does not work if uncompressed packet is split by compressed +// packet boundary. +// My assumption about compressedPacket to contain one or more complete +// compressed packets was wrong. It can wrap any chunk of data. +// This will be rmoved in favor of connection.startInflate +// currently Handshake command overwrites connection.handlePacket with handleCompressedPacket +// before expecting first compressed packet +var zlib = require('zlib'); +Connection.prototype.handleCompressedPacket = function(packet) { + var connection = this; + var inflatedLength = packet.readInt24(); + if (inflatedLength !== 0) { + var compressedBody = packet.readBuffer(packet.length() - 3); + zlib.inflate(compressedBody, function(err, packets) { + if (err) + return connection.emit('error', err); + var offset = packets.offset; + var end = offset + packets.length; + var buffer = packets.parent; + var len = 0; + var id = 0; + // single compressed packet can contain multiple uncompressed + while (offset < end) { + len = buffer.readUInt16LE(offset) + (buffer[offset+2] << 16); + id = buffer[offset+3]; + connection.handlePacket(new Packet(id, buffer, offset + 4, offset + 4 + len)); + offset += 4 + len; + } + }); + } else { + inflatedLength = packet.readInt24(); + var sequenceId = packet.readInt8(); + connection.handlePacket(new Packet(sequenceId, packet.buffer, packet.offset, packet.offset + inflatedLength)); + } +}; + +// TODO: consider using @creationix simple-streams +// https://gist.github.com/creationix/5498108 +// https://github.com/creationix/min-stream-uv +// https://github.com/creationix/min-stream-helpers + + +// TODO: try with Stream2 streams +// +// changes stream -> packetParser to +// stream -> compressedPacketParser -> inflateStream -> packetParser +// note that in the caseof ssl this should become +// stream -> securePair.encrypted -> securePair.cleartext -> compressedPacketParser -> inflateStream -> packetParser +Connection.prototype.startInflate = function() { + var connection = this; + var zlib = require('zlib'); + var inflateStream = zlib.createInflate(); + var uncompressedPacketParser = connection.packetParser; + connection.packetParser = new PacketParser(function(compressedPacket) { + var inflatedLength = packet.readInt24(); + if (inflatedLength !== 0) { + inflateStream.write(packet.readBuffer(packet.length() - 3)); + } else { + uncompressedPacketParser.execute(packet.buffer, packet.offset, packet.end); + } + }); + inflateStream.on('data', function(buff) { + uncompressedPacketParser.execute(buff.parent, buff.offset, buff.offset + buff.length); + }); + if (this.stream.ondata) + this.stream.ondata = null; + this.stream.removeAllListeners('data'); + this.pipe(); +}; + +Connection.prototype.pipe = function() { + var connection = this; + if (this.stream instanceof net.Stream) { + this.stream.ondata = function(data, start, end) { + connection.packetParser.execute(data, start, end); + }; + } else { + this.stream.on('data', function(data) { + connection.packetParser.execute(data.parent, data.offset, data.offset + data.length); + }); + } +}; + +Connection.prototype.handlePacket = function(packet) { + // TODO: check packet sequenceId here + var packetType = ''; + if (packet) + this.sequenceId = packet.sequenceId + 1; + if (this.config.debug) { + if (packet) { + console.log(this._internalId + ' ' + this.connectionId + ' ==> ' + this._command._commandName + '#' + this._command.stateName() + '(' + [packet.sequenceId, packet.type(), packet.length()].join(',') + ')'); + } + } + var done = this._command.execute(packet, this); + if (done) { + this.sequenceId = 0; + this._command = this._commands.shift(); + if (this._command) + this.handlePacket(); + } +}; + +Connection.prototype.addCommand = function(cmd) { + if (this.config.debug) { + console.log('Add command: ' + arguments.callee.caller.name); + cmd._commandName = arguments.callee.caller.name; + } + if (!this._command) { + this._command = cmd; + this.handlePacket(); + } else { + this._commands.push(cmd); + } + return cmd; +}; + +Connection.prototype.format = function(sql, values) { + if (typeof this.config.queryFormat == "function") { + return this.config.queryFormat.call(this, sql, values, this.config.timezone); + } + return SqlString.format(sql, values, this.config.timezone); +}; + +Connection.prototype.escape = function(value) { + return SqlString.escape(value, false, this.config.timezone); +}; + +function _domainify(callback) { + var domain = process.domain; + if (domain && callback) + return process.domain.bind(callback); + else + return callback; +} + +Connection.prototype.query = function query(sql, values, cb) { + // copy-paste from node-mysql/lib/Connection.js:createQuery + var options = {}; + if (typeof sql === 'object') { + // query(options, cb) + options = sql; + if (typeof values === 'function') { + cb = values; + } else { + options.values = values; + } + } else if (typeof values === 'function') { + // query(sql, cb) + cb = values; + options.sql = sql; + options.values = undefined; + } else { + // query(sql, values, cb) + options.sql = sql; + options.values = values; + } + var rawSql = this.format(options.sql, options.values || []); + return this.addCommand(new Commands.Query(rawSql, options, _domainify(cb))); +}; + +Connection.prototype.execute = function execute(sql, values, cb) { + var options = {}; + if (typeof sql === 'object') { + // execute(options, cb) + options = sql; + if (typeof values === 'function') { + cb = values; + } else { + options.values = values; + } + } else if (typeof values === 'function') { + // execute(sql, cb) + cb = values; + options.sql = sql; + options.values = undefined; + } else { + // execute(sql, values, cb) + options.sql = sql; + options.values = values; + } + + return this.addCommand(new Commands.Execute(options, _domainify(cb))); +}; + +// transaction helpers +Connection.prototype.beginTransaction = function(cb) { + return this.query('START TRANSACTION', cb); +} + +Connection.prototype.commit = function(cb) { + return this.query('COMMIT', cb); +} + +Connection.prototype.rollback = function(cb) { + return this.query('ROLLBACK', cb); +} + +Connection.prototype.ping = function ping(cb) { + return this.addCommand(new Commands.Ping(_domainify(cb))); +}; + +Connection.prototype._registerSlave = function registerSlave(opts, cb) { + return this.addCommand(new Commands.RegisterSlave(opts, _domainify(cb))); +}; + +Connection.prototype._binlogDump = function binlogDump(opts, cb) { + return this.addCommand(new Commands.BinlogDump(opts, _domainify(cb))); +}; + +Connection.prototype.createBinlogStream = function(opts) { + // TODO: create proper stream class + // TODO: use through2 + var test = 1; + var Readable = require('stream').Readable; + var stream = new Readable({objectMode: true}); + stream._read = function() { + return { + data: test++ + } + }; + var connection = this; + connection._registerSlave(opts, function(err) { + var dumpCmd = connection._binlogDump(opts); + dumpCmd.on('event', function(ev) { + stream.push(ev); + }); + dumpCmd.on('eof', function() { + stream.push(null); + // if non-blocking, then close stream to prevent errors + if (opts.flags && (opts.flags & 0x01)) { + connection._closing = true; + connection.stream.end(); + } + }); + // TODO: pipe errors as well + }) + return stream; +} + +Connection.prototype.connect = function(cb) { + if (!cb) return; + var connectCalled = 0; + + // TODO domainify this callback as well. Note that domain has to be captured + // at the top of function due to nested callback + function callbackOnce(isErrorHandler) { + return function(param) { + if (!connectCalled) { + if (isErrorHandler) + cb(param); + else + cb(null, param); + } + connectCalled = 1; + }; + } + this.once('error', callbackOnce(true) ); + this.once('connect', callbackOnce(false)); +}; + +// =================================== +// outgoing server connection methods +// =================================== + +Connection.prototype.writeColumns = function(columns) { + var connection = this; + this.writePacket(Packets.ResultSetHeader.toPacket(columns.length)); + columns.forEach(function(column) { + connection.writePacket(Packets.ColumnDefinition.toPacket(column)); + }); + this.writeEof(); +}; + +// row is array of columns, not hash +Connection.prototype.writeTextRow = function(column) { + this.writePacket(Packets.TextRow.toPacket(column)); +}; + +Connection.prototype.writeTextResult = function(rows, columns) { + var connection = this; + connection.writeColumns(columns); + rows.forEach(function(row) { + var arrayRow = new Array(columns.length); + columns.forEach(function(column) { + arrayRow.push(row[column.name]); + }); + connection.writeTextRow(arrayRow); + }); + connection.writeEof(); +}; + +Connection.prototype.writeEof = function(warnings, statusFlags) { + this.writePacket(Packets.EOF.toPacket(warnings, statusFlags)); +}; + +Connection.prototype.writeOk = function(args) { + if (!args) + args = { affectedRows: 0 }; + this.writePacket(Packets.OK.toPacket(args)); +}; + +Connection.prototype.writeError = function(args) { + this.writePacket(Packets.Error.toPacket(args)); +}; + +Connection.prototype.serverHandshake = function serverHandshake(args) { + return this.addCommand(new Commands.ServerHandshake(args)); +}; + +// =============================================================== + +// TODO: domainify +Connection.prototype.end = function(callback) { + // TODO: implement COM_QUIT command + var self = this; + var endCmd = { connection: this }; + endCmd.execute = function() { + self._closing = true; + this.connection.stream.end(); + if (callback) + callback(); + }; + return this.addCommand(endCmd); + //return this.addCommand(new Commands.Quit(callback)); +}; + +module.exports = Connection; diff --git a/node_modules/mysql2/lib/connection_config.js b/node_modules/mysql2/lib/connection_config.js new file mode 100644 index 0000000..457055d --- /dev/null +++ b/node_modules/mysql2/lib/connection_config.js @@ -0,0 +1,120 @@ +var urlParse = require('url').parse; +var ClientConstants = require('./constants/client'); +var Charsets = require('./constants/charsets'); + +module.exports = ConnectionConfig; +function ConnectionConfig(options) { + if (typeof options === 'string') { + options = ConnectionConfig.parseUrl(options); + } + + this.isServer = options.isServer; + this.stream = options.stream; + + this.host = options.host || 'localhost'; + this.port = options.port || 3306; + this.socketPath = options.socketPath; + this.user = options.user || undefined; + this.password = options.password || undefined; + this.database = options.database; + this.insecureAuth = options.insecureAuth || false; + this.supportBigNumbers = options.supportBigNumbers || false; + this.bigNumberStrings = options.bigNumberStrings || false; + this.debug = options.debug; + this.timezone = options.timezone || 'local'; + this.flags = options.flags || ''; + this.queryFormat = options.queryFormat; + this.pool = options.pool || undefined; + this.multipleStatements = options.multipleStatements || false; + this.typeCast = (options.typeCast === undefined) ? true : options.typeCast; + this.ssl = options.ssl; + this.compress = options.compress || false; + this.dateStrings = options.dateStrings || false; + + + if (this.timezone[0] == " ") { + // "+" is a url encoded char for space so it + // gets translated to space when giving a + // connection string.. + this.timezone = "+" + this.timezone.substr(1); + } + + this.maxPacketSize = 0; + this.charsetNumber = (options.charset) + ? ConnectionConfig.getCharsetNumber(options.charset) + : options.charsetNumber||Charsets.UTF8_GENERAL_CI; + + this.clientFlags = ConnectionConfig.mergeFlags(ConnectionConfig.getDefaultFlags(options), + options.flags || ''); +} + +ConnectionConfig.mergeFlags = function(default_flags, user_flags) { + var flags = 0x0, i; + + user_flags = (user_flags || '').toUpperCase().split(/\s*,+\s*/); + + // add default flags unless "blacklisted" + for (i in default_flags) { + if (user_flags.indexOf("-" + default_flags[i]) >= 0) continue; + + flags |= ClientConstants[default_flags[i]] || 0x0; + } + // add user flags unless already already added + for (i in user_flags) { + if (user_flags[i][0] == "-") continue; + if (default_flags.indexOf(user_flags[i]) >= 0) continue; + + flags |= ClientConstants[user_flags[i]] || 0x0; + } + + return flags; +}; + +ConnectionConfig.getDefaultFlags = function(options) { + var defaultFlags = [ "LONG_PASSWORD", "FOUND_ROWS", "LONG_FLAG", + "CONNECT_WITH_DB", "ODBC", "LOCAL_FILES", + "IGNORE_SPACE", "PROTOCOL_41", "IGNORE_SIGPIPE", + "TRANSACTIONS", "RESERVED", "SECURE_CONNECTION", + "MULTI_RESULTS" ]; + if (options && options.multipleStatements) { + defaultFlags.push("MULTI_STATEMENTS"); + } + + return defaultFlags; +}; + +ConnectionConfig.getCharsetNumber = function(charset) { + return Charsets[charset]; +}; + +ConnectionConfig.parseUrl = function(url) { + url = urlParse(url, true); + + var options = { + host : url.hostname, + port : url.port, + database : url.pathname.substr(1), + }; + + if (url.auth) { + var auth = url.auth.split(':'); + options.user = auth[0]; + options.password = auth[1]; + } + + if (url.query) { + for (var key in url.query) { + var value = url.query[key]; + + try { + // Try to parse this as a JSON expression first + options[key] = JSON.parse(value); + } catch (err) { + // Otherwise assume it is a plain string + options[key] = value; + } + } + } + + return options; +}; diff --git a/node_modules/mysql2/lib/constants/charsets.js b/node_modules/mysql2/lib/constants/charsets.js new file mode 100644 index 0000000..5883964 --- /dev/null +++ b/node_modules/mysql2/lib/constants/charsets.js @@ -0,0 +1,195 @@ +exports.BIG5_CHINESE_CI = 1; +exports.LATIN2_CZECH_CS = 2; +exports.DEC8_SWEDISH_CI = 3; +exports.CP850_GENERAL_CI = 4; +exports.LATIN1_GERMAN1_CI = 5; +exports.HP8_ENGLISH_CI = 6; +exports.KOI8R_GENERAL_CI = 7; +exports.LATIN1_SWEDISH_CI = 8; +exports.LATIN2_GENERAL_CI = 9; +exports.SWE7_SWEDISH_CI = 10; +exports.ASCII_GENERAL_CI = 11; +exports.UJIS_JAPANESE_CI = 12; +exports.SJIS_JAPANESE_CI = 13; +exports.CP1251_BULGARIAN_CI = 14; +exports.LATIN1_DANISH_CI = 15; +exports.HEBREW_GENERAL_CI = 16; +exports.TIS620_THAI_CI = 18; +exports.EUCKR_KOREAN_CI = 19; +exports.LATIN7_ESTONIAN_CS = 20; +exports.LATIN2_HUNGARIAN_CI = 21; +exports.KOI8U_GENERAL_CI = 22; +exports.CP1251_UKRAINIAN_CI = 23; +exports.GB2312_CHINESE_CI = 24; +exports.GREEK_GENERAL_CI = 25; +exports.CP1250_GENERAL_CI = 26; +exports.LATIN2_CROATIAN_CI = 27; +exports.GBK_CHINESE_CI = 28; +exports.CP1257_LITHUANIAN_CI = 29; +exports.LATIN5_TURKISH_CI = 30; +exports.LATIN1_GERMAN2_CI = 31; +exports.ARMSCII8_GENERAL_CI = 32; +exports.UTF8_GENERAL_CI = 33; +exports.CP1250_CZECH_CS = 34; +exports.UCS2_GENERAL_CI = 35; +exports.CP866_GENERAL_CI = 36; +exports.KEYBCS2_GENERAL_CI = 37; +exports.MACCE_GENERAL_CI = 38; +exports.MACROMAN_GENERAL_CI = 39; +exports.CP852_GENERAL_CI = 40; +exports.LATIN7_GENERAL_CI = 41; +exports.LATIN7_GENERAL_CS = 42; +exports.MACCE_BIN = 43; +exports.CP1250_CROATIAN_CI = 44; +exports.UTF8MB4_GENERAL_CI = 45; +exports.UTF8MB4_BIN = 46; +exports.LATIN1_BIN = 47; +exports.LATIN1_GENERAL_CI = 48; +exports.LATIN1_GENERAL_CS = 49; +exports.CP1251_BIN = 50; +exports.CP1251_GENERAL_CI = 51; +exports.CP1251_GENERAL_CS = 52; +exports.MACROMAN_BIN = 53; +exports.UTF16_GENERAL_CI = 54; +exports.UTF16_BIN = 55; +exports.CP1256_GENERAL_CI = 57; +exports.CP1257_BIN = 58; +exports.CP1257_GENERAL_CI = 59; +exports.UTF32_GENERAL_CI = 60; +exports.UTF32_BIN = 61; +exports.BINARY = 63; +exports.ARMSCII8_BIN = 64; +exports.ASCII_BIN = 65; +exports.CP1250_BIN = 66; +exports.CP1256_BIN = 67; +exports.CP866_BIN = 68; +exports.DEC8_BIN = 69; +exports.GREEK_BIN = 70; +exports.HEBREW_BIN = 71; +exports.HP8_BIN = 72; +exports.KEYBCS2_BIN = 73; +exports.KOI8R_BIN = 74; +exports.KOI8U_BIN = 75; +exports.LATIN2_BIN = 77; +exports.LATIN5_BIN = 78; +exports.LATIN7_BIN = 79; +exports.CP850_BIN = 80; +exports.CP852_BIN = 81; +exports.SWE7_BIN = 82; +exports.UTF8_BIN = 83; +exports.BIG5_BIN = 84; +exports.EUCKR_BIN = 85; +exports.GB2312_BIN = 86; +exports.GBK_BIN = 87; +exports.SJIS_BIN = 88; +exports.TIS620_BIN = 89; +exports.UCS2_BIN = 90; +exports.UJIS_BIN = 91; +exports.GEOSTD8_GENERAL_CI = 92; +exports.GEOSTD8_BIN = 93; +exports.LATIN1_SPANISH_CI = 94; +exports.CP932_JAPANESE_CI = 95; +exports.CP932_BIN = 96; +exports.EUCJPMS_JAPANESE_CI = 97; +exports.EUCJPMS_BIN = 98; +exports.CP1250_POLISH_CI = 99; +exports.UTF16_UNICODE_CI = 101; +exports.UTF16_ICELANDIC_CI = 102; +exports.UTF16_LATVIAN_CI = 103; +exports.UTF16_ROMANIAN_CI = 104; +exports.UTF16_SLOVENIAN_CI = 105; +exports.UTF16_POLISH_CI = 106; +exports.UTF16_ESTONIAN_CI = 107; +exports.UTF16_SPANISH_CI = 108; +exports.UTF16_SWEDISH_CI = 109; +exports.UTF16_TURKISH_CI = 110; +exports.UTF16_CZECH_CI = 111; +exports.UTF16_DANISH_CI = 112; +exports.UTF16_LITHUANIAN_CI = 113; +exports.UTF16_SLOVAK_CI = 114; +exports.UTF16_SPANISH2_CI = 115; +exports.UTF16_ROMAN_CI = 116; +exports.UTF16_PERSIAN_CI = 117; +exports.UTF16_ESPERANTO_CI = 118; +exports.UTF16_HUNGARIAN_CI = 119; +exports.UTF16_SINHALA_CI = 120; +exports.UCS2_UNICODE_CI = 128; +exports.UCS2_ICELANDIC_CI = 129; +exports.UCS2_LATVIAN_CI = 130; +exports.UCS2_ROMANIAN_CI = 131; +exports.UCS2_SLOVENIAN_CI = 132; +exports.UCS2_POLISH_CI = 133; +exports.UCS2_ESTONIAN_CI = 134; +exports.UCS2_SPANISH_CI = 135; +exports.UCS2_SWEDISH_CI = 136; +exports.UCS2_TURKISH_CI = 137; +exports.UCS2_CZECH_CI = 138; +exports.UCS2_DANISH_CI = 139; +exports.UCS2_LITHUANIAN_CI = 140; +exports.UCS2_SLOVAK_CI = 141; +exports.UCS2_SPANISH2_CI = 142; +exports.UCS2_ROMAN_CI = 143; +exports.UCS2_PERSIAN_CI = 144; +exports.UCS2_ESPERANTO_CI = 145; +exports.UCS2_HUNGARIAN_CI = 146; +exports.UCS2_SINHALA_CI = 147; +exports.UTF32_UNICODE_CI = 160; +exports.UTF32_ICELANDIC_CI = 161; +exports.UTF32_LATVIAN_CI = 162; +exports.UTF32_ROMANIAN_CI = 163; +exports.UTF32_SLOVENIAN_CI = 164; +exports.UTF32_POLISH_CI = 165; +exports.UTF32_ESTONIAN_CI = 166; +exports.UTF32_SPANISH_CI = 167; +exports.UTF32_SWEDISH_CI = 168; +exports.UTF32_TURKISH_CI = 169; +exports.UTF32_CZECH_CI = 170; +exports.UTF32_DANISH_CI = 171; +exports.UTF32_LITHUANIAN_CI = 172; +exports.UTF32_SLOVAK_CI = 173; +exports.UTF32_SPANISH2_CI = 174; +exports.UTF32_ROMAN_CI = 175; +exports.UTF32_PERSIAN_CI = 176; +exports.UTF32_ESPERANTO_CI = 177; +exports.UTF32_HUNGARIAN_CI = 178; +exports.UTF32_SINHALA_CI = 179; +exports.UTF8_UNICODE_CI = 192; +exports.UTF8_ICELANDIC_CI = 193; +exports.UTF8_LATVIAN_CI = 194; +exports.UTF8_ROMANIAN_CI = 195; +exports.UTF8_SLOVENIAN_CI = 196; +exports.UTF8_POLISH_CI = 197; +exports.UTF8_ESTONIAN_CI = 198; +exports.UTF8_SPANISH_CI = 199; +exports.UTF8_SWEDISH_CI = 200; +exports.UTF8_TURKISH_CI = 201; +exports.UTF8_CZECH_CI = 202; +exports.UTF8_DANISH_CI = 203; +exports.UTF8_LITHUANIAN_CI = 204; +exports.UTF8_SLOVAK_CI = 205; +exports.UTF8_SPANISH2_CI = 206; +exports.UTF8_ROMAN_CI = 207; +exports.UTF8_PERSIAN_CI = 208; +exports.UTF8_ESPERANTO_CI = 209; +exports.UTF8_HUNGARIAN_CI = 210; +exports.UTF8_SINHALA_CI = 211; +exports.UTF8MB4_UNICODE_CI = 224; +exports.UTF8MB4_ICELANDIC_CI = 225; +exports.UTF8MB4_LATVIAN_CI = 226; +exports.UTF8MB4_ROMANIAN_CI = 227; +exports.UTF8MB4_SLOVENIAN_CI = 228; +exports.UTF8MB4_POLISH_CI = 229; +exports.UTF8MB4_ESTONIAN_CI = 230; +exports.UTF8MB4_SPANISH_CI = 231; +exports.UTF8MB4_SWEDISH_CI = 232; +exports.UTF8MB4_TURKISH_CI = 233; +exports.UTF8MB4_CZECH_CI = 234; +exports.UTF8MB4_DANISH_CI = 235; +exports.UTF8MB4_LITHUANIAN_CI = 236; +exports.UTF8MB4_SLOVAK_CI = 237; +exports.UTF8MB4_SPANISH2_CI = 238; +exports.UTF8MB4_ROMAN_CI = 239; +exports.UTF8MB4_PERSIAN_CI = 240; +exports.UTF8MB4_ESPERANTO_CI = 241; +exports.UTF8MB4_HUNGARIAN_CI = 242; +exports.UTF8MB4_SINHALA_CI = 243; \ No newline at end of file diff --git a/node_modules/mysql2/lib/constants/client.js b/node_modules/mysql2/lib/constants/client.js new file mode 100644 index 0000000..119488e --- /dev/null +++ b/node_modules/mysql2/lib/constants/client.js @@ -0,0 +1,26 @@ +// Manually extracted from mysql-5.5.23/include/mysql_com.h +exports.LONG_PASSWORD = 1; /* new more secure passwords */ +exports.FOUND_ROWS = 2; /* Found instead of affected rows */ +exports.LONG_FLAG = 4; /* Get all column flags */ +exports.CONNECT_WITH_DB = 8; /* One can specify db on connect */ +exports.NO_SCHEMA = 16; /* Don't allow database.table.column */ +exports.COMPRESS = 32; /* Can use compression protocol */ +exports.ODBC = 64; /* Odbc client */ +exports.LOCAL_FILES = 128; /* Can use LOAD DATA LOCAL */ +exports.IGNORE_SPACE = 256; /* Ignore spaces before '(' */ +exports.PROTOCOL_41 = 512; /* New 4.1 protocol */ +exports.INTERACTIVE = 1024; /* This is an interactive client */ +exports.SSL = 2048; /* Switch to SSL after handshake */ +exports.IGNORE_SIGPIPE = 4096; /* IGNORE sigpipes */ +exports.TRANSACTIONS = 8192; /* Client knows about transactions */ +exports.RESERVED = 16384; /* Old flag for 4.1 protocol */ +exports.SECURE_CONNECTION = 32768; /* New 4.1 authentication */ + +exports.MULTI_STATEMENTS = 65536; /* Enable/disable multi-stmt support */ +exports.MULTI_RESULTS = 131072; /* Enable/disable multi-results */ +exports.PS_MULTI_RESULTS = 262144; /* Multi-results in PS-protocol */ + +exports.PLUGIN_AUTH = 524288; /* Client supports plugin authentication */ + +exports.SSL_VERIFY_SERVER_CERT = 1073741824; +exports.REMEMBER_OPTIONS = 2147483648; diff --git a/node_modules/mysql2/lib/constants/commands.js b/node_modules/mysql2/lib/constants/commands.js new file mode 100644 index 0000000..adf0c1e --- /dev/null +++ b/node_modules/mysql2/lib/constants/commands.js @@ -0,0 +1,34 @@ +module.exports = { + SLEEP : 0x00, // deprecated + QUIT : 0x01, + INIT_DB : 0x02, + QUERY : 0x03, + FIELD_LIST : 0x04, + CREATE_DB : 0x05, + DROP_DB : 0x06, + REFRESH : 0x07, + SHUTDOWN : 0x08, + STATISTICS : 0x09, + PROCESS_INFO : 0x0a, // deprecated + CONNECT : 0x0b, // deprecated + PROCESS_KILL : 0x0c, + DEBUG : 0x0d, + PING : 0x0e, + TIME : 0x0f, // deprecated + DELAYED_INSERT : 0x10, // deprecated + CHANGE_USER : 0x11, + BINLOG_DUMP : 0x12, + TABLE_DUMP : 0x13, + CONNECT_OUT : 0x14, + REGISTER_SLAVE : 0x15, + STMT_PREPARE : 0x16, + STMT_EXECUTE : 0x17, + STMT_SEND_LONG_DATA: 0x18, + STMT_CLOSE : 0x19, + STMT_RESET : 0x1a, + SET_OPTION : 0x1b, + STMT_FETCH : 0x1c, + DAEMON : 0x1d, // deprecated + BINLOG_DUMP_GTID : 0x1e, + UNKNOWN : 0xff // bad! +}; \ No newline at end of file diff --git a/node_modules/mysql2/lib/constants/cursor.js b/node_modules/mysql2/lib/constants/cursor.js new file mode 100644 index 0000000..97e3d3e --- /dev/null +++ b/node_modules/mysql2/lib/constants/cursor.js @@ -0,0 +1,6 @@ +module.exports = { + NO_CURSOR: 0, + READ_ONLY: 1, + FOR_UPDATE: 2, + SCROLLABLE: 3 +}; diff --git a/node_modules/mysql2/lib/constants/errors.js b/node_modules/mysql2/lib/constants/errors.js new file mode 100644 index 0000000..5fcd72b --- /dev/null +++ b/node_modules/mysql2/lib/constants/errors.js @@ -0,0 +1,726 @@ +// Generated by generate-error-constants.js, do not modify by hand +module.exports.codeToName = []; +module.exports.codeToName[1000] = 'ER_HASHCHK'; +module.exports.codeToName[1001] = 'ER_NISAMCHK'; +module.exports.codeToName[1002] = 'ER_NO'; +module.exports.codeToName[1003] = 'ER_YES'; +module.exports.codeToName[1004] = 'ER_CANT_CREATE_FILE'; +module.exports.codeToName[1005] = 'ER_CANT_CREATE_TABLE'; +module.exports.codeToName[1006] = 'ER_CANT_CREATE_DB'; +module.exports.codeToName[1007] = 'ER_DB_CREATE_EXISTS'; +module.exports.codeToName[1008] = 'ER_DB_DROP_EXISTS'; +module.exports.codeToName[1009] = 'ER_DB_DROP_DELETE'; +module.exports.codeToName[1010] = 'ER_DB_DROP_RMDIR'; +module.exports.codeToName[1011] = 'ER_CANT_DELETE_FILE'; +module.exports.codeToName[1012] = 'ER_CANT_FIND_SYSTEM_REC'; +module.exports.codeToName[1013] = 'ER_CANT_GET_STAT'; +module.exports.codeToName[1014] = 'ER_CANT_GET_WD'; +module.exports.codeToName[1015] = 'ER_CANT_LOCK'; +module.exports.codeToName[1016] = 'ER_CANT_OPEN_FILE'; +module.exports.codeToName[1017] = 'ER_FILE_NOT_FOUND'; +module.exports.codeToName[1018] = 'ER_CANT_READ_DIR'; +module.exports.codeToName[1019] = 'ER_CANT_SET_WD'; +module.exports.codeToName[1020] = 'ER_CHECKREAD'; +module.exports.codeToName[1021] = 'ER_DISK_FULL'; +module.exports.codeToName[1022] = 'ER_DUP_KEY'; +module.exports.codeToName[1023] = 'ER_ERROR_ON_CLOSE'; +module.exports.codeToName[1024] = 'ER_ERROR_ON_READ'; +module.exports.codeToName[1025] = 'ER_ERROR_ON_RENAME'; +module.exports.codeToName[1026] = 'ER_ERROR_ON_WRITE'; +module.exports.codeToName[1027] = 'ER_FILE_USED'; +module.exports.codeToName[1028] = 'ER_FILSORT_ABORT'; +module.exports.codeToName[1029] = 'ER_FORM_NOT_FOUND'; +module.exports.codeToName[1030] = 'ER_GET_ERRNO'; +module.exports.codeToName[1031] = 'ER_ILLEGAL_HA'; +module.exports.codeToName[1032] = 'ER_KEY_NOT_FOUND'; +module.exports.codeToName[1033] = 'ER_NOT_FORM_FILE'; +module.exports.codeToName[1034] = 'ER_NOT_KEYFILE'; +module.exports.codeToName[1035] = 'ER_OLD_KEYFILE'; +module.exports.codeToName[1036] = 'ER_OPEN_AS_READONLY'; +module.exports.codeToName[1037] = 'ER_OUTOFMEMORY'; +module.exports.codeToName[1038] = 'ER_OUT_OF_SORTMEMORY'; +module.exports.codeToName[1039] = 'ER_UNEXPECTED_EOF'; +module.exports.codeToName[1040] = 'ER_CON_COUNT_ERROR'; +module.exports.codeToName[1041] = 'ER_OUT_OF_RESOURCES'; +module.exports.codeToName[1042] = 'ER_BAD_HOST_ERROR'; +module.exports.codeToName[1043] = 'ER_HANDSHAKE_ERROR'; +module.exports.codeToName[1044] = 'ER_DBACCESS_DENIED_ERROR'; +module.exports.codeToName[1045] = 'ER_ACCESS_DENIED_ERROR'; +module.exports.codeToName[1046] = 'ER_NO_DB_ERROR'; +module.exports.codeToName[1047] = 'ER_UNKNOWN_COM_ERROR'; +module.exports.codeToName[1048] = 'ER_BAD_NULL_ERROR'; +module.exports.codeToName[1049] = 'ER_BAD_DB_ERROR'; +module.exports.codeToName[1050] = 'ER_TABLE_EXISTS_ERROR'; +module.exports.codeToName[1051] = 'ER_BAD_TABLE_ERROR'; +module.exports.codeToName[1052] = 'ER_NON_UNIQ_ERROR'; +module.exports.codeToName[1053] = 'ER_SERVER_SHUTDOWN'; +module.exports.codeToName[1054] = 'ER_BAD_FIELD_ERROR'; +module.exports.codeToName[1055] = 'ER_WRONG_FIELD_WITH_GROUP'; +module.exports.codeToName[1056] = 'ER_WRONG_GROUP_FIELD'; +module.exports.codeToName[1057] = 'ER_WRONG_SUM_SELECT'; +module.exports.codeToName[1058] = 'ER_WRONG_VALUE_COUNT'; +module.exports.codeToName[1059] = 'ER_TOO_LONG_IDENT'; +module.exports.codeToName[1060] = 'ER_DUP_FIELDNAME'; +module.exports.codeToName[1061] = 'ER_DUP_KEYNAME'; +module.exports.codeToName[1062] = 'ER_DUP_ENTRY'; +module.exports.codeToName[1063] = 'ER_WRONG_FIELD_SPEC'; +module.exports.codeToName[1064] = 'ER_PARSE_ERROR'; +module.exports.codeToName[1065] = 'ER_EMPTY_QUERY'; +module.exports.codeToName[1066] = 'ER_NONUNIQ_TABLE'; +module.exports.codeToName[1067] = 'ER_INVALID_DEFAULT'; +module.exports.codeToName[1068] = 'ER_MULTIPLE_PRI_KEY'; +module.exports.codeToName[1069] = 'ER_TOO_MANY_KEYS'; +module.exports.codeToName[1070] = 'ER_TOO_MANY_KEY_PARTS'; +module.exports.codeToName[1071] = 'ER_TOO_LONG_KEY'; +module.exports.codeToName[1072] = 'ER_KEY_COLUMN_DOES_NOT_EXITS'; +module.exports.codeToName[1073] = 'ER_BLOB_USED_AS_KEY'; +module.exports.codeToName[1074] = 'ER_TOO_BIG_FIELDLENGTH'; +module.exports.codeToName[1075] = 'ER_WRONG_AUTO_KEY'; +module.exports.codeToName[1076] = 'ER_READY'; +module.exports.codeToName[1077] = 'ER_NORMAL_SHUTDOWN'; +module.exports.codeToName[1078] = 'ER_GOT_SIGNAL'; +module.exports.codeToName[1079] = 'ER_SHUTDOWN_COMPLETE'; +module.exports.codeToName[1080] = 'ER_FORCING_CLOSE'; +module.exports.codeToName[1081] = 'ER_IPSOCK_ERROR'; +module.exports.codeToName[1082] = 'ER_NO_SUCH_INDEX'; +module.exports.codeToName[1083] = 'ER_WRONG_FIELD_TERMINATORS'; +module.exports.codeToName[1084] = 'ER_BLOBS_AND_NO_TERMINATED'; +module.exports.codeToName[1085] = 'ER_TEXTFILE_NOT_READABLE'; +module.exports.codeToName[1086] = 'ER_FILE_EXISTS_ERROR'; +module.exports.codeToName[1087] = 'ER_LOAD_INFO'; +module.exports.codeToName[1088] = 'ER_ALTER_INFO'; +module.exports.codeToName[1089] = 'ER_WRONG_SUB_KEY'; +module.exports.codeToName[1090] = 'ER_CANT_REMOVE_ALL_FIELDS'; +module.exports.codeToName[1091] = 'ER_CANT_DROP_FIELD_OR_KEY'; +module.exports.codeToName[1092] = 'ER_INSERT_INFO'; +module.exports.codeToName[1093] = 'ER_UPDATE_TABLE_USED'; +module.exports.codeToName[1094] = 'ER_NO_SUCH_THREAD'; +module.exports.codeToName[1095] = 'ER_KILL_DENIED_ERROR'; +module.exports.codeToName[1096] = 'ER_NO_TABLES_USED'; +module.exports.codeToName[1097] = 'ER_TOO_BIG_SET'; +module.exports.codeToName[1098] = 'ER_NO_UNIQUE_LOGFILE'; +module.exports.codeToName[1099] = 'ER_TABLE_NOT_LOCKED_FOR_WRITE'; +module.exports.codeToName[1100] = 'ER_TABLE_NOT_LOCKED'; +module.exports.codeToName[1101] = 'ER_BLOB_CANT_HAVE_DEFAULT'; +module.exports.codeToName[1102] = 'ER_WRONG_DB_NAME'; +module.exports.codeToName[1103] = 'ER_WRONG_TABLE_NAME'; +module.exports.codeToName[1104] = 'ER_TOO_BIG_SELECT'; +module.exports.codeToName[1105] = 'ER_UNKNOWN_ERROR'; +module.exports.codeToName[1106] = 'ER_UNKNOWN_PROCEDURE'; +module.exports.codeToName[1107] = 'ER_WRONG_PARAMCOUNT_TO_PROCEDURE'; +module.exports.codeToName[1108] = 'ER_WRONG_PARAMETERS_TO_PROCEDURE'; +module.exports.codeToName[1109] = 'ER_UNKNOWN_TABLE'; +module.exports.codeToName[1110] = 'ER_FIELD_SPECIFIED_TWICE'; +module.exports.codeToName[1111] = 'ER_INVALID_GROUP_FUNC_USE'; +module.exports.codeToName[1112] = 'ER_UNSUPPORTED_EXTENSION'; +module.exports.codeToName[1113] = 'ER_TABLE_MUST_HAVE_COLUMNS'; +module.exports.codeToName[1114] = 'ER_RECORD_FILE_FULL'; +module.exports.codeToName[1115] = 'ER_UNKNOWN_CHARACTER_SET'; +module.exports.codeToName[1116] = 'ER_TOO_MANY_TABLES'; +module.exports.codeToName[1117] = 'ER_TOO_MANY_FIELDS'; +module.exports.codeToName[1118] = 'ER_TOO_BIG_ROWSIZE'; +module.exports.codeToName[1119] = 'ER_STACK_OVERRUN'; +module.exports.codeToName[1120] = 'ER_WRONG_OUTER_JOIN'; +module.exports.codeToName[1121] = 'ER_NULL_COLUMN_IN_INDEX'; +module.exports.codeToName[1122] = 'ER_CANT_FIND_UDF'; +module.exports.codeToName[1123] = 'ER_CANT_INITIALIZE_UDF'; +module.exports.codeToName[1124] = 'ER_UDF_NO_PATHS'; +module.exports.codeToName[1125] = 'ER_UDF_EXISTS'; +module.exports.codeToName[1126] = 'ER_CANT_OPEN_LIBRARY'; +module.exports.codeToName[1127] = 'ER_CANT_FIND_DL_ENTRY'; +module.exports.codeToName[1128] = 'ER_FUNCTION_NOT_DEFINED'; +module.exports.codeToName[1129] = 'ER_HOST_IS_BLOCKED'; +module.exports.codeToName[1130] = 'ER_HOST_NOT_PRIVILEGED'; +module.exports.codeToName[1131] = 'ER_PASSWORD_ANONYMOUS_USER'; +module.exports.codeToName[1132] = 'ER_PASSWORD_NOT_ALLOWED'; +module.exports.codeToName[1133] = 'ER_PASSWORD_NO_MATCH'; +module.exports.codeToName[1134] = 'ER_UPDATE_INFO'; +module.exports.codeToName[1135] = 'ER_CANT_CREATE_THREAD'; +module.exports.codeToName[1136] = 'ER_WRONG_VALUE_COUNT_ON_ROW'; +module.exports.codeToName[1137] = 'ER_CANT_REOPEN_TABLE'; +module.exports.codeToName[1138] = 'ER_INVALID_USE_OF_NULL'; +module.exports.codeToName[1139] = 'ER_REGEXP_ERROR'; +module.exports.codeToName[1140] = 'ER_MIX_OF_GROUP_FUNC_AND_FIELDS'; +module.exports.codeToName[1141] = 'ER_NONEXISTING_GRANT'; +module.exports.codeToName[1142] = 'ER_TABLEACCESS_DENIED_ERROR'; +module.exports.codeToName[1143] = 'ER_COLUMNACCESS_DENIED_ERROR'; +module.exports.codeToName[1144] = 'ER_ILLEGAL_GRANT_FOR_TABLE'; +module.exports.codeToName[1145] = 'ER_GRANT_WRONG_HOST_OR_USER'; +module.exports.codeToName[1146] = 'ER_NO_SUCH_TABLE'; +module.exports.codeToName[1147] = 'ER_NONEXISTING_TABLE_GRANT'; +module.exports.codeToName[1148] = 'ER_NOT_ALLOWED_COMMAND'; +module.exports.codeToName[1149] = 'ER_SYNTAX_ERROR'; +module.exports.codeToName[1150] = 'ER_DELAYED_CANT_CHANGE_LOCK'; +module.exports.codeToName[1151] = 'ER_TOO_MANY_DELAYED_THREADS'; +module.exports.codeToName[1152] = 'ER_ABORTING_CONNECTION'; +module.exports.codeToName[1153] = 'ER_NET_PACKET_TOO_LARGE'; +module.exports.codeToName[1154] = 'ER_NET_READ_ERROR_FROM_PIPE'; +module.exports.codeToName[1155] = 'ER_NET_FCNTL_ERROR'; +module.exports.codeToName[1156] = 'ER_NET_PACKETS_OUT_OF_ORDER'; +module.exports.codeToName[1157] = 'ER_NET_UNCOMPRESS_ERROR'; +module.exports.codeToName[1158] = 'ER_NET_READ_ERROR'; +module.exports.codeToName[1159] = 'ER_NET_READ_INTERRUPTED'; +module.exports.codeToName[1160] = 'ER_NET_ERROR_ON_WRITE'; +module.exports.codeToName[1161] = 'ER_NET_WRITE_INTERRUPTED'; +module.exports.codeToName[1162] = 'ER_TOO_LONG_STRING'; +module.exports.codeToName[1163] = 'ER_TABLE_CANT_HANDLE_BLOB'; +module.exports.codeToName[1164] = 'ER_TABLE_CANT_HANDLE_AUTO_INCREMENT'; +module.exports.codeToName[1165] = 'ER_DELAYED_INSERT_TABLE_LOCKED'; +module.exports.codeToName[1166] = 'ER_WRONG_COLUMN_NAME'; +module.exports.codeToName[1167] = 'ER_WRONG_KEY_COLUMN'; +module.exports.codeToName[1168] = 'ER_WRONG_MRG_TABLE'; +module.exports.codeToName[1169] = 'ER_DUP_UNIQUE'; +module.exports.codeToName[1170] = 'ER_BLOB_KEY_WITHOUT_LENGTH'; +module.exports.codeToName[1171] = 'ER_PRIMARY_CANT_HAVE_NULL'; +module.exports.codeToName[1172] = 'ER_TOO_MANY_ROWS'; +module.exports.codeToName[1173] = 'ER_REQUIRES_PRIMARY_KEY'; +module.exports.codeToName[1174] = 'ER_NO_RAID_COMPILED'; +module.exports.codeToName[1175] = 'ER_UPDATE_WITHOUT_KEY_IN_SAFE_MODE'; +module.exports.codeToName[1176] = 'ER_KEY_DOES_NOT_EXITS'; +module.exports.codeToName[1177] = 'ER_CHECK_NO_SUCH_TABLE'; +module.exports.codeToName[1178] = 'ER_CHECK_NOT_IMPLEMENTED'; +module.exports.codeToName[1179] = 'ER_CANT_DO_THIS_DURING_AN_TRANSACTION'; +module.exports.codeToName[1180] = 'ER_ERROR_DURING_COMMIT'; +module.exports.codeToName[1181] = 'ER_ERROR_DURING_ROLLBACK'; +module.exports.codeToName[1182] = 'ER_ERROR_DURING_FLUSH_LOGS'; +module.exports.codeToName[1183] = 'ER_ERROR_DURING_CHECKPOINT'; +module.exports.codeToName[1184] = 'ER_NEW_ABORTING_CONNECTION'; +module.exports.codeToName[1185] = 'ER_DUMP_NOT_IMPLEMENTED'; +module.exports.codeToName[1186] = 'ER_FLUSH_MASTER_BINLOG_CLOSED'; +module.exports.codeToName[1187] = 'ER_INDEX_REBUILD'; +module.exports.codeToName[1188] = 'ER_MASTER'; +module.exports.codeToName[1189] = 'ER_MASTER_NET_READ'; +module.exports.codeToName[1190] = 'ER_MASTER_NET_WRITE'; +module.exports.codeToName[1191] = 'ER_FT_MATCHING_KEY_NOT_FOUND'; +module.exports.codeToName[1192] = 'ER_LOCK_OR_ACTIVE_TRANSACTION'; +module.exports.codeToName[1193] = 'ER_UNKNOWN_SYSTEM_VARIABLE'; +module.exports.codeToName[1194] = 'ER_CRASHED_ON_USAGE'; +module.exports.codeToName[1195] = 'ER_CRASHED_ON_REPAIR'; +module.exports.codeToName[1196] = 'ER_WARNING_NOT_COMPLETE_ROLLBACK'; +module.exports.codeToName[1197] = 'ER_TRANS_CACHE_FULL'; +module.exports.codeToName[1198] = 'ER_SLAVE_MUST_STOP'; +module.exports.codeToName[1199] = 'ER_SLAVE_NOT_RUNNING'; +module.exports.codeToName[1200] = 'ER_BAD_SLAVE'; +module.exports.codeToName[1201] = 'ER_MASTER_INFO'; +module.exports.codeToName[1202] = 'ER_SLAVE_THREAD'; +module.exports.codeToName[1203] = 'ER_TOO_MANY_USER_CONNECTIONS'; +module.exports.codeToName[1204] = 'ER_SET_CONSTANTS_ONLY'; +module.exports.codeToName[1205] = 'ER_LOCK_WAIT_TIMEOUT'; +module.exports.codeToName[1206] = 'ER_LOCK_TABLE_FULL'; +module.exports.codeToName[1207] = 'ER_READ_ONLY_TRANSACTION'; +module.exports.codeToName[1208] = 'ER_DROP_DB_WITH_READ_LOCK'; +module.exports.codeToName[1209] = 'ER_CREATE_DB_WITH_READ_LOCK'; +module.exports.codeToName[1210] = 'ER_WRONG_ARGUMENTS'; +module.exports.codeToName[1211] = 'ER_NO_PERMISSION_TO_CREATE_USER'; +module.exports.codeToName[1212] = 'ER_UNION_TABLES_IN_DIFFERENT_DIR'; +module.exports.codeToName[1213] = 'ER_LOCK_DEADLOCK'; +module.exports.codeToName[1214] = 'ER_TABLE_CANT_HANDLE_FT'; +module.exports.codeToName[1215] = 'ER_CANNOT_ADD_FOREIGN'; +module.exports.codeToName[1216] = 'ER_NO_REFERENCED_ROW'; +module.exports.codeToName[1217] = 'ER_ROW_IS_REFERENCED'; +module.exports.codeToName[1218] = 'ER_CONNECT_TO_MASTER'; +module.exports.codeToName[1219] = 'ER_QUERY_ON_MASTER'; +module.exports.codeToName[1220] = 'ER_ERROR_WHEN_EXECUTING_COMMAND'; +module.exports.codeToName[1221] = 'ER_WRONG_USAGE'; +module.exports.codeToName[1222] = 'ER_WRONG_NUMBER_OF_COLUMNS_IN_SELECT'; +module.exports.codeToName[1223] = 'ER_CANT_UPDATE_WITH_READLOCK'; +module.exports.codeToName[1224] = 'ER_MIXING_NOT_ALLOWED'; +module.exports.codeToName[1225] = 'ER_DUP_ARGUMENT'; +module.exports.codeToName[1226] = 'ER_USER_LIMIT_REACHED'; +module.exports.codeToName[1227] = 'ER_SPECIFIC_ACCESS_DENIED_ERROR'; +module.exports.codeToName[1228] = 'ER_LOCAL_VARIABLE'; +module.exports.codeToName[1229] = 'ER_GLOBAL_VARIABLE'; +module.exports.codeToName[1230] = 'ER_NO_DEFAULT'; +module.exports.codeToName[1231] = 'ER_WRONG_VALUE_FOR_VAR'; +module.exports.codeToName[1232] = 'ER_WRONG_TYPE_FOR_VAR'; +module.exports.codeToName[1233] = 'ER_VAR_CANT_BE_READ'; +module.exports.codeToName[1234] = 'ER_CANT_USE_OPTION_HERE'; +module.exports.codeToName[1235] = 'ER_NOT_SUPPORTED_YET'; +module.exports.codeToName[1236] = 'ER_MASTER_FATAL_ERROR_READING_BINLOG'; +module.exports.codeToName[1237] = 'ER_SLAVE_IGNORED_TABLE'; +module.exports.codeToName[1238] = 'ER_INCORRECT_GLOBAL_LOCAL_VAR'; +module.exports.codeToName[1239] = 'ER_WRONG_FK_DEF'; +module.exports.codeToName[1240] = 'ER_KEY_REF_DO_NOT_MATCH_TABLE_REF'; +module.exports.codeToName[1241] = 'ER_OPERAND_COLUMNS'; +module.exports.codeToName[1242] = 'ER_SUBQUERY_NO_'; +module.exports.codeToName[1243] = 'ER_UNKNOWN_STMT_HANDLER'; +module.exports.codeToName[1244] = 'ER_CORRUPT_HELP_DB'; +module.exports.codeToName[1245] = 'ER_CYCLIC_REFERENCE'; +module.exports.codeToName[1246] = 'ER_AUTO_CONVERT'; +module.exports.codeToName[1247] = 'ER_ILLEGAL_REFERENCE'; +module.exports.codeToName[1248] = 'ER_DERIVED_MUST_HAVE_ALIAS'; +module.exports.codeToName[1249] = 'ER_SELECT_REDUCED'; +module.exports.codeToName[1250] = 'ER_TABLENAME_NOT_ALLOWED_HERE'; +module.exports.codeToName[1251] = 'ER_NOT_SUPPORTED_AUTH_MODE'; +module.exports.codeToName[1252] = 'ER_SPATIAL_CANT_HAVE_NULL'; +module.exports.codeToName[1253] = 'ER_COLLATION_CHARSET_MISMATCH'; +module.exports.codeToName[1254] = 'ER_SLAVE_WAS_RUNNING'; +module.exports.codeToName[1255] = 'ER_SLAVE_WAS_NOT_RUNNING'; +module.exports.codeToName[1256] = 'ER_TOO_BIG_FOR_UNCOMPRESS'; +module.exports.codeToName[1257] = 'ER_ZLIB_Z_MEM_ERROR'; +module.exports.codeToName[1258] = 'ER_ZLIB_Z_BUF_ERROR'; +module.exports.codeToName[1259] = 'ER_ZLIB_Z_DATA_ERROR'; +module.exports.codeToName[1260] = 'ER_CUT_VALUE_GROUP_CONCAT'; +module.exports.codeToName[1261] = 'ER_WARN_TOO_FEW_RECORDS'; +module.exports.codeToName[1262] = 'ER_WARN_TOO_MANY_RECORDS'; +module.exports.codeToName[1263] = 'ER_WARN_NULL_TO_NOTNULL'; +module.exports.codeToName[1264] = 'ER_WARN_DATA_OUT_OF_RANGE'; +module.exports.codeToName[1265] = 'WARN_DATA_TRUNCATED'; +module.exports.codeToName[1266] = 'ER_WARN_USING_OTHER_HANDLER'; +module.exports.codeToName[1267] = 'ER_CANT_AGGREGATE_'; +module.exports.codeToName[1268] = 'ER_DROP_USER'; +module.exports.codeToName[1269] = 'ER_REVOKE_GRANTS'; +module.exports.codeToName[1270] = 'ER_CANT_AGGREGATE_'; +module.exports.codeToName[1271] = 'ER_CANT_AGGREGATE_NCOLLATIONS'; +module.exports.codeToName[1272] = 'ER_VARIABLE_IS_NOT_STRUCT'; +module.exports.codeToName[1273] = 'ER_UNKNOWN_COLLATION'; +module.exports.codeToName[1274] = 'ER_SLAVE_IGNORED_SSL_PARAMS'; +module.exports.codeToName[1275] = 'ER_SERVER_IS_IN_SECURE_AUTH_MODE'; +module.exports.codeToName[1276] = 'ER_WARN_FIELD_RESOLVED'; +module.exports.codeToName[1277] = 'ER_BAD_SLAVE_UNTIL_COND'; +module.exports.codeToName[1278] = 'ER_MISSING_SKIP_SLAVE'; +module.exports.codeToName[1279] = 'ER_UNTIL_COND_IGNORED'; +module.exports.codeToName[1280] = 'ER_WRONG_NAME_FOR_INDEX'; +module.exports.codeToName[1281] = 'ER_WRONG_NAME_FOR_CATALOG'; +module.exports.codeToName[1282] = 'ER_WARN_QC_RESIZE'; +module.exports.codeToName[1283] = 'ER_BAD_FT_COLUMN'; +module.exports.codeToName[1284] = 'ER_UNKNOWN_KEY_CACHE'; +module.exports.codeToName[1285] = 'ER_WARN_HOSTNAME_WONT_WORK'; +module.exports.codeToName[1286] = 'ER_UNKNOWN_STORAGE_ENGINE'; +module.exports.codeToName[1287] = 'ER_WARN_DEPRECATED_SYNTAX'; +module.exports.codeToName[1288] = 'ER_NON_UPDATABLE_TABLE'; +module.exports.codeToName[1289] = 'ER_FEATURE_DISABLED'; +module.exports.codeToName[1290] = 'ER_OPTION_PREVENTS_STATEMENT'; +module.exports.codeToName[1291] = 'ER_DUPLICATED_VALUE_IN_TYPE'; +module.exports.codeToName[1292] = 'ER_TRUNCATED_WRONG_VALUE'; +module.exports.codeToName[1293] = 'ER_TOO_MUCH_AUTO_TIMESTAMP_COLS'; +module.exports.codeToName[1294] = 'ER_INVALID_ON_UPDATE'; +module.exports.codeToName[1295] = 'ER_UNSUPPORTED_PS'; +module.exports.codeToName[1296] = 'ER_GET_ERRMSG'; +module.exports.codeToName[1297] = 'ER_GET_TEMPORARY_ERRMSG'; +module.exports.codeToName[1298] = 'ER_UNKNOWN_TIME_ZONE'; +module.exports.codeToName[1299] = 'ER_WARN_INVALID_TIMESTAMP'; +module.exports.codeToName[1300] = 'ER_INVALID_CHARACTER_STRING'; +module.exports.codeToName[1301] = 'ER_WARN_ALLOWED_PACKET_OVERFLOWED'; +module.exports.codeToName[1302] = 'ER_CONFLICTING_DECLARATIONS'; +module.exports.codeToName[1303] = 'ER_SP_NO_RECURSIVE_CREATE'; +module.exports.codeToName[1304] = 'ER_SP_ALREADY_EXISTS'; +module.exports.codeToName[1305] = 'ER_SP_DOES_NOT_EXIST'; +module.exports.codeToName[1306] = 'ER_SP_DROP_FAILED'; +module.exports.codeToName[1307] = 'ER_SP_STORE_FAILED'; +module.exports.codeToName[1308] = 'ER_SP_LILABEL_MISMATCH'; +module.exports.codeToName[1309] = 'ER_SP_LABEL_REDEFINE'; +module.exports.codeToName[1310] = 'ER_SP_LABEL_MISMATCH'; +module.exports.codeToName[1311] = 'ER_SP_UNINIT_VAR'; +module.exports.codeToName[1312] = 'ER_SP_BADSELECT'; +module.exports.codeToName[1313] = 'ER_SP_BADRETURN'; +module.exports.codeToName[1314] = 'ER_SP_BADSTATEMENT'; +module.exports.codeToName[1315] = 'ER_UPDATE_LOG_DEPRECATED_IGNORED'; +module.exports.codeToName[1316] = 'ER_UPDATE_LOG_DEPRECATED_TRANSLATED'; +module.exports.codeToName[1317] = 'ER_QUERY_INTERRUPTED'; +module.exports.codeToName[1318] = 'ER_SP_WRONG_NO_OF_ARGS'; +module.exports.codeToName[1319] = 'ER_SP_COND_MISMATCH'; +module.exports.codeToName[1320] = 'ER_SP_NORETURN'; +module.exports.codeToName[1321] = 'ER_SP_NORETURNEND'; +module.exports.codeToName[1322] = 'ER_SP_BAD_CURSOR_QUERY'; +module.exports.codeToName[1323] = 'ER_SP_BAD_CURSOR_SELECT'; +module.exports.codeToName[1324] = 'ER_SP_CURSOR_MISMATCH'; +module.exports.codeToName[1325] = 'ER_SP_CURSOR_ALREADY_OPEN'; +module.exports.codeToName[1326] = 'ER_SP_CURSOR_NOT_OPEN'; +module.exports.codeToName[1327] = 'ER_SP_UNDECLARED_VAR'; +module.exports.codeToName[1328] = 'ER_SP_WRONG_NO_OF_FETCH_ARGS'; +module.exports.codeToName[1329] = 'ER_SP_FETCH_NO_DATA'; +module.exports.codeToName[1330] = 'ER_SP_DUP_PARAM'; +module.exports.codeToName[1331] = 'ER_SP_DUP_VAR'; +module.exports.codeToName[1332] = 'ER_SP_DUP_COND'; +module.exports.codeToName[1333] = 'ER_SP_DUP_CURS'; +module.exports.codeToName[1334] = 'ER_SP_CANT_ALTER'; +module.exports.codeToName[1335] = 'ER_SP_SUBSELECT_NYI'; +module.exports.codeToName[1336] = 'ER_STMT_NOT_ALLOWED_IN_SF_OR_TRG'; +module.exports.codeToName[1337] = 'ER_SP_VARCOND_AFTER_CURSHNDLR'; +module.exports.codeToName[1338] = 'ER_SP_CURSOR_AFTER_HANDLER'; +module.exports.codeToName[1339] = 'ER_SP_CASE_NOT_FOUND'; +module.exports.codeToName[1340] = 'ER_FPARSER_TOO_BIG_FILE'; +module.exports.codeToName[1341] = 'ER_FPARSER_BAD_HEADER'; +module.exports.codeToName[1342] = 'ER_FPARSER_EOF_IN_COMMENT'; +module.exports.codeToName[1343] = 'ER_FPARSER_ERROR_IN_PARAMETER'; +module.exports.codeToName[1344] = 'ER_FPARSER_EOF_IN_UNKNOWN_PARAMETER'; +module.exports.codeToName[1345] = 'ER_VIEW_NO_EXPLAIN'; +module.exports.codeToName[1346] = 'ER_FRM_UNKNOWN_TYPE'; +module.exports.codeToName[1347] = 'ER_WRONG_OBJECT'; +module.exports.codeToName[1348] = 'ER_NONUPDATEABLE_COLUMN'; +module.exports.codeToName[1349] = 'ER_VIEW_SELECT_DERIVED'; +module.exports.codeToName[1350] = 'ER_VIEW_SELECT_CLAUSE'; +module.exports.codeToName[1351] = 'ER_VIEW_SELECT_VARIABLE'; +module.exports.codeToName[1352] = 'ER_VIEW_SELECT_TMPTABLE'; +module.exports.codeToName[1353] = 'ER_VIEW_WRONG_LIST'; +module.exports.codeToName[1354] = 'ER_WARN_VIEW_MERGE'; +module.exports.codeToName[1355] = 'ER_WARN_VIEW_WITHOUT_KEY'; +module.exports.codeToName[1356] = 'ER_VIEW_INVALID'; +module.exports.codeToName[1357] = 'ER_SP_NO_DROP_SP'; +module.exports.codeToName[1358] = 'ER_SP_GOTO_IN_HNDLR'; +module.exports.codeToName[1359] = 'ER_TRG_ALREADY_EXISTS'; +module.exports.codeToName[1360] = 'ER_TRG_DOES_NOT_EXIST'; +module.exports.codeToName[1361] = 'ER_TRG_ON_VIEW_OR_TEMP_TABLE'; +module.exports.codeToName[1362] = 'ER_TRG_CANT_CHANGE_ROW'; +module.exports.codeToName[1363] = 'ER_TRG_NO_SUCH_ROW_IN_TRG'; +module.exports.codeToName[1364] = 'ER_NO_DEFAULT_FOR_FIELD'; +module.exports.codeToName[1365] = 'ER_DIVISION_BY_ZERO'; +module.exports.codeToName[1366] = 'ER_TRUNCATED_WRONG_VALUE_FOR_FIELD'; +module.exports.codeToName[1367] = 'ER_ILLEGAL_VALUE_FOR_TYPE'; +module.exports.codeToName[1368] = 'ER_VIEW_NONUPD_CHECK'; +module.exports.codeToName[1369] = 'ER_VIEW_CHECK_FAILED'; +module.exports.codeToName[1370] = 'ER_PROCACCESS_DENIED_ERROR'; +module.exports.codeToName[1371] = 'ER_RELAY_LOG_FAIL'; +module.exports.codeToName[1372] = 'ER_PASSWD_LENGTH'; +module.exports.codeToName[1373] = 'ER_UNKNOWN_TARGET_BINLOG'; +module.exports.codeToName[1374] = 'ER_IO_ERR_LOG_INDEX_READ'; +module.exports.codeToName[1375] = 'ER_BINLOG_PURGE_PROHIBITED'; +module.exports.codeToName[1376] = 'ER_FSEEK_FAIL'; +module.exports.codeToName[1377] = 'ER_BINLOG_PURGE_FATAL_ERR'; +module.exports.codeToName[1378] = 'ER_LOG_IN_USE'; +module.exports.codeToName[1379] = 'ER_LOG_PURGE_UNKNOWN_ERR'; +module.exports.codeToName[1380] = 'ER_RELAY_LOG_INIT'; +module.exports.codeToName[1381] = 'ER_NO_BINARY_LOGGING'; +module.exports.codeToName[1382] = 'ER_RESERVED_SYNTAX'; +module.exports.codeToName[1383] = 'ER_WSAS_FAILED'; +module.exports.codeToName[1384] = 'ER_DIFF_GROUPS_PROC'; +module.exports.codeToName[1385] = 'ER_NO_GROUP_FOR_PROC'; +module.exports.codeToName[1386] = 'ER_ORDER_WITH_PROC'; +module.exports.codeToName[1387] = 'ER_LOGGING_PROHIBIT_CHANGING_OF'; +module.exports.codeToName[1388] = 'ER_NO_FILE_MAPPING'; +module.exports.codeToName[1389] = 'ER_WRONG_MAGIC'; +module.exports.codeToName[1390] = 'ER_PS_MANY_PARAM'; +module.exports.codeToName[1391] = 'ER_KEY_PART_'; +module.exports.codeToName[1392] = 'ER_VIEW_CHECKSUM'; +module.exports.codeToName[1393] = 'ER_VIEW_MULTIUPDATE'; +module.exports.codeToName[1394] = 'ER_VIEW_NO_INSERT_FIELD_LIST'; +module.exports.codeToName[1395] = 'ER_VIEW_DELETE_MERGE_VIEW'; +module.exports.codeToName[1396] = 'ER_CANNOT_USER'; +module.exports.codeToName[1397] = 'ER_XAER_NOTA'; +module.exports.codeToName[1398] = 'ER_XAER_INVAL'; +module.exports.codeToName[1399] = 'ER_XAER_RMFAIL'; +module.exports.codeToName[1400] = 'ER_XAER_OUTSIDE'; +module.exports.codeToName[1401] = 'ER_XAER_RMERR'; +module.exports.codeToName[1402] = 'ER_XA_RBROLLBACK'; +module.exports.codeToName[1403] = 'ER_NONEXISTING_PROC_GRANT'; +module.exports.codeToName[1404] = 'ER_PROC_AUTO_GRANT_FAIL'; +module.exports.codeToName[1405] = 'ER_PROC_AUTO_REVOKE_FAIL'; +module.exports.codeToName[1406] = 'ER_DATA_TOO_LONG'; +module.exports.codeToName[1407] = 'ER_SP_BAD_SQLSTATE'; +module.exports.codeToName[1408] = 'ER_STARTUP'; +module.exports.codeToName[1409] = 'ER_LOAD_FROM_FIXED_SIZE_ROWS_TO_VAR'; +module.exports.codeToName[1410] = 'ER_CANT_CREATE_USER_WITH_GRANT'; +module.exports.codeToName[1411] = 'ER_WRONG_VALUE_FOR_TYPE'; +module.exports.codeToName[1412] = 'ER_TABLE_DEF_CHANGED'; +module.exports.codeToName[1413] = 'ER_SP_DUP_HANDLER'; +module.exports.codeToName[1414] = 'ER_SP_NOT_VAR_ARG'; +module.exports.codeToName[1415] = 'ER_SP_NO_RETSET'; +module.exports.codeToName[1416] = 'ER_CANT_CREATE_GEOMETRY_OBJECT'; +module.exports.codeToName[1417] = 'ER_FAILED_ROUTINE_BREAK_BINLOG'; +module.exports.codeToName[1418] = 'ER_BINLOG_UNSAFE_ROUTINE'; +module.exports.codeToName[1419] = 'ER_BINLOG_CREATE_ROUTINE_NEED_SUPER'; +module.exports.codeToName[1420] = 'ER_EXEC_STMT_WITH_OPEN_CURSOR'; +module.exports.codeToName[1421] = 'ER_STMT_HAS_NO_OPEN_CURSOR'; +module.exports.codeToName[1422] = 'ER_COMMIT_NOT_ALLOWED_IN_SF_OR_TRG'; +module.exports.codeToName[1423] = 'ER_NO_DEFAULT_FOR_VIEW_FIELD'; +module.exports.codeToName[1424] = 'ER_SP_NO_RECURSION'; +module.exports.codeToName[1425] = 'ER_TOO_BIG_SCALE'; +module.exports.codeToName[1426] = 'ER_TOO_BIG_PRECISION'; +module.exports.codeToName[1427] = 'ER_M_BIGGER_THAN_D'; +module.exports.codeToName[1428] = 'ER_WRONG_LOCK_OF_SYSTEM_TABLE'; +module.exports.codeToName[1429] = 'ER_CONNECT_TO_FOREIGN_DATA_SOURCE'; +module.exports.codeToName[1430] = 'ER_QUERY_ON_FOREIGN_DATA_SOURCE'; +module.exports.codeToName[1431] = 'ER_FOREIGN_DATA_SOURCE_DOESNT_EXIST'; +module.exports.codeToName[1432] = 'ER_FOREIGN_DATA_STRING_INVALID_CANT_CREATE'; +module.exports.codeToName[1433] = 'ER_FOREIGN_DATA_STRING_INVALID'; +module.exports.codeToName[1434] = 'ER_CANT_CREATE_FEDERATED_TABLE'; +module.exports.codeToName[1435] = 'ER_TRG_IN_WRONG_SCHEMA'; +module.exports.codeToName[1436] = 'ER_STACK_OVERRUN_NEED_MORE'; +module.exports.codeToName[1437] = 'ER_TOO_LONG_BODY'; +module.exports.codeToName[1438] = 'ER_WARN_CANT_DROP_DEFAULT_KEYCACHE'; +module.exports.codeToName[1439] = 'ER_TOO_BIG_DISPLAYWIDTH'; +module.exports.codeToName[1440] = 'ER_XAER_DUPID'; +module.exports.codeToName[1441] = 'ER_DATETIME_FUNCTION_OVERFLOW'; +module.exports.codeToName[1442] = 'ER_CANT_UPDATE_USED_TABLE_IN_SF_OR_TRG'; +module.exports.codeToName[1443] = 'ER_VIEW_PREVENT_UPDATE'; +module.exports.codeToName[1444] = 'ER_PS_NO_RECURSION'; +module.exports.codeToName[1445] = 'ER_SP_CANT_SET_AUTOCOMMIT'; +module.exports.codeToName[1446] = 'ER_MALFORMED_DEFINER'; +module.exports.codeToName[1447] = 'ER_VIEW_FRM_NO_USER'; +module.exports.codeToName[1448] = 'ER_VIEW_OTHER_USER'; +module.exports.codeToName[1449] = 'ER_NO_SUCH_USER'; +module.exports.codeToName[1450] = 'ER_FORBID_SCHEMA_CHANGE'; +module.exports.codeToName[1451] = 'ER_ROW_IS_REFERENCED_'; +module.exports.codeToName[1452] = 'ER_NO_REFERENCED_ROW_'; +module.exports.codeToName[1453] = 'ER_SP_BAD_VAR_SHADOW'; +module.exports.codeToName[1454] = 'ER_TRG_NO_DEFINER'; +module.exports.codeToName[1455] = 'ER_OLD_FILE_FORMAT'; +module.exports.codeToName[1456] = 'ER_SP_RECURSION_LIMIT'; +module.exports.codeToName[1457] = 'ER_SP_PROC_TABLE_CORRUPT'; +module.exports.codeToName[1458] = 'ER_SP_WRONG_NAME'; +module.exports.codeToName[1459] = 'ER_TABLE_NEEDS_UPGRADE'; +module.exports.codeToName[1460] = 'ER_SP_NO_AGGREGATE'; +module.exports.codeToName[1461] = 'ER_MAX_PREPARED_STMT_COUNT_REACHED'; +module.exports.codeToName[1462] = 'ER_VIEW_RECURSIVE'; +module.exports.codeToName[1463] = 'ER_NON_GROUPING_FIELD_USED'; +module.exports.codeToName[1464] = 'ER_TABLE_CANT_HANDLE_SPKEYS'; +module.exports.codeToName[1465] = 'ER_NO_TRIGGERS_ON_SYSTEM_SCHEMA'; +module.exports.codeToName[1466] = 'ER_REMOVED_SPACES'; +module.exports.codeToName[1467] = 'ER_AUTOINC_READ_FAILED'; +module.exports.codeToName[1468] = 'ER_USERNAME'; +module.exports.codeToName[1469] = 'ER_HOSTNAME'; +module.exports.codeToName[1470] = 'ER_WRONG_STRING_LENGTH'; +module.exports.codeToName[1471] = 'ER_NON_INSERTABLE_TABLE'; +module.exports.codeToName[1472] = 'ER_ADMIN_WRONG_MRG_TABLE'; +module.exports.codeToName[1473] = 'ER_TOO_HIGH_LEVEL_OF_NESTING_FOR_SELECT'; +module.exports.codeToName[1474] = 'ER_NAME_BECOMES_EMPTY'; +module.exports.codeToName[1475] = 'ER_AMBIGUOUS_FIELD_TERM'; +module.exports.codeToName[1476] = 'ER_FOREIGN_SERVER_EXISTS'; +module.exports.codeToName[1477] = 'ER_FOREIGN_SERVER_DOESNT_EXIST'; +module.exports.codeToName[1478] = 'ER_ILLEGAL_HA_CREATE_OPTION'; +module.exports.codeToName[1479] = 'ER_PARTITION_REQUIRES_VALUES_ERROR'; +module.exports.codeToName[1480] = 'ER_PARTITION_WRONG_VALUES_ERROR'; +module.exports.codeToName[1481] = 'ER_PARTITION_MAXVALUE_ERROR'; +module.exports.codeToName[1482] = 'ER_PARTITION_SUBPARTITION_ERROR'; +module.exports.codeToName[1483] = 'ER_PARTITION_SUBPART_MIX_ERROR'; +module.exports.codeToName[1484] = 'ER_PARTITION_WRONG_NO_PART_ERROR'; +module.exports.codeToName[1485] = 'ER_PARTITION_WRONG_NO_SUBPART_ERROR'; +module.exports.codeToName[1486] = 'ER_WRONG_EXPR_IN_PARTITION_FUNC_ERROR'; +module.exports.codeToName[1487] = 'ER_NO_CONST_EXPR_IN_RANGE_OR_LIST_ERROR'; +module.exports.codeToName[1488] = 'ER_FIELD_NOT_FOUND_PART_ERROR'; +module.exports.codeToName[1489] = 'ER_LIST_OF_FIELDS_ONLY_IN_HASH_ERROR'; +module.exports.codeToName[1490] = 'ER_INCONSISTENT_PARTITION_INFO_ERROR'; +module.exports.codeToName[1491] = 'ER_PARTITION_FUNC_NOT_ALLOWED_ERROR'; +module.exports.codeToName[1492] = 'ER_PARTITIONS_MUST_BE_DEFINED_ERROR'; +module.exports.codeToName[1493] = 'ER_RANGE_NOT_INCREASING_ERROR'; +module.exports.codeToName[1494] = 'ER_INCONSISTENT_TYPE_OF_FUNCTIONS_ERROR'; +module.exports.codeToName[1495] = 'ER_MULTIPLE_DEF_CONST_IN_LIST_PART_ERROR'; +module.exports.codeToName[1496] = 'ER_PARTITION_ENTRY_ERROR'; +module.exports.codeToName[1497] = 'ER_MIX_HANDLER_ERROR'; +module.exports.codeToName[1498] = 'ER_PARTITION_NOT_DEFINED_ERROR'; +module.exports.codeToName[1499] = 'ER_TOO_MANY_PARTITIONS_ERROR'; +module.exports.codeToName[1500] = 'ER_SUBPARTITION_ERROR'; +module.exports.codeToName[1501] = 'ER_CANT_CREATE_HANDLER_FILE'; +module.exports.codeToName[1502] = 'ER_BLOB_FIELD_IN_PART_FUNC_ERROR'; +module.exports.codeToName[1503] = 'ER_UNIQUE_KEY_NEED_ALL_FIELDS_IN_PF'; +module.exports.codeToName[1504] = 'ER_NO_PARTS_ERROR'; +module.exports.codeToName[1505] = 'ER_PARTITION_MGMT_ON_NONPARTITIONED'; +module.exports.codeToName[1506] = 'ER_FOREIGN_KEY_ON_PARTITIONED'; +module.exports.codeToName[1507] = 'ER_DROP_PARTITION_NON_EXISTENT'; +module.exports.codeToName[1508] = 'ER_DROP_LAST_PARTITION'; +module.exports.codeToName[1509] = 'ER_COALESCE_ONLY_ON_HASH_PARTITION'; +module.exports.codeToName[1510] = 'ER_REORG_HASH_ONLY_ON_SAME_NO'; +module.exports.codeToName[1511] = 'ER_REORG_NO_PARAM_ERROR'; +module.exports.codeToName[1512] = 'ER_ONLY_ON_RANGE_LIST_PARTITION'; +module.exports.codeToName[1513] = 'ER_ADD_PARTITION_SUBPART_ERROR'; +module.exports.codeToName[1514] = 'ER_ADD_PARTITION_NO_NEW_PARTITION'; +module.exports.codeToName[1515] = 'ER_COALESCE_PARTITION_NO_PARTITION'; +module.exports.codeToName[1516] = 'ER_REORG_PARTITION_NOT_EXIST'; +module.exports.codeToName[1517] = 'ER_SAME_NAME_PARTITION'; +module.exports.codeToName[1518] = 'ER_NO_BINLOG_ERROR'; +module.exports.codeToName[1519] = 'ER_CONSECUTIVE_REORG_PARTITIONS'; +module.exports.codeToName[1520] = 'ER_REORG_OUTSIDE_RANGE'; +module.exports.codeToName[1521] = 'ER_PARTITION_FUNCTION_FAILURE'; +module.exports.codeToName[1522] = 'ER_PART_STATE_ERROR'; +module.exports.codeToName[1523] = 'ER_LIMITED_PART_RANGE'; +module.exports.codeToName[1524] = 'ER_PLUGIN_IS_NOT_LOADED'; +module.exports.codeToName[1525] = 'ER_WRONG_VALUE'; +module.exports.codeToName[1526] = 'ER_NO_PARTITION_FOR_GIVEN_VALUE'; +module.exports.codeToName[1527] = 'ER_FILEGROUP_OPTION_ONLY_ONCE'; +module.exports.codeToName[1528] = 'ER_CREATE_FILEGROUP_FAILED'; +module.exports.codeToName[1529] = 'ER_DROP_FILEGROUP_FAILED'; +module.exports.codeToName[1530] = 'ER_TABLESPACE_AUTO_EXTEND_ERROR'; +module.exports.codeToName[1531] = 'ER_WRONG_SIZE_NUMBER'; +module.exports.codeToName[1532] = 'ER_SIZE_OVERFLOW_ERROR'; +module.exports.codeToName[1533] = 'ER_ALTER_FILEGROUP_FAILED'; +module.exports.codeToName[1534] = 'ER_BINLOG_ROW_LOGGING_FAILED'; +module.exports.codeToName[1535] = 'ER_BINLOG_ROW_WRONG_TABLE_DEF'; +module.exports.codeToName[1536] = 'ER_BINLOG_ROW_RBR_TO_SBR'; +module.exports.codeToName[1537] = 'ER_EVENT_ALREADY_EXISTS'; +module.exports.codeToName[1538] = 'ER_EVENT_STORE_FAILED'; +module.exports.codeToName[1539] = 'ER_EVENT_DOES_NOT_EXIST'; +module.exports.codeToName[1540] = 'ER_EVENT_CANT_ALTER'; +module.exports.codeToName[1541] = 'ER_EVENT_DROP_FAILED'; +module.exports.codeToName[1542] = 'ER_EVENT_INTERVAL_NOT_POSITIVE_OR_TOO_BIG'; +module.exports.codeToName[1543] = 'ER_EVENT_ENDS_BEFORE_STARTS'; +module.exports.codeToName[1544] = 'ER_EVENT_EXEC_TIME_IN_THE_PAST'; +module.exports.codeToName[1545] = 'ER_EVENT_OPEN_TABLE_FAILED'; +module.exports.codeToName[1546] = 'ER_EVENT_NEITHER_M_EXPR_NOR_M_AT'; +module.exports.codeToName[1547] = 'ER_COL_COUNT_DOESNT_MATCH_CORRUPTED'; +module.exports.codeToName[1548] = 'ER_CANNOT_LOAD_FROM_TABLE'; +module.exports.codeToName[1549] = 'ER_EVENT_CANNOT_DELETE'; +module.exports.codeToName[1550] = 'ER_EVENT_COMPILE_ERROR'; +module.exports.codeToName[1551] = 'ER_EVENT_SAME_NAME'; +module.exports.codeToName[1552] = 'ER_EVENT_DATA_TOO_LONG'; +module.exports.codeToName[1553] = 'ER_DROP_INDEX_FK'; +module.exports.codeToName[1554] = 'ER_WARN_DEPRECATED_SYNTAX_WITH_VER'; +module.exports.codeToName[1555] = 'ER_CANT_WRITE_LOCK_LOG_TABLE'; +module.exports.codeToName[1556] = 'ER_CANT_LOCK_LOG_TABLE'; +module.exports.codeToName[1557] = 'ER_FOREIGN_DUPLICATE_KEY'; +module.exports.codeToName[1558] = 'ER_COL_COUNT_DOESNT_MATCH_PLEASE_UPDATE'; +module.exports.codeToName[1559] = 'ER_TEMP_TABLE_PREVENTS_SWITCH_OUT_OF_RBR'; +module.exports.codeToName[1560] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_FORMAT'; +module.exports.codeToName[1561] = 'ER_NDB_CANT_SWITCH_BINLOG_FORMAT'; +module.exports.codeToName[1562] = 'ER_PARTITION_NO_TEMPORARY'; +module.exports.codeToName[1563] = 'ER_PARTITION_CONST_DOMAIN_ERROR'; +module.exports.codeToName[1564] = 'ER_PARTITION_FUNCTION_IS_NOT_ALLOWED'; +module.exports.codeToName[1565] = 'ER_DDL_LOG_ERROR'; +module.exports.codeToName[1566] = 'ER_NULL_IN_VALUES_LESS_THAN'; +module.exports.codeToName[1567] = 'ER_WRONG_PARTITION_NAME'; +module.exports.codeToName[1568] = 'ER_CANT_CHANGE_TX_ISOLATION'; +module.exports.codeToName[1569] = 'ER_DUP_ENTRY_AUTOINCREMENT_CASE'; +module.exports.codeToName[1570] = 'ER_EVENT_MODIFY_QUEUE_ERROR'; +module.exports.codeToName[1571] = 'ER_EVENT_SET_VAR_ERROR'; +module.exports.codeToName[1572] = 'ER_PARTITION_MERGE_ERROR'; +module.exports.codeToName[1573] = 'ER_CANT_ACTIVATE_LOG'; +module.exports.codeToName[1574] = 'ER_RBR_NOT_AVAILABLE'; +module.exports.codeToName[1575] = 'ER_BASE'; +module.exports.codeToName[1576] = 'ER_EVENT_RECURSION_FORBIDDEN'; +module.exports.codeToName[1577] = 'ER_EVENTS_DB_ERROR'; +module.exports.codeToName[1578] = 'ER_ONLY_INTEGERS_ALLOWED'; +module.exports.codeToName[1579] = 'ER_UNSUPORTED_LOG_ENGINE'; +module.exports.codeToName[1580] = 'ER_BAD_LOG_STATEMENT'; +module.exports.codeToName[1581] = 'ER_CANT_RENAME_LOG_TABLE'; +module.exports.codeToName[1582] = 'ER_WRONG_PARAMCOUNT_TO_NATIVE_FCT'; +module.exports.codeToName[1583] = 'ER_WRONG_PARAMETERS_TO_NATIVE_FCT'; +module.exports.codeToName[1584] = 'ER_WRONG_PARAMETERS_TO_STORED_FCT'; +module.exports.codeToName[1585] = 'ER_NATIVE_FCT_NAME_COLLISION'; +module.exports.codeToName[1586] = 'ER_DUP_ENTRY_WITH_KEY_NAME'; +module.exports.codeToName[1587] = 'ER_BINLOG_PURGE_EMFILE'; +module.exports.codeToName[1588] = 'ER_EVENT_CANNOT_CREATE_IN_THE_PAST'; +module.exports.codeToName[1589] = 'ER_EVENT_CANNOT_ALTER_IN_THE_PAST'; +module.exports.codeToName[1590] = 'ER_SLAVE_INCIDENT'; +module.exports.codeToName[1591] = 'ER_NO_PARTITION_FOR_GIVEN_VALUE_SILENT'; +module.exports.codeToName[1592] = 'ER_BINLOG_UNSAFE_STATEMENT'; +module.exports.codeToName[1593] = 'ER_SLAVE_FATAL_ERROR'; +module.exports.codeToName[1594] = 'ER_SLAVE_RELAY_LOG_READ_FAILURE'; +module.exports.codeToName[1595] = 'ER_SLAVE_RELAY_LOG_WRITE_FAILURE'; +module.exports.codeToName[1596] = 'ER_SLAVE_CREATE_EVENT_FAILURE'; +module.exports.codeToName[1597] = 'ER_SLAVE_MASTER_COM_FAILURE'; +module.exports.codeToName[1598] = 'ER_BINLOG_LOGGING_IMPOSSIBLE'; +module.exports.codeToName[1599] = 'ER_VIEW_NO_CREATION_CTX'; +module.exports.codeToName[1600] = 'ER_VIEW_INVALID_CREATION_CTX'; +module.exports.codeToName[1601] = 'ER_SR_INVALID_CREATION_CTX'; +module.exports.codeToName[1602] = 'ER_TRG_CORRUPTED_FILE'; +module.exports.codeToName[1603] = 'ER_TRG_NO_CREATION_CTX'; +module.exports.codeToName[1604] = 'ER_TRG_INVALID_CREATION_CTX'; +module.exports.codeToName[1605] = 'ER_EVENT_INVALID_CREATION_CTX'; +module.exports.codeToName[1606] = 'ER_TRG_CANT_OPEN_TABLE'; +module.exports.codeToName[1607] = 'ER_CANT_CREATE_SROUTINE'; +module.exports.codeToName[1608] = 'ER_NEVER_USED'; +module.exports.codeToName[1609] = 'ER_NO_FORMAT_DESCRIPTION_EVENT_BEFORE_BINLOG_STATEMENT'; +module.exports.codeToName[1610] = 'ER_SLAVE_CORRUPT_EVENT'; +module.exports.codeToName[1611] = 'ER_LOAD_DATA_INVALID_COLUMN'; +module.exports.codeToName[1612] = 'ER_LOG_PURGE_NO_FILE'; +module.exports.codeToName[1613] = 'ER_XA_RBTIMEOUT'; +module.exports.codeToName[1614] = 'ER_XA_RBDEADLOCK'; +module.exports.codeToName[1615] = 'ER_NEED_REPREPARE'; +module.exports.codeToName[1616] = 'ER_DELAYED_NOT_SUPPORTED'; +module.exports.codeToName[1617] = 'WARN_NO_MASTER_INFO'; +module.exports.codeToName[1618] = 'WARN_OPTION_IGNORED'; +module.exports.codeToName[1619] = 'WARN_PLUGIN_DELETE_BUILTIN'; +module.exports.codeToName[1620] = 'WARN_PLUGIN_BUSY'; +module.exports.codeToName[1621] = 'ER_VARIABLE_IS_READONLY'; +module.exports.codeToName[1622] = 'ER_WARN_ENGINE_TRANSACTION_ROLLBACK'; +module.exports.codeToName[1623] = 'ER_SLAVE_HEARTBEAT_FAILURE'; +module.exports.codeToName[1624] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE'; +module.exports.codeToName[1625] = 'ER_NDB_REPLICATION_SCHEMA_ERROR'; +module.exports.codeToName[1626] = 'ER_CONFLICT_FN_PARSE_ERROR'; +module.exports.codeToName[1627] = 'ER_EXCEPTIONS_WRITE_ERROR'; +module.exports.codeToName[1628] = 'ER_TOO_LONG_TABLE_COMMENT'; +module.exports.codeToName[1629] = 'ER_TOO_LONG_FIELD_COMMENT'; +module.exports.codeToName[1630] = 'ER_FUNC_INEXISTENT_NAME_COLLISION'; +module.exports.codeToName[1631] = 'ER_DATABASE_NAME'; +module.exports.codeToName[1632] = 'ER_TABLE_NAME'; +module.exports.codeToName[1633] = 'ER_PARTITION_NAME'; +module.exports.codeToName[1634] = 'ER_SUBPARTITION_NAME'; +module.exports.codeToName[1635] = 'ER_TEMPORARY_NAME'; +module.exports.codeToName[1636] = 'ER_RENAMED_NAME'; +module.exports.codeToName[1637] = 'ER_TOO_MANY_CONCURRENT_TRXS'; +module.exports.codeToName[1638] = 'WARN_NON_ASCII_SEPARATOR_NOT_IMPLEMENTED'; +module.exports.codeToName[1639] = 'ER_DEBUG_SYNC_TIMEOUT'; +module.exports.codeToName[1640] = 'ER_DEBUG_SYNC_HIT_LIMIT'; +module.exports.codeToName[1641] = 'ER_DUP_SIGNAL_SET'; +module.exports.codeToName[1642] = 'ER_SIGNAL_WARN'; +module.exports.codeToName[1643] = 'ER_SIGNAL_NOT_FOUND'; +module.exports.codeToName[1644] = 'ER_SIGNAL_EXCEPTION'; +module.exports.codeToName[1645] = 'ER_RESIGNAL_WITHOUT_ACTIVE_HANDLER'; +module.exports.codeToName[1646] = 'ER_SIGNAL_BAD_CONDITION_TYPE'; +module.exports.codeToName[1647] = 'WARN_COND_ITEM_TRUNCATED'; +module.exports.codeToName[1648] = 'ER_COND_ITEM_TOO_LONG'; +module.exports.codeToName[1649] = 'ER_UNKNOWN_LOCALE'; +module.exports.codeToName[1650] = 'ER_SLAVE_IGNORE_SERVER_IDS'; +module.exports.codeToName[1651] = 'ER_QUERY_CACHE_DISABLED'; +module.exports.codeToName[1652] = 'ER_SAME_NAME_PARTITION_FIELD'; +module.exports.codeToName[1653] = 'ER_PARTITION_COLUMN_LIST_ERROR'; +module.exports.codeToName[1654] = 'ER_WRONG_TYPE_COLUMN_VALUE_ERROR'; +module.exports.codeToName[1655] = 'ER_TOO_MANY_PARTITION_FUNC_FIELDS_ERROR'; +module.exports.codeToName[1656] = 'ER_MAXVALUE_IN_VALUES_IN'; +module.exports.codeToName[1657] = 'ER_TOO_MANY_VALUES_ERROR'; +module.exports.codeToName[1658] = 'ER_ROW_SINGLE_PARTITION_FIELD_ERROR'; +module.exports.codeToName[1659] = 'ER_FIELD_TYPE_NOT_ALLOWED_AS_PARTITION_FIELD'; +module.exports.codeToName[1660] = 'ER_PARTITION_FIELDS_TOO_LONG'; +module.exports.codeToName[1661] = 'ER_BINLOG_ROW_ENGINE_AND_STMT_ENGINE'; +module.exports.codeToName[1662] = 'ER_BINLOG_ROW_MODE_AND_STMT_ENGINE'; +module.exports.codeToName[1663] = 'ER_BINLOG_UNSAFE_AND_STMT_ENGINE'; +module.exports.codeToName[1664] = 'ER_BINLOG_ROW_INJECTION_AND_STMT_ENGINE'; +module.exports.codeToName[1665] = 'ER_BINLOG_STMT_MODE_AND_ROW_ENGINE'; +module.exports.codeToName[1666] = 'ER_BINLOG_ROW_INJECTION_AND_STMT_MODE'; +module.exports.codeToName[1667] = 'ER_BINLOG_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE'; +module.exports.codeToName[1668] = 'ER_BINLOG_UNSAFE_LIMIT'; +module.exports.codeToName[1669] = 'ER_BINLOG_UNSAFE_INSERT_DELAYED'; +module.exports.codeToName[1670] = 'ER_BINLOG_UNSAFE_SYSTEM_TABLE'; +module.exports.codeToName[1671] = 'ER_BINLOG_UNSAFE_AUTOINC_COLUMNS'; +module.exports.codeToName[1672] = 'ER_BINLOG_UNSAFE_UDF'; +module.exports.codeToName[1673] = 'ER_BINLOG_UNSAFE_SYSTEM_VARIABLE'; +module.exports.codeToName[1674] = 'ER_BINLOG_UNSAFE_SYSTEM_FUNCTION'; +module.exports.codeToName[1675] = 'ER_BINLOG_UNSAFE_NONTRANS_AFTER_TRANS'; +module.exports.codeToName[1676] = 'ER_MESSAGE_AND_STATEMENT'; +module.exports.codeToName[1677] = 'ER_SLAVE_CONVERSION_FAILED'; +module.exports.codeToName[1678] = 'ER_SLAVE_CANT_CREATE_CONVERSION'; +module.exports.codeToName[1679] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_FORMAT'; +module.exports.codeToName[1680] = 'ER_PATH_LENGTH'; +module.exports.codeToName[1681] = 'ER_WARN_DEPRECATED_SYNTAX_NO_REPLACEMENT'; +module.exports.codeToName[1682] = 'ER_WRONG_NATIVE_TABLE_STRUCTURE'; +module.exports.codeToName[1683] = 'ER_WRONG_PERFSCHEMA_USAGE'; +module.exports.codeToName[1684] = 'ER_WARN_I_S_SKIPPED_TABLE'; +module.exports.codeToName[1685] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_BINLOG_DIRECT'; +module.exports.codeToName[1686] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_BINLOG_DIRECT'; +module.exports.codeToName[1687] = 'ER_SPATIAL_MUST_HAVE_GEOM_COL'; +module.exports.codeToName[1688] = 'ER_TOO_LONG_INDEX_COMMENT'; +module.exports.codeToName[1689] = 'ER_LOCK_ABORTED'; +module.exports.codeToName[1690] = 'ER_DATA_OUT_OF_RANGE'; +module.exports.codeToName[1691] = 'ER_WRONG_SPVAR_TYPE_IN_LIMIT'; +module.exports.codeToName[1692] = 'ER_BINLOG_UNSAFE_MULTIPLE_ENGINES_AND_SELF_LOGGING_ENGINE'; +module.exports.codeToName[1693] = 'ER_BINLOG_UNSAFE_MIXED_STATEMENT'; +module.exports.codeToName[1694] = 'ER_INSIDE_TRANSACTION_PREVENTS_SWITCH_SQL_LOG_BIN'; +module.exports.codeToName[1695] = 'ER_STORED_FUNCTION_PREVENTS_SWITCH_SQL_LOG_BIN'; +module.exports.codeToName[1696] = 'ER_FAILED_READ_FROM_PAR_FILE'; +module.exports.codeToName[1697] = 'ER_VALUES_IS_NOT_INT_TYPE_ERROR'; +module.exports.codeToName[1698] = 'ER_ACCESS_DENIED_NO_PASSWORD_ERROR'; +module.exports.codeToName[1699] = 'ER_SET_PASSWORD_AUTH_PLUGIN'; +module.exports.codeToName[1700] = 'ER_GRANT_PLUGIN_USER_EXISTS'; +module.exports.codeToName[1701] = 'ER_TRUNCATE_ILLEGAL_FK'; +module.exports.codeToName[1702] = 'ER_PLUGIN_IS_PERMANENT'; +module.exports.codeToName[1703] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MIN'; +module.exports.codeToName[1704] = 'ER_SLAVE_HEARTBEAT_VALUE_OUT_OF_RANGE_MAX'; +module.exports.codeToName[1705] = 'ER_STMT_CACHE_FULL'; +module.exports.codeToName[1706] = 'ER_MULTI_UPDATE_KEY_CONFLICT'; +module.exports.codeToName[1707] = 'ER_TABLE_NEEDS_REBUILD'; +module.exports.codeToName[1708] = 'WARN_OPTION_BELOW_LIMIT'; +module.exports.codeToName[1709] = 'ER_INDEX_COLUMN_TOO_LONG'; +module.exports.codeToName[1710] = 'ER_ERROR_IN_TRIGGER_BODY'; +module.exports.codeToName[1711] = 'ER_ERROR_IN_UNKNOWN_TRIGGER_BODY'; +module.exports.codeToName[1712] = 'ER_INDEX_CORRUPT'; +module.exports.codeToName[1713] = 'ER_UNDO_RECORD_TOO_BIG'; +module.exports.codeToName[1714] = 'ER_BINLOG_UNSAFE_INSERT_IGNORE_SELECT'; +module.exports.codeToName[1715] = 'ER_BINLOG_UNSAFE_INSERT_SELECT_UPDATE'; +module.exports.codeToName[1716] = 'ER_BINLOG_UNSAFE_REPLACE_SELECT'; +module.exports.codeToName[1717] = 'ER_BINLOG_UNSAFE_CREATE_IGNORE_SELECT'; +module.exports.codeToName[1718] = 'ER_BINLOG_UNSAFE_CREATE_REPLACE_SELECT'; +module.exports.codeToName[1719] = 'ER_BINLOG_UNSAFE_UPDATE_IGNORE'; +module.exports.codeToName[1720] = 'ER_PLUGIN_NO_UNINSTALL'; +module.exports.codeToName[1721] = 'ER_PLUGIN_NO_INSTALL'; +module.exports.codeToName[1722] = 'ER_BINLOG_UNSAFE_WRITE_AUTOINC_SELECT'; +module.exports.codeToName[1723] = 'ER_BINLOG_UNSAFE_CREATE_SELECT_AUTOINC'; diff --git a/node_modules/mysql2/lib/constants/field_flags.js b/node_modules/mysql2/lib/constants/field_flags.js new file mode 100644 index 0000000..3fe05c3 --- /dev/null +++ b/node_modules/mysql2/lib/constants/field_flags.js @@ -0,0 +1,18 @@ +// Manually extracted from mysql-5.5.23/include/mysql_com.h +exports.NOT_NULL = 1; /* Field can't be NULL */ +exports.PRI_KEY = 2; /* Field is part of a primary key */ +exports.UNIQUE_KEY = 4; /* Field is part of a unique key */ +exports.MULTIPLE_KEY = 8; /* Field is part of a key */ +exports.BLOB = 16; /* Field is a blob */ +exports.UNSIGNED = 32; /* Field is unsigned */ +exports.ZEROFILL = 64; /* Field is zerofill */ +exports.BINARY = 128; /* Field is binary */ + +/* The following are only sent to new clients */ +exports.ENUM = 256; /* field is an enum */ +exports.AUTO_INCREMENT = 512; /* field is a autoincrement field */ +exports.TIMESTAMP = 1024; /* Field is a timestamp */ +exports.SET = 2048; /* field is a set */ +exports.NO_DEFAULT_VALUE = 4096; /* Field doesn't have default value */ +exports.ON_UPDATE_NOW = 8192; /* Field is set to NOW on UPDATE */ +exports.NUM = 32768; /* Field is num (for clients) */ diff --git a/node_modules/mysql/lib/protocol/constants/server_status.js b/node_modules/mysql2/lib/constants/server_status.js similarity index 100% rename from node_modules/mysql/lib/protocol/constants/server_status.js rename to node_modules/mysql2/lib/constants/server_status.js diff --git a/node_modules/mysql/lib/protocol/constants/types.js b/node_modules/mysql2/lib/constants/types.js similarity index 100% rename from node_modules/mysql/lib/protocol/constants/types.js rename to node_modules/mysql2/lib/constants/types.js diff --git a/node_modules/mysql2/lib/helpers.js b/node_modules/mysql2/lib/helpers.js new file mode 100644 index 0000000..2554905 --- /dev/null +++ b/node_modules/mysql2/lib/helpers.js @@ -0,0 +1,21 @@ + /* + + this seems to be not only shorter, but faster than + string.replace(/\\/g, '\\\\'). + replace(/\u0008/g, '\\b'). + replace(/\t/g, '\\t'). + replace(/\n/g, '\\n'). + replace(/\f/g, '\\f'). + replace(/\r/g, '\\r'). + replace(/'/g, '\\\''). + replace(/"/g, '\\"'); + or string.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g, "\\$&") + see http://jsperf.com/string-escape-regexp-vs-json-stringify + */ + function srcEscape(str) { + var a = {}; + a[str] = 1; + return JSON.stringify(a).slice(1,-3); + } + +module.exports.srcEscape = srcEscape; diff --git a/node_modules/mysql2/lib/packet_parser.js b/node_modules/mysql2/lib/packet_parser.js new file mode 100644 index 0000000..0bd3283 --- /dev/null +++ b/node_modules/mysql2/lib/packet_parser.js @@ -0,0 +1,83 @@ +var Packet = require('./packets/packet'); + +// as this is very low level parser, EventEmitter is not used +// onPayload(sequenceId, payload) is called for each mysql packet +function PacketParser(onPacket) +{ + // array of last payload chunks + // only used when corrent payload is not complete + this.buffer = []; + // total length of chunks on buffer + this.bufferLength = 0; + this.headerLen = 0; + this.headerBuff = Buffer(4); + + this.state = 'head0'; + + // expected payload length + this.length = 0; + this.sequenceId = 0; + this.onPacket = onPacket; +} + +PacketParser.prototype.execute = function(chunk, start, end) { + + // node 0.11 has different ondata signature + if (!start && !end) { + start = 0; + end = chunk.length; + } + + while (start < chunk.length) { + if (this.state == 'head0' && (end - start) > 3) { + this.length = chunk[start] + (chunk[start+1] << 8) + (chunk[start+2] << 16); + this.sequenceId = chunk[start+3]; + var packetLength = this.length + 4; + if (end - start > packetLength) { // more than one packet in chunk + this.onPacket(new Packet(this.sequenceId, chunk, start + 4, start + packetLength)); + start += packetLength; + } else if (end - start == packetLength) { + return this.onPacket(new Packet(this.sequenceId, chunk, start + 4, start + packetLength)); + } else { // payload is incomplete + this.buffer = [chunk.slice(start + 4, end)]; + this.bufferLength = end - start - 4; + this.state = 'payload'; + return; + } + } else if (this.state == 'payload') { + var remainingPayload = this.length - this.bufferLength; + if (end - start >= remainingPayload) { // last chunk for payload + var payload = new Buffer(this.length); + var offset = 0; + for (var i=0; i < this.buffer.length; ++i) { + this.buffer[i].copy(payload, offset); + offset += this.buffer[i].length; + } + chunk.copy(payload, offset, start, start + remainingPayload); + this.onPacket(new Packet(this.sequenceId, payload, 0, this.length)); + this.buffer = []; + this.bufferLength = 0; + start += remainingPayload; + this.state = 'head0'; + } else { + this.buffer.push(chunk.slice(start, end)); + this.bufferLength += end - start; + return; + } + } else { // length < 4 or state != header0 + if (end - start + this.headerLen < 4) { + chunk.copy(this.headerBuff, this.headerLen, start, end); + this.headerLen += end - start; + this.state = 'head_'; + return; + } + chunk.copy(this.headerBuff, this.headerLen, start, start + 4 - this.headerLen); + start += 4 - this.headerLen; + this.length = this.headerBuff[0] + (this.headerBuff[1] << 8) + (this.headerBuff[2] << 16); + this.headerLen = 0; + this.state = 'payload'; + } + } +}; + +module.exports = PacketParser; diff --git a/node_modules/mysql2/lib/packets/binary_row.js b/node_modules/mysql2/lib/packets/binary_row.js new file mode 100644 index 0000000..695e7f2 --- /dev/null +++ b/node_modules/mysql2/lib/packets/binary_row.js @@ -0,0 +1,44 @@ +var Types = require('../constants/types'); +var Packet = require('../packets/packet'); + +function BinaryRow(columns) +{ + this.columns = columns || []; +} + + var binaryReader = new Array(256); + + // TODO: replace with constants.MYSQL_TYPE_* + binaryReader[Types.DECIMAL] = Packet.prototype.readLengthCodedString; + binaryReader[1] = Packet.prototype.readInt8; // tiny + binaryReader[2] = Packet.prototype.readInt16; // short + binaryReader[3] = Packet.prototype.readInt32; // long + binaryReader[4] = Packet.prototype.readFloat; // float + binaryReader[5] = Packet.prototype.readDouble; // double + binaryReader[6] = Packet.prototype.assertInvalid; // null, should be skipped vie null bitmap + binaryReader[7] = Packet.prototype.readTimestamp; // timestamp, http://dev.mysql.com/doc/internals/en/prepared-statements.html#packet-ProtocolBinary::MYSQL_TYPE_TIMESTAMP + binaryReader[8] = Packet.prototype.readInt64; // long long + binaryReader[9] = Packet.prototype.readInt32; // int24 + binaryReader[10] = Packet.prototype.readTimestamp; // date + binaryReader[11] = Packet.prototype.readTime; // time, http://dev.mysql.com/doc/internals/en/prepared-statements.html#packet-ProtocolBinary::MYSQL_TYPE_TIME + binaryReader[12] = Packet.prototype.readDateTime; // datetime, http://dev.mysql.com/doc/internals/en/prepared-statements.html#packet-ProtocolBinary::MYSQL_TYPE_DATETIME + binaryReader[13] = Packet.prototype.readInt16; // year + binaryReader[Types.VAR_STRING] = Packet.prototype.readLengthCodedString; // var string + // TODO: complete list of types... + +BinaryRow.fromPacket = function(fields, packet) { + var columns = new Array(fields.length); + var ok = packet.readInt8(); // TODO check it's 0 + var nullBitmapLength = Math.floor((fields.length + 7 + 2) / 8); + // TODO: read and interpret null bitmap + packet.skip(nullBitmapLength); + for (var i = 0; i < columns.length; ++i) + columns[i] = binaryReader[fields[i].columnType].apply(packet); + return new BinaryRow(columns); +}; + +BinaryRow.prototype.toPacket = function(sequenceId) { + throw "Not implemented"; +}; + +module.exports = BinaryRow; diff --git a/node_modules/mysql2/lib/packets/binlog_dump.js b/node_modules/mysql2/lib/packets/binlog_dump.js new file mode 100644 index 0000000..b56baac --- /dev/null +++ b/node_modules/mysql2/lib/packets/binlog_dump.js @@ -0,0 +1,33 @@ +// http://dev.mysql.com/doc/internals/en/com-binlog-dump.html#packet-COM_BINLOG_DUMP + +var Packet = require('../packets/packet'); +var CommandCodes = require('../constants/commands'); + +// TODO: add flag to constants +// 0x01 - BINLOG_DUMP_NON_BLOCK +// send EOF instead of blocking + +function BinlogDump(opts) +{ + this.binlogPos = opts.binlogPos || 0; + this.serverId = opts.serverId || 0; + this.flags = opts.flags || 0; + this.filename = opts.filename || ''; +} + +BinlogDump.prototype.toPacket = function() +{ + var length = 15 + // TODO: should be ascii? + Buffer.byteLength(this.filename, 'utf8'); + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(CommandCodes.BINLOG_DUMP); + packet.writeInt32(this.binlogPos); + packet.writeInt16(this.flags); + packet.writeInt32(this.serverId); + packet.writeString(this.filename); + return packet; +}; + +module.exports = BinlogDump; \ No newline at end of file diff --git a/node_modules/mysql2/lib/packets/binlog_query_statusvars.js b/node_modules/mysql2/lib/packets/binlog_query_statusvars.js new file mode 100644 index 0000000..d880288 --- /dev/null +++ b/node_modules/mysql2/lib/packets/binlog_query_statusvars.js @@ -0,0 +1,99 @@ +// http://dev.mysql.com/doc/internals/en/query-event.html + +var keys = { + FLAGS2: 0, + SQL_MODE: 1, + CATALOG: 2, + AUTO_INCREMENT: 3, + CHARSET: 4, + TIME_ZONE: 5, + CATALOG_NZ: 6, + LC_TIME_NAMES: 7, + CHARSET_DATABASE: 8, + TABLE_MAP_FOR_UPDATE: 9, + MASTER_DATA_WRITTEN: 10, + INVOKERS: 11, + UPDATED_DB_NAMES: 12, + MICROSECONDS: 3 +}; + +module.exports = function parseStatusVars(buffer) { + var result = {}; + var offset = 0; + var key, length, username, hostname, prevOffset; + while(offset < buffer.length) { + key = buffer[offset++]; + val = [key]; + switch(key) { + case keys.FLAGS2: + result.flags = buffer.readUInt32LE(offset); + offset += 4; break; + case keys.SQL_MODE: + // value is 8 bytes, but all dcumented flags are in first 4 bytes + result.sqlMode = buffer.readUInt32LE(offset); + offset += 8; + break; + case keys.CATALOG: + length = buffer[offset++]; + result.catalog = buffer.toString('utf8', offset, offset + length); + offset += length + 1; // null byte after string + break; + case keys.CHARSET: + result.clientCharset = buffer.readUInt16LE(offset); + result.connectionCollation = buffer.readUInt16LE(offset + 2); + result.serverCharset = buffer.readUInt16LE(offset + 4); + offset += 6; + break; + case keys.TIME_ZONE: + length = buffer[offset++]; + result.timeZone = buffer.toString('utf8', offset, offset + length); + offset += length; // no null byte + break; + case keys.CATALOG_NZ: + length = buffer[offset++]; + result.catalogNz = buffer.toString('utf8', offset, offset + length); + offset += length ; // no null byte + break; + case keys.LC_TIME_NAMES: + result.lcTimeNames = buffer.readUInt16LE(offset); + offset += 2; + break; + case keys.CHARSET_DATABASE: + result.schemaCharset = buffer.readUInt16LE(offset); + offset += 2; + break; + case keys.TABLE_MAP_FOR_UPDATE: + result.mapForUpdate1 = buffer.readUInt32LE(offset); + result.mapForUpdate2 = buffer.readUInt32LE(offset + 4); + offset += 8; + break; + case keys.MASTER_DATA_WRITTEN: + result.masterDataWritten = buffer.readUInt32LE(offset); + offset += 4; + break; + case keys.INVOKERS: + length = buffer[offset++]; + result.invokerUsername = buffer.toString('utf8', offset, offset + length); + offset += length; + length = buffer[offset++]; + result.invokerHostname = buffer.toString('utf8', offset, offset + length); + offset += length; + break; + case keys.UPDATED_DB_NAMES: + length = buffer[offset++]; + // length - number of null-terminated strings + result.updatedDBs = []; // we'll store them as array here + for (; length; --length) { + prevOffset = offset; + // fast forward to null terminating byte + while(buffer[offset++] && offset < buffer.length) {} + result.updatedDBs.push(buffer.toString('utf8', prevOffset, offset-1)); + } + break; + case keys.MICROSECONDS: + result.microseconds = buffer.readInt16LE(offset) + (buffsre[offset+2] << 16); + offset += 3; + } + } + return result; +} \ No newline at end of file diff --git a/node_modules/mysql2/lib/packets/column_definition.js b/node_modules/mysql2/lib/packets/column_definition.js new file mode 100644 index 0000000..c27932c --- /dev/null +++ b/node_modules/mysql2/lib/packets/column_definition.js @@ -0,0 +1,46 @@ +var Packet = require('../packets/packet'); + +function ColumnDefinition(packet) +{ + this.catalog = packet.readLengthCodedString(); + this.schema = packet.readLengthCodedString(); + this.table = packet.readLengthCodedString(); + this.orgTable = packet.readLengthCodedString(); + this.name = packet.readLengthCodedString(); + this.orgName = packet.readLengthCodedString(); + packet.skip(1); // length of the following fields (always 0x0c) + this.characterSet = packet.readInt16(); + this.columnLength = packet.readInt32(); + this.columnType = packet.readInt8(); + this.flags = packet.readInt16(); + this.decimals = packet.readInt8(); +} + +ColumnDefinition.toPacket = function(column, sequenceId) +{ + var length = 0; + var fields = 'catalog schema table orgTable name orgName'.split(' '); + function addFieldLength(name) { + var str = column[name]; + length +=Packet.lengthCodedNumberLength(str); + length += str.length; + } + fields.forEach(addFieldLength); + length += 13; + var buffer = new Buffer(length); + function writeField(name) { + packet.writeLengthCodedString(column[name]); + } + var packet = new Packet(sequenceId, buffer); + packet.offset = 4; + fields.forEach(writeField); + packet.writeInt8 (0x0c); + packet.writeInt16(column.characterSet); + packet.writeInt32(column.columnLength); + packet.writeInt8 (column.columnType); + packet.writeInt16(column.flags); + packet.writeInt8 (column.decimals); + return packet; +}; + +module.exports = ColumnDefinition; diff --git a/node_modules/mysql2/lib/packets/execute.js b/node_modules/mysql2/lib/packets/execute.js new file mode 100644 index 0000000..68a9c4e --- /dev/null +++ b/node_modules/mysql2/lib/packets/execute.js @@ -0,0 +1,103 @@ +var CursorType = require('../constants/cursor'); +var CommandCodes = require('../constants/commands'); +var Types = require('../constants/types'); +var Packet = require('../packets/packet'); + +function Execute(id, parameters) +{ + this.id = id; + this.parameters = parameters; +} + +Execute.prototype.toPacket = function() +{ + + // TODO: don't try to calculate packet length in advance, allocate some big buffer in advance (header + 256 bytes?) + // and copy + reallocate if not enough + + var i; + // 0 + 4 - length, seqId + // 4 + 1 - COM_EXECUTE + // 5 + 4 - stmtId + // 9 + 1 - flags + // 10 + 4 - iteration-count (always 1) + var length = 14; + if (this.parameters && this.parameters.length > 0) + { + length += Math.floor((this.parameters.length + 7) / 8); + length += 1; // new-params-bound-flag + length += 2*this.parameters.length; // type byte for each parameter if new-params-bound-flag is set + for (i=0; i < this.parameters.length; i++) + { + if (this.parameters[i] !== null) { + if (Object.prototype.toString.call(this.parameters[i]) == '[object Date]') { + var d = this.parameters[i]; + // TODO: move to asMysqlDateTime() + this.parameters[i] = [d.getFullYear(), d.getMonth() + 1, d.getDate()].join('-') + + ' ' + [d.getHours(), d.getMinutes(), d.getSeconds()].join(':'); + } + if (Buffer.isBuffer(this.parameters[i])) { + length += Packet.lengthCodedNumberLength(this.parameters[i].length); + length += this.parameters[i].length; + } + else { + var str = this.parameters[i].toString(); + var byteLen = Buffer.byteLength(str, 'utf8'); + length += Packet.lengthCodedNumberLength(byteLen); + length += byteLen; + } + } + } + } + + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(CommandCodes.STMT_EXECUTE); + packet.writeInt32(this.id); + packet.writeInt8(CursorType.NO_CURSOR); // flags + packet.writeInt32(1); // iteration-count, always 1 + if (this.parameters && this.parameters.length > 0) { + + var bitmap = 0; + var bitValue = 1; + for (i=0; i < this.parameters.length; i++) + { + if (this.parameters[i] === null) + bitmap += bitValue; + bitValue *= 2; + if (bitValue == 256) { + packet.writeInt8(bitmap); + bitmap = 0; + bitValue = 1; + } + } + if (bitValue != 1) + packet.writeInt8(bitmap); + + // TODO: explain meaning of the flag + // afaik, if set n*2 bytes with type of parameter are sent before parameters + // if not, previous execution types are used (TODO prooflink) + packet.writeInt8(1); // new-params-bound-flag + + // TODO: don't typecast always to sting, use parameters type + for (i=0; i < this.parameters.length; i++) + { + if (this.parameters[i] !== null) + packet.writeInt16(Types.VAR_STRING); + else + packet.writeInt16(Types.NULL); + } + for (i=0; i < this.parameters.length; i++) + { + if (this.parameters[i] !== null) + if (Buffer.isBuffer(this.parameters[i])) + packet.writeLengthCodedBuffer(this.parameters[i]); + else + packet.writeLengthCodedString(this.parameters[i].toString()); + } + } + return packet; +}; + +module.exports = Execute; diff --git a/node_modules/mysql2/lib/packets/handshake.js b/node_modules/mysql2/lib/packets/handshake.js new file mode 100644 index 0000000..0f8ee03 --- /dev/null +++ b/node_modules/mysql2/lib/packets/handshake.js @@ -0,0 +1,73 @@ +var Packet = require('../packets/packet'); + +function Handshake(args) { + this.protocolVersion = args.protocolVersion; + this.serverVersion = args.serverVersion; + this.capabilityFlags = args.capabilityFlags; + this.connectionId = args.connectionId; + this.authPluginData1 = args.authPluginData1; + this.authPluginData2 = args.authPluginData2; + this.characterSet = args.characterSet; + this.statusFlags = args.statusFlags; +} + +Handshake.fromPacket = function(packet) +{ + var args = {}; + args.protocolVersion = packet.readInt8(); + args.serverVersion = packet.readNullTerminatedString(); + args.connectionId = packet.readInt32(); + args.authPluginData1 = packet.readBuffer(8); + packet.skip(1); + args.capabilityFlags = packet.readInt16(); + if (packet.haveMoreData()) { + args.characterSet = packet.readInt8(); + args.statusFlags = packet.readInt16(); + // upper 2 bytes + args.capabilityFlags += packet.readInt16() << 16; + args.authPluginDataLength = packet.readInt8(); + packet.skip(10); + } + //var len = Math.max(12, args.authPluginDataLength - 8); + args.authPluginData2 = packet.readBuffer(12); + return new Handshake(args); +}; + +Handshake.prototype.setScrambleData = function(cb) { + var self = this; + require('crypto').randomBytes(20, function(err, data) { + if (err) return cb(err); + self.authPluginData1 = data.slice(0, 8); + self.authPluginData2 = data.slice(8,20); + cb(); + }); +}; + +Handshake.prototype.toPacket = function(sequenceId) { + var buffer, packet; + var length = 68 + Buffer.byteLength(this.serverVersion, 'utf8'); + buffer = new Buffer(length+4); + packet = new Packet(sequenceId, buffer); + packet.offset = 4; + packet.writeInt8(this.protocolVersion); + packet.writeString(this.serverVersion); + packet.writeInt8(0); + packet.writeInt32(this.connectionId); + packet.writeBuffer(this.authPluginData1); + packet.writeInt8(0); + packet.writeInt16(this.capabilityFlags & 0xffff); + packet.writeInt8(this.characterSet); + packet.writeInt16(this.statusFlags); + packet.writeInt16(this.capabilityFlags >> 16); + packet.writeInt8(21); // authPluginDataLength + var filler = new Buffer(10); + filler.fill(0); + packet.writeBuffer(filler); + packet.writeBuffer(this.authPluginData2); + packet.writeInt8(0); + packet.writeString('mysql_native_password'); + packet.writeInt8(0); + return packet; +}; + +module.exports = Handshake; diff --git a/node_modules/mysql2/lib/packets/handshake_response.js b/node_modules/mysql2/lib/packets/handshake_response.js new file mode 100644 index 0000000..ee7861b --- /dev/null +++ b/node_modules/mysql2/lib/packets/handshake_response.js @@ -0,0 +1,77 @@ +var ClientConstants = require('../constants/client'); +var Charsets = require('../constants/charsets'); +var crypto = require('crypto'); +var Packet = require('../packets/packet'); + +function sha1(msg, msg1, msg2) { + var hash = crypto.createHash('sha1'); + hash.update(msg); + if (msg1) + hash.update(msg1); + if (msg2) + hash.update(msg2); + return hash.digest('binary'); +} + +function xor(a, b) { + if (!Buffer.isBuffer(a)) + a = new Buffer(a, 'binary'); + if (!Buffer.isBuffer(b)) + b = new Buffer(b, 'binary'); + var result = new Buffer(a.length); + for (var i = 0; i < a.length; i++) { + result[i] = (a[i] ^ b[i]); + } + return result; +} + +function token(password, scramble1, scramble2) { + var scramble = Buffer(scramble1.toString('binary') + scramble2.toString('binary')); + if (!password) { + return new Buffer(0); + } + var stage1 = sha1(Buffer(password, "utf8").toString('binary')); + var stage2 = sha1(stage1); + var stage3 = sha1(scramble1, scramble2, stage2); + return xor(stage3, stage1); +} + +function HandshakeResponse(handshake) +{ + this.user = handshake.user || ''; + this.database = handshake.database || ''; + this.password = handshake.password || ''; + this.authPluginData1 = handshake.authPluginData1; + this.authPluginData2 = handshake.authPluginData2; + this.compress = handshake.compress; + this.clientFlags = handshake.flags; + this.authToken = token(this.password, this.authPluginData1, this.authPluginData2); + this.charsetNumber = handshake.charsetNumber; +} + +HandshakeResponse.prototype.toPacket = function() +{ + if (typeof this.user != 'string') + throw new Error('"user" connection config prperty must be a string'); + if (typeof this.database != 'string') + throw new Error('"database" connection config prperty must be a string'); + + var length = 36 + 23 + this.user.length + this.database.length; + + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + buffer.fill(0); + packet.offset = 4; + + packet.writeInt32(this.clientFlags); + packet.writeInt32(0); // max packet size. todo: move to config + packet.writeInt8(this.charsetNumber); + packet.skip(23); + packet.writeNullTerminatedString(this.user); + packet.writeInt8(this.authToken.length); + packet.writeBuffer(this.authToken); + packet.writeNullTerminatedString(this.database); + return packet; +}; + +module.exports = HandshakeResponse; diff --git a/node_modules/mysql2/lib/packets/index.js b/node_modules/mysql2/lib/packets/index.js new file mode 100644 index 0000000..0ccf978 --- /dev/null +++ b/node_modules/mysql2/lib/packets/index.js @@ -0,0 +1,68 @@ +"binlog_dump register_slave ssl_request handshake handshake_response query resultset_header column_definition text_row binary_row prepare_statement prepared_statement_header execute".split(' ').forEach(function(name) { + var ctor = require('./' + name); + module.exports[ctor.name] = ctor; + // monkey-patch it to include name if debug is on + if (process.env.NODE_DEBUG) { + if (ctor.prototype.toPacket) { + var old = ctor.prototype.toPacket; + ctor.prototype.toPacket = function() { + var p = old.call(this); + p._name = ctor.name; + return p; + } + } + } +}); + +// simple packets: +var Packet = require('./packet'); + +module.exports.OK = function OK() { +}; + +module.exports.OK.toPacket = function(args) { + var length = 5 + Packet.lengthCodedNumberLength(args.affectedRows); + if (args.insertId) + length += Packet.lengthCodedNumberLength(args.insertId); + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(0); + packet.writeLengthCodedNumber(args.affectedRows); + if (args.insertId) + packet.writeLengthCodedNumber(args.insertId); + packet._name = "OK"; + return packet; +}; + +// warnings, statusFlags +module.exports.EOF = function EOF() { +}; + +module.exports.EOF.toPacket = function(warnings, statusFlags) { + if (typeof warnings == 'undefined') + warnings = 0; + if (typeof statusFlags == 'undefined') + statusFlags = 0; + var packet = new Packet(0, new Buffer(9)); + packet.offset = 4; + packet.writeInt8(0xfe); + packet.writeInt16(warnings); + packet.writeInt16(statusFlags); + packet._name = "EOF"; + return packet; +}; + +module.exports.Error = function Error() { +}; + +module.exports.Error.toPacket = function(args) { + var packet = new Packet(0, new Buffer(13 + Buffer.byteLength(args.message, 'utf8'))); + packet.offset = 4; + packet.writeInt8(0xff); + packet.writeInt16(args.code); + packet.writeString('#_____'); + packet.writeString(args.message); + packet._name = "Error"; + return packet; +}; diff --git a/node_modules/mysql2/lib/packets/packet.js b/node_modules/mysql2/lib/packets/packet.js new file mode 100644 index 0000000..d53ea56 --- /dev/null +++ b/node_modules/mysql2/lib/packets/packet.js @@ -0,0 +1,606 @@ +//var BigNumber = require("bignumber.js"); +var ErrorCodeToName = require('../constants/errors').codeToName; + +var bn = require('bn.js'); + +function Packet(id, buffer, start, end) +{ + this.sequenceId = id; + this.buffer = buffer; + this.offset = start || 0; + this.start = start || 0; + this.end = end || this.buffer.length; +} + +// ============================== +// readers +// ============================== + +Packet.prototype.reset = function() { + this.offset = this.start; +}; + +Packet.prototype.length = function() { + return this.end - this.start; +}; + +Packet.prototype.slice = function() { + return this.buffer.slice(this.start, this.end); +}; + +Packet.prototype.dump = function() { + console.log([this.buffer.asciiSlice(this.start, this.end)], this.buffer.slice(this.start, this.end), this.length(), this.sequenceId); +}; + +Packet.prototype.haveMoreData = function() { + return this.end > this.offset; +}; + +Packet.prototype.skip = function(num) { + if (!num) + throw "Bad param in skip!"; // for some reason I keep doing skip(0) to indicate "skip one byte which should be 0" + this.offset += num; +}; + +Packet.prototype.readInt8 = function() +{ + return this.buffer[this.offset++]; +}; + +Packet.prototype.readInt16 = function() +{ + this.offset += 2; + return this.buffer.readUInt16LE(this.offset - 2, true); +}; + +Packet.prototype.readInt24 = function() { + return this.readInt16() + (this.readInt8() << 16); +}; + +Packet.prototype.readInt32 = function() +{ + this.offset += 4; + return this.buffer.readUInt32LE(this.offset - 4, true); +}; + +Packet.prototype.readSInt8 = function() +{ + return this.buffer.readInt8(this.offset++, true); +}; + +Packet.prototype.readSInt16 = function() +{ + this.offset += 2; + return this.buffer.readInt16LE(this.offset - 2, true); +}; + +Packet.prototype.readSInt32 = function() +{ + this.offset += 4; + return this.buffer.readInt32LE(this.offset - 4, true); +}; + +Packet.prototype.readInt64 = function() { + return this.readInt32() + 0x100000000*this.readInt32(); +}; + +Packet.prototype.readSInt64 = function() { + var word0 = this.readInt32(); + var word1 = this.readInt32(); + if (!(word1 & 0x80000000)) + return word0 + 0x100000000*word1; + return -((((~word1)>>>0) * 0x100000000) + ((~word0)>>>0) + 1); +}; + +Packet.prototype.isEOF = function() { + return this.buffer[this.offset] == 0xfe && this.length() < 9; +}; + +Packet.prototype.eofStatusFlags = function() { + return this.buffer.readInt16LE(this.offset + 3); +}; + +Packet.prototype.eofWarningCount = function() { + return this.buffer.readInt16LE(this.offset + 1); +}; + +Packet.prototype.readLengthCodedNumber = function(bigNumberStrings) { + var word0, word1; + var res; + var byte1 = this.readInt8(); + if (byte1 < 0xfb) + return byte1; + if (byte1 == 0xfc) { + return this.readInt8() + (this.readInt8() << 8); + } + if (byte1 == 0xfd) { + return this.readInt8() + (this.readInt8() << 8) + (this.readInt8() << 16); + } + if (byte1 == 0xfe) { + // TODO: check version + // Up to MySQL 3.22, 0xfe was followed by a 4-byte integer. + word0 = this.readInt32(); + word1 = this.readInt32(); + if (word1 === 0) + return word0; // don't convert to float if possible + if (word1 < 2097152) // max exact float point int, 2^52 / 2^32 + return word1*0x100000000 + word0; + + res = (new bn(word1)).ishln(32).iaddn(word0); + return bigNumberStrings ? res.toString() : res; + } + if (byte1 == 0xfb) + return null; + + console.trace(); + throw "Should not reach here: " + byte1; +}; + +Packet.prototype.readFloat = function() { + var res = this.buffer.readFloatLE(this.offset); + this.offset += 4; + return res; +}; + +Packet.prototype.readDouble = function() { + var res = this.buffer.readDoubleLE(this.offset); + this.offset += 8; + return res; +}; + +Packet.prototype.readBuffer = function(len) { + if (typeof len == 'undefined') + len = this.end - this.offset; + this.offset += len; + return this.buffer.slice(this.offset - len, this.offset); +}; + +var INVALID_DATE = new Date(NaN); +// DATE, DATETIME and TIMESTAMP +Packet.prototype.readDateTime = function() { + var length = this.readInt8(); + var y = 0; + var m = 0; + var d = 0; + var H = 0; + var M = 0; + var S = 0; + var ms = 0; + if (length > 3) { + y = this.readInt16(); + m = this.readInt8(); + d = this.readInt8(); + + } + if (length > 6) { + H = this.readInt8(); + M = this.readInt8(); + S = this.readInt8(); + } + if (length > 11) + ms = this.readInt32(); + if ((y + m + d + H + M + S + ms) === 0) { + return INVALID_DATE; + } + return new Date(y, m-1, d, H, M, S, ms); +}; + +// this is nearly duplicate of previous function so generated code is not slower +// due to "if (dateStrings)" branching +var pad = "000000000000"; +function leftPad(num, value) { + var s = value.toString(); + // if we don't need to pad + if (s.length >= num) + return s; + return (pad + s).slice(-num); +} + +Packet.prototype.readDateTimeString = function() { + var length = this.readInt8(); + var y = 0; + var m = 0; + var d = 0; + var H = 0; + var M = 0; + var S = 0; + var ms = 0; + var str; + if (length > 3) { + y = this.readInt16(); + m = this.readInt8(); + d = this.readInt8(); + str = [leftPad(4, y), leftPad(2, m), leftPad(2, d)].join('-'); + } + if (length > 6) { + H = this.readInt8(); + M = this.readInt8(); + S = this.readInt8(); + str += ' ' + [leftPad(2, H), leftPad(2, M), leftPad(2, S)].join(':'); + } + /* in text protocol you don't see microseconds as DATETIME/TIMESTAMP result. + instead you need to use MICROSECOND() function + if (length > 11) { + ms = this.readInt32(); + } + */ + return str; +}; + +// TIME - value as a string, Can be negative +Packet.prototype.readTimeString = function(convertTtoMs) { + var length = this.readInt8(); + if (length === 0) + return 0; + + var result = 0; + var sign = this.readInt8() ? -1 : 1; // 'isNegative' flag byte + var d = 0; + var H = 0; + var M = 0; + var S = 0; + var ms = 0; + if (length > 7) { + d = this.readInt32(); + H = this.readInt8(); + M = this.readInt8(); + S = this.readInt8(); + } + if (length > 11) + ms = this.readInt32(); + + if (convertTtoMs) { + H += d * 24; + M += H * 60; + S += M * 60; + ms += S * 1000; + ms *= sign; + return ms; + } + return ( sign === -1 ? '-' : '' ) + [( d ? (d*24) + H : H ), leftPad(2, M), leftPad(2, S)].join(':') + ( ms ? '.'+ ms : '' ); +}; + +Packet.prototype.readLengthCodedString = function() { + var len = this.readLengthCodedNumber(); + // TODO: check manually first byte here to avoid polymorphic return type? + if (len === null) + return null; + this.offset += len; + return this.buffer.utf8Slice(this.offset - len, this.offset); +}; + +Packet.prototype.readLengthCodedBuffer = function() { + var len = this.readLengthCodedNumber(); + return this.readBuffer(len); +}; + +Packet.prototype.readNullTerminatedString = function() { + var start = this.offset; + var end = this.offset; + while (this.buffer[end]) + end = end + 1; // TODO: handle OOB check + this.offset = end + 1; + return this.buffer.utf8Slice(start, end); +}; + +// TODO reuse? +Packet.prototype.readString = function(len) { + if (typeof len == 'undefined') + len = this.end - this.offset; + this.offset += len; + return this.buffer.utf8Slice(this.offset - len, this.offset); +}; + +var minus = '-'.charCodeAt(0); +var plus = '+'.charCodeAt(0); +// TODO: faster versions of parseInt for smaller types? +// discard overflow checks if we know from type definition it's safe so +Packet.prototype.parseInt = function(len) { + + if (len === null) + return null; + + var result = 0; + var end = this.offset + len; + var sign = 1; + if (len === 0) + return 0; // TODO: assert? exception? + if (this.buffer[this.offset] == minus) { + this.offset++; + sign = -1; + } + + // max precise int is 9007199254740992 + // note that we are here after handling optional +/- + // treat everything above 9000000000000000 as potential overflow + var str; + var numDigits = end - this.offset; + if (numDigits == 16 && (this.buffer[this.offset] - 48) > 8) { + str = this.readString(end - this.offset); + result = parseInt(str, 10); + if (result.toString() == str) + return sign*result; + else + return sign == -1 ? "-" + str : str; + } else if (numDigits > 16) { + str = this.readString(end - this.offset); + return sign == -1 ? "-" + str : str; + } + + if (this.buffer[this.offset] == plus) { + this.offset++; // just ignore + } + while(this.offset < end) { + result *= 10; + result += this.buffer[this.offset] - 48; + this.offset++; + } + return result*sign; +}; + +// copy-paste from https://github.com/felixge/node-mysql/blob/master/lib/protocol/Parser.js +Packet.prototype.parseGeometryValue = function() { + var buffer = this.readLengthCodedBuffer(); + var offset = 4; + + if (buffer === null || !buffer.length) { + return null; + } + + function parseGeometry() { + var x, y, i, j, numPoints, line; + var result = null; + var byteOrder = buffer.readUInt8(offset); offset += 1; + var wkbType = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; + switch(wkbType) { + case 1: // WKBPoint + x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + result = {x: x, y: y}; + break; + case 2: // WKBLineString + numPoints = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; + result = []; + for(i=numPoints;i>0;i--) { + x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + result.push({x: x, y: y}); + } + break; + case 3: // WKBPolygon + var numRings = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; + result = []; + for(i=numRings;i>0;i--) { + numPoints = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; + line = []; + for(j=numPoints;j>0;j--) { + x = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + y = byteOrder? buffer.readDoubleLE(offset) : buffer.readDoubleBE(offset); offset += 8; + line.push({x: x, y: y}); + } + result.push(line); + } + break; + case 4: // WKBMultiPoint + case 5: // WKBMultiLineString + case 6: // WKBMultiPolygon + case 7: // WKBGeometryCollection + var num = byteOrder? buffer.readUInt32LE(offset) : buffer.readUInt32BE(offset); offset += 4; + result = []; + for(i=num;i>0;i--) { + result.push(parseGeometry()); + } + break; + } + return result; + } + return parseGeometry(); +}; + +Packet.prototype.parseDate = function() { + var strLen = this.readLengthCodedNumber(); + if (strLen === null) + return null; + if (strLen != 10) { + // we expect only YYYY-MM-DD here. + // if for some reason it's not the case return invalid date + return new Date(NaN); + } + var y = this.parseInt(4); + this.offset++; // - + var m = this.parseInt(2); + this.offset++; // - + var d = this.parseInt(2); + return new Date(y, m-1, d); +}; + +Packet.prototype.parseDateTime = function() { + var str = this.readLengthCodedString(); + if (str === null) + return null; + return new Date(str); +}; + + +// TODO: handle E notation +var dot = '.'.charCodeAt(0); +var exponent = 'e'.charCodeAt(0); +var exponentCapital = 'E'.charCodeAt(0); +Packet.prototype.parseFloat = function(len) { + + if (len === null) + return null; + + var result = 0; + var end = this.offset + len; + var factor = 1; + var pastDot = false; + var charCode = 0; + if (len === 0) + return 0; // TODO: assert? exception? + + if (this.buffer[this.offset] == minus) { + this.offset++; + factor = -1; + } + if (this.buffer[this.offset] == plus) { + this.offset++; // just ignore + } + while(this.offset < end) { + charCode = this.buffer[this.offset]; + if (charCode == dot) + { + pastDot = true; + this.offset++; + } else if (charCode == exponent || charCode == exponentCapital) { + this.offset++; + var exponentValue = this.parseInt(end - this.offset); + return (result/factor)*Math.pow(10, exponentValue); + } else { + result *= 10; + result += this.buffer[this.offset] - 48; + this.offset++; + if (pastDot) + factor = factor*10; + } + } + return result/factor; +}; + +Packet.prototype.parseLengthCodedInt = function() { + return this.parseInt(this.readLengthCodedNumber()); +}; + +Packet.prototype.parseLengthCodedFloat = function() { + return this.parseFloat(this.readLengthCodedNumber()); +}; + +Packet.prototype.isError = function() { + return this.buffer[this.offset] == 0xff; +}; + +Packet.prototype.asError = function() { + this.reset(); + + var fieldCount = this.readInt8(); + var errorCode = this.readInt16(); + var sqlState = ''; + if (this.buffer[this.offset] == 0x23) + sqlState = this.readBuffer(6).toString(); + var message = this.readString(); + var err = new Error(message); + err.code = ErrorCodeToName[errorCode]; + err.sqlState = sqlState; + return err; +}; + + +Packet.lengthCodedNumberLength = function(n) { + if (n < 0xfb) + return 1; + if (n < 0xffff) + return 3; + if (n < 0xffffff) + return 5; + else + return 9; +}; + +Packet.prototype.writeInt32 = function(n) { + this.buffer.writeUInt32LE(n, this.offset); + this.offset += 4; +}; + +Packet.prototype.writeInt24 = function(n) { + this.writeInt8(n & 0xff); + this.writeInt16(n >> 8); +}; + +Packet.prototype.writeInt16 = function(n) { + this.buffer.writeUInt16LE(n, this.offset); + this.offset += 2; +}; + +Packet.prototype.writeInt8 = function(n) { + this.buffer.writeUInt8(n, this.offset); + this.offset++; +}; + +Packet.prototype.writeBuffer = function(b) { + b.copy(this.buffer, this.offset); + this.offset += b.length; +}; + +Packet.prototype.writeNull = function() { + this.buffer[this.offset] = 0xfb; + this.offset++; +}; + +// TODO: refactor following three? +Packet.prototype.writeNullTerminatedString = function(s) { + this.buffer.write(s, this.offset); + this.offset += s.length; + this.writeInt8(0); +}; + +Packet.prototype.writeString = function(s) { + var bytes = Buffer.byteLength(s, 'utf8'); + this.buffer.write(s, this.offset, bytes, 'utf8'); + this.offset += bytes; +}; + +Packet.prototype.writeLengthCodedString = function(s) { + var bytes = Buffer.byteLength(s, 'utf8'); + this.writeLengthCodedNumber(bytes); + this.buffer.write(s, this.offset, bytes, 'utf8'); + this.offset += bytes; +}; + +Packet.prototype.writeLengthCodedBuffer = function(b) { + this.writeLengthCodedNumber(b.length); + b.copy(this.buffer, this.offset); + this.offset += b.length; +}; + +Packet.prototype.writeLengthCodedNumber = function(n) { + // TODO: null - http://dev.mysql.com/doc/internals/en/overview.html#length-encoded-integer + if (n < 0xfb) + return this.writeInt8(n); + if (n < 0xffff) { + this.writeInt8(0xfc); + return this.writeInt16(n); + } + if (n < 0xffffff) { + this.writeInt8(0xfd); + return this.writeInt24(n); + } + console.log(n); + console.trace(); + throw "No bignumbers yet"; +}; + +Packet.prototype.writeHeader = function(sequenceId) +{ + var offset = this.offset; + this.offset = 0; + this.writeInt24(this.buffer.length - 4); + this.writeInt8(sequenceId); + this.offset = offset; +}; + +Packet.prototype.clone = function() { + var buffer = this.buffer.slice(this.start, this.end); + var other = new Packet(this.sequenceId, this.buffer); + return other; +}; + +Packet.prototype.type = function() { + if (this.isEOF()) + return 'EOF'; + if (this.isError()) + return 'Error'; + if (this.buffer[this.offset] == 0) + return 'maybeOK'; // could be other packet types as well + return ''; +}; +module.exports = Packet; diff --git a/node_modules/mysql2/lib/packets/prepare_statement.js b/node_modules/mysql2/lib/packets/prepare_statement.js new file mode 100644 index 0000000..c07aa79 --- /dev/null +++ b/node_modules/mysql2/lib/packets/prepare_statement.js @@ -0,0 +1,20 @@ +var Packet = require('../packets/packet'); +var CommandCodes = require('../constants/commands'); + +function PrepareStatement(sql) +{ + this.query = sql; +} + +PrepareStatement.prototype.toPacket = function() +{ + var length = 5 + Buffer.byteLength(this.query, 'utf8'); + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(CommandCodes.STMT_PREPARE); + packet.writeString(this.query); + return packet; +}; + +module.exports = PrepareStatement; diff --git a/node_modules/mysql2/lib/packets/prepared_statement_header.js b/node_modules/mysql2/lib/packets/prepared_statement_header.js new file mode 100644 index 0000000..de8f047 --- /dev/null +++ b/node_modules/mysql2/lib/packets/prepared_statement_header.js @@ -0,0 +1,15 @@ +var Packet = require('../packets/packet'); + +function PreparedStatementHeader(packet) +{ + packet.skip(1); // should be 0 + this.id = packet.readInt32(); + this.fieldCount = packet.readInt16(); + this.parameterCount = packet.readInt16(); + packet.skip(1); // should be 0 + this.warningCount = packet.readInt16(); +} + +// TODO: toPacket + +module.exports = PreparedStatementHeader; diff --git a/node_modules/mysql2/lib/packets/query.js b/node_modules/mysql2/lib/packets/query.js new file mode 100644 index 0000000..a42a881 --- /dev/null +++ b/node_modules/mysql2/lib/packets/query.js @@ -0,0 +1,20 @@ +var Packet = require('../packets/packet'); +var CommandCode = require('../constants/commands'); + +function Query(sql) +{ + this.query = sql; +} + +Query.prototype.toPacket = function() +{ + var length = 5 + Buffer.byteLength(this.query, 'utf8'); + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(CommandCode.QUERY); + packet.writeString(this.query); + return packet; +}; + +module.exports = Query; diff --git a/node_modules/mysql2/lib/packets/register_slave.js b/node_modules/mysql2/lib/packets/register_slave.js new file mode 100644 index 0000000..808c8a2 --- /dev/null +++ b/node_modules/mysql2/lib/packets/register_slave.js @@ -0,0 +1,41 @@ +// http://dev.mysql.com/doc/internals/en/com-register-slave.html +// note that documentation is incorrect, for example command code is actually 0x15 but documented as 0x14 + +var Packet = require('../packets/packet'); +var CommandCodes = require('../constants/commands'); + +function RegisterSlave(opts) +{ + this.serverId = opts.serverId || 0; + this.slaveHostname = opts.slaveHostname || ''; + this.slaveUser = opts.slaveUser || ''; + this.slavePassword = opts.slavePassword || ''; + this.slavePort = opts.slavePort || 0; + this.replicationRank = opts.replicationRank || 0; + this.masterId = opts.masterId || 0; +} + +RegisterSlave.prototype.toPacket = function() +{ + var length = 15 + // TODO: should be ascii? + Buffer.byteLength(this.slaveHostname, 'utf8') + + Buffer.byteLength(this.slaveUser, 'utf8') + + Buffer.byteLength(this.slavePassword, 'utf8') + 3 + 4; + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeInt8(CommandCodes.REGISTER_SLAVE); + packet.writeInt32(this.serverId); + packet.writeInt8(Buffer.byteLength(this.slaveHostname, 'utf8')); + packet.writeString(this.slaveHostname); + packet.writeInt8(Buffer.byteLength(this.slaveUser, 'utf8')); + packet.writeString(this.slaveUser); + packet.writeInt8(Buffer.byteLength(this.slavePassword, 'utf8')); + packet.writeString(this.slavePassword); + packet.writeInt16(this.slavePort); + packet.writeInt32(this.replicationRank); + packet.writeInt32(this.masterId); + return packet; +}; + +module.exports = RegisterSlave; diff --git a/node_modules/mysql2/lib/packets/resultset_header.js b/node_modules/mysql2/lib/packets/resultset_header.js new file mode 100644 index 0000000..c3b2c75 --- /dev/null +++ b/node_modules/mysql2/lib/packets/resultset_header.js @@ -0,0 +1,40 @@ +// TODO: rename to OK packet + +var Packet = require('../packets/packet'); + +function ResultSetHeader(packet, bigNumberStrings) +{ + if (packet.buffer[packet.offset] !== 0) { + this.fieldCount = packet.readLengthCodedNumber(); + } else { + this.fieldCount = packet.readInt8(); // skip OK byte + this.affectedRows = packet.readLengthCodedNumber(bigNumberStrings); + this.insertId = packet.readLengthCodedNumber(bigNumberStrings); + this.serverStatus = packet.readInt16(); + this.warningStatus = packet.readInt16(); + } + + // snippet from mysql-native: + // res.affected_rows = this.lcnum(); + // res.insert_id = this.lcnum(); + // res.server_status = this.num(2); + // res.warning_count = this.num(2); + + // TODO: extra +} + +// TODO: should be consistent instance member, but it's just easier here to have just function +ResultSetHeader.toPacket = function(fieldCount, insertId, sequenceId) { + var length = 4 + Packet.lengthCodedNumberLength(fieldCount); + if (typeof(insertId) != 'undefined') + length += Packet.lengthCodedNumberLength(insertId); + var buffer = new Buffer(length); + var packet = new Packet(0, buffer); + packet.offset = 4; + packet.writeLengthCodedNumber(fieldCount); + if (typeof(insertId) != 'undefined') + packet.writeLengthCodedNumber(insertId); + return packet; +}; + +module.exports = ResultSetHeader; diff --git a/node_modules/mysql2/lib/packets/ssl_request.js b/node_modules/mysql2/lib/packets/ssl_request.js new file mode 100644 index 0000000..761a0d3 --- /dev/null +++ b/node_modules/mysql2/lib/packets/ssl_request.js @@ -0,0 +1,24 @@ +var ClientConstants = require('../constants/client'); +var Packet = require('../packets/packet'); +var Charsets = require('../constants/charsets'); + +function SSLRequest(flags) +{ + this.clientFlags = flags | ClientConstants.SSL; +} + +SSLRequest.prototype.toPacket = function() +{ + var length = 36; + var buffer = new Buffer(36); + var packet = new Packet(0, buffer); + buffer.fill(0); + packet.offset = 4; + + packet.writeInt32(this.clientFlags); + packet.writeInt32(0); // max packet size. todo: move to config + packet.writeInt8(Charsets.UTF8_GENERAL_CI); + return packet; +}; + +module.exports = SSLRequest; diff --git a/node_modules/mysql2/lib/packets/text_row.js b/node_modules/mysql2/lib/packets/text_row.js new file mode 100644 index 0000000..44e2931 --- /dev/null +++ b/node_modules/mysql2/lib/packets/text_row.js @@ -0,0 +1,38 @@ +var Packet = require('../packets/packet'); + +function TextRow(columns) +{ + this.columns = columns || []; +} + +TextRow.fromPacket = function(packet) { + //packet.reset(); // set offset to starting point? + var columns = []; + while(packet.haveMoreData()) { + columns.push(packet.readLengthCodedString()); + } + return new TextRow(columns); +}; + +TextRow.toPacket = function(column) { + var sequenceId = 0; // TODO remove, this is calculated now in connecton + var buffer, packet; + var length = 0; + column.forEach(function(val) { + if (val === null || typeof(val) == 'undefined') return ++length; + var str = val.toString(10); + length += Packet.lengthCodedNumberLength(str); + length += str.length; + }); + buffer = new Buffer(length+4); + packet = new Packet(sequenceId, buffer); + packet.offset = 4; + column.forEach(function(val) { + if (val === null) return packet.writeNull(); + if (typeof val == 'undefined') return packet.writeInt8(0); + packet.writeLengthCodedString(val.toString(10)); + }); + return packet; +}; + +module.exports = TextRow; diff --git a/node_modules/mysql2/lib/pool.js b/node_modules/mysql2/lib/pool.js new file mode 100644 index 0000000..c99097c --- /dev/null +++ b/node_modules/mysql2/lib/pool.js @@ -0,0 +1,177 @@ +var mysql = require('../index.js'); +var Connection = mysql.Connection; + +var EventEmitter = require('events').EventEmitter; +var Util = require('util'); +var PoolConnection = require('./pool_connection.js'); + +module.exports = Pool; + +Util.inherits(Pool, EventEmitter); +function Pool(options) { + EventEmitter.call(this); + this.config = options.config; + this.config.connectionConfig.pool = this; + + this._allConnections = []; + this._freeConnections = []; + this._connectionQueue = []; + this._closed = false; +} + +Pool.prototype.getConnection = function (cb) { + if (this._closed) { + return process.nextTick(function(){ + return cb(new Error('Pool is closed.')); + }); + } + + var connection; + + if (this._freeConnections.length > 0) { + connection = this._freeConnections.shift(); + + return process.nextTick(function(){ + return cb(null, connection); + }); + } + + if (this.config.connectionLimit === 0 || this._allConnections.length < this.config.connectionLimit) { + connection = new PoolConnection(this, { config: this.config.connectionConfig }); + + this._allConnections.push(connection); + + return connection.connect(function(err) { + if (this._closed) { + return cb(new Error('Pool is closed.')); + } + if (err) { + return cb(err); + } + + this.emit('connection', connection); + return cb(null, connection); + }.bind(this)); + } + + if (!this.config.waitForConnections) { + return process.nextTick(function(){ + return cb(new Error('No connections available.')); + }); + } + + if (this.config.queueLimit && this._connectionQueue.length >= this.config.queueLimit) { + return cb(new Error('Queue limit reached.')); + } + + this._connectionQueue.push(cb); +}; + +Pool.prototype.releaseConnection = function (connection) { + var cb; + + if (!connection._pool) { + // The connection has been removed from the pool and is no longer good. + if (this._connectionQueue.length) { + cb = this._connectionQueue.shift(); + + process.nextTick(this.getConnection.bind(this, cb)); + } + } else if (this._connectionQueue.length) { + cb = this._connectionQueue.shift(); + + process.nextTick(cb.bind(null, null, connection)); + } else { + this._freeConnections.push(connection); + } +}; + +Pool.prototype.end = function (cb) { + this._closed = true; + + if (typeof cb != "function") { + cb = function (err) { + if (err) throw err; + }; + } + + var calledBack = false; + var closedConnections = 0; + var connection; + + var endCB = function(err) { + if (calledBack) { + return; + } + + if (err || ++closedConnections >= this._allConnections.length) { + calledBack = true; + return cb(err); + } + }.bind(this); + + if (this._allConnections.length === 0) { + return endCB(); + } + + for (var i = 0; i < this._allConnections.length; i++) { + connection = this._allConnections[i]; + connection._realEnd(endCB); + } +}; + +Pool.prototype.query = function (sql, values, cb) { + if (typeof values === 'function') { + cb = values; + values = null; + } + + this.getConnection(function (err, conn) { + if (err) return cb(err); + + conn.query(sql, values, function () { + conn.release(); + cb.apply(this, arguments); + }); + }); +}; + +Pool.prototype.execute = function (sql, values, cb) { + if (typeof values === 'function') { + cb = values; + values = null; + } + + this.getConnection(function (err, conn) { + if (err) return cb(err); + + conn.execute(sql, values, function () { + conn.release(); + cb.apply(this, arguments); + }); + }); +}; + +Pool.prototype._removeConnection = function(connection) { + var i; + + for (i = 0; i < this._allConnections.length; i++) { + if (this._allConnections[i] === connection) { + this._allConnections.splice(i, 1); + break; + } + } + + for (i = 0; i < this._freeConnections.length; i++) { + if (this._freeConnections[i] === connection) { + this._freeConnections.splice(i, 1); + break; + } + } + + this.releaseConnection(connection); +}; + +Pool.prototype.escape = function(value) { + return mysql.escape(value, this.config.connectionConfig.stringifyObjects, this.config.connectionConfig.timezone); +}; diff --git a/node_modules/mysql/lib/PoolCluster.js b/node_modules/mysql2/lib/pool_cluster.js similarity index 80% rename from node_modules/mysql/lib/PoolCluster.js rename to node_modules/mysql2/lib/pool_cluster.js index e2af239..169bb7c 100644 --- a/node_modules/mysql/lib/PoolCluster.js +++ b/node_modules/mysql2/lib/pool_cluster.js @@ -1,256 +1,242 @@ -var Pool = require('./Pool'); -var PoolConfig = require('./PoolConfig'); -var Util = require('util'); -var EventEmitter = require('events').EventEmitter; - -module.exports = PoolCluster; - -/** - * PoolCluster - */ -function PoolCluster(config) { - EventEmitter.call(this); - - config = config || {}; - this._canRetry = typeof config.canRetry === 'undefined' ? true : config.canRetry; - this._removeNodeErrorCount = config.removeNodeErrorCount || 5; - this._defaultSelector = config.defaultSelector || 'RR'; - - this._closed = false; - this._lastId = 0; - this._nodes = {}; - this._serviceableNodeIds = []; - this._namespaces = {}; - this._findCaches = {}; -} - -Util.inherits(PoolCluster, EventEmitter); - -PoolCluster.prototype.of = function(pattern, selector) { - pattern = pattern || '*'; - - selector = selector || this._defaultSelector; - selector = selector.toUpperCase(); - if (typeof Selector[selector] === 'undefined') { - selector = this._defaultSelector; - } - - var key = pattern + selector; - - if (typeof this._namespaces[key] === 'undefined') { - this._namespaces[key] = new PoolNamespace(this, pattern, selector); - } - - return this._namespaces[key]; -}; - -PoolCluster.prototype.add = function(id, config) { - if (typeof id === 'object') { - config = id; - id = 'CLUSTER::' + (++this._lastId); - } - - if (typeof this._nodes[id] === 'undefined') { - this._nodes[id] = { - id: id, - errorCount: 0, - pool: new Pool({config: new PoolConfig(config)}) - }; - - this._serviceableNodeIds.push(id); - - this._clearFindCaches(); - } -}; - -PoolCluster.prototype.getConnection = function(pattern, selector, cb) { - var namespace; - if (typeof pattern === 'function') { - cb = pattern; - namespace = this.of(); - } else { - if (typeof selector === 'function') { - cb = selector; - selector = this._defaultSelector; - } - - namespace = this.of(pattern, selector); - } - - namespace.getConnection(cb); -}; - -PoolCluster.prototype.end = function() { - if (this._closed) { - return; - } - - this._closed = true; - - for (var id in this._nodes) { - this._nodes[id].pool.end(); - } -}; - -PoolCluster.prototype._findNodeIds = function(pattern) { - if (typeof this._findCaches[pattern] !== 'undefined') { - return this._findCaches[pattern]; - } - - var foundNodeIds; - - if (pattern === '*') { // all - foundNodeIds = this._serviceableNodeIds; - } else if (this._serviceableNodeIds.indexOf(pattern) != -1) { // one - foundNodeIds = [pattern]; - } else if (pattern[pattern.length - 1] === '*') { - // wild matching - var keyword = pattern.substring(pattern.length - 1, 0); - - foundNodeIds = this._serviceableNodeIds.filter(function (id) { - return id.indexOf(keyword) === 0; - }); - } else { - foundNodeIds = []; - } - - this._findCaches[pattern] = foundNodeIds; - - return foundNodeIds; -}; - -PoolCluster.prototype._getNode = function(id) { - return this._nodes[id] || null; -}; - -PoolCluster.prototype._increaseErrorCount = function(node) { - if (++node.errorCount >= this._removeNodeErrorCount) { - var index = this._serviceableNodeIds.indexOf(node.id); - if (index !== -1) { - this._serviceableNodeIds.splice(index, 1); - delete this._nodes[node.id]; - - this._clearFindCaches(); - - node.pool.end(); - - this.emit('remove', node.id); - } - } -}; - -PoolCluster.prototype._decreaseErrorCount = function(node) { - if (node.errorCount > 0) { - --node.errorCount; - } -}; - -PoolCluster.prototype._getConnection = function(node, cb) { - var self = this; - - node.pool.getConnection(function (err, connection) { - if (err) { - self._increaseErrorCount(node); - cb(err); - return; - } else { - self._decreaseErrorCount(node); - } - - connection._clusterId = node.id; - - cb(null, connection); - }); -}; - -PoolCluster.prototype._clearFindCaches = function() { - this._findCaches = {}; -}; - -/** - * PoolNamespace - */ -function PoolNamespace(cluster, pattern, selector) { - this._cluster = cluster; - this._pattern = pattern; - this._selector = new Selector[selector](); -} - -PoolNamespace.prototype.getConnection = function(cb) { - var clusterNode = this._getClusterNode(); - var cluster = this._cluster; - var namespace = this; - - if (clusterNode === null) { - var err = new Error('Pool does not exist.') - err.code = 'POOL_NOEXIST'; - return cb(err); - } - - cluster._getConnection(clusterNode, function(err, connection) { - var retry = err && cluster._canRetry - && cluster._findNodeIds(namespace._pattern).length !== 0; - - if (retry) { - return namespace.getConnection(cb); - } - - if (err) { - return cb(err); - } - - cb(null, connection); - }); -}; - -PoolNamespace.prototype._getClusterNode = function _getClusterNode() { - var foundNodeIds = this._cluster._findNodeIds(this._pattern); - var nodeId; - - switch (foundNodeIds.length) { - case 0: - nodeId = null; - break; - case 1: - nodeId = foundNodeIds[0]; - break; - default: - nodeId = this._selector(foundNodeIds); - break; - } - - return nodeId !== null - ? this._cluster._getNode(nodeId) - : null; -}; - -/** - * Selector - */ -var Selector = {}; - -Selector.RR = function () { - var index = 0; - - return function(clusterIds) { - if (index >= clusterIds.length) { - index = 0; - } - - var clusterId = clusterIds[index++]; - - return clusterId; - }; -}; - -Selector.RANDOM = function () { - return function(clusterIds) { - return clusterIds[Math.floor(Math.random() * clusterIds.length)]; - }; -}; - -Selector.ORDER = function () { - return function(clusterIds) { - return clusterIds[0]; - }; -}; +var Pool = require('./pool.js'); +var PoolConfig = require('./pool_config.js'); +var Util = require('util'); +var EventEmitter = require('events').EventEmitter; + +module.exports = PoolCluster; + +/** + * PoolCluster + */ +function PoolCluster(config) { + EventEmitter.call(this); + + config = config || {}; + this._canRetry = typeof config.canRetry === 'undefined' ? true : config.canRetry; + this._removeNodeErrorCount = config.removeNodeErrorCount || 5; + this._defaultSelector = config.defaultSelector || 'RR'; + + this._closed = false; + this._lastId = 0; + this._nodes = {}; + this._serviceableNodeIds = []; + this._namespaces = {}; + this._findCaches = {}; +} + +Util.inherits(PoolCluster, EventEmitter); + +PoolCluster.prototype.of = function(pattern, selector) { + pattern = pattern || '*'; + + selector = selector || this._defaultSelector; + selector = selector.toUpperCase(); + if (typeof Selector[selector] === 'undefined') { + selector = this._defaultSelector; + } + + var key = pattern + selector; + + if (typeof this._namespaces[key] === 'undefined') { + this._namespaces[key] = new PoolNamespace(this, pattern, selector); + } + + return this._namespaces[key]; +}; + +PoolCluster.prototype.add = function(id, config) { + if (typeof id === 'object') { + config = id; + id = 'CLUSTER::' + (++this._lastId); + } + + if (typeof this._nodes[id] === 'undefined') { + this._nodes[id] = { + id: id, + errorCount: 0, + pool: new Pool({config: new PoolConfig(config)}) + }; + + this._serviceableNodeIds.push(id); + + this._clearFindCaches(); + } +}; + +PoolCluster.prototype.getConnection = function(pattern, selector, cb) { + var namespace; + if (typeof pattern === 'function') { + cb = pattern; + namespace = this.of(); + } else { + if (typeof selector === 'function') { + cb = selector; + selector = this._defaultSelector; + } + + namespace = this.of(pattern, selector); + } + + namespace.getConnection(cb); +}; + +PoolCluster.prototype.end = function() { + if (this._closed) { + return; + } + + this._closed = true; + + for (var id in this._nodes) { + this._nodes[id].pool.end(); + } +}; + +PoolCluster.prototype._findNodeIds = function(pattern) { + if (typeof this._findCaches[pattern] !== 'undefined') { + return this._findCaches[pattern]; + } + + var foundNodeIds; + + if (pattern === '*') { // all + foundNodeIds = this._serviceableNodeIds; + } else if (this._serviceableNodeIds.indexOf(pattern) != -1) { // one + foundNodeIds = [pattern]; + } else { // wild matching + var keyword = pattern.substring(pattern.length - 1, 0); + + foundNodeIds = this._serviceableNodeIds.filter(function (id) { + return id.indexOf(keyword) === 0; + }); + } + + this._findCaches[pattern] = foundNodeIds; + + return foundNodeIds; +}; + +PoolCluster.prototype._getNode = function(id) { + return this._nodes[id] || null; +}; + +PoolCluster.prototype._increaseErrorCount = function(node) { + if (++node.errorCount >= this._removeNodeErrorCount) { + var index = this._serviceableNodeIds.indexOf(node.id); + if (index !== -1) { + this._serviceableNodeIds.splice(index, 1); + delete this._nodes[node.id]; + + this._clearFindCaches(); + + node.pool.end(); + + this.emit('remove', node.id); + } + } +}; + +PoolCluster.prototype._decreaseErrorCount = function(node) { + if (node.errorCount > 0) { + --node.errorCount; + } +}; + +PoolCluster.prototype._getConnection = function(node, cb) { + var self = this; + + node.pool.getConnection(function (err, connection) { + if (err) { + self._increaseErrorCount(node); + + if (self._canRetry) { + console.warn('[Error] PoolCluster : ' + err); + return cb(null, 'retry'); + } else { + return cb(err); + } + } else { + self._decreaseErrorCount(node); + } + + connection._clusterId = node.id; + + cb(null, connection); + }); +}; + +PoolCluster.prototype._clearFindCaches = function() { + this._findCaches = {}; +}; + +/** + * PoolNamespace + */ +function PoolNamespace(cluster, pattern, selector) { + this._cluster = cluster; + this._pattern = pattern; + this._selector = new Selector[selector](); +} + +PoolNamespace.prototype.getConnection = function(cb) { + var clusterNode = this._getClusterNode(); + + if (clusterNode === null) { + return cb(new Error('Pool does Not exists.')); + } + + this._cluster._getConnection(clusterNode, function(err, connection) { + if (err) { + return cb(err); + } + + if (connection === 'retry') { + return this.getConnection(cb); + } + + cb(null, connection); + }.bind(this)); +}; + +PoolNamespace.prototype._getClusterNode = function() { + var foundNodeIds = this._cluster._findNodeIds(this._pattern); + + if (foundNodeIds.length === 0) { + return null; + } + + var nodeId = (foundNodeIds.length === 1) ? foundNodeIds[0] : this._selector(foundNodeIds); + + return this._cluster._getNode(nodeId); +}; + +/** + * Selector + */ +var Selector = {}; + +Selector.RR = function () { + var index = 0; + + return function(clusterIds) { + if (index >= clusterIds.length) { + index = 0; + } + + var clusterId = clusterIds[index++]; + + return clusterId; + }; +}; + +Selector.RANDOM = function () { + return function(clusterIds) { + return clusterIds[Math.floor(Math.random() * clusterIds.length)]; + }; +}; + +Selector.ORDER = function () { + return function(clusterIds) { + return clusterIds[0]; + }; +}; diff --git a/node_modules/mysql2/lib/pool_config.js b/node_modules/mysql2/lib/pool_config.js new file mode 100644 index 0000000..c75601e --- /dev/null +++ b/node_modules/mysql2/lib/pool_config.js @@ -0,0 +1,15 @@ +var ConnectionConfig = require('./connection_config.js'); + +module.exports = PoolConfig; +function PoolConfig(options) { + this.connectionConfig = new ConnectionConfig(options); + this.waitForConnections = (options.waitForConnections === undefined) + ? true + : Boolean(options.waitForConnections); + this.connectionLimit = (options.connectionLimit === undefined) + ? 10 + : Number(options.connectionLimit); + this.queueLimit = (options.queueLimit === undefined) + ? 0 + : Number(options.queueLimit); +} diff --git a/node_modules/mysql/lib/PoolConnection.js b/node_modules/mysql2/lib/pool_connection.js similarity index 74% rename from node_modules/mysql/lib/PoolConnection.js rename to node_modules/mysql2/lib/pool_connection.js index a99fdb0..ccd2a4e 100644 --- a/node_modules/mysql/lib/PoolConnection.js +++ b/node_modules/mysql2/lib/pool_connection.js @@ -1,14 +1,14 @@ +var mysql = require('../index.js'); +var Connection = mysql.Connection; + var inherits = require('util').inherits; -var Connection = require('./Connection') -var __changeUser = Connection.prototype.changeUser; module.exports = PoolConnection; inherits(PoolConnection, Connection); function PoolConnection(pool, options) { Connection.call(this, options); - this._pool = pool; - this._purge = false + this._pool = pool; // When a fatal error occurs the connection's protocol ends, which will cause // the connection to end as well, thus we only need to watch for the end event @@ -17,20 +17,12 @@ function PoolConnection(pool, options) { this.on('error', this._removeFromPool); } -PoolConnection.prototype.changeUser = function changeUser(options, callback) { - this._purge = true; - - return __changeUser.apply(this, arguments); -}; - -PoolConnection.prototype.release = function release() { - var pool = this._pool; - - if (!pool || pool._closed) { +PoolConnection.prototype.release = function () { + if (!this._pool || this._pool._closed) { return; } - return pool.releaseConnection(this); + return this._pool.releaseConnection(this); }; // TODO: Remove this when we are removing PoolConnection#end diff --git a/node_modules/mysql2/lib/results_stream.js b/node_modules/mysql2/lib/results_stream.js new file mode 100644 index 0000000..5405243 --- /dev/null +++ b/node_modules/mysql2/lib/results_stream.js @@ -0,0 +1,36 @@ +var Readable = require('stream').Readable; + +// copy-paste from https://github.com/felixge/node-mysql/blob/master/lib/protocol/sequences/Query.js +module.exports = function (command, connectionStream) { + command.stream = function(options) { + var self = this, + stream; + + options = options || {}; + options.objectMode = true; + stream = new Readable(options), + + stream._read = function() { + connectionStream.resume(); + }; + + this.on("result",function(row,i) { + if (!stream.push(row)) connectionStream.pause(); + stream.emit("result",row,i); // replicate old emitter + }); + + this.on("error",function(err) { + stream.emit('error',err); // Pass on any errors + }); + + this.on("end", function() { + stream.push(null); // pushing null, indicating EOF + }); + + this.on("fields",function(fields,i) { + stream.emit('fields",fields',i); // replicate old emitter + }); + + return stream; + }; +}; diff --git a/node_modules/mysql2/lib/server.js b/node_modules/mysql2/lib/server.js new file mode 100644 index 0000000..c632920 --- /dev/null +++ b/node_modules/mysql2/lib/server.js @@ -0,0 +1,31 @@ +var net = require('net'); +var util = require('util'); +var EventEmitter = require('events').EventEmitter; + +var PacketParser = require('./packet_parser'); +var Packet = require('./packets/packet'); +var Commands = require('./commands/index.js'); +var Connection = require('./connection'); +var ConnectionConfig = require('./connection_config'); + +// TODO: inherit Server from net.Server +function Server() +{ + EventEmitter.call(this); + this.connections = []; + this._server = net.createServer(this._handleConnection.bind(this)); +} +util.inherits(Server, EventEmitter); + +Server.prototype._handleConnection = function(socket) { + var connectionConfig = new ConnectionConfig({ stream: socket, isServer: true}); + var connection = new Connection({ config: connectionConfig}); + this.emit('connection', connection); + this.connections.push(connection); +}; + +Server.prototype.listen = function(port, host, backlog, callback) { + this._server.listen(port, host, backlog, callback); +}; + +module.exports = Server; diff --git a/node_modules/mysql/lib/protocol/SqlString.js b/node_modules/mysql2/lib/sql_string.js similarity index 82% rename from node_modules/mysql/lib/protocol/SqlString.js rename to node_modules/mysql2/lib/sql_string.js index c9883da..b7eb304 100644 --- a/node_modules/mysql/lib/protocol/SqlString.js +++ b/node_modules/mysql2/lib/sql_string.js @@ -1,12 +1,6 @@ var SqlString = exports; SqlString.escapeId = function (val, forbidQualified) { - if (Array.isArray(val)) { - return val.map(function(v) { - return SqlString.escapeId(v, forbidQualified); - }).join(', '); - } - if (forbidQualified) { return '`' + val.replace(/`/g, '``') + '`'; } @@ -24,7 +18,7 @@ SqlString.escape = function(val, stringifyObjects, timeZone) { } if (val instanceof Date) { - val = SqlString.dateToString(val, timeZone || 'local'); + val = SqlString.dateToString(val, timeZone || "Z"); } if (Buffer.isBuffer(val)) { @@ -59,13 +53,13 @@ SqlString.escape = function(val, stringifyObjects, timeZone) { SqlString.arrayToList = function(array, timeZone) { return array.map(function(v) { - if (Array.isArray(v)) return '(' + SqlString.arrayToList(v, timeZone) + ')'; + if (Array.isArray(v)) return '(' + SqlString.arrayToList(v) + ')'; return SqlString.escape(v, true, timeZone); }).join(', '); }; -SqlString.format = function(sql, values, stringifyObjects, timeZone) { - values = values == null ? [] : [].concat(values); +SqlString.format = function(sql, values, timeZone) { + values = [].concat(values); return sql.replace(/\?\??/g, function(match) { if (!values.length) { @@ -75,7 +69,7 @@ SqlString.format = function(sql, values, stringifyObjects, timeZone) { if (match == "??") { return SqlString.escapeId(values.shift()); } - return SqlString.escape(values.shift(), stringifyObjects, timeZone); + return SqlString.escape(values.shift(), false, timeZone); }); }; @@ -90,7 +84,7 @@ SqlString.dateToString = function(date, timeZone) { dt.setTime(dt.getTime() + (tz * 60000)); } } - + var year = dt.getFullYear(); var month = zeroPad(dt.getMonth() + 1, 2); var day = zeroPad(dt.getDate(), 2); @@ -102,8 +96,19 @@ SqlString.dateToString = function(date, timeZone) { return year + '-' + month + '-' + day + ' ' + hour + ':' + minute + ':' + second + '.' + millisecond; }; -SqlString.bufferToString = function bufferToString(buffer) { - return "X'" + buffer.toString('hex') + "'"; +SqlString.bufferToString = function(buffer) { + var hex = ''; + try { + hex = buffer.toString('hex'); + } catch (err) { + // node v0.4.x does not support hex / throws unknown encoding error + for (var i = 0; i < buffer.length; i++) { + var byte = buffer[i]; + hex += zeroPad(byte.toString(16)); + } + } + + return "X'" + hex+ "'"; }; SqlString.objectToValues = function(object, timeZone) { diff --git a/node_modules/mysql2/node_modules/.bin/cdl b/node_modules/mysql2/node_modules/.bin/cdl new file mode 120000 index 0000000..00a4369 --- /dev/null +++ b/node_modules/mysql2/node_modules/.bin/cdl @@ -0,0 +1 @@ +../cardinal/bin/cdl.js \ No newline at end of file diff --git a/node_modules/mysql2/node_modules/bn.js/.npmignore b/node_modules/mysql2/node_modules/bn.js/.npmignore new file mode 100644 index 0000000..bfd1047 --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/.npmignore @@ -0,0 +1,3 @@ +benchmarks/ +node_modules/ +npm-debug.log diff --git a/node_modules/mysql2/node_modules/bn.js/.travis.yml b/node_modules/mysql2/node_modules/bn.js/.travis.yml new file mode 100644 index 0000000..92a990f --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/.travis.yml @@ -0,0 +1,7 @@ +language: node_js +node_js: + - "0.10" + - "0.11" +branches: + only: + - master diff --git a/node_modules/mysql2/node_modules/bn.js/1.js b/node_modules/mysql2/node_modules/bn.js/1.js new file mode 100644 index 0000000..a9eac63 --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/1.js @@ -0,0 +1,17 @@ +var bn = require('./'); + +var p = new bn('ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f', 16); +var a = new bn('79be667e f9dcbbac 55a06295 ce870b07 029bfcdb 2dce28d9 59f2815b 16f81798', 16); + +var c = a.sqr(); +var m = bn.red('p25519'); +var am = a.toRed(m); + +var t = 0; +console.log(a.sqr()); +console.time('montSqr'); +for (var i = 0; i < 1000000; i++) { + t += am.redSqr().length; +} +console.timeEnd('montSqr'); +console.log(t); diff --git a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/LICENSE b/node_modules/mysql2/node_modules/bn.js/README.md similarity index 81% rename from node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/LICENSE rename to node_modules/mysql2/node_modules/bn.js/README.md index 6de584a..ec953e7 100644 --- a/node_modules/mysql/node_modules/readable-stream/node_modules/string_decoder/LICENSE +++ b/node_modules/mysql2/node_modules/bn.js/README.md @@ -1,4 +1,12 @@ -Copyright Joyent, Inc. and other Node contributors. +# bn.js [![Build Status](https://secure.travis-ci.org/indutny/bn.js.png)](http://travis-ci.org/indutny/bn.js) + +Just a bike-shed. + +#### LICENSE + +This software is licensed under the MIT License. + +Copyright Fedor Indutny, 2014. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the diff --git a/node_modules/mysql2/node_modules/bn.js/lib/bn.js b/node_modules/mysql2/node_modules/bn.js/lib/bn.js new file mode 100644 index 0000000..05d14f9 --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/lib/bn.js @@ -0,0 +1,1716 @@ +// Utils + +function assert(val, msg) { + if (!val) + throw new Error(msg || 'Assertion failed'); +} + +function assertEqual(l, r, msg) { + if (l != r) + throw new Error(msg || ('Assertion failed: ' + l + ' != ' + r)); +} + +// Could use `inherits` module, but don't want to move from single file +// architecture yet. +function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor +} + +// BN + +function BN(number, base) { + // May be `new BN(bn)` ? + if (number !== null && + typeof number === 'object' && + Array.isArray(number.words)) { + return number; + } + + this.sign = false; + this.words = null; + this.length = 0; + + // Reduction context + this.red = null; + + if (number !== null) + this._init(number || 0, base || 10); +} +module.exports = BN; + +BN.BN = BN; +BN.wordSize = 26; + +BN.prototype._init = function init(number, base) { + if (typeof number === 'number') { + if (number < 0) { + this.sign = true; + number = -number; + } + this.words = [ number & 0x3ffffff ]; + this.length = 1; + return; + } else if (typeof number === 'object') { + // Perhaps a Uint8Array + assert(typeof number.length === 'number'); + this.length = Math.ceil(number.length / 3); + this.words = new Array(this.length); + for (var i = 0; i < this.length; i++) + this.words[i] = 0; + + // Assume big-endian + var off = 0; + for (var i = number.length - 1, j = 0; i >= 0; i -= 3) { + var w = number[i] | (number[i - 1] << 8) | (number[i - 2] << 16); + this.words[j] |= (w << off) & 0x3ffffff; + this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff; + off += 24; + if (off >= 26) { + off -= 26; + j++; + } + } + + return this.strip(); + } + if (base === 'hex') + base = 16; + assert(base <= 16); + + number = number.toString().replace(/\s+/g, ''); + var start = 0; + if (number[0] === '-') + start++; + + if (base === 16) + this._parseHex(number, start); + else + this._parseBase(number, base, start); + + if (number[0] === '-') + this.sign = true; + + this.strip(); +}; + +BN.prototype._parseHex = function parseHex(number, start) { + // Create possibly bigger array to ensure that it fits the number + this.length = Math.ceil((number.length - start) / 6); + this.words = new Array(this.length); + for (var i = 0; i < this.length; i++) + this.words[i] = 0; + + // Scan 24-bit chunks and add them to the number + var off = 0; + for (var i = number.length - 6, j = 0; i >= start; i -= 6) { + var w = parseInt(number.slice(i, i + 6), 16); + this.words[j] |= (w << off) & 0x3ffffff; + this.words[j + 1] |= w >>> (26 - off) & 0x3fffff; + off += 24; + if (off >= 26) { + off -= 26; + j++; + } + } + if (i + 6 !== start) { + var w = parseInt(number.slice(start, i + 6), 16); + this.words[j] |= (w << off) & 0x3ffffff; + this.words[j + 1] |= w >>> (26 - off) & 0x3fffff; + } + this.strip(); +}; + +BN.prototype._parseBase = function parseBase(number, base, start) { + // Initialize as zero + this.words = [ 0 ]; + this.length = 1; + + var word = 0; + var q = 1; + var p = 0; + var bigQ = null; + for (var i = start; i < number.length; i++) { + var digit; + var ch = number[i]; + if (base === 10 || ch <= '9') + digit = ch | 0; + else if (ch >= 'a') + digit = ch.charCodeAt(0) - 97 + 10; + else + digit = ch.charCodeAt(0) - 65 + 10; + word *= base; + word += digit; + q *= base; + p++; + + if (q > 0xfffff) { + assert(q <= 0x3ffffff); + if (!bigQ) + bigQ = new BN(q); + this.mul(bigQ).copy(this); + this.iadd(new BN(word)); + word = 0; + q = 1; + p = 0; + } + } + if (p !== 0) { + this.mul(new BN(q)).copy(this); + this.iadd(new BN(word)); + } +}; + +BN.prototype.copy = function copy(dest) { + dest.words = new Array(this.length); + for (var i = 0; i < this.length; i++) + dest.words[i] = this.words[i]; + dest.length = this.length; + dest.sign = this.sign; + dest.red = this.red; +}; + +BN.prototype.clone = function clone() { + var r = new BN(null); + this.copy(r); + return r; +}; + +// Remove leading `0` from `this` +BN.prototype.strip = function strip() { + while (this.length > 1 && this.words[this.length - 1] === 0) + this.length--; + return this._normSign(); +}; + +BN.prototype._normSign = function _normSign() { + // -0 = 0 + if (this.length === 1 && this.words[0] === 0) + this.sign = false; + return this; +}; + +BN.prototype.inspect = function inspect() { + return (this.red ? ''; +}; + +/* +function _zero(n) { + var code = ''; + for (var i = n - 1; i > 0; i--) { + var pad = ''; + for (var j = 0; j < n - i; j++) + pad += '0'; + code += 'if (w.length === ' + i + ') return \'' + pad + '\' + w;\n'; + } + code += 'return w'; + + return new Function('w', code); +} + +var zero6 = _zero(6); +var zero14 = _zero(14); +*/ + +// Sadly chrome apps could not contain `new Function()` calls +function zero6(w) { + if (w.length === 5) return '0' + w; + if (w.length === 4) return '00' + w; + if (w.length === 3) return '000' + w; + if (w.length === 2) return '0000' + w; + if (w.length === 1) return '00000' + w; + return w; +} + +function zero14(w) { + if (w.length === 13) return '0' + w; + if (w.length === 12) return '00' + w; + if (w.length === 11) return '000' + w; + if (w.length === 10) return '0000' + w; + if (w.length === 9) return '00000' + w; + if (w.length === 8) return '000000' + w; + if (w.length === 7) return '0000000' + w; + if (w.length === 6) return '00000000' + w; + if (w.length === 5) return '000000000' + w; + if (w.length === 4) return '0000000000' + w; + if (w.length === 3) return '00000000000' + w; + if (w.length === 2) return '000000000000' + w; + if (w.length === 1) return '0000000000000' + w; + return w; +} + +// Precomputed divisor for `.toString(10)` = 10 ^ 14 +var div10 = new BN(null); +div10.words = [ 0x7a4000, 0x16bcc4 ]; +div10.length = 2; + +BN.prototype.toString = function toString(base) { + base = base || 10; + if (base === 16 || base === 'hex') { + var out = ''; + var off = 0; + var carry = 0; + for (var i = 0; i < this.length; i++) { + var w = this.words[i]; + var word = (((w << off) | carry) & 0xffffff).toString(16); + carry = (w >>> (24 - off)) & 0xffffff; + if (carry !== 0 || i !== this.length - 1) + out = zero6(word) + out; + else + out = word + out; + off += 2; + if (off >= 26) { + off -= 26; + i--; + } + } + if (carry !== 0) + out = carry.toString(16) + out; + if (this.sign) + out = '-' + out; + return out; + } else if (base === 10) { + var out = ''; + var c = this.clone(); + c.sign = false; + while (c.cmpn(0) !== 0) { + var r = c.modn(1000000); + c = c.idivn(1000000); + + if (c.cmpn(0) !== 0) + out = zero6(r + '') + out; + else + out = r + out; + } + if (this.cmpn(0) === 0) + out = '0' + out; + if (this.sign) + out = '-' + out; + return out; + } else { + assert(false, 'Only 16 and 10 base are supported'); + } +}; + +BN.prototype.toJSON = function toJSON() { + return this.toString(16); +}; + +BN.prototype.toArray = function toArray() { + this.strip(); + var res = new Array(this.byteLength()); + res[0] = 0; + + var q = this.clone(); + for (var i = 0; q.cmpn(0) !== 0; i++) { + var b = q.andln(0xff); + q.ishrn(8); + + // Assume big-endian + res[res.length - i - 1] = b; + } + + return res; +}; + +/* +function genCountBits(bits) { + var arr = []; + + for (var i = bits - 1; i >= 0; i--) { + var bit = '0x' + (1 << i).toString(16); + arr.push('w >= ' + bit + ' ? ' + (i + 1)); + } + + return new Function('w', 'return ' + arr.join(' :\n') + ' :\n0;'); +}; + +BN.prototype._countBits = genCountBits(26); +*/ + +// Sadly chrome apps could not contain `new Function()` calls +BN.prototype._countBits = function _countBits(w) { + return w >= 0x2000000 ? 26 : + w >= 0x1000000 ? 25 : + w >= 0x800000 ? 24 : + w >= 0x400000 ? 23 : + w >= 0x200000 ? 22 : + w >= 0x100000 ? 21 : + w >= 0x80000 ? 20 : + w >= 0x40000 ? 19 : + w >= 0x20000 ? 18 : + w >= 0x10000 ? 17 : + w >= 0x8000 ? 16 : + w >= 0x4000 ? 15 : + w >= 0x2000 ? 14 : + w >= 0x1000 ? 13 : + w >= 0x800 ? 12 : + w >= 0x400 ? 11 : + w >= 0x200 ? 10 : + w >= 0x100 ? 9 : + w >= 0x80 ? 8 : + w >= 0x40 ? 7 : + w >= 0x20 ? 6 : + w >= 0x10 ? 5 : + w >= 0x8 ? 4 : + w >= 0x4 ? 3 : + w >= 0x2 ? 2 : + w >= 0x1 ? 1 : + 0; +}; + +// Return number of used bits in a BN +BN.prototype.bitLength = function bitLength() { + var hi = 0; + var w = this.words[this.length - 1]; + var hi = this._countBits(w); + return (this.length - 1) * 26 + hi; +}; + +BN.prototype.byteLength = function byteLength() { + var hi = 0; + var w = this.words[this.length - 1]; + return Math.ceil(this.bitLength() / 8); +}; + +// Return negative clone of `this` +BN.prototype.neg = function neg() { + if (this.cmpn(0) === 0) + return this.clone(); + + var r = this.clone(); + r.sign = !this.sign; + return r; +}; + +// Add `num` to `this` in-place +BN.prototype.iadd = function iadd(num) { + // negative + positive + if (this.sign && !num.sign) { + this.sign = false; + var r = this.isub(num); + this.sign = !this.sign; + return this._normSign(); + + // positive + negative + } else if (!this.sign && num.sign) { + num.sign = false; + var r = this.isub(num); + num.sign = true; + return r._normSign(); + } + + // a.length > b.length + var a; + var b; + if (this.length > num.length) { + a = this; + b = num; + } else { + a = num; + b = this; + } + + var carry = 0; + for (var i = 0; i < b.length; i++) { + var r = a.words[i] + b.words[i] + carry; + this.words[i] = r & 0x3ffffff; + carry = r >>> 26; + } + for (; carry !== 0 && i < a.length; i++) { + var r = a.words[i] + carry; + this.words[i] = r & 0x3ffffff; + carry = r >>> 26; + } + + this.length = a.length; + if (carry !== 0) { + this.words[this.length] = carry; + this.length++; + // Copy the rest of the words + } else if (a !== this) { + for (; i < a.length; i++) + this.words[i] = a.words[i]; + } + + return this; +}; + +// Add `num` to `this` +BN.prototype.add = function add(num) { + if (num.sign && !this.sign) { + num.sign = false; + var res = this.sub(num); + num.sign = true; + return res; + } else if (!num.sign && this.sign) { + this.sign = false; + var res = num.sub(this); + this.sign = true; + return res; + } + + if (this.length > num.length) + return this.clone().iadd(num); + else + return num.clone().iadd(this); +}; + +// Subtract `num` from `this` in-place +BN.prototype.isub = function isub(num) { + // this - (-num) = this + num + if (num.sign) { + num.sign = false; + var r = this.iadd(num); + num.sign = true; + return r._normSign(); + + // -this - num = -(this + num) + } else if (this.sign) { + this.sign = false; + this.iadd(num); + this.sign = true; + return this._normSign(); + } + + // At this point both numbers are positive + var cmp = this.cmp(num); + + // Optimization - zeroify + if (cmp === 0) { + this.sign = false; + this.length = 1; + this.words[0] = 0; + return this; + } + + // a > b + if (cmp > 0) { + var a = this; + var b = num; + } else { + var a = num; + var b = this; + } + + var carry = 0; + for (var i = 0; i < b.length; i++) { + var r = a.words[i] - b.words[i] - carry; + if (r < 0) { + r += 0x4000000; + carry = 1; + } else { + carry = 0; + } + this.words[i] = r; + } + for (; carry !== 0 && i < a.length; i++) { + var r = a.words[i] - carry; + if (r < 0) { + r += 0x4000000; + carry = 1; + } else { + carry = 0; + } + this.words[i] = r; + } + + // Copy rest of the words + if (carry === 0 && i < a.length && a !== this) + for (; i < a.length; i++) + this.words[i] = a.words[i]; + this.length = Math.max(this.length, i); + + if (a !== this) + this.sign = true; + + return this.strip(); +}; + +// Subtract `num` from `this` +BN.prototype.sub = function sub(num) { + return this.clone().isub(num); +}; + +/* +// NOTE: This could be potentionally used to generate loop-less multiplications +function _genCombMulTo(alen, blen) { + var len = alen + blen - 1; + var src = [ + 'var a = this.words, b = num.words, o = out.words, c = 0, w, ' + + 'mask = 0x3ffffff, shift = 0x4000000;', + 'out.length = ' + len + ';' + ]; + for (var k = 0; k < len; k++) { + var minJ = Math.max(0, k - alen + 1); + var maxJ = Math.min(k, blen - 1); + + for (var j = minJ; j <= maxJ; j++) { + var i = k - j; + var mul = 'a[' + i + '] * b[' + j + ']'; + + if (j === minJ) { + src.push('w = ' + mul + ' + c;'); + src.push('c = (w / shift) | 0;'); + } else { + src.push('w += ' + mul + ';'); + src.push('c += (w / shift) | 0;'); + } + src.push('w &= mask;'); + } + src.push('o[' + k + '] = w;'); + } + src.push('if (c !== 0) {', + ' o[' + k + '] = c;', + ' out.length++;', + '}', + 'return out;'); + + return src.join('\n'); +} +*/ + +// Multiply `this` by `num` and store data in out +BN.prototype.mulTo = function mulTo(num, out) { + out.sign = num.sign !== this.sign; + out.length = this.length + num.length; + + var carry = 0; + for (var k = 0; k < out.length - 1; k++) { + // Sum all words with the same `i + j = k` and accumulate `ncarry`, + // note that ncarry could be >= 0x3ffffff + var ncarry = carry >>> 26; + var rword = carry & 0x3ffffff; + var maxJ = Math.min(k, num.length - 1); + for (var j = Math.max(0, k - this.length + 1); j <= maxJ; j++) { + var i = k - j; + var a = this.words[i]; + var b = num.words[j]; + var r = a * b; + + var lo = r & 0x3ffffff; + ncarry += (r / 0x4000000) | 0; + lo += rword; + rword = lo & 0x3ffffff; + ncarry += lo >>> 26; + } + out.words[k] = rword; + carry = ncarry; + } + if (carry !== 0) { + out.words[k] = carry; + } else { + out.length--; + } + + return out.strip(); +}; + +// Multiply `this` by `num` +BN.prototype.mul = function mul(num) { + var out = new BN(null); + out.words = new Array(this.length + num.length); + return this.mulTo(num, out); +}; + +// In-place Multiplication +BN.prototype.imul = function imul(num) { + if (this.cmpn(0) === 0 || num.cmpn(0) === 0) { + this.words[0] = 0; + this.length = 1; + return this; + } + + var tlen = this.length; + var nlen = num.length; + + this.sign = num.sign !== this.sign; + this.length = this.length + num.length; + this.words[this.length - 1] = 0; + + var lastCarry = 0; + for (var k = this.length - 2; k >= 0; k--) { + // Sum all words with the same `i + j = k` and accumulate `carry`, + // note that carry could be >= 0x3ffffff + var carry = 0; + var rword = 0; + var maxJ = Math.min(k, nlen - 1); + for (var j = Math.max(0, k - tlen + 1); j <= maxJ; j++) { + var i = k - j; + var a = this.words[i]; + var b = num.words[j]; + var r = a * b; + + var lo = r & 0x3ffffff; + carry += (r / 0x4000000) | 0; + lo += rword; + rword = lo & 0x3ffffff; + carry += lo >>> 26; + } + this.words[k] = rword; + this.words[k + 1] += carry; + carry = 0; + } + + // Propagate overflows + var carry = 0; + for (var i = 1; i < this.length; i++) { + var w = this.words[i] + carry; + this.words[i] = w & 0x3ffffff; + carry = w >>> 26; + } + + return this.strip(); +}; + +// `this` * `this` +BN.prototype.sqr = function sqr() { + return this.mul(this); +}; + +// `this` * `this` in-place +BN.prototype.isqr = function isqr() { + return this.mul(this); +}; + +// Shift-left in-place +BN.prototype.ishln = function ishln(bits) { + assert(typeof bits === 'number' && bits >= 0); + var r = bits % 26; + var s = (bits - r) / 26; + var carryMask = (0x3ffffff >>> (26 - r)) << (26 - r); + + var o = this.clone(); + if (r !== 0) { + var carry = 0; + for (var i = 0; i < this.length; i++) { + var newCarry = this.words[i] & carryMask; + var c = (this.words[i] - newCarry) << r; + this.words[i] = c | carry; + carry = newCarry >>> (26 - r); + } + if (carry) { + this.words[i] = carry; + this.length++; + } + } + + if (s !== 0) { + for (var i = this.length - 1; i >= 0; i--) + this.words[i + s] = this.words[i]; + for (var i = 0; i < s; i++) + this.words[i] = 0; + this.length += s; + } + + return this.strip(); +}; + +// Shift-right in-place +// NOTE: `hint` is a lowest bit before trailing zeroes +// NOTE: if `extended` is true - { lo: ..., hi: } object will be returned +BN.prototype.ishrn = function ishrn(bits, hint, extended) { + assert(typeof bits === 'number' && bits >= 0); + if (hint) + hint = (hint - (hint % 26)) / 26; + else + hint = 0; + + var r = bits % 26; + var s = Math.min((bits - r) / 26, this.length); + var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r); + var maskedWords = extended; + + hint -= s; + hint = Math.max(0, hint); + + // Extended mode, copy masked part + if (maskedWords) { + for (var i = 0; i < s; i++) + maskedWords.words[i] = this.words[i]; + maskedWords.length = s; + } + + if (s === 0) { + // No-op, we should not move anything at all + } else if (this.length > s) { + this.length -= s; + for (var i = 0; i < this.length; i++) + this.words[i] = this.words[i + s]; + } else { + this.words[0] = 0; + this.length = 1; + } + + var carry = 0; + for (var i = this.length - 1; i >= 0 && (carry !== 0 || i >= hint); i--) { + var word = this.words[i]; + this.words[i] = (carry << (26 - r)) | (word >>> r); + carry = word & mask; + } + + // Push carried bits as a mask + if (maskedWords && carry !== 0) + maskedWords.words[maskedWords.length++] = carry; + + if (this.length === 0) { + this.words[0] = 0; + this.length = 1; + } + + this.strip(); + if (extended) + return { hi: this, lo: maskedWords }; + + return this; +}; + +// Shift-left +BN.prototype.shln = function shln(bits) { + return this.clone().ishln(bits); +}; + +// Shift-right +BN.prototype.shrn = function shrn(bits) { + return this.clone().ishrn(bits); +}; + +// Return only lowers bits of number (in-place) +BN.prototype.imaskn = function imaskn(bits) { + assert(typeof bits === 'number' && bits >= 0); + var r = bits % 26; + var s = (bits - r) / 26; + + assert(!this.sign, 'imaskn works only with positive numbers'); + + if (r !== 0) + s++; + this.length = Math.min(s, this.length); + + if (r !== 0) { + var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r); + this.words[this.length - 1] &= mask; + } + + return this.strip(); +}; + +// Return only lowers bits of number +BN.prototype.maskn = function maskn(bits) { + return this.clone().imaskn(bits); +}; + +// Add plain number `num` to `this` +BN.prototype.iaddn = function iaddn(num) { + assert(typeof num === 'number'); + if (num < 0) + return this.isubn(num); + this.words[0] += num; + + // Carry + for (var i = 0; i < this.length && this.words[i] >= 0x4000000; i++) { + this.words[i] -= 0x4000000; + if (i === this.length - 1) + this.words[i + 1] = 1; + else + this.words[i + 1]++; + } + this.length = Math.max(this.length, i + 1); + + return this; +}; + +// Subtract plain number `num` from `this` +BN.prototype.isubn = function isubn(num) { + assert(typeof num === 'number'); + assert(this.cmpn(num) >= 0, 'Sign change is not supported in isubn'); + if (num < 0) + return this.iaddn(-num); + this.words[0] -= num; + + // Carry + for (var i = 0; i < this.length && this.words[i] < 0; i++) { + this.words[i] += 0x4000000; + this.words[i + 1] -= 1; + } + + return this.strip(); +}; + +BN.prototype.addn = function addn(num) { + return this.clone().iaddn(num); +}; + +BN.prototype.subn = function subn(num) { + return this.clone().isubn(num); +}; + +BN.prototype._wordDiv = function _wordDiv(num, mode) { + var shift = this.length - num.length; + + var a = this.clone(); + var b = num; + + var q = mode !== 'mod' && new BN(0); + var sign = false; + + // Approximate quotient at each step + while (a.length > b.length) { + // NOTE: a.length is always >= 2, because of the condition .div() + var hi = a.words[a.length - 1] * 0x4000000 + a.words[a.length - 2]; + var sq = (hi / b.words[b.length - 1]); + var sqhi = (sq / 0x4000000) | 0; + var sqlo = sq & 0x3ffffff; + sq = new BN(null); + sq.words = [ sqlo, sqhi ]; + sq.length = 2; + + // Collect quotient + var shift = (a.length - b.length - 1) * 26; + if (q) { + var t = sq.shln(shift); + if (a.sign) + q.isub(t); + else + q.iadd(t); + } + + sq = sq.mul(b).ishln(shift); + if (a.sign) + a.iadd(sq) + else + a.isub(sq); + } + // At this point a.length <= b.length + while (a.ucmp(b) >= 0) { + // NOTE: a.length is always >= 2, because of the condition above + var hi = a.words[a.length - 1]; + var sq = new BN((hi / b.words[b.length - 1]) | 0); + var shift = (a.length - b.length) * 26; + + if (q) { + var t = sq.shln(shift); + if (a.sign) + q.isub(t); + else + q.iadd(t); + } + + sq = sq.mul(b).ishln(shift); + + if (a.sign) + a.iadd(sq); + else + a.isub(sq); + } + + if (a.sign) { + if (q) + q.isubn(1); + a.iadd(b); + } + return { div: q ? q : null, mod: a }; +}; + +BN.prototype.divmod = function divmod(num, mode) { + assert(num.cmpn(0) !== 0); + + if (this.sign && !num.sign) { + var res = this.neg().divmod(num, mode); + var div; + var mod; + if (mode !== 'mod') + div = res.div.neg(); + if (mode !== 'div') + mod = res.mod.cmpn(0) === 0 ? res.mod : num.sub(res.mod); + return { + div: div, + mod: mod + }; + } else if (!this.sign && num.sign) { + var res = this.divmod(num.neg(), mode); + var div; + if (mode !== 'mod') + div = res.div.neg(); + return { div: div, mod: res.mod }; + } else if (this.sign && num.sign) { + return this.neg().divmod(num.neg(), mode); + } + + // Both numbers are positive at this point + + // Strip both numbers to approximate shift value + if (num.length > this.length || this.cmp(num) < 0) + return { div: new BN(0), mod: this }; + + // Very short reduction + if (num.length === 1) { + if (mode === 'div') + return { div: this.divn(num.words[0]), mod: null }; + else if (mode === 'mod') + return { div: null, mod: new BN(this.modn(num.words[0])) }; + return { + div: this.divn(num.words[0]), + mod: new BN(this.modn(num.words[0])) + }; + } + + return this._wordDiv(num, mode); +}; + +// Find `this` / `num` +BN.prototype.div = function div(num) { + return this.divmod(num, 'div').div; +}; + +// Find `this` % `num` +BN.prototype.mod = function mod(num) { + return this.divmod(num, 'mod').mod; +}; + +// Find Round(`this` / `num`) +BN.prototype.divRound = function divRound(num) { + var dm = this.divmod(num); + + // Fast case - exact division + if (dm.mod.cmpn(0) === 0) + return dm.div; + + var mod = dm.div.sign ? dm.mod.isub(num) : dm.mod; + + var half = num.shrn(1); + var r2 = num.andln(1); + var cmp = mod.cmp(half); + + // Round down + if (cmp < 0 || r2 === 1 && cmp === 0) + return dm.div; + + // Round up + return dm.div.sign ? dm.div.isubn(1) : dm.div.iaddn(1); +}; + +BN.prototype.modn = function modn(num) { + assert(num <= 0x3ffffff); + var p = (1 << 26) % num; + + var acc = 0; + for (var i = this.length - 1; i >= 0; i--) + acc = (p * acc + this.words[i]) % num; + + return acc; +}; + +// In-place division by number +BN.prototype.idivn = function idivn(num) { + assert(num <= 0x3ffffff); + + var carry = 0; + for (var i = this.length - 1; i >= 0; i--) { + var w = this.words[i] + carry * 0x4000000; + this.words[i] = (w / num) | 0; + carry = w % num; + } + + return this.strip(); +}; + +BN.prototype.divn = function divn(num) { + return this.clone().idivn(num); +}; + +BN.prototype._egcd = function _egcd(x1, p) { + assert(!p.sign); + assert(p.cmpn(0) !== 0); + + var a = this; + var b = p.clone(); + + if (a.sign) + a = a.mod(p); + else + a = a.clone(); + + var x2 = new BN(0); + while (a.cmpn(1) > 0 && b.cmpn(1) > 0) { + while (a.isEven()) { + a.ishrn(1); + if (x1.isEven()) + x1.ishrn(1); + else + x1.iadd(p).ishrn(1); + } + while (b.isEven()) { + b.ishrn(1); + if (x2.isEven()) + x2.ishrn(1); + else + x2.iadd(p).ishrn(1); + } + if (a.cmp(b) >= 0) { + a.isub(b); + x1.isub(x2); + } else { + b.isub(a); + x2.isub(x1); + } + } + if (a.cmpn(1) === 0) + return x1; + else + return x2; +}; + +// Invert number in the field F(num) +BN.prototype.invm = function invm(num) { + return this._egcd(new BN(1), num).mod(num); +}; + +BN.prototype.isEven = function isEven(num) { + return (this.words[0] & 1) === 0; +}; + +BN.prototype.isOdd = function isOdd(num) { + return (this.words[0] & 1) === 1; +}; + +// And first word and num +BN.prototype.andln = function andln(num) { + return this.words[0] & num; +}; + +// Increment at the bit position in-line +BN.prototype.bincn = function bincn(bit) { + assert(typeof bit === 'number'); + var r = bit % 26; + var s = (bit - r) / 26; + var q = 1 << r; + + // Fast case: bit is much higher than all existing words + if (this.length <= s) { + for (var i = this.length; i < s + 1; i++) + this.words[i] = 0; + this.words[s] |= q; + this.length = s + 1; + return this; + } + + // Add bit and propagate, if needed + var carry = q; + for (var i = s; carry !== 0 && i < this.length; i++) { + var w = this.words[i]; + w += carry; + carry = w >>> 26; + w &= 0x3ffffff; + this.words[i] = w; + } + if (carry !== 0) { + this.words[i] = carry; + this.length++; + } + return this; +}; + +BN.prototype.cmpn = function cmpn(num) { + var sign = num < 0; + if (sign) + num = -num; + + if (this.sign && !sign) + return -1; + else if (!this.sign && sign) + return 1; + + num &= 0x3ffffff; + this.strip(); + + var res; + if (this.length > 1) { + res = 1; + } else { + var w = this.words[0]; + res = w === num ? 0 : w < num ? -1 : 1; + } + if (this.sign) + res = -res; + return res; +}; + +// Compare two numbers and return: +// 1 - if `this` > `num` +// 0 - if `this` == `num` +// -1 - if `this` < `num` +BN.prototype.cmp = function cmp(num) { + if (this.sign && !num.sign) + return -1; + else if (!this.sign && num.sign) + return 1; + + var res = this.ucmp(num); + if (this.sign) + return -res; + else + return res; +}; + +// Unsigned comparison +BN.prototype.ucmp = function ucmp(num) { + // At this point both numbers have the same sign + if (this.length > num.length) + return 1; + else if (this.length < num.length) + return -1; + + var res = 0; + for (var i = this.length - 1; i >= 0; i--) { + var a = this.words[i]; + var b = num.words[i]; + + if (a === b) + continue; + if (a < b) + res = -1; + else if (a > b) + res = 1; + break; + } + return res; +}; + +// +// A reduce context, could be using montgomery or something better, depending +// on the `m` itself. +// +BN.red = function red(num) { + return new Red(num); +}; + +BN.prototype.toRed = function toRed(ctx) { + assert(!this.red, 'Already a number in reduction context'); + assert(!this.sign, 'red works only with positives'); + return ctx.convertTo(this)._forceRed(ctx); +}; + +BN.prototype.fromRed = function fromRed() { + assert(this.red, 'fromRed works only with numbers in reduction context'); + return this.red.convertFrom(this); +}; + +BN.prototype._forceRed = function _forceRed(ctx) { + this.red = ctx; + return this; +}; + +BN.prototype.forceRed = function forceRed(ctx) { + assert(!this.red, 'Already a number in reduction context'); + return this._forceRed(ctx); +}; + +BN.prototype.redAdd = function redAdd(num) { + assert(this.red, 'redAdd works only with red numbers'); + return this.red.add(this, num); +}; + +BN.prototype.redIAdd = function redIAdd(num) { + assert(this.red, 'redIAdd works only with red numbers'); + return this.red.iadd(this, num); +}; + +BN.prototype.redSub = function redSub(num) { + assert(this.red, 'redSub works only with red numbers'); + return this.red.sub(this, num); +}; + +BN.prototype.redISub = function redISub(num) { + assert(this.red, 'redISub works only with red numbers'); + return this.red.isub(this, num); +}; + +BN.prototype.redShl = function redShl(num) { + assert(this.red, 'redShl works only with red numbers'); + return this.red.shl(this, num); +}; + +BN.prototype.redMul = function redMul(num) { + assert(this.red, 'redMul works only with red numbers'); + this.red._verify2(this, num); + return this.red.mul(this, num); +}; + +BN.prototype.redIMul = function redIMul(num) { + assert(this.red, 'redMul works only with red numbers'); + this.red._verify2(this, num); + return this.red.imul(this, num); +}; + +BN.prototype.redSqr = function redSqr() { + assert(this.red, 'redSqr works only with red numbers'); + this.red._verify1(this); + return this.red.sqr(this); +}; + +BN.prototype.redISqr = function redISqr() { + assert(this.red, 'redISqr works only with red numbers'); + this.red._verify1(this); + return this.red.isqr(this); +}; + +// Square root over p +BN.prototype.redSqrt = function redSqrt() { + assert(this.red, 'redSqrt works only with red numbers'); + this.red._verify1(this); + return this.red.sqrt(this); +}; + +BN.prototype.redInvm = function redInvm() { + assert(this.red, 'redInvm works only with red numbers'); + this.red._verify1(this); + return this.red.invm(this); +}; + +// Return negative clone of `this` % `red modulo` +BN.prototype.redNeg = function redNeg() { + assert(this.red, 'redNeg works only with red numbers'); + this.red._verify1(this); + return this.red.neg(this); +}; + +BN.prototype.redPow = function redPow(num) { + assert(this.red && !num.red, 'redPow(normalNum)'); + this.red._verify1(this); + return this.red.pow(this, num); +}; + +// Prime numbers with efficient reduction +var primes = { + k256: null, + p224: null, + p192: null, + p25519: null +}; + +// Pseudo-Mersenne prime +function MPrime(name, p) { + // P = 2 ^ N - K + this.name = name; + this.p = new BN(p, 16); + this.n = this.p.bitLength(); + this.k = new BN(1).ishln(this.n).isub(this.p); + + this.tmp = this._tmp(); +} + +MPrime.prototype._tmp = function _tmp() { + var tmp = new BN(null); + tmp.words = new Array(Math.ceil(this.n / 13)); + return tmp; +}; + +MPrime.prototype.ireduce = function ireduce(num) { + // Assumes that `num` is less than `P^2` + // num = HI * (2 ^ N - K) + HI * K + LO = HI * K + LO (mod P) + var r = num; + var rlen; + + do { + var pair = r.ishrn(this.n, 0, this.tmp); + r = this.imulK(pair.hi); + r = r.iadd(pair.lo); + rlen = r.bitLength(); + } while (rlen > this.n); + + var cmp = rlen < this.n ? -1 : r.cmp(this.p); + if (cmp === 0) { + r.words[0] = 0; + r.length = 1; + } else if (cmp > 0) { + r.isub(this.p); + } else { + r.strip(); + } + + return r; +}; + +MPrime.prototype.imulK = function imulK(num) { + return num.imul(this.k); +}; + +function K256() { + MPrime.call( + this, + 'k256', + 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f'); +} +inherits(K256, MPrime); + +K256.prototype.imulK = function imulK(num) { + // K = 0x1000003d1 = [ 0x40, 0x3d1 ] + num.words[num.length] = 0; + num.words[num.length + 1] = 0; + num.length += 2; + for (var i = num.length - 3; i >= 0; i--) { + var w = num.words[i]; + var hi = w * 0x40; + var lo = w * 0x3d1; + hi += (lo / 0x4000000) | 0; + var uhi = (hi / 0x4000000) | 0; + hi &= 0x3ffffff; + lo &= 0x3ffffff; + + num.words[i + 2] += uhi; + num.words[i + 1] += hi; + num.words[i] = lo; + } + var w = num.words[num.length - 2]; + if (w >= 0x4000000) { + num.words[num.length - 1] += w >>> 26; + num.words[num.length - 2] = w & 0x3ffffff; + } + if (num.words[num.length - 1] === 0) + num.length--; + if (num.words[num.length - 1] === 0) + num.length--; + return num; +}; + +function P224() { + MPrime.call( + this, + 'p224', + 'ffffffff ffffffff ffffffff ffffffff 00000000 00000000 00000001'); +} +inherits(P224, MPrime); + +function P192() { + MPrime.call( + this, + 'p192', + 'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff'); +} +inherits(P192, MPrime); + +function P25519() { + // 2 ^ 255 - 19 + MPrime.call( + this, + '25519', + '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed'); +} +inherits(P25519, MPrime); + +P25519.prototype.imulK = function imulK(num) { + // K = 0x13 + var carry = 0; + for (var i = 0; i < num.length; i++) { + var hi = num.words[i] * 0x13 + carry; + var lo = hi & 0x3ffffff; + hi >>>= 26; + + num.words[i] = lo; + carry = hi; + } + if (carry !== 0) + num.words[num.length++] = carry; + return num; +}; + +// Exported mostly for testing purposes, use plain name instead +BN._prime = function prime(name) { + // Cached version of prime + if (primes[name]) + return primes[name]; + + var prime; + if (name === 'k256') + prime = new K256(); + else if (name === 'p224') + prime = new P224(); + else if (name === 'p192') + prime = new P192(); + else if (name === 'p25519') + prime = new P25519(); + else + throw new Error('Unknown prime ' + name); + primes[name] = prime; + + return prime; +} + +// +// Base reduction engine +// +function Red(m) { + if (typeof m === 'string') { + var prime = BN._prime(m); + this.m = prime.p; + this.prime = prime; + } else { + this.m = m; + this.prime = null; + } +} + +Red.prototype._verify1 = function _verify1(a) { + assert(!a.sign, 'red works only with positives'); + assert(a.red, 'red works only with red numbers'); +}; + +Red.prototype._verify2 = function _verify2(a, b) { + assert(!a.sign && !b.sign, 'red works only with positives'); + assert(a.red && a.red === b.red, + 'red works only with red numbers'); +}; + +Red.prototype.imod = function imod(a) { + if (this.prime) + return this.prime.ireduce(a)._forceRed(this); + return a.mod(this.m)._forceRed(this); +}; + +Red.prototype.neg = function neg(a) { + var r = a.clone(); + r.sign = !r.sign; + return r.iadd(this.m)._forceRed(this); +}; + +Red.prototype.add = function add(a, b) { + this._verify2(a, b); + + var res = a.add(b); + if (res.cmp(this.m) >= 0) + res.isub(this.m); + return res._forceRed(this); +}; + +Red.prototype.iadd = function iadd(a, b) { + this._verify2(a, b); + + var res = a.iadd(b); + if (res.cmp(this.m) >= 0) + res.isub(this.m); + return res; +}; + +Red.prototype.sub = function sub(a, b) { + this._verify2(a, b); + + var res = a.sub(b); + if (res.cmpn(0) < 0) + res.iadd(this.m); + return res._forceRed(this); +}; + +Red.prototype.isub = function isub(a, b) { + this._verify2(a, b); + + var res = a.isub(b); + if (res.cmpn(0) < 0) + res.iadd(this.m); + return res; +}; + +Red.prototype.shl = function shl(a, num) { + this._verify1(a); + return this.imod(a.shln(num)); +}; + +Red.prototype.imul = function imul(a, b) { + this._verify2(a, b); + return this.imod(a.imul(b)); +}; + +Red.prototype.mul = function mul(a, b) { + this._verify2(a, b); + return this.imod(a.mul(b)); +}; + +Red.prototype.isqr = function isqr(a) { + return this.imul(a, a); +}; + +Red.prototype.sqr = function sqr(a) { + return this.mul(a, a); +}; + +Red.prototype.sqrt = function sqrt(a) { + if (a.cmpn(0) === 0) + return a.clone(); + + var mod3 = this.m.andln(3); + assert(mod3 % 2 === 1); + + // Fast case + if (mod3 === 3) { + var pow = this.m.add(new BN(1)).ishrn(2); + var r = this.pow(a, pow); + return r; + } + + // Tonelli-Shanks algorithm (Totally unoptimized and slow) + // + // Find Q and S, that Q * 2 ^ S = (P - 1) + var q = this.m.subn(1); + var s = 0; + while (q.cmpn(0) !== 0 && q.andln(1) === 0) { + s++; + q.ishrn(1); + } + assert(q.cmpn(0) !== 0); + + var one = new BN(1).toRed(this); + var nOne = one.redNeg(); + + // Find quadratic non-residue + // NOTE: Max is such because of generalized Riemann hypothesis. + var lpow = this.m.subn(1).ishrn(1); + var z = this.m.bitLength(); + z = new BN(2 * z * z).toRed(this); + while (this.pow(z, lpow).cmp(nOne) !== 0) + z.redIAdd(nOne); + + var c = this.pow(z, q); + var r = this.pow(a, q.addn(1).ishrn(1)); + var t = this.pow(a, q); + var m = s; + while (t.cmp(one) !== 0) { + var tmp = t; + for (var i = 0; tmp.cmp(one) !== 0; i++) + tmp = tmp.redSqr(); + assert(i < m); + var b = this.pow(c, new BN(1).ishln(m - i - 1)); + + r = r.redMul(b); + c = b.redSqr(); + t = t.redMul(c); + m = i; + } + + return r; +}; + +Red.prototype.invm = function invm(a) { + var inv = a._egcd(new BN(1), this.m); + if (inv.sign) { + inv.sign = false; + return this.imod(inv).redNeg(); + } else { + return this.imod(inv); + } +}; + +Red.prototype.pow = function pow(a, num) { + var w = []; + var q = num.clone(); + while (q.cmpn(0) !== 0) { + w.push(q.andln(1)); + q.ishrn(1); + } + + // Skip leading zeroes + var res = a; + for (var i = 0; i < w.length; i++, res = this.sqr(res)) + if (w[i] !== 0) + break; + + if (++i < w.length) { + for (var q = this.sqr(res); i < w.length; i++, q = this.sqr(q)) { + if (w[i] === 0) + continue; + res = this.mul(res, q); + } + } + + return res; +}; + +Red.prototype.convertTo = function convertTo(num) { + return num.clone(); +}; + +Red.prototype.convertFrom = function convertFrom(num) { + var res = num.clone(); + res.red = null; + return res; +}; + +// +// Montgomery method engine +// + +BN.mont = function mont(num) { + return new Mont(num); +}; + +function Mont(m) { + Red.call(this, m); + + this.shift = this.m.bitLength(); + if (this.shift % 26 !== 0) + this.shift += 26 - (this.shift % 26); + this.r = new BN(1).ishln(this.shift); + this.r2 = this.imod(this.r.sqr()); + this.rinv = this.r.invm(this.m); + + // TODO(indutny): simplify it + this.minv = this.rinv.mul(this.r) + .sub(new BN(1)) + .div(this.m) + .neg() + .mod(this.r); +} +inherits(Mont, Red); + +Mont.prototype.convertTo = function convertTo(num) { + return this.imod(num.shln(this.shift)); +}; + +Mont.prototype.convertFrom = function convertFrom(num) { + var r = this.imod(num.mul(this.rinv)); + r.red = null; + return r; +}; + +Mont.prototype.imul = function imul(a, b) { + if (a.cmpn(0) === 0 || b.cmpn(0) === 0) { + a.words[0] = 0; + a.length = 1; + return a; + } + + var t = a.imul(b); + var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m); + var u = t.isub(c).ishrn(this.shift); + var res = u; + if (u.cmp(this.m) >= 0) + res = u.isub(this.m); + else if (u.cmpn(0) < 0) + res = u.iadd(this.m); + + return res._forceRed(this); +}; + +Mont.prototype.mul = function mul(a, b) { + if (a.cmpn(0) === 0 || b.cmpn(0) === 0) + return new BN(0)._forceRed(this); + + var t = a.mul(b); + var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m); + var u = t.isub(c).ishrn(this.shift); + var res = u; + if (u.cmp(this.m) >= 0) + res = u.isub(this.m); + else if (u.cmpn(0) < 0) + res = u.iadd(this.m); + + return res._forceRed(this); +}; + +Mont.prototype.invm = function invm(a) { + // (AR)^-1 * R^2 = (A^-1 * R^-1) * R^2 = A^-1 * R + var res = this.imod(a.invm(this.m).mul(this.r2)); + return res._forceRed(this); +}; diff --git a/node_modules/mysql2/node_modules/bn.js/package.json b/node_modules/mysql2/node_modules/bn.js/package.json new file mode 100644 index 0000000..82514ee --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/package.json @@ -0,0 +1,52 @@ +{ + "name": "bn.js", + "version": "0.11.7", + "description": "Big number implementation in pure javascript", + "main": "lib/bn.js", + "scripts": { + "test": "mocha --reporter=spec test/*-test.js" + }, + "repository": { + "type": "git", + "url": "git@github.com:indutny/bn.js" + }, + "keywords": [ + "BN", + "BigNum", + "Big number", + "Modulo", + "Montgomery" + ], + "author": { + "name": "Fedor Indutny", + "email": "fedor@indutny.com" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/indutny/bn.js/issues" + }, + "homepage": "https://github.com/indutny/bn.js", + "devDependencies": { + "mocha": "^1.18.2" + }, + "_id": "bn.js@0.11.7", + "_shasum": "7c5be037ccd45afc3136c7af92466c93d4ce5a56", + "_from": "bn.js@0.11.7", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "indutny", + "email": "fedor@indutny.com" + }, + "maintainers": [ + { + "name": "indutny", + "email": "fedor@indutny.com" + } + ], + "dist": { + "shasum": "7c5be037ccd45afc3136c7af92466c93d4ce5a56", + "tarball": "http://registry.npmjs.org/bn.js/-/bn.js-0.11.7.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/bn.js/-/bn.js-0.11.7.tgz" +} diff --git a/node_modules/mysql2/node_modules/bn.js/test/bn-test.js b/node_modules/mysql2/node_modules/bn.js/test/bn-test.js new file mode 100644 index 0000000..9965f43 --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/test/bn-test.js @@ -0,0 +1,307 @@ +var assert = require('assert'); +var BN = require('../').BN; + +describe('BN', function() { + it('should work with Number input', function() { + assert.equal(new BN(12345).toString(16), '3039'); + }); + + it('should work with String input', function() { + assert.equal(new BN('29048849665247').toString(16), + '1a6b765d8cdf'); + assert.equal(new BN('-29048849665247').toString(16), + '-1a6b765d8cdf'); + assert.equal(new BN('1A6B765D8CDF', 16).toString(16), + '1a6b765d8cdf'); + assert.equal(new BN('FF', 16).toString(), '255'); + assert.equal(new BN('1A6B765D8CDF', 16).toString(), + '29048849665247'); + assert.equal(new BN('a89c e5af8724 c0a23e0e 0ff77500', 16).toString(16), + 'a89ce5af8724c0a23e0e0ff77500'); + assert.equal(new BN('123456789abcdef123456789abcdef123456789abcdef', + 16).toString(16), + '123456789abcdef123456789abcdef123456789abcdef'); + assert.equal(new BN('10654321').toString(), '10654321'); + assert.equal(new BN('10000000000000000').toString(10), + '10000000000000000'); + }); + + it('should import/export big endian', function() { + assert.equal(new BN([1,2,3]).toString(16), '10203'); + assert.equal(new BN([1,2,3,4]).toString(16), '1020304'); + assert.equal(new BN([1,2,3,4,5]).toString(16), '102030405'); + assert.equal(new BN([1,2,3,4,5,6,7,8]).toString(16), '102030405060708'); + assert.equal(new BN([1,2,3,4]).toArray().join(','), '1,2,3,4'); + assert.equal(new BN([1,2,3,4,5,6,7,8]).toArray().join(','), + '1,2,3,4,5,6,7,8'); + }); + + it('should return proper bitLength', function() { + assert.equal(new BN(0).bitLength(), 0); + assert.equal(new BN(0x1).bitLength(), 1); + assert.equal(new BN(0x2).bitLength(), 2); + assert.equal(new BN(0x3).bitLength(), 2); + assert.equal(new BN(0x4).bitLength(), 3); + assert.equal(new BN(0x8).bitLength(), 4); + assert.equal(new BN(0x10).bitLength(), 5); + assert.equal(new BN(0x100).bitLength(), 9); + assert.equal(new BN(0x123456).bitLength(), 21); + assert.equal(new BN('123456789', 16).bitLength(), 33); + assert.equal(new BN('8023456789', 16).bitLength(), 40); + }); + + it('should add numbers', function() { + assert.equal(new BN(14).add(new BN(26)).toString(16), '28'); + var k = new BN(0x1234); + var r = k; + for (var i = 0; i < 257; i++) + r = r.add(k); + assert.equal(r.toString(16), '125868'); + + var k = new BN('abcdefabcdefabcdef', 16); + var r = new BN('deadbeef', 16); + for (var i = 0; i < 257; i++) + r.iadd(k); + assert.equal(r.toString(16), 'ac79bd9b79be7a277bde'); + }); + + it('should subtract numbers', function() { + assert.equal(new BN(14).sub(new BN(26)).toString(16), '-c'); + assert.equal(new BN(26).sub(new BN(14)).toString(16), 'c'); + assert.equal(new BN(26).sub(new BN(26)).toString(16), '0'); + assert.equal(new BN(-26).sub(new BN(26)).toString(16), '-34'); + + var a = new BN( + '31ff3c61db2db84b9823d320907a573f6ad37c437abe458b1802cda041d6384' + + 'a7d8daef41395491e2', + 16); + var b = new BN( + '6f0e4d9f1d6071c183677f601af9305721c91d31b0bbbae8fb790000', + 16); + var r = new BN( + '31ff3c61db2db84b9823d3208989726578fd75276287cd9516533a9acfb9a67' + + '76281f34583ddb91e2', + 16); + assert.equal(a.sub(b).cmp(r), 0); + + // In-place + assert.equal(b.clone().isub(a).neg().cmp(r), 0); + + var r = b.sub(new BN(14)); + assert.equal(b.clone().isubn(14).cmp(r), 0); + + var r = new BN( + '7fffffffffffffffffffffffffffffff5d576e7357a4501ddfe92f46681b', 16); + assert.equal(r.isubn(-1).toString(16), + '7fffffffffffffffffffffffffffffff5d576e7357a4501ddfe92f46681c'); + + // Carry and copy + var a = new BN('12345', 16); + var b = new BN('1000000000000', 16); + assert.equal(a.isub(b).toString(16), '-fffffffedcbb'); + + var a = new BN('12345', 16); + var b = new BN('1000000000000', 16); + assert.equal(b.isub(a).toString(16), 'fffffffedcbb'); + }); + + it('should mul numbers', function() { + assert.equal(new BN(0x1001).mul(new BN(0x1234)).toString(16), + '1235234'); + assert.equal(new BN(-0x1001).mul(new BN(0x1234)).toString(16), + '-1235234'); + assert.equal(new BN(-0x1001).mul(new BN(-0x1234)).toString(16), + '1235234'); + var n = new BN(0x1001); + var r = n; + for (var i = 0; i < 4; i++) + r = r.mul(n); + assert.equal(r.toString(16), + '100500a00a005001'); + + var n = new BN( + '79be667ef9dcbbac55a06295ce870b07029bfcdb2dce28d959f2815b16f81798', + 16 + ); + assert.equal(n.mul(n).toString(16), + '39e58a8055b6fb264b75ec8c646509784204ac15a8c24e05babc9729ab9' + + 'b055c3a9458e4ce3289560a38e08ba8175a9446ce14e608245ab3a9' + + '978a8bd8acaa40'); + assert.equal(n.mul(n).mul(n).toString(16), + '1b888e01a06e974017a28a5b4da436169761c9730b7aeedf75fc60f687b' + + '46e0cf2cb11667f795d5569482640fe5f628939467a01a612b02350' + + '0d0161e9730279a7561043af6197798e41b7432458463e64fa81158' + + '907322dc330562697d0d600'); + + assert.equal( + new BN('-100000000000').mul(new BN('3').div(new BN('4'))).toString(16), + '0' + ); + }); + + it('should imul numbers', function() { + var a = new BN('abcdef01234567890abcd', 16); + var b = new BN('deadbeefa551edebabba8', 16); + var c = a.mul(b); + + assert.equal(a.imul(b).toString(16), c.toString(16)); + + var a = new BN('abcdef01234567890abcd214a25123f512361e6d236', 16); + var b = new BN('deadbeefa551edebabba8121234fd21bac0341324dd', 16); + var c = a.mul(b); + + assert.equal(a.imul(b).toString(16), c.toString(16)); + }); + + it('should div numbers', function() { + assert.equal(new BN('10').div(new BN(256)).toString(16), + '0'); + assert.equal(new BN('69527932928').div(new BN('16974594')).toString(16), + 'fff'); + assert.equal(new BN('-69527932928').div(new BN('16974594')).toString(16), + '-fff'); + + var b = new BN( + '39e58a8055b6fb264b75ec8c646509784204ac15a8c24e05babc9729ab9' + + 'b055c3a9458e4ce3289560a38e08ba8175a9446ce14e608245ab3a9' + + '978a8bd8acaa40', + 16); + var n = new BN( + '79be667ef9dcbbac55a06295ce870b07029bfcdb2dce28d959f2815b16f81798', + 16 + ); + assert.equal(b.div(n).toString(16), n.toString(16)); + + assert.equal(new BN('1').div(new BN('-5')).toString(10), '0'); + + // Regression after moving to word div + var p = new BN( + 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f', + 16); + var a = new BN( + '79be667e f9dcbbac 55a06295 ce870b07 029bfcdb 2dce28d9 59f2815b 16f81798', + 16); + var as = a.sqr(); + assert.equal( + as.div(p).toString(16), + '39e58a8055b6fb264b75ec8c646509784204ac15a8c24e05babc9729e58090b9'); + + var p = new BN( + 'ffffffff00000001000000000000000000000000ffffffffffffffffffffffff', + 16); + var a = new BN( + 'fffffffe00000003fffffffd0000000200000001fffffffe00000002ffffffff' + + 'ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff', + 16); + assert.equal( + a.div(p).toString(16), + 'ffffffff00000002000000000000000000000001000000000000000000000001'); + }); + + it('should mod numbers', function() { + assert.equal(new BN('10').mod(new BN(256)).toString(16), + 'a'); + assert.equal(new BN('69527932928').mod(new BN('16974594')).toString(16), + '102f302'); + assert.equal(new BN('-69527932928').mod(new BN('16974594')).toString(16), + '1000'); + + var p = new BN( + 'ffffffff00000001000000000000000000000000ffffffffffffffffffffffff', + 16); + var a = new BN( + 'fffffffe00000003fffffffd0000000200000001fffffffe00000002ffffffff' + + 'ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff', + 16); + assert.equal( + a.mod(p).toString(16), + '0'); + }); + + it('should divRound numbers', function() { + assert.equal(new BN(9).divRound(new BN(20)).toString(10), + '0'); + assert.equal(new BN(10).divRound(new BN(20)).toString(10), + '1'); + assert.equal(new BN(150).divRound(new BN(20)).toString(10), + '8'); + assert.equal(new BN(149).divRound(new BN(20)).toString(10), + '7'); + assert.equal(new BN(149).divRound(new BN(17)).toString(10), + '9'); + assert.equal(new BN(144).divRound(new BN(17)).toString(10), + '8'); + assert.equal(new BN(-144).divRound(new BN(17)).toString(10), + '-8'); + }); + + it('should modn numbers', function() { + assert.equal(new BN('10', 16).modn(256).toString(16), '10'); + assert.equal(new BN('100', 16).modn(256).toString(16), '0'); + assert.equal(new BN('1001', 16).modn(256).toString(16), '1'); + assert.equal(new BN('100000000001', 16).modn(256).toString(16), '1'); + assert.equal(new BN('100000000001', 16).modn(257).toString(16), + new BN('100000000001', 16).mod(new BN(257)).toString(16)); + assert.equal(new BN('123456789012', 16).modn(3).toString(16), + new BN('123456789012', 16).mod(new BN(3)).toString(16)); + }); + + it('should idivn numbers', function() { + assert.equal(new BN('10', 16).idivn(3).toString(16), '5'); + assert.equal(new BN('12', 16).idivn(3).toString(16), '6'); + assert.equal(new BN('10000000000000000').idivn(3).toString(10), + '3333333333333333'); + assert.equal(new BN('100000000000000000000000000000').idivn(3).toString(10), + '33333333333333333333333333333'); + + var t = new BN(3); + assert.equal(new BN('12345678901234567890123456', 16).idivn(3).toString(16), + new BN('12345678901234567890123456', 16).div(t).toString(16)); + }); + + it('should shl numbers', function() { + assert.equal(new BN('69527932928').shln(13).toString(16), + '2060602000000'); + assert.equal(new BN('69527932928').shln(45).toString(16), + '206060200000000000000'); + }); + + it('should shr numbers', function() { + assert.equal(new BN('69527932928').shrn(13).toString(16), + '818180'); + assert.equal(new BN('69527932928').shrn(17).toString(16), + '81818'); + assert.equal(new BN('69527932928').shrn(256).toString(16), + '0'); + }); + + it('should invm numbers', function() { + var p = new BN(257); + var a = new BN(3); + var b = a.invm(p); + assert.equal(a.mul(b).mod(p).toString(16), '1'); + + var p192 = new BN( + 'fffffffffffffffffffffffffffffffeffffffffffffffff', + 16); + var a = new BN('deadbeef', 16); + var b = a.invm(p192); + assert.equal(a.mul(b).mod(p192).toString(16), '1'); + }); + + it('should support bincn', function() { + assert.equal(new BN(0).bincn(1).toString(16), '2'); + assert.equal(new BN(2).bincn(1).toString(16), '4'); + assert.equal(new BN(2).bincn(1).bincn(1).toString(16), + new BN(2).bincn(2).toString(16)); + assert.equal(new BN(0xffffff).bincn(1).toString(16), '1000001'); + }); + + it('should support imaskn', function() { + assert.equal(new BN(0).imaskn(1).toString(16), '0'); + assert.equal(new BN(3).imaskn(1).toString(16), '1'); + assert.equal(new BN('123456789', 16).imaskn(4).toString(16), '9'); + assert.equal(new BN('123456789', 16).imaskn(16).toString(16), '6789'); + assert.equal(new BN('123456789', 16).imaskn(28).toString(16), '3456789'); + }); +}); diff --git a/node_modules/mysql2/node_modules/bn.js/test/red-test.js b/node_modules/mysql2/node_modules/bn.js/test/red-test.js new file mode 100644 index 0000000..d57ba7c --- /dev/null +++ b/node_modules/mysql2/node_modules/bn.js/test/red-test.js @@ -0,0 +1,126 @@ +var assert = require('assert'); +var BN = require('../').BN; + +describe('BN.js/Reduction context', function() { + function testMethod(name, fn) { + describe(name + ' method', function() { + it('should support add, iadd, sub, isub operations', function() { + var p = new BN(257); + var m = fn(p); + var a = new BN(123).toRed(m); + var b = new BN(231).toRed(m); + + assert.equal(a.redAdd(b).fromRed().toString(10), '97'); + assert.equal(a.redSub(b).fromRed().toString(10), '149'); + assert.equal(b.redSub(a).fromRed().toString(10), '108'); + + assert.equal(a.clone().redIAdd(b).fromRed().toString(10), '97'); + assert.equal(a.clone().redISub(b).fromRed().toString(10), '149'); + assert.equal(b.clone().redISub(a).fromRed().toString(10), '108'); + }); + + it('should support pow and mul operations', function() { + var p192 = new BN( + 'fffffffffffffffffffffffffffffffeffffffffffffffff', + 16); + var m = fn(p192); + var a = new BN(123); + var b = new BN(231); + var c = a.toRed(m).redMul(b.toRed(m)).fromRed(); + assert(c.cmp(a.mul(b).mod(p192)) === 0); + + assert.equal(a.toRed(m).redPow(new BN(3)).fromRed() + .cmp(a.sqr().mul(a)), 0); + assert.equal(a.toRed(m).redPow(new BN(4)).fromRed() + .cmp(a.sqr().sqr()), 0); + assert.equal(a.toRed(m).redPow(new BN(8)).fromRed() + .cmp(a.sqr().sqr().sqr()), 0); + assert.equal(a.toRed(m).redPow(new BN(9)).fromRed() + .cmp(a.sqr().sqr().sqr().mul(a)), 0); + assert.equal(a.toRed(m).redPow(new BN(17)).fromRed() + .cmp(a.sqr().sqr().sqr().sqr().mul(a)), 0); + }); + + it('should sqrtm numbers', function() { + var p = new BN(263); + var m = fn(p); + var q = new BN(11).toRed(m); + var qr = q.redSqrt(true, p); + assert.equal(qr.redSqr().cmp(q), 0); + var qr = q.redSqrt(false, p); + assert.equal(qr.redSqr().cmp(q), 0); + + var p = new BN( + 'fffffffffffffffffffffffffffffffeffffffffffffffff', + 16); + var m = fn(p); + var q = new BN(13).toRed(m); + var qr = q.redSqrt(true, p); + assert.equal(qr.redSqr().cmp(q), 0); + var qr = q.redSqrt(false, p); + assert.equal(qr.redSqr().cmp(q), 0); + + // Tonelli-shanks + var p = new BN(13); + var m = fn(p); + var q = new BN(10).toRed(m); + assert.equal(q.redSqrt().fromRed().toString(10), '7'); + }); + + it('should invm numbers', function() { + var p = new BN(257); + var m = fn(p); + var a = new BN(3).toRed(m); + var b = a.redInvm(p); + assert.equal(a.redMul(b).fromRed().toString(16), '1'); + }); + + it('should imul numbers', function() { + var p = new BN( + 'fffffffffffffffffffffffffffffffeffffffffffffffff', + 16); + var m = fn(p); + + var a = new BN('deadbeefabbadead', 16); + var b = new BN('abbadeadbeefdead', 16); + var c = a.mul(b).mod(p); + + assert.equal(a.toRed(m).redIMul(b.toRed(m)).fromRed().toString(16), + c.toString(16)); + }); + }); + } + + testMethod('Plain', BN.red); + testMethod('Montgomery', BN.mont); + + describe('Pseudo-Mersenne Primes', function() { + it('should reduce numbers mod k256', function() { + var p = BN._prime('k256'); + + assert.equal(p.ireduce(new BN(0xdead)).toString(16), 'dead'); + assert.equal(p.ireduce(new BN('deadbeef', 16)).toString(16), 'deadbeef'); + + var num = new BN('fedcba9876543210fedcba9876543210dead' + + 'fedcba9876543210fedcba9876543210dead', + 16); + var exp = num.mod(p.p).toString(16); + assert.equal(p.ireduce(num).toString(16), exp); + + var regr = new BN('f7e46df64c1815962bf7bc9c56128798' + + '3f4fcef9cb1979573163b477eab93959' + + '335dfb29ef07a4d835d22aa3b6797760' + + '70a8b8f59ba73d56d01a79af9', + 16); + var exp = regr.mod(p.p).toString(16); + assert.equal(p.ireduce(regr).toString(16), exp); + }); + + it('should not fail to invm number mod k256', function() { + var regr2 = new BN( + '6c150c4aa9a8cf1934485d40674d4a7cd494675537bda36d49405c5d2c6f496f', 16); + regr2 = regr2.toRed(BN.red('k256')); + assert.equal(regr2.redInvm().redMul(regr2).fromRed().cmpn(1), 0); + }); + }); +}); diff --git a/node_modules/mysql2/node_modules/cardinal/.npmignore b/node_modules/mysql2/node_modules/cardinal/.npmignore new file mode 100644 index 0000000..7e2f179 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/.npmignore @@ -0,0 +1 @@ +assets diff --git a/node_modules/mysql2/node_modules/cardinal/.travis.yml b/node_modules/mysql2/node_modules/cardinal/.travis.yml new file mode 100644 index 0000000..65488b0 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.8 + - 0.10 diff --git a/node_modules/mysql2/node_modules/cardinal/LICENSE b/node_modules/mysql2/node_modules/cardinal/LICENSE new file mode 100644 index 0000000..19c037f --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/LICENSE @@ -0,0 +1,23 @@ +Copyright 2012 Thorsten Lorenz. +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mysql2/node_modules/cardinal/README.md b/node_modules/mysql2/node_modules/cardinal/README.md new file mode 100644 index 0000000..5c3d5ad --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/README.md @@ -0,0 +1,132 @@ +# cardinal [![Build Status](https://secure.travis-ci.org/thlorenz/cardinal.png)](http://travis-ci.org/thlorenz/cardinal) + +[![NPM](https://nodei.co/npm/cardinal.png?downloads=true&stars=true)](https://nodei.co/npm/cardinal/) + +**car·di·nal** *(kärdn-l, kärdnl)* - crested thick-billed North American finch having bright red plumage in the male. + +![screenshot](https://github.com/thlorenz/cardinal/raw/master/assets/screen-shot.png) + +## Features + +- highlights JavaScript code with ANSI colors to improve terminal output +- theming support, see [custom color themes](https://github.com/thlorenz/cardinal/tree/master/themes) +- optionally print line numbers +- API and command line interface (`cdl`) +- `.cardinalrc` config to customize settings +- supports UNIX pipes + +*** + +**Table of Contents** *generated with [DocToc](http://doctoc.herokuapp.com/)* + +- [Installation](#installation) + - [As library](#as-library) + - [As Commandline Tool](#as-commandline-tool) +- [Commandline](#commandline) + - [Highlight a file](#highlight-a-file) + - [As part of a UNIX pipe](#as-part-of-a-unix-pipe) + - [Theme](#theme) +- [API](#api) + - [*highlight(code[, opts])*](#highlightcode-opts) + - [*highlightFileSync(fullPath[, opts])*](#highlightfilesyncfullpath-opts) + - [*highlightFile(fullPath[, opts], callback)*](#highlightfilefullpath-opts-callback) + - [opts](#opts) +- [Examples ([*browse*](https://github.com/thlorenz/cardinal/tree/master/examples))](#examples-[browse]https://githubcom/thlorenz/cardinal/tree/master/examples) + + +## Installation + +### As library + + npm install cardinal + +### As Commandline Tool + + [sudo] npm install -g cardinal + +**Note:** + +When installed globally, cardinal exposes itself as the `cdl` command. + +## Commandline + +### Highlight a file + + cdl [options] + +**options**: + - `--nonum`: turns off line number printing (relevant if it is turned on inside `~/.cardinalrc` + +### As part of a UNIX pipe + + cat file.js | grep console | cdl + +**Note:** + +Not all code lines may be parsable JavaScript. In these cases the line is printed to the terminal without +highlighting it. + +### Theme + +The default theme will be used for highlighting. + +To use a different theme, include a `.cardinalrc` file in your `HOME` directory. + +This is a JSON file of the following form: + +```json +{ + "theme": "hide-semicolons", + "linenos": true|false +} +``` + +- `theme` can be the name of any of the [built-in themes](https://github.com/thlorenz/cardinal/tree/master/themes) or the +full path to a custom theme anywhere on your computer. +- linenos toggles line number printing + +## API + +### *highlight(code[, opts])* + +- returns the highlighted version of the passed code ({String}) or throws an error if it was not able to parse it +- opts (see below) + +### *highlightFileSync(fullPath[, opts])* + +- returns the highlighted version of the file whose fullPath ({String}) was passed or throws an error if it was not able + to parse it +- opts (see below) + +### *highlightFile(fullPath[, opts], callback)* + +- calls back with the highlighted version of the file whose fullPath ({String}) was passed or with an error if it was not able + to parse it +- opts (see below) +- `callback` ({Function}) has the following signature: `function (err, highlighted) { .. }` + +### opts + +opts is an {Object} with the following properties: + +- `theme` {Object} is used to optionally override the theme used to highlight +- `linenos` {Boolean} if `true` line numbers are included in the highlighted code +- `firstline` {Integer} sets line number of the first line when line numbers are printed +- `json` {Boolean} if `true` highlights JSON in addition to JavaScript (`true` by default if file extension is `.json`) + +## Examples ([*browse*](https://github.com/thlorenz/cardinal/tree/master/examples)) + +- [sample .cardinalrc](https://github.com/thlorenz/cardinal/blob/master/examples/.cardinalrc) +- [highlighting a code snippet](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-string.js) via + ***highlight()*** +- [file that highlights itself](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-self.js) via + ***highlightFile()*** including line numbers +- [file that highlights itself hiding all + semicolons](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-self-hide-semicolons.js) via + ***highlightFileSync()*** + + + + +[![Bitdeli Badge](https://d2weczhvl823v0.cloudfront.net/thlorenz/cardinal/trend.png)](https://bitdeli.com/free "Bitdeli Badge") + diff --git a/node_modules/mysql2/node_modules/cardinal/bin/cdl.js b/node_modules/mysql2/node_modules/cardinal/bin/cdl.js new file mode 100755 index 0000000..c58eb08 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/bin/cdl.js @@ -0,0 +1,74 @@ +#!/usr/bin/env node +var cardinal = require('..') + , utl = require('../utl') + , settings = require('../settings') + , args = process.argv + , theme = settings.resolveTheme() + , opts = settings.getSettings() + , highlighted + ; + +opts = opts || {}; +opts.theme = theme; + +function usage() { + var msg = [ + 'Usage: cdl [options]' + , '' + , 'Options (~/.cardinalrc overrides):' + , ' --nonum: turn off line printing' + , '' + , 'Unix Pipe Example: cat filename.js | grep console | cdl' + , '' + ].join('\n'); + console.log(msg); +} + +function highlightFile () { + try { + highlighted = cardinal.highlightFileSync(args[2], opts); + console.log(highlighted); + } catch (e) { + console.trace(); + console.error(e); + } +} + +// E.g., "cardinal myfile.js" +if (args.length === 3) return highlightFile(); + +var opt = args[3]; + +// E.g., "cardinal myfile.js --nonum" +if (opt && opt.indexOf('--') === 0 ) { + if ((/^--(nonum|noline)/i).test(opt)) opts.linenos = false; + else { + usage(); + return console.error('Unknown option: ', opt); + } + + return highlightFile(); +} + + +// UNIX pipes e.g., "cat myfile.js | grep console | cardinal +var stdin = process.stdin + , stdout = process.stdout; + +// line numbers don't make sense when we are printing line by line +opts.linenos = false; + +stdin.setEncoding('utf-8'); +stdin.resume(); +stdin + .on('data', function (chunk) { + chunk.split('\n').forEach(function (line) { + try { + stdout.write(cardinal.highlight(line, opts) + '\n'); + } catch (e) { + // line doesn't represent a valid js snippet and therefore cannot be parsed -> just print as is + stdout.write(line + '\n'); + } + }); + }); + diff --git a/node_modules/mysql2/node_modules/cardinal/cardinal.js b/node_modules/mysql2/node_modules/cardinal/cardinal.js new file mode 100644 index 0000000..4df4bb4 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/cardinal.js @@ -0,0 +1,5 @@ +module.exports = { + highlight: require('./lib/highlight') + , highlightFile: require('./lib/highlightFile') + , highlightFileSync: require('./lib/highlightFileSync') +}; diff --git a/node_modules/mysql2/node_modules/cardinal/examples/.cardinalrc b/node_modules/mysql2/node_modules/cardinal/examples/.cardinalrc new file mode 100644 index 0000000..34be5cc --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/.cardinalrc @@ -0,0 +1,3 @@ +{ + "theme": "hide-semicolons" +} diff --git a/node_modules/mysql2/node_modules/cardinal/examples/README.md b/node_modules/mysql2/node_modules/cardinal/examples/README.md new file mode 100644 index 0000000..a6c2cd9 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/README.md @@ -0,0 +1,7 @@ +# Cardinal Examples + +You can run the examples individually or as a demo: + +- install cardinal: `npm install cardinal` +- explore cardinal: `npm explore cardinal` +- run the demo: `npm run demo` diff --git a/node_modules/mysql2/node_modules/cardinal/examples/highlight-json.js b/node_modules/mysql2/node_modules/cardinal/examples/highlight-json.js new file mode 100644 index 0000000..3c06e5d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/highlight-json.js @@ -0,0 +1,10 @@ +// This file will highlight the passed code using the custom theme when run via: "node highlight-json" + +var cardinal = require('..'); + +var json = JSON.stringify({ + foo: 'bar', + baz: 'quux' +}); + +console.log(cardinal.highlight(json, {json: true})); diff --git a/node_modules/mysql2/node_modules/cardinal/examples/highlight-self-hide-semicolons.js b/node_modules/mysql2/node_modules/cardinal/examples/highlight-self-hide-semicolons.js new file mode 100644 index 0000000..bf2c7d6 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/highlight-self-hide-semicolons.js @@ -0,0 +1,22 @@ + /* + * This file will highlight itself using a custom theme when run via: "node highlight-self-hide-semicolons" + * The custom theme highlights semicolons as 'black', thus hiding them. + */ + +var cardinal = require('..') + , hideSemicolonsTheme = require('../themes/hide-semicolons'); + +function highlight () { + + // Using the synchronous highlightFileSync() + // For asynchronous highlighting use: highlightFile() - see highlight-self.js + + try { + var highlighted = cardinal.highlightFileSync(__filename, hideSemicolonsTheme); + console.log(highlighted); + } catch (err) { + console.error(err); + } +} + +highlight(); diff --git a/node_modules/mysql2/node_modules/cardinal/examples/highlight-self.js b/node_modules/mysql2/node_modules/cardinal/examples/highlight-self.js new file mode 100644 index 0000000..ceeb599 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/highlight-self.js @@ -0,0 +1,16 @@ +// This file will highlight itself using the default theme when run via: "node highlight-self" + +var cardinal = require('..'); + +function highlight () { + + // Using the asynchronous highlightFile() + // For synchronous highlighting use: highlightFileSync() - see highlight-self-hide-semicolons.js + + cardinal.highlightFile(__filename, { linenos: true }, function (err, res) { + if (err) return console.error(err); + console.log(res); + }); +} + +highlight(); diff --git a/node_modules/mysql2/node_modules/cardinal/examples/highlight-string.js b/node_modules/mysql2/node_modules/cardinal/examples/highlight-string.js new file mode 100644 index 0000000..dcc7b4e --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/examples/highlight-string.js @@ -0,0 +1,14 @@ +// This file will highlight the passed code using the custom theme when run via: "node highlight-string" + +var cardinal = require('..'); + +var code = '' + + +function add (a, b) { + var sum = a + b; + return sum; +} + + +''; + +console.log(cardinal.highlight(code)); diff --git a/node_modules/mysql2/node_modules/cardinal/lib/highlight.js b/node_modules/mysql2/node_modules/cardinal/lib/highlight.js new file mode 100644 index 0000000..9c55e2c --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/lib/highlight.js @@ -0,0 +1,83 @@ +var redeyed = require('redeyed') + , theme = require('../themes/default') + , colors = require('ansicolors') + + , colorSurround = colors.brightBlack + , surroundClose = '\u001b[39m' + ; + +function trimEmptyLines(lines) { + + // remove lines from the end until we find a non-empy one + var line = lines.pop(); + while(!line || !line.length) + line = lines.pop(); + + // put the non-empty line back + if (line) lines.push(line); +} + +function addLinenos (highlightedCode, firstline) { + var highlightedLines = highlightedCode.split('\n'); + + trimEmptyLines(highlightedLines); + + var linesLen = highlightedLines.length + , lines = [] + , totalDigits + , lineno + ; + + function getDigits (n) { + if (n < 10) return 1; + if (n < 100) return 2; + if (n < 1000) return 3; + if (n < 10000) return 4; + // this works for up to 99,999 lines - any questions? + return 5; + } + + function pad (n, totalDigits) { + // not pretty, but simple and should perform quite well + var padDigits= totalDigits - getDigits(n); + switch(padDigits) { + case 0: return '' + n; + case 1: return ' ' + n; + case 2: return ' ' + n; + case 3: return ' ' + n; + case 4: return ' ' + n; + case 5: return ' ' + n; + } + } + + totalDigits = getDigits(linesLen + firstline - 1); + + for (var i = 0; i < linesLen; i++) { + // Don't close the escape sequence here in order to not break multi line code highlights like block comments + lineno = colorSurround(pad(i + firstline, totalDigits) + ': ').replace(surroundClose, ''); + lines.push(lineno + highlightedLines[i]); + } + + return lines.join('\n'); +} + +module.exports = function highlight (code, opts) { + opts = opts || { }; + if (opts.json) { + code = '!\n' + code; + } + try { + + var result = redeyed(code, opts.theme || theme) + , firstline = opts.firstline && !isNaN(opts.firstline) ? opts.firstline : 1; + + if (opts.json) { + result.code = result.code.split('\n').slice(1).join('\n'); + } + + return opts.linenos ? addLinenos(result.code, firstline) : result.code; + } catch (e) { + e.message = 'Unable to perform highlight. The code contained syntax errors: ' + e.message; + throw e; + } +}; diff --git a/node_modules/mysql2/node_modules/cardinal/lib/highlightFile.js b/node_modules/mysql2/node_modules/cardinal/lib/highlightFile.js new file mode 100644 index 0000000..bb3271d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/lib/highlightFile.js @@ -0,0 +1,26 @@ +var fs = require('fs') + , highlight = require('./highlight'); + +function isFunction (obj) { + return toString.call(obj) == '[object Function]'; +} + +module.exports = function highlightFile (fullPath, opts, cb) { + if (isFunction(opts)) { + cb = opts; + opts = { }; + } + opts = opts || { }; + if (opts.json !== false && fullPath.match(/\.json$/i)) { + opts.json = true; + } + + fs.readFile(fullPath, 'utf-8', function (err, code) { + if (err) return cb(err); + try { + cb(null, highlight(code, opts)); + } catch (e) { + cb(e); + } + }); +}; diff --git a/node_modules/mysql2/node_modules/cardinal/lib/highlightFileSync.js b/node_modules/mysql2/node_modules/cardinal/lib/highlightFileSync.js new file mode 100644 index 0000000..bc33dd4 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/lib/highlightFileSync.js @@ -0,0 +1,11 @@ +var fs = require('fs') + , highlight = require('./highlight'); + +module.exports = function highlightFileSync (fullPath, opts) { + var code = fs.readFileSync(fullPath, 'utf-8'); + opts = opts || { }; + if (opts.json !== false && fullPath.match(/\.json$/i)) { + opts.json = true; + } + return highlight(code, opts); +}; diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.npmignore b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.npmignore new file mode 100644 index 0000000..a72b52e --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.npmignore @@ -0,0 +1,15 @@ +lib-cov +*.seed +*.log +*.csv +*.dat +*.out +*.pid +*.gz + +pids +logs +results + +npm-debug.log +node_modules diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.travis.yml b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.travis.yml new file mode 100644 index 0000000..895dbd3 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.6 + - 0.8 diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/LICENSE b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/LICENSE new file mode 100644 index 0000000..41702c5 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/LICENSE @@ -0,0 +1,23 @@ +Copyright 2013 Thorsten Lorenz. +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/README.md b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/README.md new file mode 100644 index 0000000..30b6a52 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/README.md @@ -0,0 +1,42 @@ +# ansicolors [![build status](https://secure.travis-ci.org/thlorenz/ansicolors.png)](http://next.travis-ci.org/thlorenz/ansicolors) + +Functions that surround a string with ansicolor codes so it prints in color. + +## Installation + + npm install ansicolors + +## Usage + +```js +var colors = require('ansicolors'); + +// foreground colors +var redHerring = colors.red('herring'); +var blueMoon = colors.blue('moon'); +var brighBlueMoon = colors.brightBlue('moon'); + +console.log(redHerring); // this will print 'herring' in red +console.log(blueMoon); // this 'moon' in blue +console.log(brightBlueMoon); // I think you got the idea + +// background colors +console.log(colors.bgYellow('printed on yellow background')); +console.log(colors.bgBrightBlue('printed on bright blue background')); + +// mixing background and foreground colors +// below two lines have same result (order in which bg and fg are combined doesn't matter) +console.log(colors.bgYellow(colors.blue('printed on yellow background in blue'))); +console.log(colors.blue(colors.bgYellow('printed on yellow background in blue'))); +``` + +## Tests + +Look at the [tests](https://github.com/thlorenz/ansicolors/blob/master/test/ansicolors.js) to see more examples and/or run them via: + + npm explore ansicolors && npm test + +## Alternatives + +**ansicolors** tries to meet simple use cases with a very simple API. However, if you need a more powerful ansi formatting tool, +I'd suggest to look at the [features](https://github.com/TooTallNate/ansi.js#features) of the [ansi module](https://github.com/TooTallNate/ansi.js). diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/ansicolors.js b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/ansicolors.js new file mode 100644 index 0000000..b0e18f6 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/ansicolors.js @@ -0,0 +1,55 @@ +// ColorCodes explained: http://www.termsys.demon.co.uk/vtansi.htm +'use strict'; + +var colorNums = { + white : 37 + , black : 30 + , blue : 34 + , cyan : 36 + , green : 32 + , magenta : 35 + , red : 31 + , yellow : 33 + , brightBlack : 90 + , brightRed : 91 + , brightGreen : 92 + , brightYellow : 93 + , brightBlue : 94 + , brightMagenta : 95 + , brightCyan : 96 + , brightWhite : 97 + } + , backgroundColorNums = { + bgBlack : 40 + , bgRed : 41 + , bgGreen : 42 + , bgYellow : 43 + , bgBlue : 44 + , bgMagenta : 45 + , bgCyan : 46 + , bgWhite : 47 + , bgBrightBlack : 100 + , bgBrightRed : 101 + , bgBrightGreen : 102 + , bgBrightYellow : 103 + , bgBrightBlue : 104 + , bgBrightMagenta : 105 + , bgBrightCyan : 106 + , bgBrightWhite : 107 + } + , colors = {}; + + +Object.keys(colorNums).forEach(function (k) { + colors[k] = function (s) { + return '\u001b[' + colorNums[k] + 'm' + s + '\u001b[39m'; + }; +}); + +Object.keys(backgroundColorNums).forEach(function (k) { + colors[k] = function (s) { + return '\u001b[' + backgroundColorNums[k] + 'm' + s + '\u001b[49m'; + }; +}); + +module.exports = colors; diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/package.json b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/package.json new file mode 100644 index 0000000..4188c40 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/package.json @@ -0,0 +1,34 @@ +{ + "name": "ansicolors", + "version": "0.2.1", + "description": "Functions that surround a string with ansicolor codes so it prints in color.", + "main": "ansicolors.js", + "scripts": { + "test": "node test/*.js" + }, + "repository": { + "type": "git", + "url": "git://github.com/thlorenz/ansicolors.git" + }, + "keywords": [ + "ansi", + "colors", + "highlight", + "string" + ], + "author": { + "name": "Thorsten Lorenz", + "email": "thlorenz@gmx.de", + "url": "thlorenz.com" + }, + "license": "MIT", + "readmeFilename": "README.md", + "gitHead": "858847ca28e8b360d9b70eee0592700fa2ab087d", + "readme": "# ansicolors [![build status](https://secure.travis-ci.org/thlorenz/ansicolors.png)](http://next.travis-ci.org/thlorenz/ansicolors)\n\nFunctions that surround a string with ansicolor codes so it prints in color.\n\n## Installation\n\n npm install ansicolors\n\n## Usage\n\n```js\nvar colors = require('ansicolors');\n\n// foreground colors\nvar redHerring = colors.red('herring');\nvar blueMoon = colors.blue('moon');\nvar brighBlueMoon = colors.brightBlue('moon');\n\nconsole.log(redHerring); // this will print 'herring' in red\nconsole.log(blueMoon); // this 'moon' in blue\nconsole.log(brightBlueMoon); // I think you got the idea\n\n// background colors\nconsole.log(colors.bgYellow('printed on yellow background'));\nconsole.log(colors.bgBrightBlue('printed on bright blue background'));\n\n// mixing background and foreground colors\n// below two lines have same result (order in which bg and fg are combined doesn't matter)\nconsole.log(colors.bgYellow(colors.blue('printed on yellow background in blue')));\nconsole.log(colors.blue(colors.bgYellow('printed on yellow background in blue')));\n```\n\n## Tests\n\nLook at the [tests](https://github.com/thlorenz/ansicolors/blob/master/test/ansicolors.js) to see more examples and/or run them via: \n\n npm explore ansicolors && npm test\n\n## Alternatives\n\n**ansicolors** tries to meet simple use cases with a very simple API. However, if you need a more powerful ansi formatting tool, \nI'd suggest to look at the [features](https://github.com/TooTallNate/ansi.js#features) of the [ansi module](https://github.com/TooTallNate/ansi.js).\n", + "bugs": { + "url": "https://github.com/thlorenz/ansicolors/issues" + }, + "homepage": "https://github.com/thlorenz/ansicolors", + "_id": "ansicolors@0.2.1", + "_from": "ansicolors@>=0.2.1 <0.3.0" +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/test/ansicolors.js b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/test/ansicolors.js new file mode 100644 index 0000000..46aec3e --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/ansicolors/test/ansicolors.js @@ -0,0 +1,55 @@ +'use strict'; + +var assert = require('assert') + , colors = require('..'); + +console.log('Foreground colors ..'); + +assert.equal(colors.white('printed in white'), '\u001b[37mprinted in white\u001b[39m'); + +assert.equal(colors.black('printed in black'), '\u001b[30mprinted in black\u001b[39m'); +assert.equal(colors.brightBlack('printed in bright black'), '\u001b[90mprinted in bright black\u001b[39m'); + +assert.equal(colors.green('printed in green'), '\u001b[32mprinted in green\u001b[39m'); +assert.equal(colors.brightGreen('printed in bright green'), '\u001b[92mprinted in bright green\u001b[39m'); + +assert.equal(colors.red('printed in red'), '\u001b[31mprinted in red\u001b[39m'); +assert.equal(colors.brightRed('printed in bright red'), '\u001b[91mprinted in bright red\u001b[39m'); + +console.log('OK'); + +console.log('Background colors ..'); + +assert.equal( + colors.bgBlack('printed with black background') + , '\u001b[40mprinted with black background\u001b[49m' +); + +assert.equal( + colors.bgYellow('printed with yellow background') + , '\u001b[43mprinted with yellow background\u001b[49m' +); +assert.equal( + colors.bgBrightYellow('printed with bright yellow background') + , '\u001b[103mprinted with bright yellow background\u001b[49m' +); + +assert.equal( + colors.bgWhite('printed with white background') + , '\u001b[47mprinted with white background\u001b[49m' +); + +console.log('OK'); + +console.log('Mixing background and foreground colors ..'); + +assert.equal( + colors.blue(colors.bgYellow('printed in blue with yellow background')) + , '\u001b[34m\u001b[43mprinted in blue with yellow background\u001b[49m\u001b[39m' +); +assert.equal( + colors.bgYellow(colors.blue('printed in blue with yellow background again')) + , '\u001b[43m\u001b[34mprinted in blue with yellow background again\u001b[39m\u001b[49m' +); + +console.log('OK'); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.npmignore b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.npmignore new file mode 100644 index 0000000..7dccd97 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.npmignore @@ -0,0 +1,15 @@ +lib-cov +*.seed +*.log +*.csv +*.dat +*.out +*.pid +*.gz + +pids +logs +results + +node_modules +npm-debug.log \ No newline at end of file diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.travis.yml b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.travis.yml new file mode 100644 index 0000000..84fd7ca --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/.travis.yml @@ -0,0 +1,5 @@ +language: node_js +node_js: + - 0.6 + - 0.8 + - 0.9 diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/Changelog.md b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/Changelog.md new file mode 100644 index 0000000..ab1f7bb --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/Changelog.md @@ -0,0 +1,15 @@ +# Changelog + +### 0.4 +- browser support + +### 0.3 +- passing more information into {Function} config +- API change: returning {Object} with code, ast, comments and tokens attached instead of just a code {String} +- comments support + +### 0.2 +- upgrade to Esprima 1.0.0 + +### 0.1 +- first working version diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/LICENSE b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/LICENSE new file mode 100644 index 0000000..19c037f --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/LICENSE @@ -0,0 +1,23 @@ +Copyright 2012 Thorsten Lorenz. +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/README.md b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/README.md new file mode 100644 index 0000000..81b8a53 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/README.md @@ -0,0 +1,192 @@ +# redeyed [![build status](https://secure.travis-ci.org/thlorenz/redeyed.png?branch=master)](http://travis-ci.org/thlorenz/redeyed) + +*Add color to your JavaScript!* + +![frog](http://allaboutfrogs.org/gallery/photos/redeyes/red1.gif) + +[Red Eyed Tree Frog](http://allaboutfrogs.org/info/species/redeye.html) *(Agalychnis callidryas)* + +## What? + +Takes JavaScript code, along with a config and returns the original code with tokens wrapped and/or replaced as configured. + +## Where? + +- server side using nodejs +- in the [browser](#browser-support) + +## What for? + +One usecase is adding metadata to your code that can then be used to apply syntax highlighting. + +## How? + +- copy the [config.js](https://github.com/thlorenz/redeyed/blob/master/config.js) and edit it in order to specify how + certain tokens are to be surrounded/replaced +- replace the `undefined` of each token you want to configure with one of the following + +### {String} config + +`'before:after'` + +wraps the token inside before/after + +### {Object} config + +`{ _before: 'before', _after: 'after' }` + +wraps token inside before/after + +#### Missing before and after resolution for {String} and {Object} config + +For the `{String}` and `{Object}` configurations, 'before' or 'after' may be omitted: + +- `{String}`: + - `'before:'` (omitting 'after') + - `':after'` (omitting 'before') +- `{Object}`: + - `{ _before: 'before' }` (omitting '_after') + - `{ _after: 'after' }` (omitting '_before') + +In these cases the missing half is resolved as follows: + +- from the `parent._default` (i.e., `Keyword._default`) if found +- otherwise from the `config._default` if found +- otherwise `''` (empty string) + +### {Function} config + +`function (tokenString, info) { return {String}|{Object}; }` + +#### Inputs + +- tokenString: the content of the token that is currently being processed +- info: an object with the following structure + +```js +{ + // {Int} + // the index of the token being processed inside tokens + tokenIndex + + // {Array} + // all tokens that are being processed including comments + // (i.e. the result of merging esprima tokens and comments) + , tokens + + // {Object} + // the abstract syntax tree of the parsed code + , ast + + // {String} + // the code that was parsed (same string as the one passed to redeyed(code ..) + , code +} +``` + +In most cases the `tokenString` is all you need. The extra info object is passed in case you need to gather more +information about the `token`'s surroundings in order to decide how to transform it. +See: [replace-log-example](https://github.com/thlorenz/redeyed/blob/master/examples/replace-log.js) + +#### Output + +You can return a {String} or an {Object} from a {Function} config. + +- when returning a {String}, the token value will be replaced with it +- when returning an {Object}, it should be of the following form: + +```js +{ + // {String} + // the string that should be substituted for the value of the current and all skipped tokens + replacement + + // {Object} (Token) + // the token after which processing should continue + // all tokens in between the current one and this one inclusive will be ignored + , skipPastToken +} +``` + +### Transforming JavaScript code + +***redeyed(code, config[, opts])*** + +Invoke redeyed with your **config**uration, a **code** snippet and maybe **opts** as in the below example: + +```javascript +var redeyed = require('redeyed') + , config = require('./path/to/config') + , code = 'var a = 3;' + , result; + +// redeyed will throw an error (caused by the esprima parser) if the code has invalid javascript +try { + result = redeyed(code, config); + console.log(result.code); +} catch(err) { + console.error(err); +} +``` + +***opts***: +```js +{ // {Boolean} + // if true `result.code` is not assigned and therefore `undefined` + // if false (default) `result.code` property contains the result of `split.join` + nojoin: true|false +} +``` + +***return value***: + +```js +{ ast + , tokens + , comments + , splits + , code +} +``` + +- ast `{Array}`: [abstract syntax tree](http://en.wikipedia.org/wiki/Abstract_syntax_tree) as returned by [esprima + parse](http://en.wikipedia.org/wiki/Abstract_syntax_tree) +- tokens `{Array}`: [tokens](http://en.wikipedia.org/wiki/Token_(parser)) provided by esprima (excluding + comments) +- comments `{Array}`: block and line comments as provided by esprima +- splits `{Array}`: code pieces split up, some of which where transformed as configured +- code `{String}`: transformed code, same as `splits.join('')` unless this step has been skipped (see opts) + +## Browser Support + +### AMD + +Ensure to include [esprima](https://github.com/ariya/esprima) as one of your dependencies + +```js +define(['redeyed'], function (redeyed) { + [ .. ] +}); +``` + +### Attached to global window object + +The `redeyed {Function}` will be exposed globally as `window.redeyed` - big surprise! + +```html + + +``` + +## redeyed in the wild + +- [cardinal](https://github.com/thlorenz/cardinal): Syntax highlights JavaScript code with ANSI colors to be printed to + the terminal +- [peacock](http://thlorenz.github.com/peacock/): JavaScript syntax highlighter that generates html that is compatible + with pygments styles. + +## Examples + +- `npm explore redeyed; npm demo` will let you try the [browser example](https://github.com/thlorenz/redeyed/tree/master/examples/browser) +- `npm explore redeyed; npm demo-log` will let you try the [replace log example](https://github.com/thlorenz/redeyed/blob/master/examples/replace-log.js) + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/config.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/config.js new file mode 100644 index 0000000..ade0de8 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/config.js @@ -0,0 +1,137 @@ +/* + * Copy this file and use it as a starting point for your redeyed config. + * Just fill in the tokens you want to surround/replace. + * Keep in mind that more specific configurations override less specific ones. + */ + +module.exports = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : undefined + } + + , 'Identifier': { + _default: undefined + } + + , 'Null': { + _default: undefined + } + + , 'Numeric': { + _default: undefined + } + + , 'String': { + _default: undefined + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : undefined + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : undefined + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : undefined + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : undefined + , 'return' : undefined + , 'switch' : undefined + + , 'this' : undefined + , 'throw' : undefined + , 'try' : undefined + , 'typeof' : undefined + + , 'var' : undefined + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : undefined + } + , 'Punctuator': { + ';': undefined + , '.': undefined + , ',': undefined + + , '{': undefined + , '}': undefined + , '(': undefined + , ')': undefined + , '[': undefined + , ']': undefined + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: undefined + } + + // line comment + , Line: { + _default: undefined + } + + /* block comment */ + , Block: { + _default: undefined + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.css b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.css new file mode 100644 index 0000000..fc9206e --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.css @@ -0,0 +1,31 @@ +.code { + width: 500px; + height: 500px; + display: block; +} + +.config { + width: 500px; + height: 400px; + display: block; +} + +.go { + display: block; + float: right; + font-size: 18px; +} + +.result { + width: 500px; + height: 1000px; + display: block; +} + +.edit { + float: left; +} + +.results { + float: left; +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.html b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.html new file mode 100644 index 0000000..a20ea4c --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.html @@ -0,0 +1,35 @@ + + + + + + + + +
+ Change the config and/or the original code in order to affect the "redeyed" result +
+
+
+

Redeyed Config

+ + +
+
+

Original Code

+ +
+
+
+

Result

+ +
+ + + + + + + + + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.js new file mode 100644 index 0000000..82fd22f --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/index.js @@ -0,0 +1,33 @@ +var $code = $('.code') + , $config = $('.config') + , $result = $('.result') + ; + +function go () { + var config; + try { + config = JSON.parse($config.val()); + } catch (e) { + $result.val('In "Redeyed Config": ' + e.toString()); + return; + } + + try { + var code = $code.val() + , result = redeyed(code, config); + + $result.val(result.code); + } catch (e) { + $result.val('In "Original Code": ' + e.toString()); + } +} + +$code.val(window.redeyed.toString()); + +$config.val(JSON.stringify(window.sampleConfig, false, 2)); + +$('.go').click(go); + +go(); + + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/sample-config.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/sample-config.js new file mode 100644 index 0000000..47456ef --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/browser/sample-config.js @@ -0,0 +1,131 @@ +window.sampleConfig = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : '?:?' + } + + , 'Identifier': { + _default: '-> : <-' + } + + , 'Null': { + _default: '**:**' + } + + , 'Numeric': { + _default: 'n:N' + } + + , 'String': { + _default: 'string -> :' + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : undefined + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : undefined + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : undefined + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : undefined + , 'return' : undefined + , 'switch' : undefined + + , 'this' : undefined + , 'throw' : undefined + , 'try' : undefined + , 'typeof' : undefined + + , 'var' : undefined + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : ': <- keyword' + } + , 'Punctuator': { + ';': undefined + , '.': undefined + , ',': undefined + + , '{': undefined + , '}': undefined + , '(': undefined + , ')': undefined + , '[': undefined + , ']': undefined + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: undefined + } + + // line comment + , Line: { + _default: undefined + } + + /* block comment */ + , Block: { + _default: undefined + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/replace-log.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/replace-log.js new file mode 100644 index 0000000..4b12ccf --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/replace-log.js @@ -0,0 +1,61 @@ +var path = require('path') + , fs = require('fs') + , redeyed = require('..') + , vm = require('vm') + ; + +var samplePath = path.join(__dirname, 'sources', 'log.js') + , origCode = fs.readFileSync(samplePath, 'utf-8') + , kinds = ['silly', 'info', 'warn', 'error' ] + ; + +function replaceConsole(s, info) { + var code = info.code + , idx = info.tokenIndex + , tokens = info.tokens + , next = tokens[idx + 1].value + , kind = tokens[idx + 2].value + , openParen = tokens[idx + 3].value + , firstArgTkn = tokens[idx + 4] + , argIdx = idx + 3 + , open + , tkn + ; + + if (kind === 'log') kind = 'silly'; + + // not a console.xxx(...) statement? -> just return original + if (next !== '.' || !~kinds.indexOf(kind) || openParen !== '(') return s; + + // skip past arguments to console.xxx all args from ( to ) + open = 1; + while (open) { + tkn = tokens[++argIdx]; + + // count open parens vs. closed ones to handle things like console.log(new Error('..')); + if (tkn.value === '(') open++; + if (tkn.value === ')') open--; + } + + // tkn now is the last closing paren + var argsIncludingClosingParen = code.slice(firstArgTkn.range[0], tkn.range[1]) + , result = 'log.' + kind + '("main-logger", ' + argsIncludingClosingParen; + + // tell redeyed to skip the entire console.xxx(..) statement since we are replacing it all + return { replacement: result, skipPastToken: tkn }; +} + +function transformAndRun () { + var config = { + Identifier: { console: replaceConsole } + } + , code = redeyed(origCode, config).code + , context = vm.createContext({ require: require }); + + console.log('Original code:\n', origCode); + console.log('\nlog calls replaced:\n', code); + console.log('\nLets run it:'); + vm.runInContext(code, context, 'transformed-log.vm'); +} + +transformAndRun(); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/sources/log.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/sources/log.js new file mode 100644 index 0000000..7994d2f --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/examples/sources/log.js @@ -0,0 +1,8 @@ +// First two lines will be needed when we replaced all console.xxx statements with log.xxx +var log = require('npmlog'); +log.level = 'silly'; + +console.info('info ', 1); +console.log('log ', 2); +console.warn('warn ', 3); +console.error('error ', new Error('oh my!')); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esparse b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esparse new file mode 120000 index 0000000..7423b18 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esparse @@ -0,0 +1 @@ +../esprima/bin/esparse.js \ No newline at end of file diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esvalidate b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esvalidate new file mode 120000 index 0000000..16069ef --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/.bin/esvalidate @@ -0,0 +1 @@ +../esprima/bin/esvalidate.js \ No newline at end of file diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/README.md b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/README.md new file mode 100644 index 0000000..a74bd12 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/README.md @@ -0,0 +1,73 @@ +**Esprima** ([esprima.org](http://esprima.org)) is a high performance, +standard-compliant [ECMAScript](http://www.ecma-international.org/publications/standards/Ecma-262.htm) +parser written in ECMAScript (also popularly known as +[JavaScript](http://en.wikipedia.org/wiki/JavaScript>JavaScript)). +Esprima is created and maintained by [Ariya Hidayat](http://twitter.com/ariyahidayat), +with the help of [many contributors](https://github.com/ariya/esprima/contributors). + +Esprima runs on web browsers (IE 6+, Firefox 1+, Safari 3+, Chrome 1+, Konqueror 4.6+, Opera 8+) as well as +[Node.js](http://nodejs.org). + +### Features + +- Full support for [ECMAScript 5.1](http://www.ecma-international.org/publications/standards/Ecma-262.htm)(ECMA-262) +- Sensible [syntax tree format](http://esprima.org/doc/index.html#ast) compatible with Mozilla +[Parser AST](https://developer.mozilla.org/en/SpiderMonkey/Parser_API) +- Heavily tested (> 550 [unit tests](http://esprima.org/test/) with solid 100% statement coverage) +- Optional tracking of syntax node location (index-based and line-column) +- Experimental support for ES6/Harmony (module, class, destructuring, ...) + +Esprima is blazing fast (see the [benchmark suite](http://esprima.org/test/benchmarks.html)). +It is up to 3x faster than UglifyJS v1 and it is still [competitive](http://esprima.org/test/compare.html) +with the new generation of fast parsers. + +### Applications + +Esprima serves as the basis for many popular JavaScript development tools: + +- Code coverage analysis: [node-cover](https://github.com/itay/node-cover), [Istanbul](https://github.com/yahoo/Istanbul) +- Documentation tool: [JFDoc](https://github.com/thejohnfreeman/jfdoc), [JSDuck](https://github.com/senchalabs/jsduck) +- Language extension: [LLJS](http://mbebenita.github.com/LLJS/) (low-level JS), +[Sweet.js](http://sweetjs.org/) (macro) +- ES6/Harmony transpiler: [Six](https://github.com/matthewrobb/six), [Harmonizr](https://github.com/jdiamond/harmonizr) +- Eclipse Orion smart editing ([outline view](https://github.com/aclement/esprima-outline), [content assist](http://contraptionsforprogramming.blogspot.com/2012/02/better-javascript-content-assist-in.html)) +- Source code modification: [Esmorph](https://github.com/ariya/esmorph), [Code Painter](https://github.com/fawek/codepainter), +- Source transformation: [node-falafel](https://github.com/substack/node-falafel), [Esmangle](https://github.com/Constellation/esmangle), [escodegen](https://github.com/Constellation/escodegen) + +### Questions? +- [Documentation](http://esprima.org/doc) +- [Issue tracker](http://issues.esprima.org): [known problems](http://code.google.com/p/esprima/issues/list?q=Defect) +and [future plans](http://code.google.com/p/esprima/issues/list?q=Enhancement) +- [Mailing list](http://groups.google.com/group/esprima) +- [Contribution guide](http://esprima.org/doc/index.html#contribution) + +Follow [@Esprima](http://twitter.com/Esprima) on Twitter to get the +development updates. +Feedback and contribution are welcomed! + +### License + +Copyright (C) 2012, 2011 [Ariya Hidayat](http://ariya.ofilabs.com/about) + and other contributors. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esparse.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esparse.js new file mode 100755 index 0000000..3e7bb81 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esparse.js @@ -0,0 +1,117 @@ +#!/usr/bin/env node +/* + Copyright (C) 2012 Ariya Hidayat + Copyright (C) 2011 Ariya Hidayat + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint sloppy:true node:true rhino:true */ + +var fs, esprima, fname, content, options, syntax; + +if (typeof require === 'function') { + fs = require('fs'); + esprima = require('esprima'); +} else if (typeof load === 'function') { + try { + load('esprima.js'); + } catch (e) { + load('../esprima.js'); + } +} + +// Shims to Node.js objects when running under Rhino. +if (typeof console === 'undefined' && typeof process === 'undefined') { + console = { log: print }; + fs = { readFileSync: readFile }; + process = { argv: arguments, exit: quit }; + process.argv.unshift('esparse.js'); + process.argv.unshift('rhino'); +} + +function showUsage() { + console.log('Usage:'); + console.log(' esparse [options] file.js'); + console.log(); + console.log('Available options:'); + console.log(); + console.log(' --comment Gather all line and block comments in an array'); + console.log(' --loc Include line-column location info for each syntax node'); + console.log(' --range Include index-based range for each syntax node'); + console.log(' --raw Display the raw value of literals'); + console.log(' --tokens List all tokens in an array'); + console.log(' --tolerant Tolerate errors on a best-effort basis (experimental)'); + console.log(' -v, --version Shows program version'); + console.log(); + process.exit(1); +} + +if (process.argv.length <= 2) { + showUsage(); +} + +options = {}; + +process.argv.splice(2).forEach(function (entry) { + + if (entry === '-h' || entry === '--help') { + showUsage(); + } else if (entry === '-v' || entry === '--version') { + console.log('ECMAScript Parser (using Esprima version', esprima.version, ')'); + console.log(); + process.exit(0); + } else if (entry === '--comment') { + options.comment = true; + } else if (entry === '--loc') { + options.loc = true; + } else if (entry === '--range') { + options.range = true; + } else if (entry === '--raw') { + options.raw = true; + } else if (entry === '--tokens') { + options.tokens = true; + } else if (entry === '--tolerant') { + options.tolerant = true; + } else if (entry.slice(0, 2) === '--') { + console.log('Error: unknown option ' + entry + '.'); + process.exit(1); + } else if (typeof fname === 'string') { + console.log('Error: more than one input file.'); + process.exit(1); + } else { + fname = entry; + } +}); + +if (typeof fname !== 'string') { + console.log('Error: no input file.'); + process.exit(1); +} + +try { + content = fs.readFileSync(fname, 'utf-8'); + syntax = esprima.parse(content, options); + console.log(JSON.stringify(syntax, null, 4)); +} catch (e) { + console.log('Error: ' + e.message); + process.exit(1); +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esvalidate.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esvalidate.js new file mode 100755 index 0000000..e0af3f7 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/bin/esvalidate.js @@ -0,0 +1,177 @@ +#!/usr/bin/env node +/* + Copyright (C) 2012 Ariya Hidayat + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint sloppy:true plusplus:true node:true rhino:true */ + +var fs, esprima, options, fnames, count; + +if (typeof require === 'function') { + fs = require('fs'); + esprima = require('esprima'); +} else if (typeof load === 'function') { + try { + load('esprima.js'); + } catch (e) { + load('../esprima.js'); + } +} + +// Shims to Node.js objects when running under Rhino. +if (typeof console === 'undefined' && typeof process === 'undefined') { + console = { log: print }; + fs = { readFileSync: readFile }; + process = { argv: arguments, exit: quit }; + process.argv.unshift('esvalidate.js'); + process.argv.unshift('rhino'); +} + +function showUsage() { + console.log('Usage:'); + console.log(' esvalidate [options] file.js'); + console.log(); + console.log('Available options:'); + console.log(); + console.log(' --format=type Set the report format, plain (default) or junit'); + console.log(' -v, --version Print program version'); + console.log(); + process.exit(1); +} + +if (process.argv.length <= 2) { + showUsage(); +} + +options = { + format: 'plain' +}; + +fnames = []; + +process.argv.splice(2).forEach(function (entry) { + + if (entry === '-h' || entry === '--help') { + showUsage(); + } else if (entry === '-v' || entry === '--version') { + console.log('ECMAScript Validator (using Esprima version', esprima.version, ')'); + console.log(); + process.exit(0); + } else if (entry.slice(0, 9) === '--format=') { + options.format = entry.slice(9); + if (options.format !== 'plain' && options.format !== 'junit') { + console.log('Error: unknown report format ' + options.format + '.'); + process.exit(1); + } + } else if (entry.slice(0, 2) === '--') { + console.log('Error: unknown option ' + entry + '.'); + process.exit(1); + } else { + fnames.push(entry); + } +}); + +if (fnames.length === 0) { + console.log('Error: no input file.'); + process.exit(1); +} + +if (options.format === 'junit') { + console.log(''); + console.log(''); +} + +count = 0; +fnames.forEach(function (fname) { + var content, timestamp, syntax, name; + try { + content = fs.readFileSync(fname, 'utf-8'); + + if (content[0] === '#' && content[1] === '!') { + content = '//' + content.substr(2, content.length); + } + + timestamp = Date.now(); + syntax = esprima.parse(content, { tolerant: true }); + + if (options.format === 'junit') { + + name = fname; + if (name.lastIndexOf('/') >= 0) { + name = name.slice(name.lastIndexOf('/') + 1); + } + + console.log(''); + + syntax.errors.forEach(function (error) { + var msg = error.message; + msg = msg.replace(/^Line\ [0-9]*\:\ /, ''); + console.log(' '); + console.log(' ' + + error.message + '(' + name + ':' + error.lineNumber + ')' + + ''); + console.log(' '); + }); + + console.log(''); + + } else if (options.format === 'plain') { + + syntax.errors.forEach(function (error) { + var msg = error.message; + msg = msg.replace(/^Line\ [0-9]*\:\ /, ''); + msg = fname + ':' + error.lineNumber + ': ' + msg; + console.log(msg); + ++count; + }); + + } + } catch (e) { + ++count; + if (options.format === 'junit') { + console.log(''); + console.log(' '); + console.log(' ' + + e.message + '(' + fname + ((e.lineNumber) ? ':' + e.lineNumber : '') + + ')'); + console.log(' '); + console.log(''); + } else { + console.log('Error: ' + e.message); + } + } +}); + +if (options.format === 'junit') { + console.log(''); +} + +if (count > 0) { + process.exit(1); +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/esprima.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/esprima.js new file mode 100644 index 0000000..f1320da --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/esprima.js @@ -0,0 +1,3908 @@ +/* + Copyright (C) 2012 Ariya Hidayat + Copyright (C) 2012 Mathias Bynens + Copyright (C) 2012 Joost-Wim Boekesteijn + Copyright (C) 2012 Kris Kowal + Copyright (C) 2012 Yusuke Suzuki + Copyright (C) 2012 Arpad Borsos + Copyright (C) 2011 Ariya Hidayat + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint bitwise:true plusplus:true */ +/*global esprima:true, define:true, exports:true, window: true, +throwError: true, createLiteral: true, generateStatement: true, +parseAssignmentExpression: true, parseBlock: true, parseExpression: true, +parseFunctionDeclaration: true, parseFunctionExpression: true, +parseFunctionSourceElements: true, parseVariableIdentifier: true, +parseLeftHandSideExpression: true, +parseStatement: true, parseSourceElement: true */ + +(function (root, factory) { + 'use strict'; + + // Universal Module Definition (UMD) to support AMD, CommonJS/Node.js, + // Rhino, and plain browser loading. + if (typeof define === 'function' && define.amd) { + define(['exports'], factory); + } else if (typeof exports !== 'undefined') { + factory(exports); + } else { + factory((root.esprima = {})); + } +}(this, function (exports) { + 'use strict'; + + var Token, + TokenName, + Syntax, + PropertyKind, + Messages, + Regex, + source, + strict, + index, + lineNumber, + lineStart, + length, + buffer, + state, + extra; + + Token = { + BooleanLiteral: 1, + EOF: 2, + Identifier: 3, + Keyword: 4, + NullLiteral: 5, + NumericLiteral: 6, + Punctuator: 7, + StringLiteral: 8 + }; + + TokenName = {}; + TokenName[Token.BooleanLiteral] = 'Boolean'; + TokenName[Token.EOF] = ''; + TokenName[Token.Identifier] = 'Identifier'; + TokenName[Token.Keyword] = 'Keyword'; + TokenName[Token.NullLiteral] = 'Null'; + TokenName[Token.NumericLiteral] = 'Numeric'; + TokenName[Token.Punctuator] = 'Punctuator'; + TokenName[Token.StringLiteral] = 'String'; + + Syntax = { + AssignmentExpression: 'AssignmentExpression', + ArrayExpression: 'ArrayExpression', + BlockStatement: 'BlockStatement', + BinaryExpression: 'BinaryExpression', + BreakStatement: 'BreakStatement', + CallExpression: 'CallExpression', + CatchClause: 'CatchClause', + ConditionalExpression: 'ConditionalExpression', + ContinueStatement: 'ContinueStatement', + DoWhileStatement: 'DoWhileStatement', + DebuggerStatement: 'DebuggerStatement', + EmptyStatement: 'EmptyStatement', + ExpressionStatement: 'ExpressionStatement', + ForStatement: 'ForStatement', + ForInStatement: 'ForInStatement', + FunctionDeclaration: 'FunctionDeclaration', + FunctionExpression: 'FunctionExpression', + Identifier: 'Identifier', + IfStatement: 'IfStatement', + Literal: 'Literal', + LabeledStatement: 'LabeledStatement', + LogicalExpression: 'LogicalExpression', + MemberExpression: 'MemberExpression', + NewExpression: 'NewExpression', + ObjectExpression: 'ObjectExpression', + Program: 'Program', + Property: 'Property', + ReturnStatement: 'ReturnStatement', + SequenceExpression: 'SequenceExpression', + SwitchStatement: 'SwitchStatement', + SwitchCase: 'SwitchCase', + ThisExpression: 'ThisExpression', + ThrowStatement: 'ThrowStatement', + TryStatement: 'TryStatement', + UnaryExpression: 'UnaryExpression', + UpdateExpression: 'UpdateExpression', + VariableDeclaration: 'VariableDeclaration', + VariableDeclarator: 'VariableDeclarator', + WhileStatement: 'WhileStatement', + WithStatement: 'WithStatement' + }; + + PropertyKind = { + Data: 1, + Get: 2, + Set: 4 + }; + + // Error messages should be identical to V8. + Messages = { + UnexpectedToken: 'Unexpected token %0', + UnexpectedNumber: 'Unexpected number', + UnexpectedString: 'Unexpected string', + UnexpectedIdentifier: 'Unexpected identifier', + UnexpectedReserved: 'Unexpected reserved word', + UnexpectedEOS: 'Unexpected end of input', + NewlineAfterThrow: 'Illegal newline after throw', + InvalidRegExp: 'Invalid regular expression', + UnterminatedRegExp: 'Invalid regular expression: missing /', + InvalidLHSInAssignment: 'Invalid left-hand side in assignment', + InvalidLHSInForIn: 'Invalid left-hand side in for-in', + MultipleDefaultsInSwitch: 'More than one default clause in switch statement', + NoCatchOrFinally: 'Missing catch or finally after try', + UnknownLabel: 'Undefined label \'%0\'', + Redeclaration: '%0 \'%1\' has already been declared', + IllegalContinue: 'Illegal continue statement', + IllegalBreak: 'Illegal break statement', + IllegalReturn: 'Illegal return statement', + StrictModeWith: 'Strict mode code may not include a with statement', + StrictCatchVariable: 'Catch variable may not be eval or arguments in strict mode', + StrictVarName: 'Variable name may not be eval or arguments in strict mode', + StrictParamName: 'Parameter name eval or arguments is not allowed in strict mode', + StrictParamDupe: 'Strict mode function may not have duplicate parameter names', + StrictFunctionName: 'Function name may not be eval or arguments in strict mode', + StrictOctalLiteral: 'Octal literals are not allowed in strict mode.', + StrictDelete: 'Delete of an unqualified identifier in strict mode.', + StrictDuplicateProperty: 'Duplicate data property in object literal not allowed in strict mode', + AccessorDataProperty: 'Object literal may not have data and accessor property with the same name', + AccessorGetSet: 'Object literal may not have multiple get/set accessors with the same name', + StrictLHSAssignment: 'Assignment to eval or arguments is not allowed in strict mode', + StrictLHSPostfix: 'Postfix increment/decrement may not have eval or arguments operand in strict mode', + StrictLHSPrefix: 'Prefix increment/decrement may not have eval or arguments operand in strict mode', + StrictReservedWord: 'Use of future reserved word in strict mode' + }; + + // See also tools/generate-unicode-regex.py. + Regex = { + NonAsciiIdentifierStart: new RegExp('[\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u05d0-\u05ea\u05f0-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u08a0\u08a2-\u08ac\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0977\u0979-\u097f\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d\u0c58\u0c59\u0c60\u0c61\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d60\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1877\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191c\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19c1-\u19c7\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2e2f\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua697\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa80-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc]'), + NonAsciiIdentifierPart: new RegExp('[\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0300-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u0483-\u0487\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u05d0-\u05ea\u05f0-\u05f2\u0610-\u061a\u0620-\u0669\u066e-\u06d3\u06d5-\u06dc\u06df-\u06e8\u06ea-\u06fc\u06ff\u0710-\u074a\u074d-\u07b1\u07c0-\u07f5\u07fa\u0800-\u082d\u0840-\u085b\u08a0\u08a2-\u08ac\u08e4-\u08fe\u0900-\u0963\u0966-\u096f\u0971-\u0977\u0979-\u097f\u0981-\u0983\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bc-\u09c4\u09c7\u09c8\u09cb-\u09ce\u09d7\u09dc\u09dd\u09df-\u09e3\u09e6-\u09f1\u0a01-\u0a03\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a59-\u0a5c\u0a5e\u0a66-\u0a75\u0a81-\u0a83\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abc-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ad0\u0ae0-\u0ae3\u0ae6-\u0aef\u0b01-\u0b03\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3c-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b56\u0b57\u0b5c\u0b5d\u0b5f-\u0b63\u0b66-\u0b6f\u0b71\u0b82\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd0\u0bd7\u0be6-\u0bef\u0c01-\u0c03\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c58\u0c59\u0c60-\u0c63\u0c66-\u0c6f\u0c82\u0c83\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbc-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0cde\u0ce0-\u0ce3\u0ce6-\u0cef\u0cf1\u0cf2\u0d02\u0d03\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d-\u0d44\u0d46-\u0d48\u0d4a-\u0d4e\u0d57\u0d60-\u0d63\u0d66-\u0d6f\u0d7a-\u0d7f\u0d82\u0d83\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0df2\u0df3\u0e01-\u0e3a\u0e40-\u0e4e\u0e50-\u0e59\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb9\u0ebb-\u0ebd\u0ec0-\u0ec4\u0ec6\u0ec8-\u0ecd\u0ed0-\u0ed9\u0edc-\u0edf\u0f00\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e-\u0f47\u0f49-\u0f6c\u0f71-\u0f84\u0f86-\u0f97\u0f99-\u0fbc\u0fc6\u1000-\u1049\u1050-\u109d\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u135d-\u135f\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1714\u1720-\u1734\u1740-\u1753\u1760-\u176c\u176e-\u1770\u1772\u1773\u1780-\u17d3\u17d7\u17dc\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u1820-\u1877\u1880-\u18aa\u18b0-\u18f5\u1900-\u191c\u1920-\u192b\u1930-\u193b\u1946-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u19d0-\u19d9\u1a00-\u1a1b\u1a20-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1aa7\u1b00-\u1b4b\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1bf3\u1c00-\u1c37\u1c40-\u1c49\u1c4d-\u1c7d\u1cd0-\u1cd2\u1cd4-\u1cf6\u1d00-\u1de6\u1dfc-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u200c\u200d\u203f\u2040\u2054\u2071\u207f\u2090-\u209c\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d7f-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2de0-\u2dff\u2e2f\u3005-\u3007\u3021-\u302f\u3031-\u3035\u3038-\u303c\u3041-\u3096\u3099\u309a\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua62b\ua640-\ua66f\ua674-\ua67d\ua67f-\ua697\ua69f-\ua6f1\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua827\ua840-\ua873\ua880-\ua8c4\ua8d0-\ua8d9\ua8e0-\ua8f7\ua8fb\ua900-\ua92d\ua930-\ua953\ua960-\ua97c\ua980-\ua9c0\ua9cf-\ua9d9\uaa00-\uaa36\uaa40-\uaa4d\uaa50-\uaa59\uaa60-\uaa76\uaa7a\uaa7b\uaa80-\uaac2\uaadb-\uaadd\uaae0-\uaaef\uaaf2-\uaaf6\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabea\uabec\uabed\uabf0-\uabf9\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe00-\ufe0f\ufe20-\ufe26\ufe33\ufe34\ufe4d-\ufe4f\ufe70-\ufe74\ufe76-\ufefc\uff10-\uff19\uff21-\uff3a\uff3f\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc]') + }; + + // Ensure the condition is true, otherwise throw an error. + // This is only to have a better contract semantic, i.e. another safety net + // to catch a logic error. The condition shall be fulfilled in normal case. + // Do NOT use this to enforce a certain condition on any user input. + + function assert(condition, message) { + if (!condition) { + throw new Error('ASSERT: ' + message); + } + } + + function sliceSource(from, to) { + return source.slice(from, to); + } + + if (typeof 'esprima'[0] === 'undefined') { + sliceSource = function sliceArraySource(from, to) { + return source.slice(from, to).join(''); + }; + } + + function isDecimalDigit(ch) { + return '0123456789'.indexOf(ch) >= 0; + } + + function isHexDigit(ch) { + return '0123456789abcdefABCDEF'.indexOf(ch) >= 0; + } + + function isOctalDigit(ch) { + return '01234567'.indexOf(ch) >= 0; + } + + + // 7.2 White Space + + function isWhiteSpace(ch) { + return (ch === ' ') || (ch === '\u0009') || (ch === '\u000B') || + (ch === '\u000C') || (ch === '\u00A0') || + (ch.charCodeAt(0) >= 0x1680 && + '\u1680\u180E\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\uFEFF'.indexOf(ch) >= 0); + } + + // 7.3 Line Terminators + + function isLineTerminator(ch) { + return (ch === '\n' || ch === '\r' || ch === '\u2028' || ch === '\u2029'); + } + + // 7.6 Identifier Names and Identifiers + + function isIdentifierStart(ch) { + return (ch === '$') || (ch === '_') || (ch === '\\') || + (ch >= 'a' && ch <= 'z') || (ch >= 'A' && ch <= 'Z') || + ((ch.charCodeAt(0) >= 0x80) && Regex.NonAsciiIdentifierStart.test(ch)); + } + + function isIdentifierPart(ch) { + return (ch === '$') || (ch === '_') || (ch === '\\') || + (ch >= 'a' && ch <= 'z') || (ch >= 'A' && ch <= 'Z') || + ((ch >= '0') && (ch <= '9')) || + ((ch.charCodeAt(0) >= 0x80) && Regex.NonAsciiIdentifierPart.test(ch)); + } + + // 7.6.1.2 Future Reserved Words + + function isFutureReservedWord(id) { + switch (id) { + + // Future reserved words. + case 'class': + case 'enum': + case 'export': + case 'extends': + case 'import': + case 'super': + return true; + } + + return false; + } + + function isStrictModeReservedWord(id) { + switch (id) { + + // Strict Mode reserved words. + case 'implements': + case 'interface': + case 'package': + case 'private': + case 'protected': + case 'public': + case 'static': + case 'yield': + case 'let': + return true; + } + + return false; + } + + function isRestrictedWord(id) { + return id === 'eval' || id === 'arguments'; + } + + // 7.6.1.1 Keywords + + function isKeyword(id) { + var keyword = false; + switch (id.length) { + case 2: + keyword = (id === 'if') || (id === 'in') || (id === 'do'); + break; + case 3: + keyword = (id === 'var') || (id === 'for') || (id === 'new') || (id === 'try'); + break; + case 4: + keyword = (id === 'this') || (id === 'else') || (id === 'case') || (id === 'void') || (id === 'with'); + break; + case 5: + keyword = (id === 'while') || (id === 'break') || (id === 'catch') || (id === 'throw'); + break; + case 6: + keyword = (id === 'return') || (id === 'typeof') || (id === 'delete') || (id === 'switch'); + break; + case 7: + keyword = (id === 'default') || (id === 'finally'); + break; + case 8: + keyword = (id === 'function') || (id === 'continue') || (id === 'debugger'); + break; + case 10: + keyword = (id === 'instanceof'); + break; + } + + if (keyword) { + return true; + } + + switch (id) { + // Future reserved words. + // 'const' is specialized as Keyword in V8. + case 'const': + return true; + + // For compatiblity to SpiderMonkey and ES.next + case 'yield': + case 'let': + return true; + } + + if (strict && isStrictModeReservedWord(id)) { + return true; + } + + return isFutureReservedWord(id); + } + + // 7.4 Comments + + function skipComment() { + var ch, blockComment, lineComment; + + blockComment = false; + lineComment = false; + + while (index < length) { + ch = source[index]; + + if (lineComment) { + ch = source[index++]; + if (isLineTerminator(ch)) { + lineComment = false; + if (ch === '\r' && source[index] === '\n') { + ++index; + } + ++lineNumber; + lineStart = index; + } + } else if (blockComment) { + if (isLineTerminator(ch)) { + if (ch === '\r' && source[index + 1] === '\n') { + ++index; + } + ++lineNumber; + ++index; + lineStart = index; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } else { + ch = source[index++]; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + if (ch === '*') { + ch = source[index]; + if (ch === '/') { + ++index; + blockComment = false; + } + } + } + } else if (ch === '/') { + ch = source[index + 1]; + if (ch === '/') { + index += 2; + lineComment = true; + } else if (ch === '*') { + index += 2; + blockComment = true; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } else { + break; + } + } else if (isWhiteSpace(ch)) { + ++index; + } else if (isLineTerminator(ch)) { + ++index; + if (ch === '\r' && source[index] === '\n') { + ++index; + } + ++lineNumber; + lineStart = index; + } else { + break; + } + } + } + + function scanHexEscape(prefix) { + var i, len, ch, code = 0; + + len = (prefix === 'u') ? 4 : 2; + for (i = 0; i < len; ++i) { + if (index < length && isHexDigit(source[index])) { + ch = source[index++]; + code = code * 16 + '0123456789abcdef'.indexOf(ch.toLowerCase()); + } else { + return ''; + } + } + return String.fromCharCode(code); + } + + function scanIdentifier() { + var ch, start, id, restore; + + ch = source[index]; + if (!isIdentifierStart(ch)) { + return; + } + + start = index; + if (ch === '\\') { + ++index; + if (source[index] !== 'u') { + return; + } + ++index; + restore = index; + ch = scanHexEscape('u'); + if (ch) { + if (ch === '\\' || !isIdentifierStart(ch)) { + return; + } + id = ch; + } else { + index = restore; + id = 'u'; + } + } else { + id = source[index++]; + } + + while (index < length) { + ch = source[index]; + if (!isIdentifierPart(ch)) { + break; + } + if (ch === '\\') { + ++index; + if (source[index] !== 'u') { + return; + } + ++index; + restore = index; + ch = scanHexEscape('u'); + if (ch) { + if (ch === '\\' || !isIdentifierPart(ch)) { + return; + } + id += ch; + } else { + index = restore; + id += 'u'; + } + } else { + id += source[index++]; + } + } + + // There is no keyword or literal with only one character. + // Thus, it must be an identifier. + if (id.length === 1) { + return { + type: Token.Identifier, + value: id, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (isKeyword(id)) { + return { + type: Token.Keyword, + value: id, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // 7.8.1 Null Literals + + if (id === 'null') { + return { + type: Token.NullLiteral, + value: id, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // 7.8.2 Boolean Literals + + if (id === 'true' || id === 'false') { + return { + type: Token.BooleanLiteral, + value: id, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + return { + type: Token.Identifier, + value: id, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // 7.7 Punctuators + + function scanPunctuator() { + var start = index, + ch1 = source[index], + ch2, + ch3, + ch4; + + // Check for most common single-character punctuators. + + if (ch1 === ';' || ch1 === '{' || ch1 === '}') { + ++index; + return { + type: Token.Punctuator, + value: ch1, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (ch1 === ',' || ch1 === '(' || ch1 === ')') { + ++index; + return { + type: Token.Punctuator, + value: ch1, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // Dot (.) can also start a floating-point number, hence the need + // to check the next character. + + ch2 = source[index + 1]; + if (ch1 === '.' && !isDecimalDigit(ch2)) { + return { + type: Token.Punctuator, + value: source[index++], + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // Peek more characters. + + ch3 = source[index + 2]; + ch4 = source[index + 3]; + + // 4-character punctuator: >>>= + + if (ch1 === '>' && ch2 === '>' && ch3 === '>') { + if (ch4 === '=') { + index += 4; + return { + type: Token.Punctuator, + value: '>>>=', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + } + + // 3-character punctuators: === !== >>> <<= >>= + + if (ch1 === '=' && ch2 === '=' && ch3 === '=') { + index += 3; + return { + type: Token.Punctuator, + value: '===', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (ch1 === '!' && ch2 === '=' && ch3 === '=') { + index += 3; + return { + type: Token.Punctuator, + value: '!==', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (ch1 === '>' && ch2 === '>' && ch3 === '>') { + index += 3; + return { + type: Token.Punctuator, + value: '>>>', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (ch1 === '<' && ch2 === '<' && ch3 === '=') { + index += 3; + return { + type: Token.Punctuator, + value: '<<=', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + if (ch1 === '>' && ch2 === '>' && ch3 === '=') { + index += 3; + return { + type: Token.Punctuator, + value: '>>=', + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // 2-character punctuators: <= >= == != ++ -- << >> && || + // += -= *= %= &= |= ^= /= + + if (ch2 === '=') { + if ('<>=!+-*%&|^/'.indexOf(ch1) >= 0) { + index += 2; + return { + type: Token.Punctuator, + value: ch1 + ch2, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + } + + if (ch1 === ch2 && ('+-<>&|'.indexOf(ch1) >= 0)) { + if ('+-<>&|'.indexOf(ch2) >= 0) { + index += 2; + return { + type: Token.Punctuator, + value: ch1 + ch2, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + } + + // The remaining 1-character punctuators. + + if ('[]<>+-*%&|^!~?:=/'.indexOf(ch1) >= 0) { + return { + type: Token.Punctuator, + value: source[index++], + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + } + + // 7.8.3 Numeric Literals + + function scanNumericLiteral() { + var number, start, ch; + + ch = source[index]; + assert(isDecimalDigit(ch) || (ch === '.'), + 'Numeric literal must start with a decimal digit or a decimal point'); + + start = index; + number = ''; + if (ch !== '.') { + number = source[index++]; + ch = source[index]; + + // Hex number starts with '0x'. + // Octal number starts with '0'. + if (number === '0') { + if (ch === 'x' || ch === 'X') { + number += source[index++]; + while (index < length) { + ch = source[index]; + if (!isHexDigit(ch)) { + break; + } + number += source[index++]; + } + + if (number.length <= 2) { + // only 0x + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + + if (index < length) { + ch = source[index]; + if (isIdentifierStart(ch)) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } + return { + type: Token.NumericLiteral, + value: parseInt(number, 16), + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } else if (isOctalDigit(ch)) { + number += source[index++]; + while (index < length) { + ch = source[index]; + if (!isOctalDigit(ch)) { + break; + } + number += source[index++]; + } + + if (index < length) { + ch = source[index]; + if (isIdentifierStart(ch) || isDecimalDigit(ch)) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } + return { + type: Token.NumericLiteral, + value: parseInt(number, 8), + octal: true, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // decimal number starts with '0' such as '09' is illegal. + if (isDecimalDigit(ch)) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } + + while (index < length) { + ch = source[index]; + if (!isDecimalDigit(ch)) { + break; + } + number += source[index++]; + } + } + + if (ch === '.') { + number += source[index++]; + while (index < length) { + ch = source[index]; + if (!isDecimalDigit(ch)) { + break; + } + number += source[index++]; + } + } + + if (ch === 'e' || ch === 'E') { + number += source[index++]; + + ch = source[index]; + if (ch === '+' || ch === '-') { + number += source[index++]; + } + + ch = source[index]; + if (isDecimalDigit(ch)) { + number += source[index++]; + while (index < length) { + ch = source[index]; + if (!isDecimalDigit(ch)) { + break; + } + number += source[index++]; + } + } else { + ch = 'character ' + ch; + if (index >= length) { + ch = ''; + } + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } + + if (index < length) { + ch = source[index]; + if (isIdentifierStart(ch)) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } + + return { + type: Token.NumericLiteral, + value: parseFloat(number), + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + // 7.8.4 String Literals + + function scanStringLiteral() { + var str = '', quote, start, ch, code, unescaped, restore, octal = false; + + quote = source[index]; + assert((quote === '\'' || quote === '"'), + 'String literal must starts with a quote'); + + start = index; + ++index; + + while (index < length) { + ch = source[index++]; + + if (ch === quote) { + quote = ''; + break; + } else if (ch === '\\') { + ch = source[index++]; + if (!isLineTerminator(ch)) { + switch (ch) { + case 'n': + str += '\n'; + break; + case 'r': + str += '\r'; + break; + case 't': + str += '\t'; + break; + case 'u': + case 'x': + restore = index; + unescaped = scanHexEscape(ch); + if (unescaped) { + str += unescaped; + } else { + index = restore; + str += ch; + } + break; + case 'b': + str += '\b'; + break; + case 'f': + str += '\f'; + break; + case 'v': + str += '\x0B'; + break; + + default: + if (isOctalDigit(ch)) { + code = '01234567'.indexOf(ch); + + // \0 is not octal escape sequence + if (code !== 0) { + octal = true; + } + + if (index < length && isOctalDigit(source[index])) { + octal = true; + code = code * 8 + '01234567'.indexOf(source[index++]); + + // 3 digits are only allowed when string starts + // with 0, 1, 2, 3 + if ('0123'.indexOf(ch) >= 0 && + index < length && + isOctalDigit(source[index])) { + code = code * 8 + '01234567'.indexOf(source[index++]); + } + } + str += String.fromCharCode(code); + } else { + str += ch; + } + break; + } + } else { + ++lineNumber; + if (ch === '\r' && source[index] === '\n') { + ++index; + } + } + } else if (isLineTerminator(ch)) { + break; + } else { + str += ch; + } + } + + if (quote !== '') { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + + return { + type: Token.StringLiteral, + value: str, + octal: octal, + lineNumber: lineNumber, + lineStart: lineStart, + range: [start, index] + }; + } + + function scanRegExp() { + var str, ch, start, pattern, flags, value, classMarker = false, restore, terminated = false; + + buffer = null; + skipComment(); + + start = index; + ch = source[index]; + assert(ch === '/', 'Regular expression literal must start with a slash'); + str = source[index++]; + + while (index < length) { + ch = source[index++]; + str += ch; + if (ch === '\\') { + ch = source[index++]; + // ECMA-262 7.8.5 + if (isLineTerminator(ch)) { + throwError({}, Messages.UnterminatedRegExp); + } + str += ch; + } else if (classMarker) { + if (ch === ']') { + classMarker = false; + } + } else { + if (ch === '/') { + terminated = true; + break; + } else if (ch === '[') { + classMarker = true; + } else if (isLineTerminator(ch)) { + throwError({}, Messages.UnterminatedRegExp); + } + } + } + + if (!terminated) { + throwError({}, Messages.UnterminatedRegExp); + } + + // Exclude leading and trailing slash. + pattern = str.substr(1, str.length - 2); + + flags = ''; + while (index < length) { + ch = source[index]; + if (!isIdentifierPart(ch)) { + break; + } + + ++index; + if (ch === '\\' && index < length) { + ch = source[index]; + if (ch === 'u') { + ++index; + restore = index; + ch = scanHexEscape('u'); + if (ch) { + flags += ch; + str += '\\u'; + for (; restore < index; ++restore) { + str += source[restore]; + } + } else { + index = restore; + flags += 'u'; + str += '\\u'; + } + } else { + str += '\\'; + } + } else { + flags += ch; + str += ch; + } + } + + try { + value = new RegExp(pattern, flags); + } catch (e) { + throwError({}, Messages.InvalidRegExp); + } + + return { + literal: str, + value: value, + range: [start, index] + }; + } + + function isIdentifierName(token) { + return token.type === Token.Identifier || + token.type === Token.Keyword || + token.type === Token.BooleanLiteral || + token.type === Token.NullLiteral; + } + + function advance() { + var ch, token; + + skipComment(); + + if (index >= length) { + return { + type: Token.EOF, + lineNumber: lineNumber, + lineStart: lineStart, + range: [index, index] + }; + } + + token = scanPunctuator(); + if (typeof token !== 'undefined') { + return token; + } + + ch = source[index]; + + if (ch === '\'' || ch === '"') { + return scanStringLiteral(); + } + + if (ch === '.' || isDecimalDigit(ch)) { + return scanNumericLiteral(); + } + + token = scanIdentifier(); + if (typeof token !== 'undefined') { + return token; + } + + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + + function lex() { + var token; + + if (buffer) { + index = buffer.range[1]; + lineNumber = buffer.lineNumber; + lineStart = buffer.lineStart; + token = buffer; + buffer = null; + return token; + } + + buffer = null; + return advance(); + } + + function lookahead() { + var pos, line, start; + + if (buffer !== null) { + return buffer; + } + + pos = index; + line = lineNumber; + start = lineStart; + buffer = advance(); + index = pos; + lineNumber = line; + lineStart = start; + + return buffer; + } + + // Return true if there is a line terminator before the next token. + + function peekLineTerminator() { + var pos, line, start, found; + + pos = index; + line = lineNumber; + start = lineStart; + skipComment(); + found = lineNumber !== line; + index = pos; + lineNumber = line; + lineStart = start; + + return found; + } + + // Throw an exception + + function throwError(token, messageFormat) { + var error, + args = Array.prototype.slice.call(arguments, 2), + msg = messageFormat.replace( + /%(\d)/g, + function (whole, index) { + return args[index] || ''; + } + ); + + if (typeof token.lineNumber === 'number') { + error = new Error('Line ' + token.lineNumber + ': ' + msg); + error.index = token.range[0]; + error.lineNumber = token.lineNumber; + error.column = token.range[0] - lineStart + 1; + } else { + error = new Error('Line ' + lineNumber + ': ' + msg); + error.index = index; + error.lineNumber = lineNumber; + error.column = index - lineStart + 1; + } + + throw error; + } + + function throwErrorTolerant() { + try { + throwError.apply(null, arguments); + } catch (e) { + if (extra.errors) { + extra.errors.push(e); + } else { + throw e; + } + } + } + + + // Throw an exception because of the token. + + function throwUnexpected(token) { + if (token.type === Token.EOF) { + throwError(token, Messages.UnexpectedEOS); + } + + if (token.type === Token.NumericLiteral) { + throwError(token, Messages.UnexpectedNumber); + } + + if (token.type === Token.StringLiteral) { + throwError(token, Messages.UnexpectedString); + } + + if (token.type === Token.Identifier) { + throwError(token, Messages.UnexpectedIdentifier); + } + + if (token.type === Token.Keyword) { + if (isFutureReservedWord(token.value)) { + throwError(token, Messages.UnexpectedReserved); + } else if (strict && isStrictModeReservedWord(token.value)) { + throwErrorTolerant(token, Messages.StrictReservedWord); + return; + } + throwError(token, Messages.UnexpectedToken, token.value); + } + + // BooleanLiteral, NullLiteral, or Punctuator. + throwError(token, Messages.UnexpectedToken, token.value); + } + + // Expect the next token to match the specified punctuator. + // If not, an exception will be thrown. + + function expect(value) { + var token = lex(); + if (token.type !== Token.Punctuator || token.value !== value) { + throwUnexpected(token); + } + } + + // Expect the next token to match the specified keyword. + // If not, an exception will be thrown. + + function expectKeyword(keyword) { + var token = lex(); + if (token.type !== Token.Keyword || token.value !== keyword) { + throwUnexpected(token); + } + } + + // Return true if the next token matches the specified punctuator. + + function match(value) { + var token = lookahead(); + return token.type === Token.Punctuator && token.value === value; + } + + // Return true if the next token matches the specified keyword + + function matchKeyword(keyword) { + var token = lookahead(); + return token.type === Token.Keyword && token.value === keyword; + } + + // Return true if the next token is an assignment operator + + function matchAssign() { + var token = lookahead(), + op = token.value; + + if (token.type !== Token.Punctuator) { + return false; + } + return op === '=' || + op === '*=' || + op === '/=' || + op === '%=' || + op === '+=' || + op === '-=' || + op === '<<=' || + op === '>>=' || + op === '>>>=' || + op === '&=' || + op === '^=' || + op === '|='; + } + + function consumeSemicolon() { + var token, line; + + // Catch the very common case first. + if (source[index] === ';') { + lex(); + return; + } + + line = lineNumber; + skipComment(); + if (lineNumber !== line) { + return; + } + + if (match(';')) { + lex(); + return; + } + + token = lookahead(); + if (token.type !== Token.EOF && !match('}')) { + throwUnexpected(token); + } + } + + // Return true if provided expression is LeftHandSideExpression + + function isLeftHandSide(expr) { + return expr.type === Syntax.Identifier || expr.type === Syntax.MemberExpression; + } + + // 11.1.4 Array Initialiser + + function parseArrayInitialiser() { + var elements = []; + + expect('['); + + while (!match(']')) { + if (match(',')) { + lex(); + elements.push(null); + } else { + elements.push(parseAssignmentExpression()); + + if (!match(']')) { + expect(','); + } + } + } + + expect(']'); + + return { + type: Syntax.ArrayExpression, + elements: elements + }; + } + + // 11.1.5 Object Initialiser + + function parsePropertyFunction(param, first) { + var previousStrict, body; + + previousStrict = strict; + body = parseFunctionSourceElements(); + if (first && strict && isRestrictedWord(param[0].name)) { + throwErrorTolerant(first, Messages.StrictParamName); + } + strict = previousStrict; + + return { + type: Syntax.FunctionExpression, + id: null, + params: param, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }; + } + + function parseObjectPropertyKey() { + var token = lex(); + + // Note: This function is called only from parseObjectProperty(), where + // EOF and Punctuator tokens are already filtered out. + + if (token.type === Token.StringLiteral || token.type === Token.NumericLiteral) { + if (strict && token.octal) { + throwErrorTolerant(token, Messages.StrictOctalLiteral); + } + return createLiteral(token); + } + + return { + type: Syntax.Identifier, + name: token.value + }; + } + + function parseObjectProperty() { + var token, key, id, param; + + token = lookahead(); + + if (token.type === Token.Identifier) { + + id = parseObjectPropertyKey(); + + // Property Assignment: Getter and Setter. + + if (token.value === 'get' && !match(':')) { + key = parseObjectPropertyKey(); + expect('('); + expect(')'); + return { + type: Syntax.Property, + key: key, + value: parsePropertyFunction([]), + kind: 'get' + }; + } else if (token.value === 'set' && !match(':')) { + key = parseObjectPropertyKey(); + expect('('); + token = lookahead(); + if (token.type !== Token.Identifier) { + expect(')'); + throwErrorTolerant(token, Messages.UnexpectedToken, token.value); + return { + type: Syntax.Property, + key: key, + value: parsePropertyFunction([]), + kind: 'set' + }; + } else { + param = [ parseVariableIdentifier() ]; + expect(')'); + return { + type: Syntax.Property, + key: key, + value: parsePropertyFunction(param, token), + kind: 'set' + }; + } + } else { + expect(':'); + return { + type: Syntax.Property, + key: id, + value: parseAssignmentExpression(), + kind: 'init' + }; + } + } else if (token.type === Token.EOF || token.type === Token.Punctuator) { + throwUnexpected(token); + } else { + key = parseObjectPropertyKey(); + expect(':'); + return { + type: Syntax.Property, + key: key, + value: parseAssignmentExpression(), + kind: 'init' + }; + } + } + + function parseObjectInitialiser() { + var properties = [], property, name, kind, map = {}, toString = String; + + expect('{'); + + while (!match('}')) { + property = parseObjectProperty(); + + if (property.key.type === Syntax.Identifier) { + name = property.key.name; + } else { + name = toString(property.key.value); + } + kind = (property.kind === 'init') ? PropertyKind.Data : (property.kind === 'get') ? PropertyKind.Get : PropertyKind.Set; + if (Object.prototype.hasOwnProperty.call(map, name)) { + if (map[name] === PropertyKind.Data) { + if (strict && kind === PropertyKind.Data) { + throwErrorTolerant({}, Messages.StrictDuplicateProperty); + } else if (kind !== PropertyKind.Data) { + throwErrorTolerant({}, Messages.AccessorDataProperty); + } + } else { + if (kind === PropertyKind.Data) { + throwErrorTolerant({}, Messages.AccessorDataProperty); + } else if (map[name] & kind) { + throwErrorTolerant({}, Messages.AccessorGetSet); + } + } + map[name] |= kind; + } else { + map[name] = kind; + } + + properties.push(property); + + if (!match('}')) { + expect(','); + } + } + + expect('}'); + + return { + type: Syntax.ObjectExpression, + properties: properties + }; + } + + // 11.1.6 The Grouping Operator + + function parseGroupExpression() { + var expr; + + expect('('); + + expr = parseExpression(); + + expect(')'); + + return expr; + } + + + // 11.1 Primary Expressions + + function parsePrimaryExpression() { + var token = lookahead(), + type = token.type; + + if (type === Token.Identifier) { + return { + type: Syntax.Identifier, + name: lex().value + }; + } + + if (type === Token.StringLiteral || type === Token.NumericLiteral) { + if (strict && token.octal) { + throwErrorTolerant(token, Messages.StrictOctalLiteral); + } + return createLiteral(lex()); + } + + if (type === Token.Keyword) { + if (matchKeyword('this')) { + lex(); + return { + type: Syntax.ThisExpression + }; + } + + if (matchKeyword('function')) { + return parseFunctionExpression(); + } + } + + if (type === Token.BooleanLiteral) { + lex(); + token.value = (token.value === 'true'); + return createLiteral(token); + } + + if (type === Token.NullLiteral) { + lex(); + token.value = null; + return createLiteral(token); + } + + if (match('[')) { + return parseArrayInitialiser(); + } + + if (match('{')) { + return parseObjectInitialiser(); + } + + if (match('(')) { + return parseGroupExpression(); + } + + if (match('/') || match('/=')) { + return createLiteral(scanRegExp()); + } + + return throwUnexpected(lex()); + } + + // 11.2 Left-Hand-Side Expressions + + function parseArguments() { + var args = []; + + expect('('); + + if (!match(')')) { + while (index < length) { + args.push(parseAssignmentExpression()); + if (match(')')) { + break; + } + expect(','); + } + } + + expect(')'); + + return args; + } + + function parseNonComputedProperty() { + var token = lex(); + + if (!isIdentifierName(token)) { + throwUnexpected(token); + } + + return { + type: Syntax.Identifier, + name: token.value + }; + } + + function parseNonComputedMember() { + expect('.'); + + return parseNonComputedProperty(); + } + + function parseComputedMember() { + var expr; + + expect('['); + + expr = parseExpression(); + + expect(']'); + + return expr; + } + + function parseNewExpression() { + var expr; + + expectKeyword('new'); + + expr = { + type: Syntax.NewExpression, + callee: parseLeftHandSideExpression(), + 'arguments': [] + }; + + if (match('(')) { + expr['arguments'] = parseArguments(); + } + + return expr; + } + + function parseLeftHandSideExpressionAllowCall() { + var expr; + + expr = matchKeyword('new') ? parseNewExpression() : parsePrimaryExpression(); + + while (match('.') || match('[') || match('(')) { + if (match('(')) { + expr = { + type: Syntax.CallExpression, + callee: expr, + 'arguments': parseArguments() + }; + } else if (match('[')) { + expr = { + type: Syntax.MemberExpression, + computed: true, + object: expr, + property: parseComputedMember() + }; + } else { + expr = { + type: Syntax.MemberExpression, + computed: false, + object: expr, + property: parseNonComputedMember() + }; + } + } + + return expr; + } + + + function parseLeftHandSideExpression() { + var expr; + + expr = matchKeyword('new') ? parseNewExpression() : parsePrimaryExpression(); + + while (match('.') || match('[')) { + if (match('[')) { + expr = { + type: Syntax.MemberExpression, + computed: true, + object: expr, + property: parseComputedMember() + }; + } else { + expr = { + type: Syntax.MemberExpression, + computed: false, + object: expr, + property: parseNonComputedMember() + }; + } + } + + return expr; + } + + // 11.3 Postfix Expressions + + function parsePostfixExpression() { + var expr = parseLeftHandSideExpressionAllowCall(), token; + + token = lookahead(); + if (token.type !== Token.Punctuator) { + return expr; + } + + if ((match('++') || match('--')) && !peekLineTerminator()) { + // 11.3.1, 11.3.2 + if (strict && expr.type === Syntax.Identifier && isRestrictedWord(expr.name)) { + throwErrorTolerant({}, Messages.StrictLHSPostfix); + } + if (!isLeftHandSide(expr)) { + throwErrorTolerant({}, Messages.InvalidLHSInAssignment); + } + + expr = { + type: Syntax.UpdateExpression, + operator: lex().value, + argument: expr, + prefix: false + }; + } + + return expr; + } + + // 11.4 Unary Operators + + function parseUnaryExpression() { + var token, expr; + + token = lookahead(); + if (token.type !== Token.Punctuator && token.type !== Token.Keyword) { + return parsePostfixExpression(); + } + + if (match('++') || match('--')) { + token = lex(); + expr = parseUnaryExpression(); + // 11.4.4, 11.4.5 + if (strict && expr.type === Syntax.Identifier && isRestrictedWord(expr.name)) { + throwErrorTolerant({}, Messages.StrictLHSPrefix); + } + + if (!isLeftHandSide(expr)) { + throwErrorTolerant({}, Messages.InvalidLHSInAssignment); + } + + expr = { + type: Syntax.UpdateExpression, + operator: token.value, + argument: expr, + prefix: true + }; + return expr; + } + + if (match('+') || match('-') || match('~') || match('!')) { + expr = { + type: Syntax.UnaryExpression, + operator: lex().value, + argument: parseUnaryExpression(), + prefix: true + }; + return expr; + } + + if (matchKeyword('delete') || matchKeyword('void') || matchKeyword('typeof')) { + expr = { + type: Syntax.UnaryExpression, + operator: lex().value, + argument: parseUnaryExpression(), + prefix: true + }; + if (strict && expr.operator === 'delete' && expr.argument.type === Syntax.Identifier) { + throwErrorTolerant({}, Messages.StrictDelete); + } + return expr; + } + + return parsePostfixExpression(); + } + + // 11.5 Multiplicative Operators + + function parseMultiplicativeExpression() { + var expr = parseUnaryExpression(); + + while (match('*') || match('/') || match('%')) { + expr = { + type: Syntax.BinaryExpression, + operator: lex().value, + left: expr, + right: parseUnaryExpression() + }; + } + + return expr; + } + + // 11.6 Additive Operators + + function parseAdditiveExpression() { + var expr = parseMultiplicativeExpression(); + + while (match('+') || match('-')) { + expr = { + type: Syntax.BinaryExpression, + operator: lex().value, + left: expr, + right: parseMultiplicativeExpression() + }; + } + + return expr; + } + + // 11.7 Bitwise Shift Operators + + function parseShiftExpression() { + var expr = parseAdditiveExpression(); + + while (match('<<') || match('>>') || match('>>>')) { + expr = { + type: Syntax.BinaryExpression, + operator: lex().value, + left: expr, + right: parseAdditiveExpression() + }; + } + + return expr; + } + // 11.8 Relational Operators + + function parseRelationalExpression() { + var expr, previousAllowIn; + + previousAllowIn = state.allowIn; + state.allowIn = true; + + expr = parseShiftExpression(); + + while (match('<') || match('>') || match('<=') || match('>=') || (previousAllowIn && matchKeyword('in')) || matchKeyword('instanceof')) { + expr = { + type: Syntax.BinaryExpression, + operator: lex().value, + left: expr, + right: parseShiftExpression() + }; + } + + state.allowIn = previousAllowIn; + return expr; + } + + // 11.9 Equality Operators + + function parseEqualityExpression() { + var expr = parseRelationalExpression(); + + while (match('==') || match('!=') || match('===') || match('!==')) { + expr = { + type: Syntax.BinaryExpression, + operator: lex().value, + left: expr, + right: parseRelationalExpression() + }; + } + + return expr; + } + + // 11.10 Binary Bitwise Operators + + function parseBitwiseANDExpression() { + var expr = parseEqualityExpression(); + + while (match('&')) { + lex(); + expr = { + type: Syntax.BinaryExpression, + operator: '&', + left: expr, + right: parseEqualityExpression() + }; + } + + return expr; + } + + function parseBitwiseXORExpression() { + var expr = parseBitwiseANDExpression(); + + while (match('^')) { + lex(); + expr = { + type: Syntax.BinaryExpression, + operator: '^', + left: expr, + right: parseBitwiseANDExpression() + }; + } + + return expr; + } + + function parseBitwiseORExpression() { + var expr = parseBitwiseXORExpression(); + + while (match('|')) { + lex(); + expr = { + type: Syntax.BinaryExpression, + operator: '|', + left: expr, + right: parseBitwiseXORExpression() + }; + } + + return expr; + } + + // 11.11 Binary Logical Operators + + function parseLogicalANDExpression() { + var expr = parseBitwiseORExpression(); + + while (match('&&')) { + lex(); + expr = { + type: Syntax.LogicalExpression, + operator: '&&', + left: expr, + right: parseBitwiseORExpression() + }; + } + + return expr; + } + + function parseLogicalORExpression() { + var expr = parseLogicalANDExpression(); + + while (match('||')) { + lex(); + expr = { + type: Syntax.LogicalExpression, + operator: '||', + left: expr, + right: parseLogicalANDExpression() + }; + } + + return expr; + } + + // 11.12 Conditional Operator + + function parseConditionalExpression() { + var expr, previousAllowIn, consequent; + + expr = parseLogicalORExpression(); + + if (match('?')) { + lex(); + previousAllowIn = state.allowIn; + state.allowIn = true; + consequent = parseAssignmentExpression(); + state.allowIn = previousAllowIn; + expect(':'); + + expr = { + type: Syntax.ConditionalExpression, + test: expr, + consequent: consequent, + alternate: parseAssignmentExpression() + }; + } + + return expr; + } + + // 11.13 Assignment Operators + + function parseAssignmentExpression() { + var token, expr; + + token = lookahead(); + expr = parseConditionalExpression(); + + if (matchAssign()) { + // LeftHandSideExpression + if (!isLeftHandSide(expr)) { + throwErrorTolerant({}, Messages.InvalidLHSInAssignment); + } + + // 11.13.1 + if (strict && expr.type === Syntax.Identifier && isRestrictedWord(expr.name)) { + throwErrorTolerant(token, Messages.StrictLHSAssignment); + } + + expr = { + type: Syntax.AssignmentExpression, + operator: lex().value, + left: expr, + right: parseAssignmentExpression() + }; + } + + return expr; + } + + // 11.14 Comma Operator + + function parseExpression() { + var expr = parseAssignmentExpression(); + + if (match(',')) { + expr = { + type: Syntax.SequenceExpression, + expressions: [ expr ] + }; + + while (index < length) { + if (!match(',')) { + break; + } + lex(); + expr.expressions.push(parseAssignmentExpression()); + } + + } + return expr; + } + + // 12.1 Block + + function parseStatementList() { + var list = [], + statement; + + while (index < length) { + if (match('}')) { + break; + } + statement = parseSourceElement(); + if (typeof statement === 'undefined') { + break; + } + list.push(statement); + } + + return list; + } + + function parseBlock() { + var block; + + expect('{'); + + block = parseStatementList(); + + expect('}'); + + return { + type: Syntax.BlockStatement, + body: block + }; + } + + // 12.2 Variable Statement + + function parseVariableIdentifier() { + var token = lex(); + + if (token.type !== Token.Identifier) { + throwUnexpected(token); + } + + return { + type: Syntax.Identifier, + name: token.value + }; + } + + function parseVariableDeclaration(kind) { + var id = parseVariableIdentifier(), + init = null; + + // 12.2.1 + if (strict && isRestrictedWord(id.name)) { + throwErrorTolerant({}, Messages.StrictVarName); + } + + if (kind === 'const') { + expect('='); + init = parseAssignmentExpression(); + } else if (match('=')) { + lex(); + init = parseAssignmentExpression(); + } + + return { + type: Syntax.VariableDeclarator, + id: id, + init: init + }; + } + + function parseVariableDeclarationList(kind) { + var list = []; + + do { + list.push(parseVariableDeclaration(kind)); + if (!match(',')) { + break; + } + lex(); + } while (index < length); + + return list; + } + + function parseVariableStatement() { + var declarations; + + expectKeyword('var'); + + declarations = parseVariableDeclarationList(); + + consumeSemicolon(); + + return { + type: Syntax.VariableDeclaration, + declarations: declarations, + kind: 'var' + }; + } + + // kind may be `const` or `let` + // Both are experimental and not in the specification yet. + // see http://wiki.ecmascript.org/doku.php?id=harmony:const + // and http://wiki.ecmascript.org/doku.php?id=harmony:let + function parseConstLetDeclaration(kind) { + var declarations; + + expectKeyword(kind); + + declarations = parseVariableDeclarationList(kind); + + consumeSemicolon(); + + return { + type: Syntax.VariableDeclaration, + declarations: declarations, + kind: kind + }; + } + + // 12.3 Empty Statement + + function parseEmptyStatement() { + expect(';'); + + return { + type: Syntax.EmptyStatement + }; + } + + // 12.4 Expression Statement + + function parseExpressionStatement() { + var expr = parseExpression(); + + consumeSemicolon(); + + return { + type: Syntax.ExpressionStatement, + expression: expr + }; + } + + // 12.5 If statement + + function parseIfStatement() { + var test, consequent, alternate; + + expectKeyword('if'); + + expect('('); + + test = parseExpression(); + + expect(')'); + + consequent = parseStatement(); + + if (matchKeyword('else')) { + lex(); + alternate = parseStatement(); + } else { + alternate = null; + } + + return { + type: Syntax.IfStatement, + test: test, + consequent: consequent, + alternate: alternate + }; + } + + // 12.6 Iteration Statements + + function parseDoWhileStatement() { + var body, test, oldInIteration; + + expectKeyword('do'); + + oldInIteration = state.inIteration; + state.inIteration = true; + + body = parseStatement(); + + state.inIteration = oldInIteration; + + expectKeyword('while'); + + expect('('); + + test = parseExpression(); + + expect(')'); + + if (match(';')) { + lex(); + } + + return { + type: Syntax.DoWhileStatement, + body: body, + test: test + }; + } + + function parseWhileStatement() { + var test, body, oldInIteration; + + expectKeyword('while'); + + expect('('); + + test = parseExpression(); + + expect(')'); + + oldInIteration = state.inIteration; + state.inIteration = true; + + body = parseStatement(); + + state.inIteration = oldInIteration; + + return { + type: Syntax.WhileStatement, + test: test, + body: body + }; + } + + function parseForVariableDeclaration() { + var token = lex(); + + return { + type: Syntax.VariableDeclaration, + declarations: parseVariableDeclarationList(), + kind: token.value + }; + } + + function parseForStatement() { + var init, test, update, left, right, body, oldInIteration; + + init = test = update = null; + + expectKeyword('for'); + + expect('('); + + if (match(';')) { + lex(); + } else { + if (matchKeyword('var') || matchKeyword('let')) { + state.allowIn = false; + init = parseForVariableDeclaration(); + state.allowIn = true; + + if (init.declarations.length === 1 && matchKeyword('in')) { + lex(); + left = init; + right = parseExpression(); + init = null; + } + } else { + state.allowIn = false; + init = parseExpression(); + state.allowIn = true; + + if (matchKeyword('in')) { + // LeftHandSideExpression + if (!isLeftHandSide(init)) { + throwErrorTolerant({}, Messages.InvalidLHSInForIn); + } + + lex(); + left = init; + right = parseExpression(); + init = null; + } + } + + if (typeof left === 'undefined') { + expect(';'); + } + } + + if (typeof left === 'undefined') { + + if (!match(';')) { + test = parseExpression(); + } + expect(';'); + + if (!match(')')) { + update = parseExpression(); + } + } + + expect(')'); + + oldInIteration = state.inIteration; + state.inIteration = true; + + body = parseStatement(); + + state.inIteration = oldInIteration; + + if (typeof left === 'undefined') { + return { + type: Syntax.ForStatement, + init: init, + test: test, + update: update, + body: body + }; + } + + return { + type: Syntax.ForInStatement, + left: left, + right: right, + body: body, + each: false + }; + } + + // 12.7 The continue statement + + function parseContinueStatement() { + var token, label = null; + + expectKeyword('continue'); + + // Optimize the most common form: 'continue;'. + if (source[index] === ';') { + lex(); + + if (!state.inIteration) { + throwError({}, Messages.IllegalContinue); + } + + return { + type: Syntax.ContinueStatement, + label: null + }; + } + + if (peekLineTerminator()) { + if (!state.inIteration) { + throwError({}, Messages.IllegalContinue); + } + + return { + type: Syntax.ContinueStatement, + label: null + }; + } + + token = lookahead(); + if (token.type === Token.Identifier) { + label = parseVariableIdentifier(); + + if (!Object.prototype.hasOwnProperty.call(state.labelSet, label.name)) { + throwError({}, Messages.UnknownLabel, label.name); + } + } + + consumeSemicolon(); + + if (label === null && !state.inIteration) { + throwError({}, Messages.IllegalContinue); + } + + return { + type: Syntax.ContinueStatement, + label: label + }; + } + + // 12.8 The break statement + + function parseBreakStatement() { + var token, label = null; + + expectKeyword('break'); + + // Optimize the most common form: 'break;'. + if (source[index] === ';') { + lex(); + + if (!(state.inIteration || state.inSwitch)) { + throwError({}, Messages.IllegalBreak); + } + + return { + type: Syntax.BreakStatement, + label: null + }; + } + + if (peekLineTerminator()) { + if (!(state.inIteration || state.inSwitch)) { + throwError({}, Messages.IllegalBreak); + } + + return { + type: Syntax.BreakStatement, + label: null + }; + } + + token = lookahead(); + if (token.type === Token.Identifier) { + label = parseVariableIdentifier(); + + if (!Object.prototype.hasOwnProperty.call(state.labelSet, label.name)) { + throwError({}, Messages.UnknownLabel, label.name); + } + } + + consumeSemicolon(); + + if (label === null && !(state.inIteration || state.inSwitch)) { + throwError({}, Messages.IllegalBreak); + } + + return { + type: Syntax.BreakStatement, + label: label + }; + } + + // 12.9 The return statement + + function parseReturnStatement() { + var token, argument = null; + + expectKeyword('return'); + + if (!state.inFunctionBody) { + throwErrorTolerant({}, Messages.IllegalReturn); + } + + // 'return' followed by a space and an identifier is very common. + if (source[index] === ' ') { + if (isIdentifierStart(source[index + 1])) { + argument = parseExpression(); + consumeSemicolon(); + return { + type: Syntax.ReturnStatement, + argument: argument + }; + } + } + + if (peekLineTerminator()) { + return { + type: Syntax.ReturnStatement, + argument: null + }; + } + + if (!match(';')) { + token = lookahead(); + if (!match('}') && token.type !== Token.EOF) { + argument = parseExpression(); + } + } + + consumeSemicolon(); + + return { + type: Syntax.ReturnStatement, + argument: argument + }; + } + + // 12.10 The with statement + + function parseWithStatement() { + var object, body; + + if (strict) { + throwErrorTolerant({}, Messages.StrictModeWith); + } + + expectKeyword('with'); + + expect('('); + + object = parseExpression(); + + expect(')'); + + body = parseStatement(); + + return { + type: Syntax.WithStatement, + object: object, + body: body + }; + } + + // 12.10 The swith statement + + function parseSwitchCase() { + var test, + consequent = [], + statement; + + if (matchKeyword('default')) { + lex(); + test = null; + } else { + expectKeyword('case'); + test = parseExpression(); + } + expect(':'); + + while (index < length) { + if (match('}') || matchKeyword('default') || matchKeyword('case')) { + break; + } + statement = parseStatement(); + if (typeof statement === 'undefined') { + break; + } + consequent.push(statement); + } + + return { + type: Syntax.SwitchCase, + test: test, + consequent: consequent + }; + } + + function parseSwitchStatement() { + var discriminant, cases, clause, oldInSwitch, defaultFound; + + expectKeyword('switch'); + + expect('('); + + discriminant = parseExpression(); + + expect(')'); + + expect('{'); + + cases = []; + + if (match('}')) { + lex(); + return { + type: Syntax.SwitchStatement, + discriminant: discriminant, + cases: cases + }; + } + + oldInSwitch = state.inSwitch; + state.inSwitch = true; + defaultFound = false; + + while (index < length) { + if (match('}')) { + break; + } + clause = parseSwitchCase(); + if (clause.test === null) { + if (defaultFound) { + throwError({}, Messages.MultipleDefaultsInSwitch); + } + defaultFound = true; + } + cases.push(clause); + } + + state.inSwitch = oldInSwitch; + + expect('}'); + + return { + type: Syntax.SwitchStatement, + discriminant: discriminant, + cases: cases + }; + } + + // 12.13 The throw statement + + function parseThrowStatement() { + var argument; + + expectKeyword('throw'); + + if (peekLineTerminator()) { + throwError({}, Messages.NewlineAfterThrow); + } + + argument = parseExpression(); + + consumeSemicolon(); + + return { + type: Syntax.ThrowStatement, + argument: argument + }; + } + + // 12.14 The try statement + + function parseCatchClause() { + var param; + + expectKeyword('catch'); + + expect('('); + if (match(')')) { + throwUnexpected(lookahead()); + } + + param = parseVariableIdentifier(); + // 12.14.1 + if (strict && isRestrictedWord(param.name)) { + throwErrorTolerant({}, Messages.StrictCatchVariable); + } + + expect(')'); + + return { + type: Syntax.CatchClause, + param: param, + body: parseBlock() + }; + } + + function parseTryStatement() { + var block, handlers = [], finalizer = null; + + expectKeyword('try'); + + block = parseBlock(); + + if (matchKeyword('catch')) { + handlers.push(parseCatchClause()); + } + + if (matchKeyword('finally')) { + lex(); + finalizer = parseBlock(); + } + + if (handlers.length === 0 && !finalizer) { + throwError({}, Messages.NoCatchOrFinally); + } + + return { + type: Syntax.TryStatement, + block: block, + guardedHandlers: [], + handlers: handlers, + finalizer: finalizer + }; + } + + // 12.15 The debugger statement + + function parseDebuggerStatement() { + expectKeyword('debugger'); + + consumeSemicolon(); + + return { + type: Syntax.DebuggerStatement + }; + } + + // 12 Statements + + function parseStatement() { + var token = lookahead(), + expr, + labeledBody; + + if (token.type === Token.EOF) { + throwUnexpected(token); + } + + if (token.type === Token.Punctuator) { + switch (token.value) { + case ';': + return parseEmptyStatement(); + case '{': + return parseBlock(); + case '(': + return parseExpressionStatement(); + default: + break; + } + } + + if (token.type === Token.Keyword) { + switch (token.value) { + case 'break': + return parseBreakStatement(); + case 'continue': + return parseContinueStatement(); + case 'debugger': + return parseDebuggerStatement(); + case 'do': + return parseDoWhileStatement(); + case 'for': + return parseForStatement(); + case 'function': + return parseFunctionDeclaration(); + case 'if': + return parseIfStatement(); + case 'return': + return parseReturnStatement(); + case 'switch': + return parseSwitchStatement(); + case 'throw': + return parseThrowStatement(); + case 'try': + return parseTryStatement(); + case 'var': + return parseVariableStatement(); + case 'while': + return parseWhileStatement(); + case 'with': + return parseWithStatement(); + default: + break; + } + } + + expr = parseExpression(); + + // 12.12 Labelled Statements + if ((expr.type === Syntax.Identifier) && match(':')) { + lex(); + + if (Object.prototype.hasOwnProperty.call(state.labelSet, expr.name)) { + throwError({}, Messages.Redeclaration, 'Label', expr.name); + } + + state.labelSet[expr.name] = true; + labeledBody = parseStatement(); + delete state.labelSet[expr.name]; + + return { + type: Syntax.LabeledStatement, + label: expr, + body: labeledBody + }; + } + + consumeSemicolon(); + + return { + type: Syntax.ExpressionStatement, + expression: expr + }; + } + + // 13 Function Definition + + function parseFunctionSourceElements() { + var sourceElement, sourceElements = [], token, directive, firstRestricted, + oldLabelSet, oldInIteration, oldInSwitch, oldInFunctionBody; + + expect('{'); + + while (index < length) { + token = lookahead(); + if (token.type !== Token.StringLiteral) { + break; + } + + sourceElement = parseSourceElement(); + sourceElements.push(sourceElement); + if (sourceElement.expression.type !== Syntax.Literal) { + // this is not directive + break; + } + directive = sliceSource(token.range[0] + 1, token.range[1] - 1); + if (directive === 'use strict') { + strict = true; + if (firstRestricted) { + throwErrorTolerant(firstRestricted, Messages.StrictOctalLiteral); + } + } else { + if (!firstRestricted && token.octal) { + firstRestricted = token; + } + } + } + + oldLabelSet = state.labelSet; + oldInIteration = state.inIteration; + oldInSwitch = state.inSwitch; + oldInFunctionBody = state.inFunctionBody; + + state.labelSet = {}; + state.inIteration = false; + state.inSwitch = false; + state.inFunctionBody = true; + + while (index < length) { + if (match('}')) { + break; + } + sourceElement = parseSourceElement(); + if (typeof sourceElement === 'undefined') { + break; + } + sourceElements.push(sourceElement); + } + + expect('}'); + + state.labelSet = oldLabelSet; + state.inIteration = oldInIteration; + state.inSwitch = oldInSwitch; + state.inFunctionBody = oldInFunctionBody; + + return { + type: Syntax.BlockStatement, + body: sourceElements + }; + } + + function parseFunctionDeclaration() { + var id, param, params = [], body, token, stricted, firstRestricted, message, previousStrict, paramSet; + + expectKeyword('function'); + token = lookahead(); + id = parseVariableIdentifier(); + if (strict) { + if (isRestrictedWord(token.value)) { + throwErrorTolerant(token, Messages.StrictFunctionName); + } + } else { + if (isRestrictedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictFunctionName; + } else if (isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictReservedWord; + } + } + + expect('('); + + if (!match(')')) { + paramSet = {}; + while (index < length) { + token = lookahead(); + param = parseVariableIdentifier(); + if (strict) { + if (isRestrictedWord(token.value)) { + stricted = token; + message = Messages.StrictParamName; + } + if (Object.prototype.hasOwnProperty.call(paramSet, token.value)) { + stricted = token; + message = Messages.StrictParamDupe; + } + } else if (!firstRestricted) { + if (isRestrictedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictParamName; + } else if (isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictReservedWord; + } else if (Object.prototype.hasOwnProperty.call(paramSet, token.value)) { + firstRestricted = token; + message = Messages.StrictParamDupe; + } + } + params.push(param); + paramSet[param.name] = true; + if (match(')')) { + break; + } + expect(','); + } + } + + expect(')'); + + previousStrict = strict; + body = parseFunctionSourceElements(); + if (strict && firstRestricted) { + throwError(firstRestricted, message); + } + if (strict && stricted) { + throwErrorTolerant(stricted, message); + } + strict = previousStrict; + + return { + type: Syntax.FunctionDeclaration, + id: id, + params: params, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }; + } + + function parseFunctionExpression() { + var token, id = null, stricted, firstRestricted, message, param, params = [], body, previousStrict, paramSet; + + expectKeyword('function'); + + if (!match('(')) { + token = lookahead(); + id = parseVariableIdentifier(); + if (strict) { + if (isRestrictedWord(token.value)) { + throwErrorTolerant(token, Messages.StrictFunctionName); + } + } else { + if (isRestrictedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictFunctionName; + } else if (isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictReservedWord; + } + } + } + + expect('('); + + if (!match(')')) { + paramSet = {}; + while (index < length) { + token = lookahead(); + param = parseVariableIdentifier(); + if (strict) { + if (isRestrictedWord(token.value)) { + stricted = token; + message = Messages.StrictParamName; + } + if (Object.prototype.hasOwnProperty.call(paramSet, token.value)) { + stricted = token; + message = Messages.StrictParamDupe; + } + } else if (!firstRestricted) { + if (isRestrictedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictParamName; + } else if (isStrictModeReservedWord(token.value)) { + firstRestricted = token; + message = Messages.StrictReservedWord; + } else if (Object.prototype.hasOwnProperty.call(paramSet, token.value)) { + firstRestricted = token; + message = Messages.StrictParamDupe; + } + } + params.push(param); + paramSet[param.name] = true; + if (match(')')) { + break; + } + expect(','); + } + } + + expect(')'); + + previousStrict = strict; + body = parseFunctionSourceElements(); + if (strict && firstRestricted) { + throwError(firstRestricted, message); + } + if (strict && stricted) { + throwErrorTolerant(stricted, message); + } + strict = previousStrict; + + return { + type: Syntax.FunctionExpression, + id: id, + params: params, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }; + } + + // 14 Program + + function parseSourceElement() { + var token = lookahead(); + + if (token.type === Token.Keyword) { + switch (token.value) { + case 'const': + case 'let': + return parseConstLetDeclaration(token.value); + case 'function': + return parseFunctionDeclaration(); + default: + return parseStatement(); + } + } + + if (token.type !== Token.EOF) { + return parseStatement(); + } + } + + function parseSourceElements() { + var sourceElement, sourceElements = [], token, directive, firstRestricted; + + while (index < length) { + token = lookahead(); + if (token.type !== Token.StringLiteral) { + break; + } + + sourceElement = parseSourceElement(); + sourceElements.push(sourceElement); + if (sourceElement.expression.type !== Syntax.Literal) { + // this is not directive + break; + } + directive = sliceSource(token.range[0] + 1, token.range[1] - 1); + if (directive === 'use strict') { + strict = true; + if (firstRestricted) { + throwErrorTolerant(firstRestricted, Messages.StrictOctalLiteral); + } + } else { + if (!firstRestricted && token.octal) { + firstRestricted = token; + } + } + } + + while (index < length) { + sourceElement = parseSourceElement(); + if (typeof sourceElement === 'undefined') { + break; + } + sourceElements.push(sourceElement); + } + return sourceElements; + } + + function parseProgram() { + var program; + strict = false; + program = { + type: Syntax.Program, + body: parseSourceElements() + }; + return program; + } + + // The following functions are needed only when the option to preserve + // the comments is active. + + function addComment(type, value, start, end, loc) { + assert(typeof start === 'number', 'Comment must have valid position'); + + // Because the way the actual token is scanned, often the comments + // (if any) are skipped twice during the lexical analysis. + // Thus, we need to skip adding a comment if the comment array already + // handled it. + if (extra.comments.length > 0) { + if (extra.comments[extra.comments.length - 1].range[1] > start) { + return; + } + } + + extra.comments.push({ + type: type, + value: value, + range: [start, end], + loc: loc + }); + } + + function scanComment() { + var comment, ch, loc, start, blockComment, lineComment; + + comment = ''; + blockComment = false; + lineComment = false; + + while (index < length) { + ch = source[index]; + + if (lineComment) { + ch = source[index++]; + if (isLineTerminator(ch)) { + loc.end = { + line: lineNumber, + column: index - lineStart - 1 + }; + lineComment = false; + addComment('Line', comment, start, index - 1, loc); + if (ch === '\r' && source[index] === '\n') { + ++index; + } + ++lineNumber; + lineStart = index; + comment = ''; + } else if (index >= length) { + lineComment = false; + comment += ch; + loc.end = { + line: lineNumber, + column: length - lineStart + }; + addComment('Line', comment, start, length, loc); + } else { + comment += ch; + } + } else if (blockComment) { + if (isLineTerminator(ch)) { + if (ch === '\r' && source[index + 1] === '\n') { + ++index; + comment += '\r\n'; + } else { + comment += ch; + } + ++lineNumber; + ++index; + lineStart = index; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } else { + ch = source[index++]; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + comment += ch; + if (ch === '*') { + ch = source[index]; + if (ch === '/') { + comment = comment.substr(0, comment.length - 1); + blockComment = false; + ++index; + loc.end = { + line: lineNumber, + column: index - lineStart + }; + addComment('Block', comment, start, index, loc); + comment = ''; + } + } + } + } else if (ch === '/') { + ch = source[index + 1]; + if (ch === '/') { + loc = { + start: { + line: lineNumber, + column: index - lineStart + } + }; + start = index; + index += 2; + lineComment = true; + if (index >= length) { + loc.end = { + line: lineNumber, + column: index - lineStart + }; + lineComment = false; + addComment('Line', comment, start, index, loc); + } + } else if (ch === '*') { + start = index; + index += 2; + blockComment = true; + loc = { + start: { + line: lineNumber, + column: index - lineStart - 2 + } + }; + if (index >= length) { + throwError({}, Messages.UnexpectedToken, 'ILLEGAL'); + } + } else { + break; + } + } else if (isWhiteSpace(ch)) { + ++index; + } else if (isLineTerminator(ch)) { + ++index; + if (ch === '\r' && source[index] === '\n') { + ++index; + } + ++lineNumber; + lineStart = index; + } else { + break; + } + } + } + + function filterCommentLocation() { + var i, entry, comment, comments = []; + + for (i = 0; i < extra.comments.length; ++i) { + entry = extra.comments[i]; + comment = { + type: entry.type, + value: entry.value + }; + if (extra.range) { + comment.range = entry.range; + } + if (extra.loc) { + comment.loc = entry.loc; + } + comments.push(comment); + } + + extra.comments = comments; + } + + function collectToken() { + var start, loc, token, range, value; + + skipComment(); + start = index; + loc = { + start: { + line: lineNumber, + column: index - lineStart + } + }; + + token = extra.advance(); + loc.end = { + line: lineNumber, + column: index - lineStart + }; + + if (token.type !== Token.EOF) { + range = [token.range[0], token.range[1]]; + value = sliceSource(token.range[0], token.range[1]); + extra.tokens.push({ + type: TokenName[token.type], + value: value, + range: range, + loc: loc + }); + } + + return token; + } + + function collectRegex() { + var pos, loc, regex, token; + + skipComment(); + + pos = index; + loc = { + start: { + line: lineNumber, + column: index - lineStart + } + }; + + regex = extra.scanRegExp(); + loc.end = { + line: lineNumber, + column: index - lineStart + }; + + // Pop the previous token, which is likely '/' or '/=' + if (extra.tokens.length > 0) { + token = extra.tokens[extra.tokens.length - 1]; + if (token.range[0] === pos && token.type === 'Punctuator') { + if (token.value === '/' || token.value === '/=') { + extra.tokens.pop(); + } + } + } + + extra.tokens.push({ + type: 'RegularExpression', + value: regex.literal, + range: [pos, index], + loc: loc + }); + + return regex; + } + + function filterTokenLocation() { + var i, entry, token, tokens = []; + + for (i = 0; i < extra.tokens.length; ++i) { + entry = extra.tokens[i]; + token = { + type: entry.type, + value: entry.value + }; + if (extra.range) { + token.range = entry.range; + } + if (extra.loc) { + token.loc = entry.loc; + } + tokens.push(token); + } + + extra.tokens = tokens; + } + + function createLiteral(token) { + return { + type: Syntax.Literal, + value: token.value + }; + } + + function createRawLiteral(token) { + return { + type: Syntax.Literal, + value: token.value, + raw: sliceSource(token.range[0], token.range[1]) + }; + } + + function createLocationMarker() { + var marker = {}; + + marker.range = [index, index]; + marker.loc = { + start: { + line: lineNumber, + column: index - lineStart + }, + end: { + line: lineNumber, + column: index - lineStart + } + }; + + marker.end = function () { + this.range[1] = index; + this.loc.end.line = lineNumber; + this.loc.end.column = index - lineStart; + }; + + marker.applyGroup = function (node) { + if (extra.range) { + node.groupRange = [this.range[0], this.range[1]]; + } + if (extra.loc) { + node.groupLoc = { + start: { + line: this.loc.start.line, + column: this.loc.start.column + }, + end: { + line: this.loc.end.line, + column: this.loc.end.column + } + }; + } + }; + + marker.apply = function (node) { + if (extra.range) { + node.range = [this.range[0], this.range[1]]; + } + if (extra.loc) { + node.loc = { + start: { + line: this.loc.start.line, + column: this.loc.start.column + }, + end: { + line: this.loc.end.line, + column: this.loc.end.column + } + }; + } + }; + + return marker; + } + + function trackGroupExpression() { + var marker, expr; + + skipComment(); + marker = createLocationMarker(); + expect('('); + + expr = parseExpression(); + + expect(')'); + + marker.end(); + marker.applyGroup(expr); + + return expr; + } + + function trackLeftHandSideExpression() { + var marker, expr; + + skipComment(); + marker = createLocationMarker(); + + expr = matchKeyword('new') ? parseNewExpression() : parsePrimaryExpression(); + + while (match('.') || match('[')) { + if (match('[')) { + expr = { + type: Syntax.MemberExpression, + computed: true, + object: expr, + property: parseComputedMember() + }; + marker.end(); + marker.apply(expr); + } else { + expr = { + type: Syntax.MemberExpression, + computed: false, + object: expr, + property: parseNonComputedMember() + }; + marker.end(); + marker.apply(expr); + } + } + + return expr; + } + + function trackLeftHandSideExpressionAllowCall() { + var marker, expr; + + skipComment(); + marker = createLocationMarker(); + + expr = matchKeyword('new') ? parseNewExpression() : parsePrimaryExpression(); + + while (match('.') || match('[') || match('(')) { + if (match('(')) { + expr = { + type: Syntax.CallExpression, + callee: expr, + 'arguments': parseArguments() + }; + marker.end(); + marker.apply(expr); + } else if (match('[')) { + expr = { + type: Syntax.MemberExpression, + computed: true, + object: expr, + property: parseComputedMember() + }; + marker.end(); + marker.apply(expr); + } else { + expr = { + type: Syntax.MemberExpression, + computed: false, + object: expr, + property: parseNonComputedMember() + }; + marker.end(); + marker.apply(expr); + } + } + + return expr; + } + + function filterGroup(node) { + var n, i, entry; + + n = (Object.prototype.toString.apply(node) === '[object Array]') ? [] : {}; + for (i in node) { + if (node.hasOwnProperty(i) && i !== 'groupRange' && i !== 'groupLoc') { + entry = node[i]; + if (entry === null || typeof entry !== 'object' || entry instanceof RegExp) { + n[i] = entry; + } else { + n[i] = filterGroup(entry); + } + } + } + return n; + } + + function wrapTrackingFunction(range, loc) { + + return function (parseFunction) { + + function isBinary(node) { + return node.type === Syntax.LogicalExpression || + node.type === Syntax.BinaryExpression; + } + + function visit(node) { + var start, end; + + if (isBinary(node.left)) { + visit(node.left); + } + if (isBinary(node.right)) { + visit(node.right); + } + + if (range) { + if (node.left.groupRange || node.right.groupRange) { + start = node.left.groupRange ? node.left.groupRange[0] : node.left.range[0]; + end = node.right.groupRange ? node.right.groupRange[1] : node.right.range[1]; + node.range = [start, end]; + } else if (typeof node.range === 'undefined') { + start = node.left.range[0]; + end = node.right.range[1]; + node.range = [start, end]; + } + } + if (loc) { + if (node.left.groupLoc || node.right.groupLoc) { + start = node.left.groupLoc ? node.left.groupLoc.start : node.left.loc.start; + end = node.right.groupLoc ? node.right.groupLoc.end : node.right.loc.end; + node.loc = { + start: start, + end: end + }; + } else if (typeof node.loc === 'undefined') { + node.loc = { + start: node.left.loc.start, + end: node.right.loc.end + }; + } + } + } + + return function () { + var marker, node; + + skipComment(); + + marker = createLocationMarker(); + node = parseFunction.apply(null, arguments); + marker.end(); + + if (range && typeof node.range === 'undefined') { + marker.apply(node); + } + + if (loc && typeof node.loc === 'undefined') { + marker.apply(node); + } + + if (isBinary(node)) { + visit(node); + } + + return node; + }; + }; + } + + function patch() { + + var wrapTracking; + + if (extra.comments) { + extra.skipComment = skipComment; + skipComment = scanComment; + } + + if (extra.raw) { + extra.createLiteral = createLiteral; + createLiteral = createRawLiteral; + } + + if (extra.range || extra.loc) { + + extra.parseGroupExpression = parseGroupExpression; + extra.parseLeftHandSideExpression = parseLeftHandSideExpression; + extra.parseLeftHandSideExpressionAllowCall = parseLeftHandSideExpressionAllowCall; + parseGroupExpression = trackGroupExpression; + parseLeftHandSideExpression = trackLeftHandSideExpression; + parseLeftHandSideExpressionAllowCall = trackLeftHandSideExpressionAllowCall; + + wrapTracking = wrapTrackingFunction(extra.range, extra.loc); + + extra.parseAdditiveExpression = parseAdditiveExpression; + extra.parseAssignmentExpression = parseAssignmentExpression; + extra.parseBitwiseANDExpression = parseBitwiseANDExpression; + extra.parseBitwiseORExpression = parseBitwiseORExpression; + extra.parseBitwiseXORExpression = parseBitwiseXORExpression; + extra.parseBlock = parseBlock; + extra.parseFunctionSourceElements = parseFunctionSourceElements; + extra.parseCatchClause = parseCatchClause; + extra.parseComputedMember = parseComputedMember; + extra.parseConditionalExpression = parseConditionalExpression; + extra.parseConstLetDeclaration = parseConstLetDeclaration; + extra.parseEqualityExpression = parseEqualityExpression; + extra.parseExpression = parseExpression; + extra.parseForVariableDeclaration = parseForVariableDeclaration; + extra.parseFunctionDeclaration = parseFunctionDeclaration; + extra.parseFunctionExpression = parseFunctionExpression; + extra.parseLogicalANDExpression = parseLogicalANDExpression; + extra.parseLogicalORExpression = parseLogicalORExpression; + extra.parseMultiplicativeExpression = parseMultiplicativeExpression; + extra.parseNewExpression = parseNewExpression; + extra.parseNonComputedProperty = parseNonComputedProperty; + extra.parseObjectProperty = parseObjectProperty; + extra.parseObjectPropertyKey = parseObjectPropertyKey; + extra.parsePostfixExpression = parsePostfixExpression; + extra.parsePrimaryExpression = parsePrimaryExpression; + extra.parseProgram = parseProgram; + extra.parsePropertyFunction = parsePropertyFunction; + extra.parseRelationalExpression = parseRelationalExpression; + extra.parseStatement = parseStatement; + extra.parseShiftExpression = parseShiftExpression; + extra.parseSwitchCase = parseSwitchCase; + extra.parseUnaryExpression = parseUnaryExpression; + extra.parseVariableDeclaration = parseVariableDeclaration; + extra.parseVariableIdentifier = parseVariableIdentifier; + + parseAdditiveExpression = wrapTracking(extra.parseAdditiveExpression); + parseAssignmentExpression = wrapTracking(extra.parseAssignmentExpression); + parseBitwiseANDExpression = wrapTracking(extra.parseBitwiseANDExpression); + parseBitwiseORExpression = wrapTracking(extra.parseBitwiseORExpression); + parseBitwiseXORExpression = wrapTracking(extra.parseBitwiseXORExpression); + parseBlock = wrapTracking(extra.parseBlock); + parseFunctionSourceElements = wrapTracking(extra.parseFunctionSourceElements); + parseCatchClause = wrapTracking(extra.parseCatchClause); + parseComputedMember = wrapTracking(extra.parseComputedMember); + parseConditionalExpression = wrapTracking(extra.parseConditionalExpression); + parseConstLetDeclaration = wrapTracking(extra.parseConstLetDeclaration); + parseEqualityExpression = wrapTracking(extra.parseEqualityExpression); + parseExpression = wrapTracking(extra.parseExpression); + parseForVariableDeclaration = wrapTracking(extra.parseForVariableDeclaration); + parseFunctionDeclaration = wrapTracking(extra.parseFunctionDeclaration); + parseFunctionExpression = wrapTracking(extra.parseFunctionExpression); + parseLeftHandSideExpression = wrapTracking(parseLeftHandSideExpression); + parseLogicalANDExpression = wrapTracking(extra.parseLogicalANDExpression); + parseLogicalORExpression = wrapTracking(extra.parseLogicalORExpression); + parseMultiplicativeExpression = wrapTracking(extra.parseMultiplicativeExpression); + parseNewExpression = wrapTracking(extra.parseNewExpression); + parseNonComputedProperty = wrapTracking(extra.parseNonComputedProperty); + parseObjectProperty = wrapTracking(extra.parseObjectProperty); + parseObjectPropertyKey = wrapTracking(extra.parseObjectPropertyKey); + parsePostfixExpression = wrapTracking(extra.parsePostfixExpression); + parsePrimaryExpression = wrapTracking(extra.parsePrimaryExpression); + parseProgram = wrapTracking(extra.parseProgram); + parsePropertyFunction = wrapTracking(extra.parsePropertyFunction); + parseRelationalExpression = wrapTracking(extra.parseRelationalExpression); + parseStatement = wrapTracking(extra.parseStatement); + parseShiftExpression = wrapTracking(extra.parseShiftExpression); + parseSwitchCase = wrapTracking(extra.parseSwitchCase); + parseUnaryExpression = wrapTracking(extra.parseUnaryExpression); + parseVariableDeclaration = wrapTracking(extra.parseVariableDeclaration); + parseVariableIdentifier = wrapTracking(extra.parseVariableIdentifier); + } + + if (typeof extra.tokens !== 'undefined') { + extra.advance = advance; + extra.scanRegExp = scanRegExp; + + advance = collectToken; + scanRegExp = collectRegex; + } + } + + function unpatch() { + if (typeof extra.skipComment === 'function') { + skipComment = extra.skipComment; + } + + if (extra.raw) { + createLiteral = extra.createLiteral; + } + + if (extra.range || extra.loc) { + parseAdditiveExpression = extra.parseAdditiveExpression; + parseAssignmentExpression = extra.parseAssignmentExpression; + parseBitwiseANDExpression = extra.parseBitwiseANDExpression; + parseBitwiseORExpression = extra.parseBitwiseORExpression; + parseBitwiseXORExpression = extra.parseBitwiseXORExpression; + parseBlock = extra.parseBlock; + parseFunctionSourceElements = extra.parseFunctionSourceElements; + parseCatchClause = extra.parseCatchClause; + parseComputedMember = extra.parseComputedMember; + parseConditionalExpression = extra.parseConditionalExpression; + parseConstLetDeclaration = extra.parseConstLetDeclaration; + parseEqualityExpression = extra.parseEqualityExpression; + parseExpression = extra.parseExpression; + parseForVariableDeclaration = extra.parseForVariableDeclaration; + parseFunctionDeclaration = extra.parseFunctionDeclaration; + parseFunctionExpression = extra.parseFunctionExpression; + parseGroupExpression = extra.parseGroupExpression; + parseLeftHandSideExpression = extra.parseLeftHandSideExpression; + parseLeftHandSideExpressionAllowCall = extra.parseLeftHandSideExpressionAllowCall; + parseLogicalANDExpression = extra.parseLogicalANDExpression; + parseLogicalORExpression = extra.parseLogicalORExpression; + parseMultiplicativeExpression = extra.parseMultiplicativeExpression; + parseNewExpression = extra.parseNewExpression; + parseNonComputedProperty = extra.parseNonComputedProperty; + parseObjectProperty = extra.parseObjectProperty; + parseObjectPropertyKey = extra.parseObjectPropertyKey; + parsePrimaryExpression = extra.parsePrimaryExpression; + parsePostfixExpression = extra.parsePostfixExpression; + parseProgram = extra.parseProgram; + parsePropertyFunction = extra.parsePropertyFunction; + parseRelationalExpression = extra.parseRelationalExpression; + parseStatement = extra.parseStatement; + parseShiftExpression = extra.parseShiftExpression; + parseSwitchCase = extra.parseSwitchCase; + parseUnaryExpression = extra.parseUnaryExpression; + parseVariableDeclaration = extra.parseVariableDeclaration; + parseVariableIdentifier = extra.parseVariableIdentifier; + } + + if (typeof extra.scanRegExp === 'function') { + advance = extra.advance; + scanRegExp = extra.scanRegExp; + } + } + + function stringToArray(str) { + var length = str.length, + result = [], + i; + for (i = 0; i < length; ++i) { + result[i] = str.charAt(i); + } + return result; + } + + function parse(code, options) { + var program, toString; + + toString = String; + if (typeof code !== 'string' && !(code instanceof String)) { + code = toString(code); + } + + source = code; + index = 0; + lineNumber = (source.length > 0) ? 1 : 0; + lineStart = 0; + length = source.length; + buffer = null; + state = { + allowIn: true, + labelSet: {}, + inFunctionBody: false, + inIteration: false, + inSwitch: false + }; + + extra = {}; + if (typeof options !== 'undefined') { + extra.range = (typeof options.range === 'boolean') && options.range; + extra.loc = (typeof options.loc === 'boolean') && options.loc; + extra.raw = (typeof options.raw === 'boolean') && options.raw; + if (typeof options.tokens === 'boolean' && options.tokens) { + extra.tokens = []; + } + if (typeof options.comment === 'boolean' && options.comment) { + extra.comments = []; + } + if (typeof options.tolerant === 'boolean' && options.tolerant) { + extra.errors = []; + } + } + + if (length > 0) { + if (typeof source[0] === 'undefined') { + // Try first to convert to a string. This is good as fast path + // for old IE which understands string indexing for string + // literals only and not for string object. + if (code instanceof String) { + source = code.valueOf(); + } + + // Force accessing the characters via an array. + if (typeof source[0] === 'undefined') { + source = stringToArray(code); + } + } + } + + patch(); + try { + program = parseProgram(); + if (typeof extra.comments !== 'undefined') { + filterCommentLocation(); + program.comments = extra.comments; + } + if (typeof extra.tokens !== 'undefined') { + filterTokenLocation(); + program.tokens = extra.tokens; + } + if (typeof extra.errors !== 'undefined') { + program.errors = extra.errors; + } + if (extra.range || extra.loc) { + program.body = filterGroup(program.body); + } + } catch (e) { + throw e; + } finally { + unpatch(); + extra = {}; + } + + return program; + } + + // Sync with package.json. + exports.version = '1.0.4'; + + exports.parse = parse; + + // Deep copy. + exports.Syntax = (function () { + var name, types = {}; + + if (typeof Object.create === 'function') { + types = Object.create(null); + } + + for (name in Syntax) { + if (Syntax.hasOwnProperty(name)) { + types[name] = Syntax[name]; + } + } + + if (typeof Object.freeze === 'function') { + Object.freeze(types); + } + + return types; + }()); + +})); +/* vim: set sw=4 ts=4 et tw=80 : */ diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/package.json b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/package.json new file mode 100644 index 0000000..dc5f573 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/package.json @@ -0,0 +1,59 @@ +{ + "name": "esprima", + "description": "ECMAScript parsing infrastructure for multipurpose analysis", + "homepage": "http://esprima.org", + "main": "esprima.js", + "bin": { + "esparse": "./bin/esparse.js", + "esvalidate": "./bin/esvalidate.js" + }, + "files": [ + "bin", + "test/run.js", + "test/runner.js", + "test/test.js", + "test/compat.js", + "test/reflect.js", + "esprima.js" + ], + "version": "1.0.4", + "engines": { + "node": ">=0.4.0" + }, + "maintainers": [ + { + "name": "Ariya Hidayat", + "email": "ariya.hidayat@gmail.com", + "url": "http://ariya.ofilabs.com" + } + ], + "repository": { + "type": "git", + "url": "http://github.com/ariya/esprima.git" + }, + "licenses": [ + { + "type": "BSD", + "url": "http://github.com/ariya/esprima/raw/master/LICENSE.BSD" + } + ], + "keywords": [ + "ast", + "ecmascript", + "javascript", + "parser", + "syntax" + ], + "scripts": { + "test": "node test/run.js", + "benchmark": "node test/benchmarks.js", + "benchmark-quick": "node test/benchmarks.js quick" + }, + "readme": "**Esprima** ([esprima.org](http://esprima.org)) is a high performance,\nstandard-compliant [ECMAScript](http://www.ecma-international.org/publications/standards/Ecma-262.htm)\nparser written in ECMAScript (also popularly known as\n[JavaScript](http://en.wikipedia.org/wiki/JavaScript>JavaScript)).\nEsprima is created and maintained by [Ariya Hidayat](http://twitter.com/ariyahidayat),\nwith the help of [many contributors](https://github.com/ariya/esprima/contributors).\n\nEsprima runs on web browsers (IE 6+, Firefox 1+, Safari 3+, Chrome 1+, Konqueror 4.6+, Opera 8+) as well as\n[Node.js](http://nodejs.org).\n\n### Features\n\n- Full support for [ECMAScript 5.1](http://www.ecma-international.org/publications/standards/Ecma-262.htm)(ECMA-262)\n- Sensible [syntax tree format](http://esprima.org/doc/index.html#ast) compatible with Mozilla\n[Parser AST](https://developer.mozilla.org/en/SpiderMonkey/Parser_API)\n- Heavily tested (> 550 [unit tests](http://esprima.org/test/) with solid 100% statement coverage)\n- Optional tracking of syntax node location (index-based and line-column)\n- Experimental support for ES6/Harmony (module, class, destructuring, ...)\n\nEsprima is blazing fast (see the [benchmark suite](http://esprima.org/test/benchmarks.html)).\nIt is up to 3x faster than UglifyJS v1 and it is still [competitive](http://esprima.org/test/compare.html)\nwith the new generation of fast parsers.\n\n### Applications\n\nEsprima serves as the basis for many popular JavaScript development tools:\n\n- Code coverage analysis: [node-cover](https://github.com/itay/node-cover), [Istanbul](https://github.com/yahoo/Istanbul)\n- Documentation tool: [JFDoc](https://github.com/thejohnfreeman/jfdoc), [JSDuck](https://github.com/senchalabs/jsduck)\n- Language extension: [LLJS](http://mbebenita.github.com/LLJS/) (low-level JS),\n[Sweet.js](http://sweetjs.org/) (macro)\n- ES6/Harmony transpiler: [Six](https://github.com/matthewrobb/six), [Harmonizr](https://github.com/jdiamond/harmonizr)\n- Eclipse Orion smart editing ([outline view](https://github.com/aclement/esprima-outline), [content assist](http://contraptionsforprogramming.blogspot.com/2012/02/better-javascript-content-assist-in.html))\n- Source code modification: [Esmorph](https://github.com/ariya/esmorph), [Code Painter](https://github.com/fawek/codepainter),\n- Source transformation: [node-falafel](https://github.com/substack/node-falafel), [Esmangle](https://github.com/Constellation/esmangle), [escodegen](https://github.com/Constellation/escodegen)\n\n### Questions?\n- [Documentation](http://esprima.org/doc)\n- [Issue tracker](http://issues.esprima.org): [known problems](http://code.google.com/p/esprima/issues/list?q=Defect)\nand [future plans](http://code.google.com/p/esprima/issues/list?q=Enhancement)\n- [Mailing list](http://groups.google.com/group/esprima)\n- [Contribution guide](http://esprima.org/doc/index.html#contribution)\n\nFollow [@Esprima](http://twitter.com/Esprima) on Twitter to get the\ndevelopment updates.\nFeedback and contribution are welcomed!\n\n### License\n\nCopyright (C) 2012, 2011 [Ariya Hidayat](http://ariya.ofilabs.com/about)\n and other contributors.\n\nRedistribution and use in source and binary forms, with or without\nmodification, are permitted provided that the following conditions are met:\n\n * Redistributions of source code must retain the above copyright\n notice, this list of conditions and the following disclaimer.\n\n * Redistributions in binary form must reproduce the above copyright\n notice, this list of conditions and the following disclaimer in the\n documentation and/or other materials provided with the distribution.\n\nTHIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\nAND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\nIMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\nARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY\nDIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES\n(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;\nLOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND\nON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF\nTHIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/ariya/esprima/issues" + }, + "_id": "esprima@1.0.4", + "_from": "esprima@>=1.0.4 <1.1.0" +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/compat.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/compat.js new file mode 100644 index 0000000..ee3a629 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/compat.js @@ -0,0 +1,239 @@ +/* + Copyright (C) 2012 Joost-Wim Boekesteijn + Copyright (C) 2011 Ariya Hidayat + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint node: true */ +/*global document: true, window:true, esprima: true, testReflect: true */ + +var runTests; + +function getContext(esprima, reportCase, reportFailure) { + 'use strict'; + + var Reflect, Pattern; + + // Maps Mozilla Reflect object to our Esprima parser. + Reflect = { + parse: function (code) { + var result; + + reportCase(code); + + try { + result = esprima.parse(code); + } catch (error) { + result = error; + } + + return result; + } + }; + + // This is used by Reflect test suite to match a syntax tree. + Pattern = function (obj) { + var pattern; + + // Poor man's deep object cloning. + pattern = JSON.parse(JSON.stringify(obj)); + + // Special handling for regular expression literal since we need to + // convert it to a string literal, otherwise it will be decoded + // as object "{}" and the regular expression would be lost. + if (obj.type && obj.type === 'Literal') { + if (obj.value instanceof RegExp) { + pattern = { + type: obj.type, + value: obj.value.toString() + }; + } + } + + // Special handling for branch statement because SpiderMonkey + // prefers to put the 'alternate' property before 'consequent'. + if (obj.type && obj.type === 'IfStatement') { + pattern = { + type: pattern.type, + test: pattern.test, + consequent: pattern.consequent, + alternate: pattern.alternate + }; + } + + // Special handling for do while statement because SpiderMonkey + // prefers to put the 'test' property before 'body'. + if (obj.type && obj.type === 'DoWhileStatement') { + pattern = { + type: pattern.type, + body: pattern.body, + test: pattern.test + }; + } + + function adjustRegexLiteralAndRaw(key, value) { + if (key === 'value' && value instanceof RegExp) { + value = value.toString(); + } else if (key === 'raw' && typeof value === "string") { + // Ignore Esprima-specific 'raw' property. + return undefined; + } + return value; + } + + if (obj.type && (obj.type === 'Program')) { + pattern.assert = function (tree) { + var actual, expected; + actual = JSON.stringify(tree, adjustRegexLiteralAndRaw, 4); + expected = JSON.stringify(obj, null, 4); + + if (expected !== actual) { + reportFailure(expected, actual); + } + }; + } + + return pattern; + }; + + return { + Reflect: Reflect, + Pattern: Pattern + }; +} + +if (typeof window !== 'undefined') { + // Run all tests in a browser environment. + runTests = function () { + 'use strict'; + + var total = 0, + failures = 0; + + function setText(el, str) { + if (typeof el.innerText === 'string') { + el.innerText = str; + } else { + el.textContent = str; + } + } + + function reportCase(code) { + var report, e; + report = document.getElementById('report'); + e = document.createElement('pre'); + e.setAttribute('class', 'code'); + setText(e, code); + report.appendChild(e); + total += 1; + } + + function reportFailure(expected, actual) { + var report, e; + + failures += 1; + + report = document.getElementById('report'); + + e = document.createElement('p'); + setText(e, 'Expected'); + report.appendChild(e); + + e = document.createElement('pre'); + e.setAttribute('class', 'expected'); + setText(e, expected); + report.appendChild(e); + + e = document.createElement('p'); + setText(e, 'Actual'); + report.appendChild(e); + + e = document.createElement('pre'); + e.setAttribute('class', 'actual'); + setText(e, actual); + report.appendChild(e); + } + + setText(document.getElementById('version'), esprima.version); + + window.setTimeout(function () { + var tick, context = getContext(esprima, reportCase, reportFailure); + + tick = new Date(); + testReflect(context.Reflect, context.Pattern); + tick = (new Date()) - tick; + + if (failures > 0) { + setText(document.getElementById('status'), total + ' tests. ' + + 'Failures: ' + failures + '. ' + tick + ' ms'); + } else { + setText(document.getElementById('status'), total + ' tests. ' + + 'No failure. ' + tick + ' ms'); + } + }, 513); + }; +} else { + (function (global) { + 'use strict'; + var esprima = require('../esprima'), + tick, + total = 0, + failures = [], + header, + current, + context; + + function reportCase(code) { + total += 1; + current = code; + } + + function reportFailure(expected, actual) { + failures.push({ + source: current, + expected: expected.toString(), + actual: actual.toString() + }); + } + + context = getContext(esprima, reportCase, reportFailure); + + tick = new Date(); + require('./reflect').testReflect(context.Reflect, context.Pattern); + tick = (new Date()) - tick; + + header = total + ' tests. ' + failures.length + ' failures. ' + + tick + ' ms'; + if (failures.length) { + console.error(header); + failures.forEach(function (failure) { + console.error(failure.source + ': Expected\n ' + + failure.expected.split('\n').join('\n ') + + '\nto match\n ' + failure.actual); + }); + } else { + console.log(header); + } + process.exit(failures.length === 0 ? 0 : 1); + }(this)); +} +/* vim: set sw=4 ts=4 et tw=80 : */ diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/reflect.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/reflect.js new file mode 100644 index 0000000..dba1ba8 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/reflect.js @@ -0,0 +1,422 @@ +// This is modified from Mozilla Reflect.parse test suite (the file is located +// at js/src/tests/js1_8_5/extensions/reflect-parse.js in the source tree). +// +// Some notable changes: +// * Removed unsupported features (destructuring, let, comprehensions...). +// * Removed tests for E4X (ECMAScript for XML). +// * Removed everything related to builder. +// * Enclosed every 'Pattern' construct with a scope. +// * Tweaked some expected tree to remove generator field. +// * Removed the test for bug 632030 and bug 632024. + +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- */ +/* + * Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/licenses/publicdomain/ + */ + +(function (exports) { + +function testReflect(Reflect, Pattern) { + +function program(elts) { return Pattern({ type: "Program", body: elts }) } +function exprStmt(expr) { return Pattern({ type: "ExpressionStatement", expression: expr }) } +function throwStmt(expr) { return Pattern({ type: "ThrowStatement", argument: expr }) } +function returnStmt(expr) { return Pattern({ type: "ReturnStatement", argument: expr }) } +function yieldExpr(expr) { return Pattern({ type: "YieldExpression", argument: expr }) } +function lit(val) { return Pattern({ type: "Literal", value: val }) } +var thisExpr = Pattern({ type: "ThisExpression" }); +function funDecl(id, params, body) { return Pattern({ type: "FunctionDeclaration", + id: id, + params: params, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }) } +function genFunDecl(id, params, body) { return Pattern({ type: "FunctionDeclaration", + id: id, + params: params, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }) } +function declarator(id, init) { return Pattern({ type: "VariableDeclarator", id: id, init: init }) } +function varDecl(decls) { return Pattern({ type: "VariableDeclaration", declarations: decls, kind: "var" }) } +function letDecl(decls) { return Pattern({ type: "VariableDeclaration", declarations: decls, kind: "let" }) } +function constDecl(decls) { return Pattern({ type: "VariableDeclaration", declarations: decls, kind: "const" }) } +function ident(name) { return Pattern({ type: "Identifier", name: name }) } +function dotExpr(obj, id) { return Pattern({ type: "MemberExpression", computed: false, object: obj, property: id }) } +function memExpr(obj, id) { return Pattern({ type: "MemberExpression", computed: true, object: obj, property: id }) } +function forStmt(init, test, update, body) { return Pattern({ type: "ForStatement", init: init, test: test, update: update, body: body }) } +function forInStmt(lhs, rhs, body) { return Pattern({ type: "ForInStatement", left: lhs, right: rhs, body: body, each: false }) } +function forEachInStmt(lhs, rhs, body) { return Pattern({ type: "ForInStatement", left: lhs, right: rhs, body: body, each: true }) } +function breakStmt(lab) { return Pattern({ type: "BreakStatement", label: lab }) } +function continueStmt(lab) { return Pattern({ type: "ContinueStatement", label: lab }) } +function blockStmt(body) { return Pattern({ type: "BlockStatement", body: body }) } +var emptyStmt = Pattern({ type: "EmptyStatement" }); +function ifStmt(test, cons, alt) { return Pattern({ type: "IfStatement", test: test, alternate: alt, consequent: cons }) } +function labStmt(lab, stmt) { return Pattern({ type: "LabeledStatement", label: lab, body: stmt }) } +function withStmt(obj, stmt) { return Pattern({ type: "WithStatement", object: obj, body: stmt }) } +function whileStmt(test, stmt) { return Pattern({ type: "WhileStatement", test: test, body: stmt }) } +function doStmt(stmt, test) { return Pattern({ type: "DoWhileStatement", test: test, body: stmt }) } +function switchStmt(disc, cases) { return Pattern({ type: "SwitchStatement", discriminant: disc, cases: cases }) } +function caseClause(test, stmts) { return Pattern({ type: "SwitchCase", test: test, consequent: stmts }) } +function defaultClause(stmts) { return Pattern({ type: "SwitchCase", test: null, consequent: stmts }) } +function catchClause(id, guard, body) { if (guard) { return Pattern({ type: "GuardedCatchClause", param: id, guard: guard, body: body }) } else { return Pattern({ type: "CatchClause", param: id, body: body }) } } +function tryStmt(body, guarded, catches, fin) { return Pattern({ type: "TryStatement", block: body, guardedHandlers: guarded, handlers: catches, finalizer: fin }) } +function letStmt(head, body) { return Pattern({ type: "LetStatement", head: head, body: body }) } +function funExpr(id, args, body, gen) { return Pattern({ type: "FunctionExpression", + id: id, + params: args, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }) } +function genFunExpr(id, args, body) { return Pattern({ type: "FunctionExpression", + id: id, + params: args, + defaults: [], + body: body, + rest: null, + generator: false, + expression: false + }) } + +function unExpr(op, arg) { return Pattern({ type: "UnaryExpression", operator: op, argument: arg, prefix: true }) } +function binExpr(op, left, right) { return Pattern({ type: "BinaryExpression", operator: op, left: left, right: right }) } +function aExpr(op, left, right) { return Pattern({ type: "AssignmentExpression", operator: op, left: left, right: right }) } +function updExpr(op, arg, prefix) { return Pattern({ type: "UpdateExpression", operator: op, argument: arg, prefix: prefix }) } +function logExpr(op, left, right) { return Pattern({ type: "LogicalExpression", operator: op, left: left, right: right }) } + +function condExpr(test, cons, alt) { return Pattern({ type: "ConditionalExpression", test: test, consequent: cons, alternate: alt }) } +function seqExpr(exprs) { return Pattern({ type: "SequenceExpression", expressions: exprs }) } +function newExpr(callee, args) { return Pattern({ type: "NewExpression", callee: callee, arguments: args }) } +function callExpr(callee, args) { return Pattern({ type: "CallExpression", callee: callee, arguments: args }) } +function arrExpr(elts) { return Pattern({ type: "ArrayExpression", elements: elts }) } +function objExpr(elts) { return Pattern({ type: "ObjectExpression", properties: elts }) } +function objProp(key, value, kind) { return Pattern({ type: "Property", key: key, value: value, kind: kind }) } + +function arrPatt(elts) { return Pattern({ type: "ArrayPattern", elements: elts }) } +function objPatt(elts) { return Pattern({ type: "ObjectPattern", properties: elts }) } + +function localSrc(src) { return "(function(){ " + src + " })" } +function localPatt(patt) { return program([exprStmt(funExpr(null, [], blockStmt([patt])))]) } +function blockSrc(src) { return "(function(){ { " + src + " } })" } +function blockPatt(patt) { return program([exprStmt(funExpr(null, [], blockStmt([blockStmt([patt])])))]) } + +function assertBlockStmt(src, patt) { + blockPatt(patt).assert(Reflect.parse(blockSrc(src))); +} + +function assertBlockExpr(src, patt) { + assertBlockStmt(src, exprStmt(patt)); +} + +function assertBlockDecl(src, patt, builder) { + blockPatt(patt).assert(Reflect.parse(blockSrc(src), {builder: builder})); +} + +function assertLocalStmt(src, patt) { + localPatt(patt).assert(Reflect.parse(localSrc(src))); +} + +function assertLocalExpr(src, patt) { + assertLocalStmt(src, exprStmt(patt)); +} + +function assertLocalDecl(src, patt) { + localPatt(patt).assert(Reflect.parse(localSrc(src))); +} + +function assertGlobalStmt(src, patt, builder) { + program([patt]).assert(Reflect.parse(src, {builder: builder})); +} + +function assertGlobalExpr(src, patt, builder) { + program([exprStmt(patt)]).assert(Reflect.parse(src, {builder: builder})); + //assertStmt(src, exprStmt(patt)); +} + +function assertGlobalDecl(src, patt) { + program([patt]).assert(Reflect.parse(src)); +} + +function assertProg(src, patt) { + program(patt).assert(Reflect.parse(src)); +} + +function assertStmt(src, patt) { + assertLocalStmt(src, patt); + assertGlobalStmt(src, patt); + assertBlockStmt(src, patt); +} + +function assertExpr(src, patt) { + assertLocalExpr(src, patt); + assertGlobalExpr(src, patt); + assertBlockExpr(src, patt); +} + +function assertDecl(src, patt) { + assertLocalDecl(src, patt); + assertGlobalDecl(src, patt); + assertBlockDecl(src, patt); +} + +function assertError(src, errorType) { + try { + Reflect.parse(src); + } catch (e) { + return; + } + throw new Error("expected " + errorType.name + " for " + uneval(src)); +} + + +// general tests + +// NB: These are useful but for now jit-test doesn't do I/O reliably. + +//program(_).assert(Reflect.parse(snarf('data/flapjax.txt'))); +//program(_).assert(Reflect.parse(snarf('data/jquery-1.4.2.txt'))); +//program(_).assert(Reflect.parse(snarf('data/prototype.js'))); +//program(_).assert(Reflect.parse(snarf('data/dojo.js.uncompressed.js'))); +//program(_).assert(Reflect.parse(snarf('data/mootools-1.2.4-core-nc.js'))); + + +// declarations + +assertDecl("var x = 1, y = 2, z = 3", + varDecl([declarator(ident("x"), lit(1)), + declarator(ident("y"), lit(2)), + declarator(ident("z"), lit(3))])); +assertDecl("var x, y, z", + varDecl([declarator(ident("x"), null), + declarator(ident("y"), null), + declarator(ident("z"), null)])); +assertDecl("function foo() { }", + funDecl(ident("foo"), [], blockStmt([]))); +assertDecl("function foo() { return 42 }", + funDecl(ident("foo"), [], blockStmt([returnStmt(lit(42))]))); + + +// Bug 591437: rebound args have their defs turned into uses +assertDecl("function f(a) { function a() { } }", + funDecl(ident("f"), [ident("a")], blockStmt([funDecl(ident("a"), [], blockStmt([]))]))); +assertDecl("function f(a,b,c) { function b() { } }", + funDecl(ident("f"), [ident("a"),ident("b"),ident("c")], blockStmt([funDecl(ident("b"), [], blockStmt([]))]))); + +// expressions + +assertExpr("true", lit(true)); +assertExpr("false", lit(false)); +assertExpr("42", lit(42)); +assertExpr("(/asdf/)", lit(/asdf/)); +assertExpr("this", thisExpr); +assertExpr("foo", ident("foo")); +assertExpr("foo.bar", dotExpr(ident("foo"), ident("bar"))); +assertExpr("foo[bar]", memExpr(ident("foo"), ident("bar"))); +assertExpr("(function(){})", funExpr(null, [], blockStmt([]))); +assertExpr("(function f() {})", funExpr(ident("f"), [], blockStmt([]))); +assertExpr("(function f(x,y,z) {})", funExpr(ident("f"), [ident("x"),ident("y"),ident("z")], blockStmt([]))); +assertExpr("(++x)", updExpr("++", ident("x"), true)); +assertExpr("(x++)", updExpr("++", ident("x"), false)); +assertExpr("(+x)", unExpr("+", ident("x"))); +assertExpr("(-x)", unExpr("-", ident("x"))); +assertExpr("(!x)", unExpr("!", ident("x"))); +assertExpr("(~x)", unExpr("~", ident("x"))); +assertExpr("(delete x)", unExpr("delete", ident("x"))); +assertExpr("(typeof x)", unExpr("typeof", ident("x"))); +assertExpr("(void x)", unExpr("void", ident("x"))); +assertExpr("(x == y)", binExpr("==", ident("x"), ident("y"))); +assertExpr("(x != y)", binExpr("!=", ident("x"), ident("y"))); +assertExpr("(x === y)", binExpr("===", ident("x"), ident("y"))); +assertExpr("(x !== y)", binExpr("!==", ident("x"), ident("y"))); +assertExpr("(x < y)", binExpr("<", ident("x"), ident("y"))); +assertExpr("(x <= y)", binExpr("<=", ident("x"), ident("y"))); +assertExpr("(x > y)", binExpr(">", ident("x"), ident("y"))); +assertExpr("(x >= y)", binExpr(">=", ident("x"), ident("y"))); +assertExpr("(x << y)", binExpr("<<", ident("x"), ident("y"))); +assertExpr("(x >> y)", binExpr(">>", ident("x"), ident("y"))); +assertExpr("(x >>> y)", binExpr(">>>", ident("x"), ident("y"))); +assertExpr("(x + y)", binExpr("+", ident("x"), ident("y"))); +assertExpr("(w + x + y + z)", binExpr("+", binExpr("+", binExpr("+", ident("w"), ident("x")), ident("y")), ident("z"))); +assertExpr("(x - y)", binExpr("-", ident("x"), ident("y"))); +assertExpr("(w - x - y - z)", binExpr("-", binExpr("-", binExpr("-", ident("w"), ident("x")), ident("y")), ident("z"))); +assertExpr("(x * y)", binExpr("*", ident("x"), ident("y"))); +assertExpr("(x / y)", binExpr("/", ident("x"), ident("y"))); +assertExpr("(x % y)", binExpr("%", ident("x"), ident("y"))); +assertExpr("(x | y)", binExpr("|", ident("x"), ident("y"))); +assertExpr("(x ^ y)", binExpr("^", ident("x"), ident("y"))); +assertExpr("(x & y)", binExpr("&", ident("x"), ident("y"))); +assertExpr("(x in y)", binExpr("in", ident("x"), ident("y"))); +assertExpr("(x instanceof y)", binExpr("instanceof", ident("x"), ident("y"))); +assertExpr("(x = y)", aExpr("=", ident("x"), ident("y"))); +assertExpr("(x += y)", aExpr("+=", ident("x"), ident("y"))); +assertExpr("(x -= y)", aExpr("-=", ident("x"), ident("y"))); +assertExpr("(x *= y)", aExpr("*=", ident("x"), ident("y"))); +assertExpr("(x /= y)", aExpr("/=", ident("x"), ident("y"))); +assertExpr("(x %= y)", aExpr("%=", ident("x"), ident("y"))); +assertExpr("(x <<= y)", aExpr("<<=", ident("x"), ident("y"))); +assertExpr("(x >>= y)", aExpr(">>=", ident("x"), ident("y"))); +assertExpr("(x >>>= y)", aExpr(">>>=", ident("x"), ident("y"))); +assertExpr("(x |= y)", aExpr("|=", ident("x"), ident("y"))); +assertExpr("(x ^= y)", aExpr("^=", ident("x"), ident("y"))); +assertExpr("(x &= y)", aExpr("&=", ident("x"), ident("y"))); +assertExpr("(x || y)", logExpr("||", ident("x"), ident("y"))); +assertExpr("(x && y)", logExpr("&&", ident("x"), ident("y"))); +assertExpr("(w || x || y || z)", logExpr("||", logExpr("||", logExpr("||", ident("w"), ident("x")), ident("y")), ident("z"))) +assertExpr("(x ? y : z)", condExpr(ident("x"), ident("y"), ident("z"))); +assertExpr("(x,y)", seqExpr([ident("x"),ident("y")])) +assertExpr("(x,y,z)", seqExpr([ident("x"),ident("y"),ident("z")])) +assertExpr("(a,b,c,d,e,f,g)", seqExpr([ident("a"),ident("b"),ident("c"),ident("d"),ident("e"),ident("f"),ident("g")])); +assertExpr("(new Object)", newExpr(ident("Object"), [])); +assertExpr("(new Object())", newExpr(ident("Object"), [])); +assertExpr("(new Object(42))", newExpr(ident("Object"), [lit(42)])); +assertExpr("(new Object(1,2,3))", newExpr(ident("Object"), [lit(1),lit(2),lit(3)])); +assertExpr("(String())", callExpr(ident("String"), [])); +assertExpr("(String(42))", callExpr(ident("String"), [lit(42)])); +assertExpr("(String(1,2,3))", callExpr(ident("String"), [lit(1),lit(2),lit(3)])); +assertExpr("[]", arrExpr([])); +assertExpr("[1]", arrExpr([lit(1)])); +assertExpr("[1,2]", arrExpr([lit(1),lit(2)])); +assertExpr("[1,2,3]", arrExpr([lit(1),lit(2),lit(3)])); +assertExpr("[1,,2,3]", arrExpr([lit(1),,lit(2),lit(3)])); +assertExpr("[1,,,2,3]", arrExpr([lit(1),,,lit(2),lit(3)])); +assertExpr("[1,,,2,,3]", arrExpr([lit(1),,,lit(2),,lit(3)])); +assertExpr("[1,,,2,,,3]", arrExpr([lit(1),,,lit(2),,,lit(3)])); +assertExpr("[,1,2,3]", arrExpr([,lit(1),lit(2),lit(3)])); +assertExpr("[,,1,2,3]", arrExpr([,,lit(1),lit(2),lit(3)])); +assertExpr("[,,,1,2,3]", arrExpr([,,,lit(1),lit(2),lit(3)])); +assertExpr("[,,,1,2,3,]", arrExpr([,,,lit(1),lit(2),lit(3)])); +assertExpr("[,,,1,2,3,,]", arrExpr([,,,lit(1),lit(2),lit(3),undefined])); +assertExpr("[,,,1,2,3,,,]", arrExpr([,,,lit(1),lit(2),lit(3),undefined,undefined])); +assertExpr("[,,,,,]", arrExpr([undefined,undefined,undefined,undefined,undefined])); +assertExpr("({})", objExpr([])); +assertExpr("({x:1})", objExpr([objProp(ident("x"), lit(1), "init")])); +assertExpr("({x:1, y:2})", objExpr([objProp(ident("x"), lit(1), "init"), + objProp(ident("y"), lit(2), "init")])); +assertExpr("({x:1, y:2, z:3})", objExpr([objProp(ident("x"), lit(1), "init"), + objProp(ident("y"), lit(2), "init"), + objProp(ident("z"), lit(3), "init") ])); +assertExpr("({x:1, 'y':2, z:3})", objExpr([objProp(ident("x"), lit(1), "init"), + objProp(lit("y"), lit(2), "init"), + objProp(ident("z"), lit(3), "init") ])); +assertExpr("({'x':1, 'y':2, z:3})", objExpr([objProp(lit("x"), lit(1), "init"), + objProp(lit("y"), lit(2), "init"), + objProp(ident("z"), lit(3), "init") ])); +assertExpr("({'x':1, 'y':2, 3:3})", objExpr([objProp(lit("x"), lit(1), "init"), + objProp(lit("y"), lit(2), "init"), + objProp(lit(3), lit(3), "init") ])); + +// Bug 571617: eliminate constant-folding +assertExpr("2 + 3", binExpr("+", lit(2), lit(3))); + +// Bug 632026: constant-folding +assertExpr("typeof(0?0:a)", unExpr("typeof", condExpr(lit(0), lit(0), ident("a")))); + +// Bug 632056: constant-folding +program([exprStmt(ident("f")), + ifStmt(lit(1), + funDecl(ident("f"), [], blockStmt([])), + null)]).assert(Reflect.parse("f; if (1) function f(){}")); + +// statements + +assertStmt("throw 42", throwStmt(lit(42))); +assertStmt("for (;;) break", forStmt(null, null, null, breakStmt(null))); +assertStmt("for (x; y; z) break", forStmt(ident("x"), ident("y"), ident("z"), breakStmt(null))); +assertStmt("for (var x; y; z) break", forStmt(varDecl([declarator(ident("x"), null)]), ident("y"), ident("z"), breakStmt(null))); +assertStmt("for (var x = 42; y; z) break", forStmt(varDecl([declarator(ident("x"), lit(42))]), ident("y"), ident("z"), breakStmt(null))); +assertStmt("for (x; ; z) break", forStmt(ident("x"), null, ident("z"), breakStmt(null))); +assertStmt("for (var x; ; z) break", forStmt(varDecl([declarator(ident("x"), null)]), null, ident("z"), breakStmt(null))); +assertStmt("for (var x = 42; ; z) break", forStmt(varDecl([declarator(ident("x"), lit(42))]), null, ident("z"), breakStmt(null))); +assertStmt("for (x; y; ) break", forStmt(ident("x"), ident("y"), null, breakStmt(null))); +assertStmt("for (var x; y; ) break", forStmt(varDecl([declarator(ident("x"), null)]), ident("y"), null, breakStmt(null))); +assertStmt("for (var x = 42; y; ) break", forStmt(varDecl([declarator(ident("x"),lit(42))]), ident("y"), null, breakStmt(null))); +assertStmt("for (var x in y) break", forInStmt(varDecl([declarator(ident("x"),null)]), ident("y"), breakStmt(null))); +assertStmt("for (x in y) break", forInStmt(ident("x"), ident("y"), breakStmt(null))); +assertStmt("{ }", blockStmt([])); +assertStmt("{ throw 1; throw 2; throw 3; }", blockStmt([ throwStmt(lit(1)), throwStmt(lit(2)), throwStmt(lit(3))])); +assertStmt(";", emptyStmt); +assertStmt("if (foo) throw 42;", ifStmt(ident("foo"), throwStmt(lit(42)), null)); +assertStmt("if (foo) throw 42; else true;", ifStmt(ident("foo"), throwStmt(lit(42)), exprStmt(lit(true)))); +assertStmt("if (foo) { throw 1; throw 2; throw 3; }", + ifStmt(ident("foo"), + blockStmt([throwStmt(lit(1)), throwStmt(lit(2)), throwStmt(lit(3))]), + null)); +assertStmt("if (foo) { throw 1; throw 2; throw 3; } else true;", + ifStmt(ident("foo"), + blockStmt([throwStmt(lit(1)), throwStmt(lit(2)), throwStmt(lit(3))]), + exprStmt(lit(true)))); +assertStmt("foo: for(;;) break foo;", labStmt(ident("foo"), forStmt(null, null, null, breakStmt(ident("foo"))))); +assertStmt("foo: for(;;) continue foo;", labStmt(ident("foo"), forStmt(null, null, null, continueStmt(ident("foo"))))); +assertStmt("with (obj) { }", withStmt(ident("obj"), blockStmt([]))); +assertStmt("with (obj) { obj; }", withStmt(ident("obj"), blockStmt([exprStmt(ident("obj"))]))); +assertStmt("while (foo) { }", whileStmt(ident("foo"), blockStmt([]))); +assertStmt("while (foo) { foo; }", whileStmt(ident("foo"), blockStmt([exprStmt(ident("foo"))]))); +assertStmt("do { } while (foo);", doStmt(blockStmt([]), ident("foo"))); +assertStmt("do { foo; } while (foo)", doStmt(blockStmt([exprStmt(ident("foo"))]), ident("foo"))); +assertStmt("switch (foo) { case 1: 1; break; case 2: 2; break; default: 3; }", + switchStmt(ident("foo"), + [ caseClause(lit(1), [ exprStmt(lit(1)), breakStmt(null) ]), + caseClause(lit(2), [ exprStmt(lit(2)), breakStmt(null) ]), + defaultClause([ exprStmt(lit(3)) ]) ])); +assertStmt("switch (foo) { case 1: 1; break; case 2: 2; break; default: 3; case 42: 42; }", + switchStmt(ident("foo"), + [ caseClause(lit(1), [ exprStmt(lit(1)), breakStmt(null) ]), + caseClause(lit(2), [ exprStmt(lit(2)), breakStmt(null) ]), + defaultClause([ exprStmt(lit(3)) ]), + caseClause(lit(42), [ exprStmt(lit(42)) ]) ])); +assertStmt("try { } catch (e) { }", + tryStmt(blockStmt([]), + [], + [ catchClause(ident("e"), null, blockStmt([])) ], + null)); +assertStmt("try { } catch (e) { } finally { }", + tryStmt(blockStmt([]), + [], + [ catchClause(ident("e"), null, blockStmt([])) ], + blockStmt([]))); +assertStmt("try { } finally { }", + tryStmt(blockStmt([]), + [], + [], + blockStmt([]))); + +// redeclarations (TOK_NAME nodes with lexdef) + +assertStmt("function f() { function g() { } function g() { } }", + funDecl(ident("f"), [], blockStmt([funDecl(ident("g"), [], blockStmt([])), + funDecl(ident("g"), [], blockStmt([]))]))); + +assertStmt("function f() { function g() { } function g() { return 42 } }", + funDecl(ident("f"), [], blockStmt([funDecl(ident("g"), [], blockStmt([])), + funDecl(ident("g"), [], blockStmt([returnStmt(lit(42))]))]))); + +assertStmt("function f() { var x = 42; var x = 43; }", + funDecl(ident("f"), [], blockStmt([varDecl([declarator(ident("x"),lit(42))]), + varDecl([declarator(ident("x"),lit(43))])]))); + +// getters and setters + + assertExpr("({ get x() { return 42 } })", + objExpr([ objProp(ident("x"), + funExpr(null, [], blockStmt([returnStmt(lit(42))])), + "get" ) ])); + assertExpr("({ set x(v) { return 42 } })", + objExpr([ objProp(ident("x"), + funExpr(null, [ident("v")], blockStmt([returnStmt(lit(42))])), + "set" ) ])); + +} + +exports.testReflect = testReflect; + +}(typeof exports === 'undefined' ? this : exports)); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/run.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/run.js new file mode 100644 index 0000000..32ca3fa --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/run.js @@ -0,0 +1,66 @@ +/* + Copyright (C) 2012 Yusuke Suzuki + Copyright (C) 2012 Ariya Hidayat + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint node:true */ + +(function () { + 'use strict'; + + var child = require('child_process'), + nodejs = '"' + process.execPath + '"', + ret = 0, + suites, + index; + + suites = [ + 'runner', + 'compat' + ]; + + function nextTest() { + var suite = suites[index]; + + if (index < suites.length) { + child.exec(nodejs + ' ./test/' + suite + '.js', function (err, stdout, stderr) { + if (stdout) { + process.stdout.write(suite + ': ' + stdout); + } + if (stderr) { + process.stderr.write(suite + ': ' + stderr); + } + if (err) { + ret = err.code; + } + index += 1; + nextTest(); + }); + } else { + process.exit(ret); + } + } + + index = 0; + nextTest(); +}()); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/runner.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/runner.js new file mode 100644 index 0000000..c1a3fc9 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/runner.js @@ -0,0 +1,387 @@ +/* + Copyright (C) 2012 Ariya Hidayat + Copyright (C) 2012 Joost-Wim Boekesteijn + Copyright (C) 2012 Yusuke Suzuki + Copyright (C) 2012 Arpad Borsos + Copyright (C) 2011 Ariya Hidayat + Copyright (C) 2011 Yusuke Suzuki + Copyright (C) 2011 Arpad Borsos + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/*jslint browser:true node:true */ +/*global esprima:true, testFixture:true */ + +var runTests; + +// Special handling for regular expression literal since we need to +// convert it to a string literal, otherwise it will be decoded +// as object "{}" and the regular expression would be lost. +function adjustRegexLiteral(key, value) { + 'use strict'; + if (key === 'value' && value instanceof RegExp) { + value = value.toString(); + } + return value; +} + +function NotMatchingError(expected, actual) { + 'use strict'; + Error.call(this, 'Expected '); + this.expected = expected; + this.actual = actual; +} +NotMatchingError.prototype = new Error(); + +function errorToObject(e) { + 'use strict'; + var msg = e.toString(); + + // Opera 9.64 produces an non-standard string in toString(). + if (msg.substr(0, 6) !== 'Error:') { + if (typeof e.message === 'string') { + msg = 'Error: ' + e.message; + } + } + + return { + index: e.index, + lineNumber: e.lineNumber, + column: e.column, + message: msg + }; +} + +function testParse(esprima, code, syntax) { + 'use strict'; + var expected, tree, actual, options, StringObject, i, len, err; + + // alias, so that JSLint does not complain. + StringObject = String; + + options = { + comment: (typeof syntax.comments !== 'undefined'), + range: true, + loc: true, + tokens: (typeof syntax.tokens !== 'undefined'), + raw: true, + tolerant: (typeof syntax.errors !== 'undefined') + }; + + if (typeof syntax.tokens !== 'undefined') { + if (syntax.tokens.length > 0) { + options.range = (typeof syntax.tokens[0].range !== 'undefined'); + options.loc = (typeof syntax.tokens[0].loc !== 'undefined'); + } + } + + if (typeof syntax.comments !== 'undefined') { + if (syntax.comments.length > 0) { + options.range = (typeof syntax.comments[0].range !== 'undefined'); + options.loc = (typeof syntax.comments[0].loc !== 'undefined'); + } + } + + expected = JSON.stringify(syntax, null, 4); + try { + tree = esprima.parse(code, options); + tree = (options.comment || options.tokens || options.tolerant) ? tree : tree.body[0]; + + if (options.tolerant) { + for (i = 0, len = tree.errors.length; i < len; i += 1) { + tree.errors[i] = errorToObject(tree.errors[i]); + } + } + + actual = JSON.stringify(tree, adjustRegexLiteral, 4); + + // Only to ensure that there is no error when using string object. + esprima.parse(new StringObject(code), options); + + } catch (e) { + throw new NotMatchingError(expected, e.toString()); + } + if (expected !== actual) { + throw new NotMatchingError(expected, actual); + } + + function filter(key, value) { + if (key === 'value' && value instanceof RegExp) { + value = value.toString(); + } + return (key === 'loc' || key === 'range') ? undefined : value; + } + + if (options.tolerant) { + return; + } + + + // Check again without any location info. + options.range = false; + options.loc = false; + expected = JSON.stringify(syntax, filter, 4); + try { + tree = esprima.parse(code, options); + tree = (options.comment || options.tokens) ? tree : tree.body[0]; + + if (options.tolerant) { + for (i = 0, len = tree.errors.length; i < len; i += 1) { + tree.errors[i] = errorToObject(tree.errors[i]); + } + } + + actual = JSON.stringify(tree, filter, 4); + } catch (e) { + throw new NotMatchingError(expected, e.toString()); + } + if (expected !== actual) { + throw new NotMatchingError(expected, actual); + } +} + +function testError(esprima, code, exception) { + 'use strict'; + var i, options, expected, actual, handleInvalidRegexFlag; + + // Different parsing options should give the same error. + options = [ + {}, + { comment: true }, + { raw: true }, + { raw: true, comment: true } + ]; + + // If handleInvalidRegexFlag is true, an invalid flag in a regular expression + // will throw an exception. In some old version V8, this is not the case + // and hence handleInvalidRegexFlag is false. + handleInvalidRegexFlag = false; + try { + 'test'.match(new RegExp('[a-z]', 'x')); + } catch (e) { + handleInvalidRegexFlag = true; + } + + expected = JSON.stringify(exception); + + for (i = 0; i < options.length; i += 1) { + + try { + esprima.parse(code, options[i]); + } catch (e) { + actual = JSON.stringify(errorToObject(e)); + } + + if (expected !== actual) { + + // Compensate for old V8 which does not handle invalid flag. + if (exception.message.indexOf('Invalid regular expression') > 0) { + if (typeof actual === 'undefined' && !handleInvalidRegexFlag) { + return; + } + } + + throw new NotMatchingError(expected, actual); + } + + } +} + +function testAPI(esprima, code, result) { + 'use strict'; + var expected, res, actual; + + expected = JSON.stringify(result.result, null, 4); + try { + if (typeof result.property !== 'undefined') { + res = esprima[result.property]; + } else { + res = esprima[result.call].apply(esprima, result.args); + } + actual = JSON.stringify(res, adjustRegexLiteral, 4); + } catch (e) { + throw new NotMatchingError(expected, e.toString()); + } + if (expected !== actual) { + throw new NotMatchingError(expected, actual); + } +} + +function runTest(esprima, code, result) { + 'use strict'; + if (result.hasOwnProperty('lineNumber')) { + testError(esprima, code, result); + } else if (result.hasOwnProperty('result')) { + testAPI(esprima, code, result); + } else { + testParse(esprima, code, result); + } +} + +if (typeof window !== 'undefined') { + // Run all tests in a browser environment. + runTests = function () { + 'use strict'; + var total = 0, + failures = 0, + category, + fixture, + source, + tick, + expected, + index, + len; + + function setText(el, str) { + if (typeof el.innerText === 'string') { + el.innerText = str; + } else { + el.textContent = str; + } + } + + function startCategory(category) { + var report, e; + report = document.getElementById('report'); + e = document.createElement('h4'); + setText(e, category); + report.appendChild(e); + } + + function reportSuccess(code) { + var report, e; + report = document.getElementById('report'); + e = document.createElement('pre'); + e.setAttribute('class', 'code'); + setText(e, code); + report.appendChild(e); + } + + function reportFailure(code, expected, actual) { + var report, e; + + report = document.getElementById('report'); + + e = document.createElement('p'); + setText(e, 'Code:'); + report.appendChild(e); + + e = document.createElement('pre'); + e.setAttribute('class', 'code'); + setText(e, code); + report.appendChild(e); + + e = document.createElement('p'); + setText(e, 'Expected'); + report.appendChild(e); + + e = document.createElement('pre'); + e.setAttribute('class', 'expected'); + setText(e, expected); + report.appendChild(e); + + e = document.createElement('p'); + setText(e, 'Actual'); + report.appendChild(e); + + e = document.createElement('pre'); + e.setAttribute('class', 'actual'); + setText(e, actual); + report.appendChild(e); + } + + setText(document.getElementById('version'), esprima.version); + + tick = new Date(); + for (category in testFixture) { + if (testFixture.hasOwnProperty(category)) { + startCategory(category); + fixture = testFixture[category]; + for (source in fixture) { + if (fixture.hasOwnProperty(source)) { + expected = fixture[source]; + total += 1; + try { + runTest(esprima, source, expected); + reportSuccess(source, JSON.stringify(expected, null, 4)); + } catch (e) { + failures += 1; + reportFailure(source, e.expected, e.actual); + } + } + } + } + } + tick = (new Date()) - tick; + + if (failures > 0) { + setText(document.getElementById('status'), total + ' tests. ' + + 'Failures: ' + failures + '. ' + tick + ' ms'); + } else { + setText(document.getElementById('status'), total + ' tests. ' + + 'No failure. ' + tick + ' ms'); + } + }; +} else { + (function () { + 'use strict'; + + var esprima = require('../esprima'), + vm = require('vm'), + fs = require('fs'), + total = 0, + failures = [], + tick = new Date(), + expected, + header; + + vm.runInThisContext(fs.readFileSync(__dirname + '/test.js', 'utf-8')); + + Object.keys(testFixture).forEach(function (category) { + Object.keys(testFixture[category]).forEach(function (source) { + total += 1; + expected = testFixture[category][source]; + try { + runTest(esprima, source, expected); + } catch (e) { + e.source = source; + failures.push(e); + } + }); + }); + tick = (new Date()) - tick; + + header = total + ' tests. ' + failures.length + ' failures. ' + + tick + ' ms'; + if (failures.length) { + console.error(header); + failures.forEach(function (failure) { + console.error(failure.source + ': Expected\n ' + + failure.expected.split('\n').join('\n ') + + '\nto match\n ' + failure.actual); + }); + } else { + console.log(header); + } + process.exit(failures.length === 0 ? 0 : 1); + }()); +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/test.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/test.js new file mode 100644 index 0000000..8ceee54 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/node_modules/esprima/test/test.js @@ -0,0 +1,20238 @@ +/* + Copyright (C) 2012 Ariya Hidayat + Copyright (C) 2012 Joost-Wim Boekesteijn + Copyright (C) 2012 Yusuke Suzuki + Copyright (C) 2012 Arpad Borsos + Copyright (C) 2011 Ariya Hidayat + Copyright (C) 2011 Yusuke Suzuki + Copyright (C) 2011 Arpad Borsos + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES + (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND + ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +var testFixture = { + + 'Primary Expression': { + + 'this\n': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'ThisExpression', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 0 } + } + }], + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 0 } + }, + tokens: [{ + type: 'Keyword', + value: 'this', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }] + }, + + 'null\n': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: null, + raw: 'null', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 0 } + } + }], + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 0 } + }, + tokens: [{ + type: 'Null', + value: 'null', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }] + }, + + '\n 42\n\n': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }, + range: [5, 9], + loc: { + start: { line: 2, column: 4 }, + end: { line: 4, column: 0 } + } + }], + range: [5, 9], + loc: { + start: { line: 2, column: 4 }, + end: { line: 4, column: 0 } + }, + tokens: [{ + type: 'Numeric', + value: '42', + range: [5, 7], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }] + }, + + '(1 + 2 ) * 3': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Literal', + value: 1, + raw: '1', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'Literal', + value: 2, + raw: '2', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [1, 6], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Literal', + value: 3, + raw: '3', + range: [11, 12], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + } + + }, + + 'Grouping Operator': { + + '(1) + (2 ) + 3': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Literal', + value: 1, + raw: '1', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'Literal', + value: 2, + raw: '2', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + right: { + type: 'Literal', + value: 3, + raw: '3', + range: [14, 15], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + + '4 + 5 << (6)': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<<', + left: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Literal', + value: 4, + raw: '4', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 5, + raw: '5', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Literal', + value: 6, + raw: '6', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + } + + }, + + 'Array Initializer': { + + 'x = []': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }], + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + }, + tokens: [{ + type: 'Identifier', + value: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, { + type: 'Punctuator', + value: '=', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Punctuator', + value: '[', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: ']', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }] + }, + + 'x = [ ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x = [ 42 ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [{ + type: 'Literal', + value: 42, + raw: '42', + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }], + range: [4, 10], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + + 'x = [ 42, ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [{ + type: 'Literal', + value: 42, + raw: '42', + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }], + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'x = [ ,, 42 ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [ + null, + null, + { + type: 'Literal', + value: 42, + raw: '42', + range: [9, 11], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 11 } + } + }], + range: [4, 13], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'x = [ 1, 2, 3, ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [{ + type: 'Literal', + value: 1, + raw: '1', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'Literal', + value: 2, + raw: '2', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, { + type: 'Literal', + value: 3, + raw: '3', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }], + range: [4, 16], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + 'x = [ 1, 2,, 3, ]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ArrayExpression', + elements: [{ + type: 'Literal', + value: 1, + raw: '1', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'Literal', + value: 2, + raw: '2', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, null, { + type: 'Literal', + value: 3, + raw: '3', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }], + range: [4, 17], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + '日本語 = []': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: '日本語', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'T\u203F = []': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'T\u203F', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'T\u200C = []': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'T\u200C', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'T\u200D = []': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'T\u200D', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '\u2163\u2161 = []': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: '\u2163\u2161', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '\u2163\u2161\u200A=\u2009[]': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: '\u2163\u2161', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + } + + }, + + 'Object Initializer': { + + 'x = {}': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [], + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x = { }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x = { answer: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'answer', + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [14, 16], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 16 } + } + }, + kind: 'init', + range: [6, 16], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 16 } + } + }], + range: [4, 18], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 18 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }, + + 'x = { if: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'if', + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + kind: 'init', + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }], + range: [4, 14], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + 'x = { true: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'true', + range: [6, 10], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 10 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [12, 14], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 14 } + } + }, + kind: 'init', + range: [6, 14], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 14 } + } + }], + range: [4, 16], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + 'x = { false: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'false', + range: [6, 11], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 11 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [13, 15], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 15 } + } + }, + kind: 'init', + range: [6, 15], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 15 } + } + }], + range: [4, 17], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + 'x = { null: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'null', + range: [6, 10], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 10 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [12, 14], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 14 } + } + }, + kind: 'init', + range: [6, 14], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 14 } + } + }], + range: [4, 16], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + 'x = { "answer": 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 'answer', + raw: '"answer"', + range: [6, 14], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 14 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [16, 18], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 18 } + } + }, + kind: 'init', + range: [6, 18], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 18 } + } + }], + range: [4, 20], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 20 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + + 'x = { x: 1, x: 2 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [ + { + type: 'Property', + key: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + value: { + type: 'Literal', + value: 1, + raw: '1', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + kind: 'init', + range: [6, 10], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 10 } + } + }, + { + type: 'Property', + key: { + type: 'Identifier', + name: 'x', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + value: { + type: 'Literal', + value: 2, + raw: '2', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, + kind: 'init', + range: [12, 16], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 16 } + } + } + ], + range: [4, 18], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 18 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }, + + 'x = { get width() { return m_width } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'width', + range: [10, 15], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ReturnStatement', + argument: { + type: 'Identifier', + name: 'm_width', + range: [27, 34], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 34 } + } + }, + range: [20, 35], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 35 } + } + }], + range: [18, 36], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 36 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 36], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 36 } + } + }, + kind: 'get', + range: [6, 36], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 36 } + } + }], + range: [4, 38], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 38 } + } + }, + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + + 'x = { get undef() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'undef', + range: [10, 15], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + kind: 'get', + range: [6, 20], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 20 } + } + }], + range: [4, 22], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + + 'x = { get if() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'if', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + kind: 'get', + range: [6, 17], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 17 } + } + }], + range: [4, 19], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + + 'x = { get true() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'true', + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [17, 19], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 19 } + } + }, + rest: null, + generator: false, + expression: false, + range: [17, 19], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 19 } + } + }, + kind: 'get', + range: [6, 19], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 19 } + } + }], + range: [4, 21], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + + 'x = { get false() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'false', + range: [10, 15], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + kind: 'get', + range: [6, 20], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 20 } + } + }], + range: [4, 22], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + + 'x = { get null() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'null', + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [17, 19], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 19 } + } + }, + rest: null, + generator: false, + expression: false, + range: [17, 19], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 19 } + } + }, + kind: 'get', + range: [6, 19], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 19 } + } + }], + range: [4, 21], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + + 'x = { get "undef"() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 'undef', + raw: '"undef"', + range: [10, 17], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 17 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [20, 22], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 22 } + } + }, + rest: null, + generator: false, + expression: false, + range: [20, 22], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 22 } + } + }, + kind: 'get', + range: [6, 22], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 22 } + } + }], + range: [4, 24], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'x = { get 10() {} }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 10, + raw: '10', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + kind: 'get', + range: [6, 17], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 17 } + } + }], + range: [4, 19], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + + 'x = { set width(w) { m_width = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'width', + range: [10, 15], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_width', + range: [21, 28], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 28 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [31, 32], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 32 } + } + }, + range: [21, 32], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 32 } + } + }, + range: [21, 33], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 33 } + } + }], + range: [19, 34], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [19, 34], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 34 } + } + }, + kind: 'set', + range: [6, 34], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 34 } + } + }], + range: [4, 36], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'x = { set if(w) { m_if = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'if', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_if', + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [25, 26], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 26 } + } + }, + range: [18, 26], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 26 } + } + }, + range: [18, 27], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 27 } + } + }], + range: [16, 28], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 28 } + } + }, + rest: null, + generator: false, + expression: false, + range: [16, 28], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 28 } + } + }, + kind: 'set', + range: [6, 28], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 28 } + } + }], + range: [4, 30], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 30 } + } + }, + range: [0, 30], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 30 } + } + }, + range: [0, 30], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 30 } + } + }, + + 'x = { set true(w) { m_true = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'true', + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_true', + range: [20, 26], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 26 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [29, 30], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 30], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }], + range: [18, 32], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 32 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 32], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 32 } + } + }, + kind: 'set', + range: [6, 32], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 32 } + } + }], + range: [4, 34], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + + 'x = { set false(w) { m_false = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'false', + range: [10, 15], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_false', + range: [21, 28], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 28 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [31, 32], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 32 } + } + }, + range: [21, 32], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 32 } + } + }, + range: [21, 33], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 33 } + } + }], + range: [19, 34], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [19, 34], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 34 } + } + }, + kind: 'set', + range: [6, 34], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 34 } + } + }], + range: [4, 36], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'x = { set null(w) { m_null = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'null', + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_null', + range: [20, 26], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 26 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [29, 30], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 30], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }], + range: [18, 32], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 32 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 32], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 32 } + } + }, + kind: 'set', + range: [6, 32], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 32 } + } + }], + range: [4, 34], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + + 'x = { set "null"(w) { m_null = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 'null', + raw: '"null"', + range: [10, 16], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 16 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [17, 18], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 18 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_null', + range: [22, 28], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 28 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [31, 32], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 32 } + } + }, + range: [22, 32], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 32 } + } + }, + range: [22, 33], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 33 } + } + }], + range: [20, 34], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [20, 34], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 34 } + } + }, + kind: 'set', + range: [6, 34], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 34 } + } + }], + range: [4, 36], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'x = { set 10(w) { m_null = w } }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 10, + raw: '10', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'w', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'm_null', + range: [18, 24], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 24 } + } + }, + right: { + type: 'Identifier', + name: 'w', + range: [27, 28], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 28 } + } + }, + range: [18, 28], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 28 } + } + }, + range: [18, 29], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 29 } + } + }], + range: [16, 30], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 30 } + } + }, + rest: null, + generator: false, + expression: false, + range: [16, 30], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 30 } + } + }, + kind: 'set', + range: [6, 30], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 30 } + } + }], + range: [4, 32], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 32 } + } + }, + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 32 } + } + }, + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 32 } + } + }, + + 'x = { get: 42 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'get', + range: [6, 9], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 9 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [11, 13], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 13 } + } + }, + kind: 'init', + range: [6, 13], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 13 } + } + }], + range: [4, 15], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + + 'x = { set: 43 }': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'set', + range: [6, 9], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 9 } + } + }, + value: { + type: 'Literal', + value: 43, + raw: '43', + range: [11, 13], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 13 } + } + }, + kind: 'init', + range: [6, 13], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 13 } + } + }], + range: [4, 15], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + } + + }, + + 'Comments': { + + '/* block comment */ 42': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [20, 22], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 22 } + } + }, + range: [20, 22], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 22 } + } + }, + + '42 /*The*/ /*Answer*/': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }], + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + }, + comments: [{ + type: 'Block', + value: 'The', + range: [3, 10], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 10 } + } + }, { + type: 'Block', + value: 'Answer', + range: [11, 21], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 21 } + } + }] + }, + + '42 /*the*/ /*answer*/': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [0, 2] + }, + range: [0, 21] + }], + range: [0, 21], + comments: [{ + type: 'Block', + value: 'the', + range: [3, 10] + }, { + type: 'Block', + value: 'answer', + range: [11, 21] + }] + }, + + '/* multiline\ncomment\nshould\nbe\nignored */ 42': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [42, 44], + loc: { + start: { line: 5, column: 11 }, + end: { line: 5, column: 13 } + } + }, + range: [42, 44], + loc: { + start: { line: 5, column: 11 }, + end: { line: 5, column: 13 } + } + }, + + '/*a\r\nb*/ 42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [9, 11], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }, + range: [9, 11], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }], + range: [9, 11], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + }, + comments: [{ + type: 'Block', + value: 'a\r\nb', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 3 } + } + }] + }, + + '/*a\rb*/ 42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }, + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }], + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + }, + comments: [{ + type: 'Block', + value: 'a\rb', + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 3 } + } + }] + }, + + '/*a\nb*/ 42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }, + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }], + range: [8, 10], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + }, + comments: [{ + type: 'Block', + value: 'a\nb', + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 3 } + } + }] + }, + + '/*a\nc*/ 42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }, + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + } + }], + loc: { + start: { line: 2, column: 4 }, + end: { line: 2, column: 6 } + }, + comments: [{ + type: 'Block', + value: 'a\nc', + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 3 } + } + }] + }, + + '// line comment\n42': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [16, 18], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }, + range: [16, 18], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }, + + '42 // line comment': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }], + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + }, + comments: [{ + type: 'Line', + value: ' line comment', + range: [3, 18], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 18 } + } + }] + }, + + '// Hello, world!\n42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [17, 19], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }, + range: [17, 19], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }], + range: [17, 19], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + }, + comments: [{ + type: 'Line', + value: ' Hello, world!', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }] + }, + + '// Hello, world!\n': { + type: 'Program', + body: [], + range: [17, 17], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 0 } + }, + comments: [{ + type: 'Line', + value: ' Hello, world!', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }] + }, + + '// Hallo, world!\n': { + type: 'Program', + body: [], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 0 } + }, + comments: [{ + type: 'Line', + value: ' Hallo, world!', + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }] + }, + + '//\n42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [3, 5], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }, + range: [3, 5], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }], + range: [3, 5], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + }, + comments: [{ + type: 'Line', + value: '', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }] + }, + + '//': { + type: 'Program', + body: [], + range: [2, 2], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 2 } + }, + comments: [{ + type: 'Line', + value: '', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }] + }, + + '// ': { + type: 'Program', + body: [], + range: [3, 3], + comments: [{ + type: 'Line', + value: ' ', + range: [0, 3] + }] + }, + + '/**/42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }], + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + }, + comments: [{ + type: 'Block', + value: '', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }] + }, + + '// Hello, world!\n\n// Another hello\n42': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [37, 39], + loc: { + start: { line: 4, column: 0 }, + end: { line: 4, column: 2 } + } + }, + range: [37, 39], + loc: { + start: { line: 4, column: 0 }, + end: { line: 4, column: 2 } + } + }], + range: [37, 39], + loc: { + start: { line: 4, column: 0 }, + end: { line: 4, column: 2 } + }, + comments: [{ + type: 'Line', + value: ' Hello, world!', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, { + type: 'Line', + value: ' Another hello', + range: [18, 36], + loc: { + start: { line: 3, column: 0 }, + end: { line: 3, column: 18 } + } + }] + }, + + 'if (x) { // Some comment\ndoThat(); }': { + type: 'Program', + body: [{ + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + consequent: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doThat', + range: [25, 31], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }, + 'arguments': [], + range: [25, 33], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 8 } + } + }, + range: [25, 34], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 9 } + } + }], + range: [7, 36], + loc: { + start: { line: 1, column: 7 }, + end: { line: 2, column: 11 } + } + }, + alternate: null, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 11 } + } + }], + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 11 } + }, + comments: [{ + type: 'Line', + value: ' Some comment', + range: [9, 24], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 24 } + } + }] + }, + + 'switch (answer) { case 42: /* perfect */ bingo() }': { + type: 'Program', + body: [{ + type: 'SwitchStatement', + discriminant: { + type: 'Identifier', + name: 'answer', + range: [8, 14], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 14 } + } + }, + cases: [{ + type: 'SwitchCase', + test: { + type: 'Literal', + value: 42, + raw: '42', + range: [23, 25], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 25 } + } + }, + consequent: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'bingo', + range: [41, 46], + loc: { + start: { line: 1, column: 41 }, + end: { line: 1, column: 46 } + } + }, + 'arguments': [], + range: [41, 48], + loc: { + start: { line: 1, column: 41 }, + end: { line: 1, column: 48 } + } + }, + range: [41, 49], + loc: { + start: { line: 1, column: 41 }, + end: { line: 1, column: 49 } + } + }], + range: [18, 49], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 49 } + } + }], + range: [0, 50], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 50 } + } + }], + range: [0, 50], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 50 } + }, + comments: [{ + type: 'Block', + value: ' perfect ', + range: [27, 40], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 40 } + } + }] + } + + }, + + 'Numeric Literals': { + + '0': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0, + raw: '0', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + + '42': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42, + raw: '42', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + '3': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 3, + raw: '3', + range: [0, 1] + }, + range: [0, 1] + }], + range: [0, 1], + tokens: [{ + type: 'Numeric', + value: '3', + range: [0, 1] + }] + }, + + '5': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 5, + raw: '5', + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + }, + tokens: [{ + type: 'Numeric', + value: '5', + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }] + }, + + '.14': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0.14, + raw: '.14', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + '3.14159': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 3.14159, + raw: '3.14159', + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '6.02214179e+23': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 6.02214179e+23, + raw: '6.02214179e+23', + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + '1.492417830e-10': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 1.49241783e-10, + raw: '1.492417830e-10', + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + + '0x0': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0, + raw: '0x0', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + '0e+100': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0, + raw: '0e+100', + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + '0xabc': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0xabc, + raw: '0xabc', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + '0xdef': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0xdef, + raw: '0xdef', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + '0X1A': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0x1A, + raw: '0X1A', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + + '0x10': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0x10, + raw: '0x10', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + + '0x100': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0x100, + raw: '0x100', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + '0X04': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 0X04, + raw: '0X04', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + + '02': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 2, + raw: '02', + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + '012': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 10, + raw: '012', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + '0012': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 10, + raw: '0012', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + } + + }, + + 'String Literals': { + + '"Hello"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello', + raw: '"Hello"', + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '"\\n\\r\\t\\v\\b\\f\\\\\\\'\\"\\0"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: '\n\r\t\x0B\b\f\\\'"\x00', + raw: '"\\n\\r\\t\\v\\b\\f\\\\\\\'\\"\\0"', + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + + '"\\u0061"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'a', + raw: '"\\u0061"', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + '"\\x61"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'a', + raw: '"\\x61"', + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + '"\\u00"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'u00', + raw: '"\\u00"', + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + '"\\xt"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'xt', + raw: '"\\xt"', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + '"Hello\\nworld"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\nworld', + raw: '"Hello\\nworld"', + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + '"Hello\\\nworld"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Helloworld', + raw: '"Hello\\\nworld"', + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 14 } + } + }, + + '"Hello\\02World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u0002World', + raw: '"Hello\\02World"', + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + + '"Hello\\012World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u000AWorld', + raw: '"Hello\\012World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\122World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\122World', + raw: '"Hello\\122World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\0122World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u000A2World', + raw: '"Hello\\0122World"', + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + '"Hello\\312World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u00CAWorld', + raw: '"Hello\\312World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\412World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\412World', + raw: '"Hello\\412World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\812World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello812World', + raw: '"Hello\\812World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\712World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\712World', + raw: '"Hello\\712World"', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '"Hello\\0World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u0000World', + raw: '"Hello\\0World"', + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + '"Hello\\\r\nworld"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Helloworld', + raw: '"Hello\\\r\nworld"', + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 15 } + } + }, + + '"Hello\\1World"': { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'Hello\u0001World', + raw: '"Hello\\1World"', + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + } + }, + + 'Regular Expression Literals': { + + 'var x = /[a-z]/i': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/[a-z]/i', + raw: '/[a-z]/i', + range: [8, 16], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 16 } + } + }, + range: [4, 16], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 16 } + } + }], + kind: 'var', + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }], + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[a-z]/i', + range: [8, 16], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 16 } + } + }] + }, + + 'var x = /[x-z]/i': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5] + }, + init: { + type: 'Literal', + value: '/[x-z]/i', + raw: '/[x-z]/i', + range: [8, 16] + }, + range: [4, 16] + }], + kind: 'var', + range: [0, 16] + }], + range: [0, 16], + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3] + }, { + type: 'Identifier', + value: 'x', + range: [4, 5] + }, { + type: 'Punctuator', + value: '=', + range: [6, 7] + }, { + type: 'RegularExpression', + value: '/[x-z]/i', + range: [8, 16] + }] + }, + + 'var x = /[a-c]/i': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/[a-c]/i', + raw: '/[a-c]/i', + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 16 } + } + }, + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 16 } + } + }], + kind: 'var', + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[a-c]/i', + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 16 } + } + }] + }, + + 'var x = /[P QR]/i': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/[P QR]/i', + raw: '/[P QR]/i', + range: [8, 17], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 17 } + } + }, + range: [4, 17], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 17 } + } + }], + kind: 'var', + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }], + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[P QR]/i', + range: [8, 17], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 17 } + } + }] + }, + + 'var x = /[\\]/]/': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: new RegExp('[\\]/]').toString(), + raw: '/[\\]/]/', + range: [8, 15], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 15 } + } + }, + range: [4, 15], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 15 } + } + }], + kind: 'var', + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }], + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[\\]/]/', + range: [8, 15], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 15 } + } + }] + }, + + 'var x = /foo\\/bar/': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/foo\\/bar/', + raw: '/foo\\/bar/', + range: [8, 18], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 18 } + } + }, + range: [4, 18], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 18 } + } + }], + kind: 'var', + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }], + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/foo\\/bar/', + range: [8, 18], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 18 } + } + }] + }, + + 'var x = /=([^=\\s])+/g': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/=([^=\\s])+/g', + raw: '/=([^=\\s])+/g', + range: [8, 21], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 21 } + } + }, + range: [4, 21], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 21 } + } + }], + kind: 'var', + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }], + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/=([^=\\s])+/g', + range: [8, 21], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 21 } + } + }] + }, + + 'var x = /[P QR]/\\u0067': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/[P QR]/g', + raw: '/[P QR]/\\u0067', + range: [8, 22], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 22 } + } + }, + range: [4, 22], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 22 } + } + }], + kind: 'var', + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }], + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[P QR]/\\u0067', + range: [8, 22], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 22 } + } + }] + }, + + 'var x = /[P QR]/\\g': { + type: 'Program', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: '/[P QR]/g', + raw: '/[P QR]/\\g', + range: [8, 18], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 18 } + } + }, + range: [4, 18], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 18 } + } + }], + kind: 'var', + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }], + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + }, + tokens: [{ + type: 'Keyword', + value: 'var', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, { + type: 'Identifier', + value: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'Punctuator', + value: '=', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, { + type: 'RegularExpression', + value: '/[P QR]/\\g', + range: [8, 18], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 18 } + } + }] + } + + }, + + 'Left-Hand-Side Expression': { + + 'new Button': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'Button', + range: [4, 10], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 10 } + } + }, + 'arguments': [], + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + + 'new Button()': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'Button', + range: [4, 10], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 10 } + } + }, + 'arguments': [], + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + + 'new new foo': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [8, 11], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 11 } + } + }, + 'arguments': [], + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + 'arguments': [], + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'new new foo()': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [8, 11], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 11 } + } + }, + 'arguments': [], + range: [4, 13], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 13 } + } + }, + 'arguments': [], + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'new foo().bar()': { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'MemberExpression', + computed: false, + object: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + 'arguments': [], + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + property: { + type: 'Identifier', + name: 'bar', + range: [10, 13], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + 'arguments': [], + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + range: [0, 15], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 15 } + } + }, + + 'new foo[bar]': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'MemberExpression', + computed: true, + object: { + type: 'Identifier', + name: 'foo', + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + property: { + type: 'Identifier', + name: 'bar', + range: [8, 11], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 11 } + } + }, + range: [4, 12], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 12 } + } + }, + 'arguments': [], + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + + 'new foo.bar()': { + type: 'ExpressionStatement', + expression: { + type: 'NewExpression', + callee: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'foo', + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + property: { + type: 'Identifier', + name: 'bar', + range: [8, 11], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 11 } + } + }, + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + 'arguments': [], + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + '( new foo).bar()': { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'MemberExpression', + computed: false, + object: { + type: 'NewExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [6, 9], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 9 } + } + }, + 'arguments': [], + range: [2, 9], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 9 } + } + }, + property: { + type: 'Identifier', + name: 'bar', + range: [11, 14], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + 'arguments': [], + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + 'foo(bar, baz)': { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'bar', + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, { + type: 'Identifier', + name: 'baz', + range: [9, 12], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 12 } + } + }], + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + '( foo )()': { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [5, 8], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 8 } + } + }, + 'arguments': [], + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'universe.milkyway': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'milkyway', + range: [9, 17], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + 'universe.milkyway.solarsystem': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'milkyway', + range: [9, 17], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + property: { + type: 'Identifier', + name: 'solarsystem', + range: [18, 29], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 29 } + } + }, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + + 'universe.milkyway.solarsystem.Earth': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'milkyway', + range: [9, 17], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + property: { + type: 'Identifier', + name: 'solarsystem', + range: [18, 29], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 29 } + } + }, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + property: { + type: 'Identifier', + name: 'Earth', + range: [30, 35], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 35 } + } + }, + range: [0, 35], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 35 } + } + }, + range: [0, 35], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 35 } + } + }, + + 'universe[galaxyName, otherUselessName]': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: true, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'SequenceExpression', + expressions: [{ + type: 'Identifier', + name: 'galaxyName', + range: [9, 19], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 19 } + } + }, { + type: 'Identifier', + name: 'otherUselessName', + range: [21, 37], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 37 } + } + }], + range: [9, 37], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 37 } + } + }, + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + + 'universe[galaxyName]': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: true, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'galaxyName', + range: [9, 19], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + + 'universe[42].galaxies': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: true, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Literal', + value: 42, + raw: '42', + range: [9, 11], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + property: { + type: 'Identifier', + name: 'galaxies', + range: [13, 21], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + + 'universe(42).galaxies': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + 'arguments': [{ + type: 'Literal', + value: 42, + raw: '42', + range: [9, 11], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 11 } + } + }], + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + property: { + type: 'Identifier', + name: 'galaxies', + range: [13, 21], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + + 'universe(42).galaxies(14, 3, 77).milkyway': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'CallExpression', + callee: { + type: 'MemberExpression', + computed: false, + object: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + 'arguments': [{ + type: 'Literal', + value: 42, + raw: '42', + range: [9, 11], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 11 } + } + }], + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + property: { + type: 'Identifier', + name: 'galaxies', + range: [13, 21], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + 'arguments': [{ + type: 'Literal', + value: 14, + raw: '14', + range: [22, 24], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 24 } + } + }, { + type: 'Literal', + value: 3, + raw: '3', + range: [26, 27], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 27 } + } + }, { + type: 'Literal', + value: 77, + raw: '77', + range: [29, 31], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 31 } + } + }], + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 32 } + } + }, + property: { + type: 'Identifier', + name: 'milkyway', + range: [33, 41], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 41 } + } + }, + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + } + }, + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + } + }, + + 'earth.asia.Indonesia.prepareForElection(2014)': { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: false, + object: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'earth', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + property: { + type: 'Identifier', + name: 'asia', + range: [6, 10], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + property: { + type: 'Identifier', + name: 'Indonesia', + range: [11, 20], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 20 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + property: { + type: 'Identifier', + name: 'prepareForElection', + range: [21, 39], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 39 } + } + }, + range: [0, 39], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 39 } + } + }, + 'arguments': [{ + type: 'Literal', + value: 2014, + raw: '2014', + range: [40, 44], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 44 } + } + }], + range: [0, 45], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 45 } + } + }, + range: [0, 45], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 45 } + } + }, + + 'universe.if': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'if', + range: [9, 11], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'universe.true': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'true', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'universe.false': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'false', + range: [9, 14], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + 'universe.null': { + type: 'ExpressionStatement', + expression: { + type: 'MemberExpression', + computed: false, + object: { + type: 'Identifier', + name: 'universe', + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + property: { + type: 'Identifier', + name: 'null', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + } + + }, + + 'Postfix Expressions': { + + 'x++': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + prefix: false, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + 'x--': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + prefix: false, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + 'eval++': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'eval', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + prefix: false, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'eval--': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'eval', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + prefix: false, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'arguments++': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'arguments', + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + prefix: false, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'arguments--': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'arguments', + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + prefix: false, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + } + + }, + + 'Unary Operators': { + + '++x': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, + prefix: true, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + '--x': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'x', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, + prefix: true, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + '++eval': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'eval', + range: [2, 6], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 6 } + } + }, + prefix: true, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + '--eval': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'eval', + range: [2, 6], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 6 } + } + }, + prefix: true, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + '++arguments': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'arguments', + range: [2, 11], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 11 } + } + }, + prefix: true, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + '--arguments': { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'arguments', + range: [2, 11], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 11 } + } + }, + prefix: true, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + '+x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: '+', + argument: { + type: 'Identifier', + name: 'x', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + prefix: true, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + '-x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: '-', + argument: { + type: 'Identifier', + name: 'x', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + prefix: true, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + '~x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: '~', + argument: { + type: 'Identifier', + name: 'x', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + prefix: true, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + '!x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: '!', + argument: { + type: 'Identifier', + name: 'x', + range: [1, 2], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 2 } + } + }, + prefix: true, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + }, + + 'void x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: 'void', + argument: { + type: 'Identifier', + name: 'x', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + prefix: true, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'delete x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: 'delete', + argument: { + type: 'Identifier', + name: 'x', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + prefix: true, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'typeof x': { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: 'typeof', + argument: { + type: 'Identifier', + name: 'x', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + prefix: true, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + } + + }, + + 'Multiplicative Operators': { + + 'x * y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x / y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '/', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x % y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '%', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + } + + }, + + 'Additive Operators': { + + 'x + y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x - y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + } + + }, + + 'Bitwise Shift Operator': { + + 'x << y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<<', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x >> y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '>>', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x >>> y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '>>>', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + } + + }, + + 'Relational Operators': { + + 'x < y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x > y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '>', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x <= y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x >= y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '>=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x in y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: 'in', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x instanceof y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: 'instanceof', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + 'x < y < z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + } + + }, + + 'Equality Operators': { + + 'x == y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '==', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x != y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '!=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x === y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '===', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x !== y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '!==', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + } + + }, + + 'Binary Bitwise Operators': { + + 'x & y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x ^ y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '^', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'x | y': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + } + + }, + + 'Binary Expressions': { + + 'x + y + z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x - y + z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x + y - z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x - y - z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x + y * z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x + y / z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '+', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '/', + left: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x - y % z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '-', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '%', + left: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x * y * z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x * y / z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '/', + left: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x * y % z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '%', + left: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x % y * z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'BinaryExpression', + operator: '%', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x << y << z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '<<', + left: { + type: 'BinaryExpression', + operator: '<<', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'x | y | z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x & y & z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '&', + left: { + type: 'BinaryExpression', + operator: '&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x ^ y ^ z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '^', + left: { + type: 'BinaryExpression', + operator: '^', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x & y | z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'BinaryExpression', + operator: '&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x | y ^ z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '^', + left: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x | y & z': { + type: 'ExpressionStatement', + expression: { + type: 'BinaryExpression', + operator: '|', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '&', + left: { + type: 'Identifier', + name: 'y', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + } + + }, + + 'Binary Logical Operators': { + + 'x || y': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '||', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x && y': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '&&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'x || y || z': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '||', + left: { + type: 'LogicalExpression', + operator: '||', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'x && y && z': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '&&', + left: { + type: 'LogicalExpression', + operator: '&&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'x || y && z': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '||', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'LogicalExpression', + operator: '&&', + left: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [5, 11], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'x || y ^ z': { + type: 'ExpressionStatement', + expression: { + type: 'LogicalExpression', + operator: '||', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'BinaryExpression', + operator: '^', + left: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'Identifier', + name: 'z', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + range: [5, 10], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + } + + }, + + 'Conditional Operator': { + + 'y ? 1 : 2': { + type: 'ExpressionStatement', + expression: { + type: 'ConditionalExpression', + test: { + type: 'Identifier', + name: 'y', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + consequent: { + type: 'Literal', + value: 1, + raw: '1', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + alternate: { + type: 'Literal', + value: 2, + raw: '2', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x && y ? 1 : 2': { + type: 'ExpressionStatement', + expression: { + type: 'ConditionalExpression', + test: { + type: 'LogicalExpression', + operator: '&&', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + consequent: { + type: 'Literal', + value: 1, + raw: '1', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + alternate: { + type: 'Literal', + value: 2, + raw: '2', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + } + + }, + + 'Assignment Operators': { + + 'x = 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'eval = 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'eval', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [7, 9], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'arguments = 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'arguments', + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [12, 14], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + 'x *= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '*=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x /= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '/=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x %= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '%=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x += 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '+=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x -= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '-=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x <<= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '<<=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'x >>= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '>>=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [6, 8], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'x >>>= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '>>>=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [7, 9], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'x &= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '&=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x ^= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '^=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + 'x |= 42': { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '|=', + left: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [5, 7], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + } + + }, + + 'Block': { + + '{ foo }': { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'foo', + range: [2, 5], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 5 } + } + }, + range: [2, 6], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 6 } + } + }], + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '{ doThis(); doThat(); }': { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doThis', + range: [2, 8], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 8 } + } + }, + 'arguments': [], + range: [2, 10], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 10 } + } + }, + range: [2, 11], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 11 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doThat', + range: [12, 18], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 18 } + } + }, + 'arguments': [], + range: [12, 20], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 20 } + } + }, + range: [12, 21], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 21 } + } + }], + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + } + }, + + '{}': { + type: 'BlockStatement', + body: [], + range: [0, 2], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 2 } + } + } + + }, + + 'Variable Statement': { + + 'var x': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: null, + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }], + kind: 'var', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + 'var x, y;': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: null, + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + init: null, + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }], + kind: 'var', + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'var x = 42': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [8, 10], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 10 } + } + }, + range: [4, 10], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 10 } + } + }], + kind: 'var', + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + + 'var eval = 42, arguments = 42': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'eval', + range: [4, 8], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 8 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [11, 13], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 13 } + } + }, + range: [4, 13], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'arguments', + range: [15, 24], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 24 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [27, 29], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 29 } + } + }, + range: [15, 29], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 29 } + } + }], + kind: 'var', + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + + 'var x = 14, y = 3, z = 1977': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: { + type: 'Literal', + value: 14, + raw: '14', + range: [8, 10], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 10 } + } + }, + range: [4, 10], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 10 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + init: { + type: 'Literal', + value: 3, + raw: '3', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }, + range: [12, 17], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 17 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'z', + range: [19, 20], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 20 } + } + }, + init: { + type: 'Literal', + value: 1977, + raw: '1977', + range: [23, 27], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 27 } + } + }, + range: [19, 27], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 27 } + } + }], + kind: 'var', + range: [0, 27], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 27 } + } + }, + + 'var implements, interface, package': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'implements', + range: [4, 14], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 14 } + } + }, + init: null, + range: [4, 14], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 14 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'interface', + range: [16, 25], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 25 } + } + }, + init: null, + range: [16, 25], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 25 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'package', + range: [27, 34], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 34 } + } + }, + init: null, + range: [27, 34], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 34 } + } + }], + kind: 'var', + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + + 'var private, protected, public, static': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'private', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + init: null, + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'protected', + range: [13, 22], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 22 } + } + }, + init: null, + range: [13, 22], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 22 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'public', + range: [24, 30], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 30 } + } + }, + init: null, + range: [24, 30], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 30 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'static', + range: [32, 38], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 38 } + } + }, + init: null, + range: [32, 38], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 38 } + } + }], + kind: 'var', + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + } + + }, + + 'Let Statement': { + + 'let x': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: null, + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }], + kind: 'let', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + + '{ let x }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + init: null, + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }], + kind: 'let', + range: [2, 8], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 8 } + } + }], + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + '{ let x = 42 }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }], + kind: 'let', + range: [2, 13], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 13 } + } + }], + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + }, + + '{ let x = 14, y = 3, z = 1977 }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + init: { + type: 'Literal', + value: 14, + raw: '14', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [14, 15], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 15 } + } + }, + init: { + type: 'Literal', + value: 3, + raw: '3', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + range: [14, 19], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 19 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'z', + range: [21, 22], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 22 } + } + }, + init: { + type: 'Literal', + value: 1977, + raw: '1977', + range: [25, 29], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 29 } + } + }, + range: [21, 29], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 29 } + } + }], + kind: 'let', + range: [2, 30], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 30 } + } + }], + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + } + } + + }, + + 'Const Statement': { + + 'const x = 42': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }], + kind: 'const', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + + '{ const x = 42 }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [12, 14], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 14 } + } + }, + range: [8, 14], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 14 } + } + }], + kind: 'const', + range: [2, 15], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 15 } + } + }], + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + + '{ const x = 14, y = 3, z = 1977 }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'Literal', + value: 14, + raw: '14', + range: [12, 14], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 14 } + } + }, + range: [8, 14], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 14 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }, + init: { + type: 'Literal', + value: 3, + raw: '3', + range: [20, 21], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 21 } + } + }, + range: [16, 21], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 21 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'z', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + init: { + type: 'Literal', + value: 1977, + raw: '1977', + range: [27, 31], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 31 } + } + }, + range: [23, 31], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 31 } + } + }], + kind: 'const', + range: [2, 32], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 32 } + } + }], + range: [0, 33], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 33 } + } + } + + }, + + 'Empty Statement': { + + ';': { + type: 'EmptyStatement', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + } + + }, + + 'Expression Statement': { + + 'x': { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + + 'x, y': { + type: 'ExpressionStatement', + expression: { + type: 'SequenceExpression', + expressions: [{ + type: 'Identifier', + name: 'x', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, { + type: 'Identifier', + name: 'y', + range: [3, 4], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 4 } + } + }], + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + + '\\u0061': { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'a', + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }, + + 'a\\u0061': { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'aa', + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 7], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 7 } + } + }, + + '\\ua': { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'ua', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + + 'a\\u': { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'au', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + } + + }, + + 'If Statement': { + + 'if (morning) goodMorning()': { + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'morning', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + consequent: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'goodMorning', + range: [13, 24], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 24 } + } + }, + 'arguments': [], + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + alternate: null, + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + } + }, + + 'if (morning) (function(){})': { + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'morning', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + consequent: { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [24, 26], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 26 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 26], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 26 } + } + }, + range: [13, 27], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 27 } + } + }, + alternate: null, + range: [0, 27], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 27 } + } + }, + + 'if (morning) var x = 0;': { + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'morning', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + consequent: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [17, 18], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 18 } + } + }, + init: { + type: 'Literal', + value: 0, + raw: '0', + range: [21, 22], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 22 } + } + }, + range: [17, 22], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 22 } + } + }], + kind: 'var', + range: [13, 23], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 23 } + } + }, + alternate: null, + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + } + }, + + 'if (morning) function a(){}': { + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'morning', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + consequent: { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'a', + range: [22, 23], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 23 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [25, 27], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 27 } + } + }, + rest: null, + generator: false, + expression: false, + range: [13, 27], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 27 } + } + }, + alternate: null, + range: [0, 27], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 27 } + } + }, + + 'if (morning) goodMorning(); else goodDay()': { + type: 'IfStatement', + test: { + type: 'Identifier', + name: 'morning', + range: [4, 11], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 11 } + } + }, + consequent: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'goodMorning', + range: [13, 24], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 24 } + } + }, + 'arguments': [], + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + range: [13, 27], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 27 } + } + }, + alternate: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'goodDay', + range: [33, 40], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 40 } + } + }, + 'arguments': [], + range: [33, 42], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 42 } + } + }, + range: [33, 42], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 42 } + } + }, + range: [0, 42], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 42 } + } + } + + }, + + 'Iteration Statements': { + + 'do keep(); while (true)': { + type: 'DoWhileStatement', + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'keep', + range: [3, 7], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 7 } + } + }, + 'arguments': [], + range: [3, 9], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 9 } + } + }, + range: [3, 10], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 10 } + } + }, + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + } + }, + + 'do keep(); while (true);': { + type: 'DoWhileStatement', + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'keep', + range: [3, 7], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 7 } + } + }, + 'arguments': [], + range: [3, 9], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 9 } + } + }, + range: [3, 10], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 10 } + } + }, + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'do { x++; y--; } while (x < 10)': { + type: 'DoWhileStatement', + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + prefix: false, + range: [5, 8], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 8 } + } + }, + range: [5, 9], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 9 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'y', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + prefix: false, + range: [10, 13], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 13 } + } + }, + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }], + range: [3, 16], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 16 } + } + }, + test: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + right: { + type: 'Literal', + value: 10, + raw: '10', + range: [28, 30], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 30 } + } + }, + range: [24, 30], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 30 } + } + }, + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + } + }, + + '{ do { } while (false) false }': { + type: 'BlockStatement', + body: [{ + type: 'DoWhileStatement', + body: { + type: 'BlockStatement', + body: [], + range: [5, 8], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 8 } + } + }, + test: { + type: 'Literal', + value: false, + raw: 'false', + range: [16, 21], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 21 } + } + }, + range: [2, 22], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 22 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: false, + raw: 'false', + range: [23, 28], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 28 } + } + }, + range: [23, 29], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 29 } + } + }], + range: [0, 30], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 30 } + } + }, + + 'while (true) doSomething()': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doSomething', + range: [13, 24], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 24 } + } + }, + 'arguments': [], + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + } + }, + + 'while (x < 10) { x++; y--; }': { + type: 'WhileStatement', + test: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + right: { + type: 'Literal', + value: 10, + raw: '10', + range: [11, 13], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 13 } + } + }, + range: [7, 13], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 13 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [17, 18], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 18 } + } + }, + prefix: false, + range: [17, 20], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 20 } + } + }, + range: [17, 21], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 21 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'y', + range: [22, 23], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 23 } + } + }, + prefix: false, + range: [22, 25], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 25 } + } + }, + range: [22, 26], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 26 } + } + }], + range: [15, 28], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 28 } + } + }, + range: [0, 28], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 28 } + } + }, + + 'for(;;);': { + type: 'ForStatement', + init: null, + test: null, + update: null, + body: { + type: 'EmptyStatement', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'for(;;){}': { + type: 'ForStatement', + init: null, + test: null, + update: null, + body: { + type: 'BlockStatement', + body: [], + range: [7, 9], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 9 } + } + }, + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + }, + + 'for(x = 0;;);': { + type: 'ForStatement', + init: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + test: null, + update: null, + body: { + type: 'EmptyStatement', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'for(var x = 0;;);': { + type: 'ForStatement', + init: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'Literal', + value: 0, + raw: '0', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }], + kind: 'var', + range: [4, 13], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 13 } + } + }, + test: null, + update: null, + body: { + type: 'EmptyStatement', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + 'for(let x = 0;;);': { + type: 'ForStatement', + init: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'Literal', + value: 0, + raw: '0', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }], + kind: 'let', + range: [4, 13], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 13 } + } + }, + test: null, + update: null, + body: { + type: 'EmptyStatement', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }, + + 'for(var x = 0, y = 1;;);': { + type: 'ForStatement', + init: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'Literal', + value: 0, + raw: '0', + range: [12, 13], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 13 } + } + }, + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, + init: { + type: 'Literal', + value: 1, + raw: '1', + range: [19, 20], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 20 } + } + }, + range: [15, 20], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 20 } + } + }], + kind: 'var', + range: [4, 20], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 20 } + } + }, + test: null, + update: null, + body: { + type: 'EmptyStatement', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'for(x = 0; x < 42;);': { + type: 'ForStatement', + init: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + test: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [11, 12], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 12 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + range: [11, 17], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 17 } + } + }, + update: null, + body: { + type: 'EmptyStatement', + range: [19, 20], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 20 } + } + }, + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + + 'for(x = 0; x < 42; x++);': { + type: 'ForStatement', + init: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + test: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [11, 12], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 12 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + range: [11, 17], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 17 } + } + }, + update: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [19, 20], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 20 } + } + }, + prefix: false, + range: [19, 22], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 22 } + } + }, + body: { + type: 'EmptyStatement', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'for(x = 0; x < 42; x++) process(x);': { + type: 'ForStatement', + init: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + test: { + type: 'BinaryExpression', + operator: '<', + left: { + type: 'Identifier', + name: 'x', + range: [11, 12], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 12 } + } + }, + right: { + type: 'Literal', + value: 42, + raw: '42', + range: [15, 17], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 17 } + } + }, + range: [11, 17], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 17 } + } + }, + update: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'x', + range: [19, 20], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 20 } + } + }, + prefix: false, + range: [19, 22], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 22 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [24, 31], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 31 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [32, 33], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 33 } + } + }], + range: [24, 34], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 34 } + } + }, + range: [24, 35], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 35 } + } + }, + range: [0, 35], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 35 } + } + }, + + 'for(x in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [15, 22], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 22 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }], + range: [15, 25], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 25 } + } + }, + range: [15, 26], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 26 } + } + }, + each: false, + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + } + }, + + 'for (var x in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + init: null, + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }], + kind: 'var', + range: [5, 10], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 10 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [14, 18], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 18 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [20, 27], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 27 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [28, 29], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 29 } + } + }], + range: [20, 30], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }, + each: false, + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + } + }, + + 'for (var x = 42 in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [13, 15], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 15 } + } + }, + range: [9, 15], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 15 } + } + }], + kind: 'var', + range: [5, 15], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 15 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [19, 23], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 23 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [25, 32], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 32 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [33, 34], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 34 } + } + }], + range: [25, 35], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 35 } + } + }, + range: [25, 36], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 36 } + } + }, + each: false, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'for (let x in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + init: null, + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }], + kind: 'let', + range: [5, 10], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 10 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [14, 18], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 18 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [20, 27], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 27 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [28, 29], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 29 } + } + }], + range: [20, 30], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 30 } + } + }, + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }, + each: false, + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + } + }, + + 'for (let x = 42 in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + init: { + type: 'Literal', + value: 42, + raw: '42', + range: [13, 15], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 15 } + } + }, + range: [9, 15], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 15 } + } + }], + kind: 'let', + range: [5, 15], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 15 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [19, 23], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 23 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [25, 32], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 32 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [33, 34], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 34 } + } + }], + range: [25, 35], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 35 } + } + }, + range: [25, 36], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 36 } + } + }, + each: false, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'for (var i = function() { return 10 in [] } in list) process(x);': { + type: 'ForInStatement', + left: { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'i', + range: [9, 10], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 10 } + } + }, + init: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ReturnStatement', + argument: { + type: 'BinaryExpression', + operator: 'in', + left: { + type: 'Literal', + value: 10, + raw: '10', + range: [33, 35], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 35 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [39, 41], + loc: { + start: { line: 1, column: 39 }, + end: { line: 1, column: 41 } + } + }, + range: [33, 41], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 41 } + } + }, + range: [26, 42], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 42 } + } + }], + range: [24, 43], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 43 } + } + }, + rest: null, + generator: false, + expression: false, + range: [13, 43], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 43 } + } + }, + range: [9, 43], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 43 } + } + }], + kind: 'var', + range: [5, 43], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 43 } + } + }, + right: { + type: 'Identifier', + name: 'list', + range: [47, 51], + loc: { + start: { line: 1, column: 47 }, + end: { line: 1, column: 51 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'process', + range: [53, 60], + loc: { + start: { line: 1, column: 53 }, + end: { line: 1, column: 60 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'x', + range: [61, 62], + loc: { + start: { line: 1, column: 61 }, + end: { line: 1, column: 62 } + } + }], + range: [53, 63], + loc: { + start: { line: 1, column: 53 }, + end: { line: 1, column: 63 } + } + }, + range: [53, 64], + loc: { + start: { line: 1, column: 53 }, + end: { line: 1, column: 64 } + } + }, + each: false, + range: [0, 64], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 64 } + } + } + + }, + + 'continue statement': { + + 'while (true) { continue; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'ContinueStatement', + label: null, + range: [15, 24], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 24 } + } + } + ], + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + }, + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + } + }, + + 'while (true) { continue }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'ContinueStatement', + label: null, + range: [15, 24], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 24 } + } + } + ], + range: [13, 25], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 25 } + } + }, + range: [0, 25], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 25 } + } + }, + + 'done: while (true) { continue done }': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'done', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + body: { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [13, 17], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 17 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'ContinueStatement', + label: { + type: 'Identifier', + name: 'done', + range: [30, 34], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 34 } + } + }, + range: [21, 35], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 35 } + } + } + ], + range: [19, 36], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 36 } + } + }, + range: [6, 36], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + } + }, + + 'done: while (true) { continue done; }': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'done', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + body: { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [13, 17], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 17 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'ContinueStatement', + label: { + type: 'Identifier', + name: 'done', + range: [30, 34], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 34 } + } + }, + range: [21, 35], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 35 } + } + } + ], + range: [19, 37], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 37 } + } + }, + range: [6, 37], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 37 } + } + }, + range: [0, 37], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 37 } + } + } + + }, + + 'break statement': { + + 'while (true) { break }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'BreakStatement', + label: null, + range: [15, 21], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 21 } + } + } + ], + range: [13, 22], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + + 'done: while (true) { break done }': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'done', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + body: { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [13, 17], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 17 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'BreakStatement', + label: { + type: 'Identifier', + name: 'done', + range: [27, 31], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 31 } + } + }, + range: [21, 32], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 32 } + } + } + ], + range: [19, 33], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 33 } + } + }, + range: [6, 33], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 33 } + } + }, + range: [0, 33], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 33 } + } + }, + + 'done: while (true) { break done; }': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'done', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + body: { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [13, 17], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 17 } + } + }, + body: { + type: 'BlockStatement', + body: [ + { + type: 'BreakStatement', + label: { + type: 'Identifier', + name: 'done', + range: [27, 31], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 31 } + } + }, + range: [21, 32], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 32 } + } + } + ], + range: [19, 34], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 34 } + } + }, + range: [6, 34], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + } + + }, + + 'return statement': { + + '(function(){ return })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: null, + range: [13, 20], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 20 } + } + } + ], + range: [11, 21], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 21 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 21], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 21 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + }, + + '(function(){ return; })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: null, + range: [13, 20], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 20 } + } + } + ], + range: [11, 22], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 22 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 22], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + } + }, + + '(function(){ return x; })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: { + type: 'Identifier', + name: 'x', + range: [20, 21], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 21 } + } + }, + range: [13, 22], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 22 } + } + } + ], + range: [11, 24], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 24 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 24], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 25], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 25 } + } + }, + + '(function(){ return x * y })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [20, 21], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 21 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + range: [20, 25], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 25 } + } + }, + range: [13, 26], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 26 } + } + } + ], + range: [11, 27], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 27 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 27], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 27 } + } + }, + range: [0, 28], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 28 } + } + } + }, + + 'with statement': { + + 'with (x) foo = bar': { + type: 'WithStatement', + object: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'foo', + range: [9, 12], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 12 } + } + }, + right: { + type: 'Identifier', + name: 'bar', + range: [15, 18], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 18 } + } + }, + range: [9, 18], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 18 } + } + }, + range: [9, 18], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 18 } + } + }, + range: [0, 18], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 18 } + } + }, + + 'with (x) foo = bar;': { + type: 'WithStatement', + object: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + body: { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'foo', + range: [9, 12], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 12 } + } + }, + right: { + type: 'Identifier', + name: 'bar', + range: [15, 18], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 18 } + } + }, + range: [9, 18], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 18 } + } + }, + range: [9, 19], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 19 } + } + }, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + + 'with (x) { foo = bar }': { + type: 'WithStatement', + object: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'foo', + range: [11, 14], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 14 } + } + }, + right: { + type: 'Identifier', + name: 'bar', + range: [17, 20], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 20 } + } + }, + range: [11, 20], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 20 } + } + }, + range: [11, 21], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 21 } + } + }], + range: [9, 22], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 22 } + } + }, + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + } + } + + }, + + 'switch statement': { + + 'switch (x) {}': { + type: 'SwitchStatement', + discriminant: { + type: 'Identifier', + name: 'x', + range: [8, 9], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 9 } + } + }, + cases:[], + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, + + 'switch (answer) { case 42: hi(); break; }': { + type: 'SwitchStatement', + discriminant: { + type: 'Identifier', + name: 'answer', + range: [8, 14], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 14 } + } + }, + cases: [{ + type: 'SwitchCase', + test: { + type: 'Literal', + value: 42, + raw: '42', + range: [23, 25], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 25 } + } + }, + consequent: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'hi', + range: [27, 29], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 29 } + } + }, + 'arguments': [], + range: [27, 31], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 31 } + } + }, + range: [27, 32], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 32 } + } + }, { + type: 'BreakStatement', + label: null, + range: [33, 39], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 39 } + } + }], + range: [18, 39], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 39 } + } + }], + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + } + }, + + 'switch (answer) { case 42: hi(); break; default: break }': { + type: 'SwitchStatement', + discriminant: { + type: 'Identifier', + name: 'answer', + range: [8, 14], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 14 } + } + }, + cases: [{ + type: 'SwitchCase', + test: { + type: 'Literal', + value: 42, + raw: '42', + range: [23, 25], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 25 } + } + }, + consequent: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'hi', + range: [27, 29], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 29 } + } + }, + 'arguments': [], + range: [27, 31], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 31 } + } + }, + range: [27, 32], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 32 } + } + }, { + type: 'BreakStatement', + label: null, + range: [33, 39], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 39 } + } + }], + range: [18, 39], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 39 } + } + }, { + type: 'SwitchCase', + test: null, + consequent: [{ + type: 'BreakStatement', + label: null, + range: [49, 55], + loc: { + start: { line: 1, column: 49 }, + end: { line: 1, column: 55 } + } + }], + range: [40, 55], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 55 } + } + }], + range: [0, 56], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 56 } + } + } + + }, + + 'Labelled Statements': { + + 'start: for (;;) break start': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'start', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + body: { + type: 'ForStatement', + init: null, + test: null, + update: null, + body: { + type: 'BreakStatement', + label: { + type: 'Identifier', + name: 'start', + range: [22, 27], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 27 } + } + }, + range: [16, 27], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 27 } + } + }, + range: [7, 27], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 27 } + } + }, + range: [0, 27], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 27 } + } + }, + + 'start: while (true) break start': { + type: 'LabeledStatement', + label: { + type: 'Identifier', + name: 'start', + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + body: { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [14, 18], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 18 } + } + }, + body: { + type: 'BreakStatement', + label: { + type: 'Identifier', + name: 'start', + range: [26, 31], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 31 } + } + }, + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }, + range: [7, 31], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 31 } + } + }, + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + } + } + + }, + + 'throw statement': { + + 'throw x;': { + type: 'ThrowStatement', + argument: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + range: [0, 8], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 8 } + } + }, + + 'throw x * y': { + type: 'ThrowStatement', + argument: { + type: 'BinaryExpression', + operator: '*', + left: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + right: { + type: 'Identifier', + name: 'y', + range: [10, 11], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 11 } + } + }, + range: [6, 11], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 11 } + } + }, + range: [0, 11], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 11 } + } + }, + + 'throw { message: "Error" }': { + type: 'ThrowStatement', + argument: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'message', + range: [8, 15], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 15 } + } + }, + value: { + type: 'Literal', + value: 'Error', + raw: '"Error"', + range: [17, 24], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 24 } + } + }, + kind: 'init', + range: [8, 24], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 24 } + } + }], + range: [6, 26], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 26 } + } + }, + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + } + } + + }, + + 'try statement': { + + 'try { } catch (e) { }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'e', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [18, 21], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 21 } + } + }, + range: [8, 21], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 21 } + } + }], + finalizer: null, + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + } + }, + + 'try { } catch (eval) { }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'eval', + range: [15, 19], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 19 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [21, 24], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 24 } + } + }, + range: [8, 24], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 24 } + } + }], + finalizer: null, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'try { } catch (arguments) { }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'arguments', + range: [15, 24], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 24 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [26, 29], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 29 } + } + }, + range: [8, 29], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 29 } + } + }], + finalizer: null, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + + 'try { } catch (e) { say(e) }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'e', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'say', + range: [20, 23], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 23 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'e', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }], + range: [20, 26], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 26 } + } + }, + range: [20, 27], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 27 } + } + }], + range: [18, 28], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 28 } + } + }, + range: [8, 28], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 28 } + } + }], + finalizer: null, + range: [0, 28], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 28 } + } + }, + + 'try { } finally { cleanup(stuff) }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [4, 7], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 7 } + } + }, + guardedHandlers: [], + handlers: [], + finalizer: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'cleanup', + range: [18, 25], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 25 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'stuff', + range: [26, 31], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 31 } + } + }], + range: [18, 32], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 32 } + } + }, + range: [18, 33], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 33 } + } + }], + range: [16, 34], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 34 } + } + }, + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + + 'try { doThat(); } catch (e) { say(e) }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doThat', + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }, + 'arguments': [], + range: [6, 14], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 14 } + } + }, + range: [6, 15], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 15 } + } + }], + range: [4, 17], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 17 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'e', + range: [25, 26], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 26 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'say', + range: [30, 33], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 33 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'e', + range: [34, 35], + loc: { + start: { line: 1, column: 34 }, + end: { line: 1, column: 35 } + } + }], + range: [30, 36], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 36 } + } + }, + range: [30, 37], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 37 } + } + }], + range: [28, 38], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 38 } + } + }, + range: [18, 38], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 38 } + } + }], + finalizer: null, + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + + 'try { doThat(); } catch (e) { say(e) } finally { cleanup(stuff) }': { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'doThat', + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }, + 'arguments': [], + range: [6, 14], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 14 } + } + }, + range: [6, 15], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 15 } + } + }], + range: [4, 17], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 17 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'e', + range: [25, 26], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 26 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'say', + range: [30, 33], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 33 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'e', + range: [34, 35], + loc: { + start: { line: 1, column: 34 }, + end: { line: 1, column: 35 } + } + }], + range: [30, 36], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 36 } + } + }, + range: [30, 37], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 37 } + } + }], + range: [28, 38], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 38 } + } + }, + range: [18, 38], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 38 } + } + }], + finalizer: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'cleanup', + range: [49, 56], + loc: { + start: { line: 1, column: 49 }, + end: { line: 1, column: 56 } + } + }, + 'arguments': [{ + type: 'Identifier', + name: 'stuff', + range: [57, 62], + loc: { + start: { line: 1, column: 57 }, + end: { line: 1, column: 62 } + } + }], + range: [49, 63], + loc: { + start: { line: 1, column: 49 }, + end: { line: 1, column: 63 } + } + }, + range: [49, 64], + loc: { + start: { line: 1, column: 49 }, + end: { line: 1, column: 64 } + } + }], + range: [47, 65], + loc: { + start: { line: 1, column: 47 }, + end: { line: 1, column: 65 } + } + }, + range: [0, 65], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 65 } + } + } + + }, + + 'debugger statement': { + + 'debugger;': { + type: 'DebuggerStatement', + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 9 } + } + } + + }, + + 'Function Definition': { + + 'function hello() { sayHi(); }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'hello', + range: [9, 14], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 14 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'sayHi', + range: [19, 24], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 24 } + } + }, + 'arguments': [], + range: [19, 26], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 26 } + } + }, + range: [19, 27], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 27 } + } + }], + range: [17, 29], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 29 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + + 'function eval() { }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'eval', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [16, 19], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 19 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + } + }, + + 'function arguments() { }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'arguments', + range: [9, 18], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 18 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [21, 24], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 24 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + } + }, + + 'function test(t, t) { }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'test', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + params: [{ + type: 'Identifier', + name: 't', + range: [14, 15], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 15 } + } + }, { + type: 'Identifier', + name: 't', + range: [17, 18], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 18 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [20, 23], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 23 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + } + }, + + '(function test(t, t) { })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'test', + range: [10, 14], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 14 } + } + }, + params: [{ + type: 'Identifier', + name: 't', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, { + type: 'Identifier', + name: 't', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [21, 24], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 24 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 24], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 24 } + } + }, + range: [0, 25], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 25 } + } + }, + + 'function eval() { function inner() { "use strict" } }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'eval', + range: [9, 13], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 13 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'inner', + range: [27, 32], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 32 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '\"use strict\"', + range: [37, 49], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 49 } + } + }, + range: [37, 50], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 50 } + } + }], + range: [35, 51], + loc: { + start: { line: 1, column: 35 }, + end: { line: 1, column: 51 } + } + }, + rest: null, + generator: false, + expression: false, + range: [18, 51], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 51 } + } + }], + range: [16, 53], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 53 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 53], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 53 } + } + }, + + 'function hello(a) { sayHi(); }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'hello', + range: [9, 14], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 14 } + } + }, + params: [{ + type: 'Identifier', + name: 'a', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'sayHi', + range: [20, 25], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 25 } + } + }, + 'arguments': [], + range: [20, 27], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 27 } + } + }, + range: [20, 28], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 28 } + } + }], + range: [18, 30], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 30 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 30], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 30 } + } + }, + + 'function hello(a, b) { sayHi(); }': { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'hello', + range: [9, 14], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 14 } + } + }, + params: [{ + type: 'Identifier', + name: 'a', + range: [15, 16], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 16 } + } + }, { + type: 'Identifier', + name: 'b', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'sayHi', + range: [23, 28], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 28 } + } + }, + 'arguments': [], + range: [23, 30], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 30 } + } + }, + range: [23, 31], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 31 } + } + }], + range: [21, 33], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 33 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 33], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 33 } + } + }, + + 'var hi = function() { sayHi() };': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'hi', + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + init: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'sayHi', + range: [22, 27], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 27 } + } + }, + 'arguments': [], + range: [22, 29], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 29 } + } + }, + range: [22, 30], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 30 } + } + }], + range: [20, 31], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 31 } + } + }, + rest: null, + generator: false, + expression: false, + range: [9, 31], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 31 } + } + }, + range: [4, 31], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 31 } + } + }], + kind: 'var', + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 32 } + } + }, + + 'var hi = function eval() { };': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'hi', + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + init: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'eval', + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [25, 28], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 28 } + } + }, + rest: null, + generator: false, + expression: false, + range: [9, 28], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 28 } + } + }, + range: [4, 28], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 28 } + } + }], + kind: 'var', + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 29 } + } + }, + + 'var hi = function arguments() { };': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'hi', + range: [4, 6], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 6 } + } + }, + init: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'arguments', + range: [18, 27], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 27 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [30, 33], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 33 } + } + }, + rest: null, + generator: false, + expression: false, + range: [9, 33], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 33 } + } + }, + range: [4, 33], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 33 } + } + }], + kind: 'var', + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + } + }, + + 'var hello = function hi() { sayHi() };': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'hello', + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }, + init: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'hi', + range: [21, 23], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 23 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'sayHi', + range: [28, 33], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 33 } + } + }, + 'arguments': [], + range: [28, 35], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 35 } + } + }, + range: [28, 36], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 36 } + } + }], + range: [26, 37], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 37 } + } + }, + rest: null, + generator: false, + expression: false, + range: [12, 37], + loc: { + start: { line: 1, column: 12 }, + end: { line: 1, column: 37 } + } + }, + range: [4, 37], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 37 } + } + }], + kind: 'var', + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + } + }, + + '(function(){})': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [11, 13], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 13 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 13], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 13 } + } + }, + range: [0, 14], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 14 } + } + } + + }, + + 'Automatic semicolon insertion': { + + '{ x\n++y }': { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, + range: [2, 4], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 0 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'y', + range: [6, 7], + loc: { + start: { line: 2, column: 2 }, + end: { line: 2, column: 3 } + } + }, + prefix: true, + range: [4, 7], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 3 } + } + }, + range: [4, 8], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 4 } + } + }], + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 5 } + } + }, + + '{ x\n--y }': { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, + range: [2, 4], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 0 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'y', + range: [6, 7], + loc: { + start: { line: 2, column: 2 }, + end: { line: 2, column: 3 } + } + }, + prefix: true, + range: [4, 7], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 3 } + } + }, + range: [4, 8], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 4 } + } + }], + range: [0, 9], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 5 } + } + }, + + 'var x /* comment */;': { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + init: null, + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }], + kind: 'var', + range: [0, 20], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 20 } + } + }, + + '{ var x = 14, y = 3\nz; }': { + type: 'BlockStatement', + body: [{ + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [6, 7], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 7 } + } + }, + init: { + type: 'Literal', + value: 14, + raw: '14', + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + range: [6, 12], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 12 } + } + }, { + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'y', + range: [14, 15], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 15 } + } + }, + init: { + type: 'Literal', + value: 3, + raw: '3', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + range: [14, 19], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 19 } + } + }], + kind: 'var', + range: [2, 20], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 0 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'z', + range: [20, 21], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 1 } + } + }, + range: [20, 22], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + }], + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 4 } + } + }, + + 'while (true) { continue\nthere; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ContinueStatement', + label: null, + range: [15, 23], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 23 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [24, 29], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [24, 30], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [13, 32], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 8 } + } + }, + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + 'while (true) { continue // Comment\nthere; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ContinueStatement', + label: null, + range: [15, 23], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 23 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [35, 40], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [35, 41], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [13, 43], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 8 } + } + }, + range: [0, 43], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + 'while (true) { continue /* Multiline\nComment */there; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'ContinueStatement', + label: null, + range: [15, 23], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 23 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [47, 52], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 15 } + } + }, + range: [47, 53], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 16 } + } + }], + range: [13, 55], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 18 } + } + }, + range: [0, 55], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 18 } + } + }, + + 'while (true) { break\nthere; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'BreakStatement', + label: null, + range: [15, 20], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 20 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [21, 26], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [21, 27], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [13, 29], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 8 } + } + }, + range: [0, 29], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + 'while (true) { break // Comment\nthere; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'BreakStatement', + label: null, + range: [15, 20], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 20 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [32, 37], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [32, 38], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [13, 40], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 8 } + } + }, + range: [0, 40], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + 'while (true) { break /* Multiline\nComment */there; }': { + type: 'WhileStatement', + test: { + type: 'Literal', + value: true, + raw: 'true', + range: [7, 11], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 11 } + } + }, + body: { + type: 'BlockStatement', + body: [{ + type: 'BreakStatement', + label: null, + range: [15, 20], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 20 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'there', + range: [44, 49], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 15 } + } + }, + range: [44, 50], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 16 } + } + }], + range: [13, 52], + loc: { + start: { line: 1, column: 13 }, + end: { line: 2, column: 18 } + } + }, + range: [0, 52], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 18 } + } + }, + + '(function(){ return\nx; })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: null, + range: [13, 19], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 19 } + } + }, + { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [20, 21], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 1 } + } + }, + range: [20, 22], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + } + ], + range: [11, 24], + loc: { + start: { line: 1, column: 11 }, + end: { line: 2, column: 4 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 24], + loc: { + start: { line: 1, column: 1 }, + end: { line: 2, column: 4 } + } + }, + range: [0, 25], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 5 } + } + }, + + '(function(){ return // Comment\nx; })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: null, + range: [13, 19], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 19 } + } + }, + { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [31, 32], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 1 } + } + }, + range: [31, 33], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 2 } + } + } + ], + range: [11, 35], + loc: { + start: { line: 1, column: 11 }, + end: { line: 2, column: 4 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 35], + loc: { + start: { line: 1, column: 1 }, + end: { line: 2, column: 4 } + } + }, + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 5 } + } + }, + + '(function(){ return/* Multiline\nComment */x; })': { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [ + { + type: 'ReturnStatement', + argument: null, + range: [13, 19], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 19 } + } + }, + { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'x', + range: [42, 43], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 11 } + } + }, + range: [42, 44], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 12 } + } + } + ], + range: [11, 46], + loc: { + start: { line: 1, column: 11 }, + end: { line: 2, column: 14 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 46], + loc: { + start: { line: 1, column: 1 }, + end: { line: 2, column: 14 } + } + }, + range: [0, 47], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 15 } + } + }, + + '{ throw error\nerror; }': { + type: 'BlockStatement', + body: [{ + type: 'ThrowStatement', + argument: { + type: 'Identifier', + name: 'error', + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }, + range: [2, 14], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 0 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'error', + range: [14, 19], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [14, 20], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + '{ throw error// Comment\nerror; }': { + type: 'BlockStatement', + body: [{ + type: 'ThrowStatement', + argument: { + type: 'Identifier', + name: 'error', + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }, + range: [2, 24], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 0 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'error', + range: [24, 29], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 5 } + } + }, + range: [24, 30], + loc: { + start: { line: 2, column: 0 }, + end: { line: 2, column: 6 } + } + }], + range: [0, 32], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 8 } + } + }, + + '{ throw error/* Multiline\nComment */error; }': { + type: 'BlockStatement', + body: [{ + type: 'ThrowStatement', + argument: { + type: 'Identifier', + name: 'error', + range: [8, 13], + loc: { + start: { line: 1, column: 8 }, + end: { line: 1, column: 13 } + } + }, + range: [2, 36], + loc: { + start: { line: 1, column: 2 }, + end: { line: 2, column: 10 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'error', + range: [36, 41], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 15 } + } + }, + range: [36, 42], + loc: { + start: { line: 2, column: 10 }, + end: { line: 2, column: 16 } + } + }], + range: [0, 44], + loc: { + start: { line: 1, column: 0 }, + end: { line: 2, column: 18 } + } + } + + }, + + 'Source elements': { + + '': { + type: 'Program', + body: [], + range: [0, 0], + loc: { + start: { line: 0, column: 0 }, + end: { line: 0, column: 0 } + }, + tokens: [] + } + }, + + 'Invalid syntax': { + + '{': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected end of input' + }, + + '}': { + index: 0, + lineNumber: 1, + column: 1, + message: 'Error: Line 1: Unexpected token }' + }, + + '3ea': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3in []': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3e': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3e+': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3e-': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3x': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3x0': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '0x': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '09': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '018': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '01a': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '3in[]': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '0x3in[]': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '"Hello\nWorld"': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'x\\': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'x\\u005c': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'x\\u002a': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'var x = /(s/g': { + index: 13, + lineNumber: 1, + column: 14, + message: 'Error: Line 1: Invalid regular expression' + }, + + '/': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid regular expression: missing /' + }, + + '/test': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Invalid regular expression: missing /' + }, + + 'var x = /[a-z]/\\ux': { + index: 18, + lineNumber: 1, + column: 19, + message: 'Error: Line 1: Invalid regular expression' + }, + + '3 = 4': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + 'func() = 4': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '(1 + 1) = 10': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '1++': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '1--': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '++1': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '--1': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + 'for((1 + 1) in list) process(x);': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Invalid left-hand side in for-in' + }, + + '[': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected end of input' + }, + + '[,': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected end of input' + }, + + '1 + {': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Unexpected end of input' + }, + + '1 + { t:t ': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Unexpected end of input' + }, + + '1 + { t:t,': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'var x = /\n/': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Invalid regular expression: missing /' + }, + + 'var x = "\n': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'var if = 42': { + index: 4, + lineNumber: 1, + column: 5, + message: 'Error: Line 1: Unexpected token if' + }, + + 'i + 2 = 42': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '+i = 42': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }, + + '1 + (': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Unexpected end of input' + }, + + '\n\n\n{': { + index: 4, + lineNumber: 4, + column: 2, + message: 'Error: Line 4: Unexpected end of input' + }, + + '\n/* Some multiline\ncomment */\n)': { + index: 30, + lineNumber: 4, + column: 1, + message: 'Error: Line 4: Unexpected token )' + }, + + '{ set 1 }': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Unexpected number' + }, + + '{ get 2 }': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Unexpected number' + }, + + '({ set: s(if) { } })': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Unexpected token if' + }, + + '({ set s(.) { } })': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token .' + }, + + '({ set s() { } })': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token )' + }, + + '({ set: s() { } })': { + index: 12, + lineNumber: 1, + column: 13, + message: 'Error: Line 1: Unexpected token {' + }, + + '({ set: s(a, b) { } })': { + index: 16, + lineNumber: 1, + column: 17, + message: 'Error: Line 1: Unexpected token {' + }, + + '({ get: g(d) { } })': { + index: 13, + lineNumber: 1, + column: 14, + message: 'Error: Line 1: Unexpected token {' + }, + + '({ get i() { }, i: 42 })': { + index: 21, + lineNumber: 1, + column: 22, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }, + + '({ i: 42, get i() { } })': { + index: 21, + lineNumber: 1, + column: 22, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }, + + '({ set i(x) { }, i: 42 })': { + index: 22, + lineNumber: 1, + column: 23, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }, + + '({ i: 42, set i(x) { } })': { + index: 22, + lineNumber: 1, + column: 23, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }, + + '({ get i() { }, get i() { } })': { + index: 27, + lineNumber: 1, + column: 28, + message: 'Error: Line 1: Object literal may not have multiple get/set accessors with the same name' + }, + + '({ set i(x) { }, set i(x) { } })': { + index: 29, + lineNumber: 1, + column: 30, + message: 'Error: Line 1: Object literal may not have multiple get/set accessors with the same name' + }, + + 'function t(if) { }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Unexpected token if' + }, + + 'function t(true) { }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Unexpected token true' + }, + + 'function t(false) { }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Unexpected token false' + }, + + 'function t(null) { }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Unexpected token null' + }, + + 'function null() { }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token null' + }, + + 'function true() { }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token true' + }, + + 'function false() { }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token false' + }, + + 'function if() { }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token if' + }, + + 'a b;': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected identifier' + }, + + 'if.a;': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token .' + }, + + 'a if;': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token if' + }, + + 'a class;': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected reserved word' + }, + + 'break\n': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Illegal break statement' + }, + + 'break 1;': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Unexpected number' + }, + + 'continue\n': { + index: 8, + lineNumber: 1, + column: 9, + message: 'Error: Line 1: Illegal continue statement' + }, + + 'continue 2;': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected number' + }, + + 'throw': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'throw;': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Unexpected token ;' + }, + + 'throw\n': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Illegal newline after throw' + }, + + 'for (var i, i2 in {});': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Unexpected token in' + }, + + 'for ((i in {}));': { + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Unexpected token )' + }, + + 'for (i + 1 in {});': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Invalid left-hand side in for-in' + }, + + 'for (+i in {});': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Invalid left-hand side in for-in' + }, + + 'if(false)': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'if(false) doThis(); else': { + index: 24, + lineNumber: 1, + column: 25, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'do': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'while(false)': { + index: 12, + lineNumber: 1, + column: 13, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'for(;;)': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'with(x)': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'try { }': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Missing catch or finally after try' + }, + + 'try {} catch (42) {} ': { + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Unexpected number' + }, + + 'try {} catch (answer()) {} ': { + index: 20, + lineNumber: 1, + column: 21, + message: 'Error: Line 1: Unexpected token (' + }, + + 'try {} catch (-x) {} ': { + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Unexpected token -' + }, + + + '\u203F = 10': { + index: 0, + lineNumber: 1, + column: 1, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'const x = 12, y;': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Unexpected token ;' + }, + + 'const x, y = 12;': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ,' + }, + + 'const x;': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ;' + }, + + 'if(true) let a = 1;': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token let' + }, + + 'if(true) const a = 1;': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token const' + }, + + 'switch (c) { default: default: }': { + index: 30, + lineNumber: 1, + column: 31, + message: 'Error: Line 1: More than one default clause in switch statement' + }, + + 'new X()."s"': { + index: 8, + lineNumber: 1, + column: 9, + message: 'Error: Line 1: Unexpected string' + }, + + '/*': { + index: 2, + lineNumber: 1, + column: 3, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '/*\n\n\n': { + index: 5, + lineNumber: 4, + column: 1, + message: 'Error: Line 4: Unexpected token ILLEGAL' + }, + + '/**': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '/*\n\n*': { + index: 5, + lineNumber: 3, + column: 2, + message: 'Error: Line 3: Unexpected token ILLEGAL' + }, + + '/*hello': { + index: 7, + lineNumber: 1, + column: 8, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '/*hello *': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '\n]': { + index: 1, + lineNumber: 2, + column: 1, + message: 'Error: Line 2: Unexpected token ]' + }, + + '\r]': { + index: 1, + lineNumber: 2, + column: 1, + message: 'Error: Line 2: Unexpected token ]' + }, + + '\r\n]': { + index: 2, + lineNumber: 2, + column: 1, + message: 'Error: Line 2: Unexpected token ]' + }, + + '\n\r]': { + index: 2, + lineNumber: 3, + column: 1, + message: 'Error: Line 3: Unexpected token ]' + }, + + '//\r\n]': { + index: 4, + lineNumber: 2, + column: 1, + message: 'Error: Line 2: Unexpected token ]' + }, + + '//\n\r]': { + index: 4, + lineNumber: 3, + column: 1, + message: 'Error: Line 3: Unexpected token ]' + }, + + '/a\\\n/': { + index: 4, + lineNumber: 1, + column: 5, + message: 'Error: Line 1: Invalid regular expression: missing /' + }, + + '//\r \n]': { + index: 5, + lineNumber: 3, + column: 1, + message: 'Error: Line 3: Unexpected token ]' + }, + + '/*\r\n*/]': { + index: 6, + lineNumber: 2, + column: 3, + message: 'Error: Line 2: Unexpected token ]' + }, + + '/*\n\r*/]': { + index: 6, + lineNumber: 3, + column: 3, + message: 'Error: Line 3: Unexpected token ]' + }, + + '/*\r \n*/]': { + index: 7, + lineNumber: 3, + column: 3, + message: 'Error: Line 3: Unexpected token ]' + }, + + '\\\\': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '\\u005c': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + + '\\x': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '\\u0000': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '\u200C = []': { + index: 0, + lineNumber: 1, + column: 1, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '\u200D = []': { + index: 0, + lineNumber: 1, + column: 1, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '"\\': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + '"\\u': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected token ILLEGAL' + }, + + 'try { } catch() {}': { + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Unexpected token )' + }, + + 'return': { + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Illegal return statement' + }, + + 'break': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Illegal break statement' + }, + + 'continue': { + index: 8, + lineNumber: 1, + column: 9, + message: 'Error: Line 1: Illegal continue statement' + }, + + 'switch (x) { default: continue; }': { + index: 31, + lineNumber: 1, + column: 32, + message: 'Error: Line 1: Illegal continue statement' + }, + + 'do { x } *': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token *' + }, + + 'while (true) { break x; }': { + index: 22, + lineNumber: 1, + column: 23, + message: 'Error: Line 1: Undefined label \'x\'' + }, + + 'while (true) { continue x; }': { + index: 25, + lineNumber: 1, + column: 26, + message: 'Error: Line 1: Undefined label \'x\'' + }, + + 'x: while (true) { (function () { break x; }); }': { + index: 40, + lineNumber: 1, + column: 41, + message: 'Error: Line 1: Undefined label \'x\'' + }, + + 'x: while (true) { (function () { continue x; }); }': { + index: 43, + lineNumber: 1, + column: 44, + message: 'Error: Line 1: Undefined label \'x\'' + }, + + 'x: while (true) { (function () { break; }); }': { + index: 39, + lineNumber: 1, + column: 40, + message: 'Error: Line 1: Illegal break statement' + }, + + 'x: while (true) { (function () { continue; }); }': { + index: 42, + lineNumber: 1, + column: 43, + message: 'Error: Line 1: Illegal continue statement' + }, + + 'x: while (true) { x: while (true) { } }': { + index: 20, + lineNumber: 1, + column: 21, + message: 'Error: Line 1: Label \'x\' has already been declared' + }, + + '(function () { \'use strict\'; delete i; }())': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Delete of an unqualified identifier in strict mode.' + }, + + '(function () { \'use strict\'; with (i); }())': { + index: 28, + lineNumber: 1, + column: 29, + message: 'Error: Line 1: Strict mode code may not include a with statement' + }, + + 'function hello() {\'use strict\'; ({ i: 42, i: 42 }) }': { + index: 47, + lineNumber: 1, + column: 48, + message: 'Error: Line 1: Duplicate data property in object literal not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; ({ hasOwnProperty: 42, hasOwnProperty: 42 }) }': { + index: 73, + lineNumber: 1, + column: 74, + message: 'Error: Line 1: Duplicate data property in object literal not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; var eval = 10; }': { + index: 40, + lineNumber: 1, + column: 41, + message: 'Error: Line 1: Variable name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; var arguments = 10; }': { + index: 45, + lineNumber: 1, + column: 46, + message: 'Error: Line 1: Variable name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; try { } catch (eval) { } }': { + index: 51, + lineNumber: 1, + column: 52, + message: 'Error: Line 1: Catch variable may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; try { } catch (arguments) { } }': { + index: 56, + lineNumber: 1, + column: 57, + message: 'Error: Line 1: Catch variable may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; eval = 10; }': { + index: 32, + lineNumber: 1, + column: 33, + message: 'Error: Line 1: Assignment to eval or arguments is not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; arguments = 10; }': { + index: 32, + lineNumber: 1, + column: 33, + message: 'Error: Line 1: Assignment to eval or arguments is not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; ++eval; }': { + index: 38, + lineNumber: 1, + column: 39, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; --eval; }': { + index: 38, + lineNumber: 1, + column: 39, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; ++arguments; }': { + index: 43, + lineNumber: 1, + column: 44, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; --arguments; }': { + index: 43, + lineNumber: 1, + column: 44, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; eval++; }': { + index: 36, + lineNumber: 1, + column: 37, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; eval--; }': { + index: 36, + lineNumber: 1, + column: 37, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; arguments++; }': { + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; arguments--; }': { + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }, + + 'function hello() {\'use strict\'; function eval() { } }': { + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; function arguments() { } }': { + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function eval() {\'use strict\'; }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function arguments() {\'use strict\'; }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; (function eval() { }()) }': { + index: 42, + lineNumber: 1, + column: 43, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; (function arguments() { }()) }': { + index: 42, + lineNumber: 1, + column: 43, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + '(function eval() {\'use strict\'; })()': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + '(function arguments() {\'use strict\'; })()': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + 'function hello() {\'use strict\'; ({ s: function eval() { } }); }': { + index: 47, + lineNumber: 1, + column: 48, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }, + + '(function package() {\'use strict\'; })()': { + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() {\'use strict\'; ({ i: 10, set s(eval) { } }); }': { + index: 48, + lineNumber: 1, + column: 49, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; ({ set s(eval) { } }); }': { + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello() {\'use strict\'; ({ s: function s(eval) { } }); }': { + index: 49, + lineNumber: 1, + column: 50, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello(eval) {\'use strict\';}': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello(arguments) {\'use strict\';}': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello() { \'use strict\'; function inner(eval) {} }': { + index: 48, + lineNumber: 1, + column: 49, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function hello() { \'use strict\'; function inner(arguments) {} }': { + index: 48, + lineNumber: 1, + column: 49, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + ' "\\1"; \'use strict\';': { + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { \'use strict\'; "\\1"; }': { + index: 33, + lineNumber: 1, + column: 34, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { \'use strict\'; 021; }': { + index: 33, + lineNumber: 1, + column: 34, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { \'use strict\'; ({ "\\1": 42 }); }': { + index: 36, + lineNumber: 1, + column: 37, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { \'use strict\'; ({ 021: 42 }); }': { + index: 36, + lineNumber: 1, + column: 37, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { "octal directive\\1"; "use strict"; }': { + index: 19, + lineNumber: 1, + column: 20, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { "octal directive\\1"; "octal directive\\2"; "use strict"; }': { + index: 19, + lineNumber: 1, + column: 20, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { "use strict"; function inner() { "octal directive\\1"; } }': { + index: 52, + lineNumber: 1, + column: 53, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }, + + 'function hello() { "use strict"; var implements; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var interface; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var package; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var private; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var protected; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var public; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var static; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var yield; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello() { "use strict"; var let; }': { + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function hello(static) { "use strict"; }': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function static() { "use strict"; }': { + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'var yield': { + index: 4, + lineNumber: 1, + column: 5, + message: 'Error: Line 1: Unexpected token yield' + }, + + 'var let': { + index: 4, + lineNumber: 1, + column: 5, + message: 'Error: Line 1: Unexpected token let' + }, + + '"use strict"; function static() { }': { + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function a(t, t) { "use strict"; }': { + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }, + + 'function a(eval) { "use strict"; }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + 'function a(package) { "use strict"; }': { + index: 11, + lineNumber: 1, + column: 12, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'function a() { "use strict"; function b(t, t) { }; }': { + index: 43, + lineNumber: 1, + column: 44, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }, + + '(function a(t, t) { "use strict"; })': { + index: 15, + lineNumber: 1, + column: 16, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }, + + 'function a() { "use strict"; (function b(t, t) { }); }': { + index: 44, + lineNumber: 1, + column: 45, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }, + + '(function a(eval) { "use strict"; })': { + index: 12, + lineNumber: 1, + column: 13, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }, + + '(function a(package) { "use strict"; })': { + index: 12, + lineNumber: 1, + column: 13, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }, + + 'var': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'let': { + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Unexpected end of input' + }, + + 'const': { + index: 5, + lineNumber: 1, + column: 6, + message: 'Error: Line 1: Unexpected end of input' + } + + }, + + 'API': { + 'parse()': { + call: 'parse', + args: [], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'undefined' + } + }] + } + }, + + 'parse(null)': { + call: 'parse', + args: [null], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: null + } + }] + } + }, + + 'parse(42)': { + call: 'parse', + args: [42], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42 + } + }] + } + }, + + 'parse(true)': { + call: 'parse', + args: [true], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: true + } + }] + } + }, + + 'parse(undefined)': { + call: 'parse', + args: [void 0], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'undefined' + } + }] + } + }, + + 'parse(new String("test"))': { + call: 'parse', + args: [new String('test')], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Identifier', + name: 'test' + } + }] + } + }, + + 'parse(new Number(42))': { + call: 'parse', + args: [new Number(42)], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 42 + } + }] + } + }, + + 'parse(new Boolean(true))': { + call: 'parse', + args: [new Boolean(true)], + result: { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: true + } + }] + } + }, + + 'Syntax': { + property: 'Syntax', + result: { + AssignmentExpression: 'AssignmentExpression', + ArrayExpression: 'ArrayExpression', + BlockStatement: 'BlockStatement', + BinaryExpression: 'BinaryExpression', + BreakStatement: 'BreakStatement', + CallExpression: 'CallExpression', + CatchClause: 'CatchClause', + ConditionalExpression: 'ConditionalExpression', + ContinueStatement: 'ContinueStatement', + DoWhileStatement: 'DoWhileStatement', + DebuggerStatement: 'DebuggerStatement', + EmptyStatement: 'EmptyStatement', + ExpressionStatement: 'ExpressionStatement', + ForStatement: 'ForStatement', + ForInStatement: 'ForInStatement', + FunctionDeclaration: 'FunctionDeclaration', + FunctionExpression: 'FunctionExpression', + Identifier: 'Identifier', + IfStatement: 'IfStatement', + Literal: 'Literal', + LabeledStatement: 'LabeledStatement', + LogicalExpression: 'LogicalExpression', + MemberExpression: 'MemberExpression', + NewExpression: 'NewExpression', + ObjectExpression: 'ObjectExpression', + Program: 'Program', + Property: 'Property', + ReturnStatement: 'ReturnStatement', + SequenceExpression: 'SequenceExpression', + SwitchStatement: 'SwitchStatement', + SwitchCase: 'SwitchCase', + ThisExpression: 'ThisExpression', + ThrowStatement: 'ThrowStatement', + TryStatement: 'TryStatement', + UnaryExpression: 'UnaryExpression', + UpdateExpression: 'UpdateExpression', + VariableDeclaration: 'VariableDeclaration', + VariableDeclarator: 'VariableDeclarator', + WhileStatement: 'WhileStatement', + WithStatement: 'WithStatement' + } + } + + }, + + 'Tolerant parse': { + 'return': { + type: 'Program', + body: [{ + type: 'ReturnStatement', + 'argument': null, + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + } + }], + range: [0, 6], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 6 } + }, + errors: [{ + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Illegal return statement' + }] + }, + + '(function () { \'use strict\'; with (i); }())': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '\'use strict\'', + range: [15, 27], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 27 } + } + }, + range: [15, 28], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 28 } + } + }, { + type: 'WithStatement', + object: { + type: 'Identifier', + name: 'i', + range: [35, 36], + loc: { + start: { line: 1, column: 35 }, + end: { line: 1, column: 36 } + } + }, + body: { + type: 'EmptyStatement', + range: [37, 38], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 38 } + } + }, + range: [29, 38], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 38 } + } + }], + range: [13, 40], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 40 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 40], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 40 } + } + }, + 'arguments': [], + range: [1, 42], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 42 } + } + }, + range: [0, 43], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 43 } + } + }], + range: [0, 43], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 43 } + }, + errors: [{ + index: 29, + lineNumber: 1, + column: 30, + message: 'Error: Line 1: Strict mode code may not include a with statement' + }] + }, + + '(function () { \'use strict\'; 021 }())': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'CallExpression', + callee: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '\'use strict\'', + range: [15, 27], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 27 } + } + }, + range: [15, 28], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 28 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 17, + raw: "021", + range: [29, 32], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 32 } + } + }, + range: [29, 33], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 33 } + } + }], + range: [13, 34], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [1, 34], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 34 } + } + }, + 'arguments': [], + range: [1, 36], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 36 } + } + }, + range: [0, 37], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 37 } + } + }], + range: [0, 37], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 37 } + }, + errors: [{ + index: 29, + lineNumber: 1, + column: 30, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }] + }, + + '"use strict"; delete x': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UnaryExpression', + operator: 'delete', + argument: { + type: 'Identifier', + name: 'x', + range: [21, 22], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 22 } + } + }, + prefix: true, + range: [14, 22], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 22 } + } + }, + range: [14, 22], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 22 } + } + }], + range: [0, 22], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 22 } + }, + errors: [{ + index: 22, + lineNumber: 1, + column: 23, + message: 'Error: Line 1: Delete of an unqualified identifier in strict mode.' + }] + }, + + '"use strict"; try {} catch (eval) {}': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'eval', + range: [28, 32], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 32 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [34, 36], + loc: { + start: { line: 1, column: 34 }, + end: { line: 1, column: 36 } + } + }, + range: [21, 36], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 36 } + } + }], + finalizer: null, + range: [14, 36], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 36 } + } + }], + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + }, + errors: [{ + index: 32, + lineNumber: 1, + column: 33, + message: 'Error: Line 1: Catch variable may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; try {} catch (arguments) {}': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'TryStatement', + block: { + type: 'BlockStatement', + body: [], + range: [18, 20], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 20 } + } + }, + guardedHandlers: [], + handlers: [{ + type: 'CatchClause', + param: { + type: 'Identifier', + name: 'arguments', + range: [28, 37], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 37 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [39, 41], + loc: { + start: { line: 1, column: 39 }, + end: { line: 1, column: 41 } + } + }, + range: [21, 41], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 41 } + } + }], + finalizer: null, + range: [14, 41], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 41 } + } + }], + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + }, + errors: [{ + index: 37, + lineNumber: 1, + column: 38, + message: 'Error: Line 1: Catch variable may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; var eval;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'eval', + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }, + init: null, + range: [18, 22], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 22 } + } + }], + kind: 'var', + range: [14, 23], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 23 } + } + }], + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + }, + errors: [{ + index: 22, + lineNumber: 1, + column: 23, + message: 'Error: Line 1: Variable name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; var arguments;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'arguments', + range: [18, 27], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 27 } + } + }, + init: null, + range: [18, 27], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 27 } + } + }], + kind: 'var', + range: [14, 28], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 28 } + } + }], + range: [0, 28], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 28 } + }, + errors: [{ + index: 27, + lineNumber: 1, + column: 28, + message: 'Error: Line 1: Variable name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; eval = 0;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'eval', + range: [14, 18], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 18 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [21, 22], + loc: { + start: { line: 1, column: 21 }, + end: { line: 1, column: 22 } + } + }, + range: [14, 22], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 22 } + } + }, + range: [14, 23], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 23 } + } + }], + range: [0, 23], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 23 } + }, + errors: [{ + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Assignment to eval or arguments is not allowed in strict mode' + }] + }, + + '"use strict"; eval++;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'eval', + range: [14, 18], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 18 } + } + }, + prefix: false, + range: [14, 20], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 20 } + } + }, + range: [14, 21], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 21 } + } + }], + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + }, + errors: [{ + index: 18, + lineNumber: 1, + column: 19, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }] + }, + + '"use strict"; --eval;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'eval', + range: [16, 20], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 20 } + } + }, + prefix: true, + range: [14, 20], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 20 } + } + }, + range: [14, 21], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 21 } + } + }], + range: [0, 21], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 21 } + }, + errors: [{ + index: 20, + lineNumber: 1, + column: 21, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }] + }, + + '"use strict"; arguments = 0;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'arguments', + range: [14, 23], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 23 } + } + }, + right: { + type: 'Literal', + value: 0, + raw: '0', + range: [26, 27], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 27 } + } + }, + range: [14, 27], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 27 } + } + }, + range: [14, 28], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 28 } + } + }], + range: [0, 28], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 28 } + }, + errors: [{ + index: 14, + lineNumber: 1, + column: 15, + message: 'Error: Line 1: Assignment to eval or arguments is not allowed in strict mode' + }] + }, + + '"use strict"; arguments--;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Identifier', + name: 'arguments', + range: [14, 23], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 23 } + } + }, + prefix: false, + range: [14, 25], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 25 } + } + }, + range: [14, 26], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 26 } + } + }], + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + }, + errors: [{ + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Postfix increment/decrement may not have eval or arguments operand in strict mode' + }] + }, + + '"use strict"; ++arguments;': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Identifier', + name: 'arguments', + range: [16, 25], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 25 } + } + }, + prefix: true, + range: [14, 25], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 25 } + } + }, + range: [14, 26], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 26 } + } + }], + range: [0, 26], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 26 } + }, + errors: [{ + index: 25, + lineNumber: 1, + column: 26, + message: 'Error: Line 1: Prefix increment/decrement may not have eval or arguments operand in strict mode' + }] + }, + + + '"use strict";x={y:1,y:1}': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [13, 14], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 14 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'y', + range: [16, 17], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 17 } + } + }, + value: { + type: 'Literal', + value: 1, + raw: '1', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + kind: 'init', + range: [16, 19], + loc: { + start: { line: 1, column: 16 }, + end: { line: 1, column: 19 } + } + }, { + type: 'Property', + key: { + type: 'Identifier', + name: 'y', + range: [20, 21], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 21 } + } + }, + value: { + type: 'Literal', + value: 1, + raw: '1', + range: [22, 23], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 23 } + } + }, + kind: 'init', + range: [20, 23], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 23 } + } + }], + range: [15, 24], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 24 } + } + }, + range: [13, 24], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 24 } + } + }, + range: [13, 24], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 24 } + } + }], + range: [0, 24], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 24 } + }, + errors: [{ + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Duplicate data property in object literal not allowed in strict mode' + }] + }, + + '"use strict"; function eval() {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'eval', + range: [23, 27], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 27 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [30, 32], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 32 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 32], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 32 } + } + }, { + type: 'EmptyStatement', + range: [32, 33], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 33 } + } + }], + range: [0, 33], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 33 } + }, + errors: [{ + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; function arguments() {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'arguments', + range: [23, 32], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 32 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [35, 37], + loc: { + start: { line: 1, column: 35 }, + end: { line: 1, column: 37 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 37], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 37 } + } + }, { + type: 'EmptyStatement', + range: [37, 38], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 38 } + } + }], + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + }, + errors: [{ + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; function interface() {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'interface', + range: [23, 32], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 32 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [35, 37], + loc: { + start: { line: 1, column: 35 }, + end: { line: 1, column: 37 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 37], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 37 } + } + }, { + type: 'EmptyStatement', + range: [37, 38], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 38 } + } + }], + range: [0, 38], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 38 } + }, + errors: [{ + index: 23, + lineNumber: 1, + column: 24, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }] + }, + + '"use strict"; (function eval() {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'eval', + range: [24, 28], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 28 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [31, 33], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 33 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 33], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 33 } + } + }, + range: [14, 35], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 35 } + } + }], + range: [0, 35], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 35 } + }, + errors: [{ + index: 24, + lineNumber: 1, + column: 25, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; (function arguments() {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'arguments', + range: [24, 33], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 33 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [36, 38], + loc: { + start: { line: 1, column: 36 }, + end: { line: 1, column: 38 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 38], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 38 } + } + }, + range: [14, 40], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 40 } + } + }], + range: [0, 40], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 40 } + }, + errors: [{ + index: 24, + lineNumber: 1, + column: 25, + message: 'Error: Line 1: Function name may not be eval or arguments in strict mode' + }] + }, + + '"use strict"; (function interface() {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'interface', + range: [24, 33], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 33 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [36, 38], + loc: { + start: { line: 1, column: 36 }, + end: { line: 1, column: 38 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 38], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 38 } + } + }, + range: [14, 40], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 40 } + } + }], + range: [0, 40], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 40 } + }, + errors: [{ + index: 24, + lineNumber: 1, + column: 25, + message: 'Error: Line 1: Use of future reserved word in strict mode' + }] + }, + + '"use strict"; function f(eval) {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'f', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + params: [{ + type: 'Identifier', + name: 'eval', + range: [25, 29], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 29 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [31, 33], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 33 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 33], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 33 } + } + }, { + type: 'EmptyStatement', + range: [33, 34], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 34 } + } + }], + range: [0, 34], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 34 } + }, + errors: [{ + index: 25, + lineNumber: 1, + column: 26, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }] + }, + + '"use strict"; function f(arguments) {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'f', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + params: [{ + type: 'Identifier', + name: 'arguments', + range: [25, 34], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 34 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [36, 38], + loc: { + start: { line: 1, column: 36 }, + end: { line: 1, column: 38 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 38], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 38 } + } + }, { + type: 'EmptyStatement', + range: [38, 39], + loc: { + start: { line: 1, column: 38 }, + end: { line: 1, column: 39 } + } + }], + range: [0, 39], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 39 } + }, + errors: [{ + index: 25, + lineNumber: 1, + column: 26, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }] + }, + + '"use strict"; function f(foo, foo) {};': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'f', + range: [23, 24], + loc: { + start: { line: 1, column: 23 }, + end: { line: 1, column: 24 } + } + }, + params: [{ + type: 'Identifier', + name: 'foo', + range: [25, 28], + loc: { + start: { line: 1, column: 25 }, + end: { line: 1, column: 28 } + } + }, { + type: 'Identifier', + name: 'foo', + range: [31, 34], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 34 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [36, 38], + loc: { + start: { line: 1, column: 36 }, + end: { line: 1, column: 38 } + } + }, + rest: null, + generator: false, + expression: false, + range: [14, 38], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 38 } + } + }, { + type: 'EmptyStatement', + range: [38, 39], + loc: { + start: { line: 1, column: 38 }, + end: { line: 1, column: 39 } + } + }], + range: [0, 39], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 39 } + }, + errors: [{ + index: 31, + lineNumber: 1, + column: 32, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }] + }, + + '"use strict"; (function f(eval) {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'f', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + params: [{ + type: 'Identifier', + name: 'eval', + range: [26, 30], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 30 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [32, 34], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 34], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 34 } + } + }, + range: [14, 36], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 36 } + } + }], + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + }, + errors: [{ + index: 26, + lineNumber: 1, + column: 27, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }] + }, + + + '"use strict"; (function f(arguments) {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'f', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + params: [{ + type: 'Identifier', + name: 'arguments', + range: [26, 35], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 35 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [37, 39], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 39 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 39], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 39 } + } + }, + range: [14, 41], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 41 } + } + }], + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + }, + errors: [{ + index: 26, + lineNumber: 1, + column: 27, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }] + }, + + '"use strict"; (function f(foo, foo) {});': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'FunctionExpression', + id: { + type: 'Identifier', + name: 'f', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + params: [{ + type: 'Identifier', + name: 'foo', + range: [26, 29], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 29 } + } + }, { + type: 'Identifier', + name: 'foo', + range: [32, 35], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 35 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [37, 39], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 39 } + } + }, + rest: null, + generator: false, + expression: false, + range: [15, 39], + loc: { + start: { line: 1, column: 15 }, + end: { line: 1, column: 39 } + } + }, + range: [14, 41], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 41 } + } + }], + range: [0, 41], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 41 } + }, + errors: [{ + index: 32, + lineNumber: 1, + column: 33, + message: 'Error: Line 1: Strict mode function may not have duplicate parameter names' + }] + }, + + '"use strict"; x = { set f(eval) {} }' : { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Identifier', + name: 'x', + range: [14, 15], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 15 } + } + }, + right: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'f', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + value : { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'eval', + range: [26, 30], + loc: { + start: { line: 1, column: 26 }, + end: { line: 1, column: 30 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [32, 34], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [32, 34], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 34 } + } + }, + kind: 'set', + range: [20, 34], + loc: { + start: { line: 1, column: 20 }, + end: { line: 1, column: 34 } + } + }], + range: [18, 36], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 36 } + } + }, + range: [14, 36], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 36 } + } + }, + range: [14, 36], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 36 } + } + }], + range: [0, 36], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 36 } + }, + errors: [{ + index: 26, + lineNumber: 1, + column: 27, + message: 'Error: Line 1: Parameter name eval or arguments is not allowed in strict mode' + }] + }, + + 'function hello() { "octal directive\\1"; "use strict"; }': { + type: 'Program', + body: [{ + type: 'FunctionDeclaration', + id: { + type: 'Identifier', + name: 'hello', + range: [9, 14], + loc: { + start: { line: 1, column: 9 }, + end: { line: 1, column: 14 } + } + }, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'octal directive\u0001', + raw: '"octal directive\\1"', + range: [19, 38], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 38 } + } + }, + range: [19, 39], + loc: { + start: { line: 1, column: 19 }, + end: { line: 1, column: 39 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [40, 52], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 52 } + } + }, + range: [40, 53], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 53 } + } + }], + range: [17, 55], + loc: { + start: { line: 1, column: 17 }, + end: { line: 1, column: 55 } + } + }, + rest: null, + generator: false, + expression: false, + range: [0, 55], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 55 } + } + }], + range: [0, 55], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 55 } + }, + errors: [{ + index: 19, + lineNumber: 1, + column: 20, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }] + }, + + '"\\1"; \'use strict\';': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: '\u0001', + raw: '"\\1"', + range: [0, 4], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 4 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, { + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '\'use strict\'', + range: [6, 18], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 18 } + } + }, + range: [6, 19], + loc: { + start: { line: 1, column: 6 }, + end: { line: 1, column: 19 } + } + }], + range: [0, 19], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 19 } + }, + errors: [{ + index: 0, + lineNumber: 1, + column: 1, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }] + }, + + '"use strict"; var x = { 014: 3}': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + init: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Literal', + value: 12, + raw: '014', + range: [24, 27], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 27 } + } + }, + value: { + type: 'Literal', + value: 3, + raw: '3', + range: [29, 30], + loc: { + start: { line: 1, column: 29 }, + end: { line: 1, column: 30 } + } + }, + kind: 'init', + range: [24, 30], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 30 } + } + }], + range: [22, 31], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 31 } + } + }, + range: [18, 31], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 31 } + } + }], + kind: 'var', + range: [14, 31], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 31 } + } + }], + range: [0, 31], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 31 } + }, + errors: [{ + index: 24, + lineNumber: 1, + column: 25, + message: 'Error: Line 1: Octal literals are not allowed in strict mode.' + }] + }, + + '"use strict"; var x = { get i() {}, get i() {} }': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + init: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [28, 29], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 29 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [32, 34], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 34 } + } + }, + rest: null, + generator: false, + expression: false, + range: [32, 34], + loc: { + start: { line: 1, column: 32 }, + end: { line: 1, column: 34 } + } + }, + kind: 'get', + range: [24, 34], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 34 } + } + }, { + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [40, 41], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 41 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [44, 46], + loc: { + start: { line: 1, column: 44 }, + end: { line: 1, column: 46 } + } + }, + rest: null, + generator: false, + expression: false, + range: [44, 46], + loc: { + start: { line: 1, column: 44 }, + end: { line: 1, column: 46 } + } + }, + kind: 'get', + range: [36, 46], + loc: { + start: { line: 1, column: 36 }, + end: { line: 1, column: 46 } + } + }], + range: [22, 48], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 48 } + } + }, + range: [18, 48], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 48 } + } + }], + kind: 'var', + range: [14, 48], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 48 } + } + }], + range: [0, 48], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 48 } + }, + errors: [{ + index: 46, + lineNumber: 1, + column: 47, + message: 'Error: Line 1: Object literal may not have multiple get/set accessors with the same name' + }] + }, + + '"use strict"; var x = { i: 42, get i() {} }': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + init: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [24, 25], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 25 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [27, 29], + loc: { + start: { line: 1, column: 27 }, + end: { line: 1, column: 29 } + } + }, + kind: 'init', + range: [24, 29], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 29 } + } + }, { + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [35, 36], + loc: { + start: { line: 1, column: 35 }, + end: { line: 1, column: 36 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [39, 41], + loc: { + start: { line: 1, column: 39 }, + end: { line: 1, column: 41 } + } + }, + rest: null, + generator: false, + expression: false, + range: [39, 41], + loc: { + start: { line: 1, column: 39 }, + end: { line: 1, column: 41 } + } + }, + kind: 'get', + range: [31, 41], + loc: { + start: { line: 1, column: 31 }, + end: { line: 1, column: 41 } + } + }], + range: [22, 43], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 43 } + } + }, + range: [18, 43], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 43 } + } + }], + kind: 'var', + range: [14, 43], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 43 } + } + }], + range: [0, 43], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 43 } + }, + errors: [{ + index: 41, + lineNumber: 1, + column: 42, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }] + }, + + '"use strict"; var x = { set i(x) {}, i: 42 }': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'Literal', + value: 'use strict', + raw: '"use strict"', + range: [0, 12], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 12 } + } + }, + range: [0, 13], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 13 } + } + }, { + type: 'VariableDeclaration', + declarations: [{ + type: 'VariableDeclarator', + id: { + type: 'Identifier', + name: 'x', + range: [18, 19], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 19 } + } + }, + init: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [28, 29], + loc: { + start: { line: 1, column: 28 }, + end: { line: 1, column: 29 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [{ + type: 'Identifier', + name: 'x', + range: [30, 31], + loc: { + start: { line: 1, column: 30 }, + end: { line: 1, column: 31 } + } + }], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [33, 35], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 35 } + } + }, + rest: null, + generator: false, + expression: false, + range: [33, 35], + loc: { + start: { line: 1, column: 33 }, + end: { line: 1, column: 35 } + } + }, + kind: 'set', + range: [24, 35], + loc: { + start: { line: 1, column: 24 }, + end: { line: 1, column: 35 } + } + }, { + type: 'Property', + key: { + type: 'Identifier', + name: 'i', + range: [37, 38], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 38 } + } + }, + value: { + type: 'Literal', + value: 42, + raw: '42', + range: [40, 42], + loc: { + start: { line: 1, column: 40 }, + end: { line: 1, column: 42 } + } + }, + kind: 'init', + range: [37, 42], + loc: { + start: { line: 1, column: 37 }, + end: { line: 1, column: 42 } + } + }], + range: [22, 44], + loc: { + start: { line: 1, column: 22 }, + end: { line: 1, column: 44 } + } + }, + range: [18, 44], + loc: { + start: { line: 1, column: 18 }, + end: { line: 1, column: 44 } + } + }], + kind: 'var', + range: [14, 44], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 44 } + } + }], + range: [0, 44], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 44 } + }, + errors: [{ + index: 42, + lineNumber: 1, + column: 43, + message: 'Error: Line 1: Object literal may not have data and accessor property with the same name' + }] + + + }, + + '({ set s() { } })': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'ObjectExpression', + properties: [{ + type: 'Property', + key: { + type: 'Identifier', + name: 's', + range: [7, 8], + loc: { + start: { line: 1, column: 7 }, + end: { line: 1, column: 8 } + } + }, + value: { + type: 'FunctionExpression', + id: null, + params: [], + defaults: [], + body: { + type: 'BlockStatement', + body: [], + range: [11, 14], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 14 } + } + }, + rest: null, + generator: false, + expression: false, + range: [11, 14], + loc: { + start: { line: 1, column: 11 }, + end: { line: 1, column: 14 } + } + }, + kind: 'set', + range: [3, 14], + loc: { + start: { line: 1, column: 3 }, + end: { line: 1, column: 14 } + } + }], + range: [1, 16], + loc: { + start: { line: 1, column: 1 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + } + }], + range: [0, 17], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 17 } + }, + errors: [{ + index: 9, + lineNumber: 1, + column: 10, + message: 'Error: Line 1: Unexpected token )' + }] + }, + + 'foo("bar") = baz': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'CallExpression', + callee: { + type: 'Identifier', + name: 'foo', + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + 'arguments': [{ + type: 'Literal', + value: 'bar', + raw: '"bar"', + range: [4, 9], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 9 } + } + }], + range: [0, 10], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 10 } + } + }, + right: { + type: 'Identifier', + name: 'baz', + range: [13, 16], + loc: { + start: { line: 1, column: 13 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }], + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + }, + errors: [{ + index: 10, + lineNumber: 1, + column: 11, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }] + }, + + '1 = 2': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'AssignmentExpression', + operator: '=', + left: { + type: 'Literal', + value: 1, + raw: '1', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + right: { + type: 'Literal', + value: 2, + raw: '2', + range: [4, 5], + loc: { + start: { line: 1, column: 4 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }, + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + } + }], + range: [0, 5], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 5 } + }, + errors: [{ + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }] + }, + + '3++': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '++', + argument: { + type: 'Literal', + value: 3, + raw: '3', + range: [0, 1], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 1 } + } + }, + prefix: false, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }], + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + }, + errors: [{ + index: 1, + lineNumber: 1, + column: 2, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }] + }, + + '--4': { + type: 'Program', + body: [{ + type: 'ExpressionStatement', + expression: { + type: 'UpdateExpression', + operator: '--', + argument: { + type: 'Literal', + value: 4, + raw: '4', + range: [2, 3], + loc: { + start: { line: 1, column: 2 }, + end: { line: 1, column: 3 } + } + }, + prefix: true, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }, + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + } + }], + range: [0, 3], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 3 } + }, + errors: [{ + index: 3, + lineNumber: 1, + column: 4, + message: 'Error: Line 1: Invalid left-hand side in assignment' + }] + }, + + 'for (5 in []) {}': { + type: 'Program', + body: [{ + type: 'ForInStatement', + left: { + type: 'Literal', + value: 5, + raw: '5', + range: [5, 6], + loc: { + start: { line: 1, column: 5 }, + end: { line: 1, column: 6 } + } + }, + right: { + type: 'ArrayExpression', + elements: [], + range: [10, 12], + loc: { + start: { line: 1, column: 10 }, + end: { line: 1, column: 12 } + } + }, + body: { + type: 'BlockStatement', + body: [], + range: [14, 16], + loc: { + start: { line: 1, column: 14 }, + end: { line: 1, column: 16 } + } + }, + each: false, + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + } + }], + range: [0, 16], + loc: { + start: { line: 1, column: 0 }, + end: { line: 1, column: 16 } + }, + errors: [{ + index: 6, + lineNumber: 1, + column: 7, + message: 'Error: Line 1: Invalid left-hand side in for-in' + }] + } + + + } +}; + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/package.json b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/package.json new file mode 100644 index 0000000..601b3ea --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/package.json @@ -0,0 +1,45 @@ +{ + "name": "redeyed", + "version": "0.4.4", + "description": "Takes JavaScript code, along with a config and returns the original code with tokens wrapped as configured.", + "author": { + "name": "Thorsten Lorenz", + "email": "thlorenz@gmx.de", + "url": "thlorenz.com" + }, + "main": "redeyed.js", + "scripts": { + "test": "tap test/*.js", + "demo-log": "node examples/replace-log", + "demo": "cd examples/browser; open index.html" + }, + "repository": { + "type": "git", + "url": "git://github.com/thlorenz/redeyed.git" + }, + "keywords": [ + "ast", + "syntax", + "tree", + "source", + "wrap", + "metadata" + ], + "license": "MIT", + "devDependencies": { + "tap": "~0.4.8", + "readdirp": "~0.3.3", + "cardinal": "~0.4.4" + }, + "dependencies": { + "esprima": "~1.0.4" + }, + "readme": "# redeyed [![build status](https://secure.travis-ci.org/thlorenz/redeyed.png?branch=master)](http://travis-ci.org/thlorenz/redeyed)\n\n*Add color to your JavaScript!*\n\n![frog](http://allaboutfrogs.org/gallery/photos/redeyes/red1.gif)\n\n[Red Eyed Tree Frog](http://allaboutfrogs.org/info/species/redeye.html) *(Agalychnis callidryas)*\n\n## What?\n\nTakes JavaScript code, along with a config and returns the original code with tokens wrapped and/or replaced as configured.\n\n## Where?\n\n- server side using nodejs\n- in the [browser](#browser-support)\n\n## What for?\n\nOne usecase is adding metadata to your code that can then be used to apply syntax highlighting.\n\n## How?\n\n- copy the [config.js](https://github.com/thlorenz/redeyed/blob/master/config.js) and edit it in order to specify how\n certain tokens are to be surrounded/replaced\n- replace the `undefined` of each token you want to configure with one of the following\n\n### {String} config\n\n`'before:after'`\n\nwraps the token inside before/after \n\n### {Object} config\n\n`{ _before: 'before', _after: 'after' }`\n\nwraps token inside before/after\n\n#### Missing before and after resolution for {String} and {Object} config\n\nFor the `{String}` and `{Object}` configurations, 'before' or 'after' may be omitted:\n\n- `{String}`: \n - `'before:'` (omitting 'after')\n - `':after'` (omitting 'before')\n- `{Object}`: \n - `{ _before: 'before' }` (omitting '_after')\n - `{ _after: 'after' }` (omitting '_before')\n\nIn these cases the missing half is resolved as follows:\n\n- from the `parent._default` (i.e., `Keyword._default`) if found\n- otherwise from the `config._default` if found\n- otherwise `''` (empty string)\n\n### {Function} config\n\n`function (tokenString, info) { return {String}|{Object}; }`\n\n#### Inputs\n\n- tokenString: the content of the token that is currently being processed\n- info: an object with the following structure\n\n```js\n{\n // {Int}\n // the index of the token being processed inside tokens\n tokenIndex\n\n // {Array}\n // all tokens that are being processed including comments \n // (i.e. the result of merging esprima tokens and comments)\n , tokens \n\n // {Object} \n // the abstract syntax tree of the parsed code\n , ast \n\n // {String}\n // the code that was parsed (same string as the one passed to redeyed(code ..)\n , code\n}\n```\n\nIn most cases the `tokenString` is all you need. The extra info object is passed in case you need to gather more\ninformation about the `token`'s surroundings in order to decide how to transform it. \nSee: [replace-log-example](https://github.com/thlorenz/redeyed/blob/master/examples/replace-log.js)\n\n#### Output\n\nYou can return a {String} or an {Object} from a {Function} config.\n\n- when returning a {String}, the token value will be replaced with it\n- when returning an {Object}, it should be of the following form:\n\n```js\n{\n // {String}\n // the string that should be substituted for the value of the current and all skipped tokens\n replacement\n\n // {Object} (Token)\n // the token after which processing should continue\n // all tokens in between the current one and this one inclusive will be ignored\n , skipPastToken\n}\n```\n\n### Transforming JavaScript code\n\n***redeyed(code, config[, opts])***\n\nInvoke redeyed with your **config**uration, a **code** snippet and maybe **opts** as in the below example:\n\n```javascript\nvar redeyed = require('redeyed')\n , config = require('./path/to/config')\n , code = 'var a = 3;'\n , result;\n\n// redeyed will throw an error (caused by the esprima parser) if the code has invalid javascript\ntry {\n result = redeyed(code, config);\n console.log(result.code);\n} catch(err) {\n console.error(err);\n}\n```\n\n***opts***:\n```js\n{ // {Boolean}\n // if true `result.code` is not assigned and therefore `undefined`\n // if false (default) `result.code` property contains the result of `split.join`\n nojoin: true|false\n}\n```\n\n***return value***:\n\n```js\n{ ast \n , tokens \n , comments \n , splits \n , code \n}\n```\n\n- ast `{Array}`: [abstract syntax tree](http://en.wikipedia.org/wiki/Abstract_syntax_tree) as returned by [esprima\n parse](http://en.wikipedia.org/wiki/Abstract_syntax_tree)\n- tokens `{Array}`: [tokens](http://en.wikipedia.org/wiki/Token_(parser)) provided by esprima (excluding\n comments)\n- comments `{Array}`: block and line comments as provided by esprima\n- splits `{Array}`: code pieces split up, some of which where transformed as configured\n- code `{String}`: transformed code, same as `splits.join('')` unless this step has been skipped (see opts)\n\n## Browser Support\n\n### AMD\n\nEnsure to include [esprima](https://github.com/ariya/esprima) as one of your dependencies\n\n```js\ndefine(['redeyed'], function (redeyed) {\n [ .. ]\n});\n```\n\n### Attached to global window object\n\nThe `redeyed {Function}` will be exposed globally as `window.redeyed` - big surprise!\n\n```html\n\n\n```\n\n## redeyed in the wild\n\n- [cardinal](https://github.com/thlorenz/cardinal): Syntax highlights JavaScript code with ANSI colors to be printed to\n the terminal\n- [peacock](http://thlorenz.github.com/peacock/): JavaScript syntax highlighter that generates html that is compatible\n with pygments styles.\n\n## Examples\n\n- `npm explore redeyed; npm demo` will let you try the [browser example](https://github.com/thlorenz/redeyed/tree/master/examples/browser)\n- `npm explore redeyed; npm demo-log` will let you try the [replace log example](https://github.com/thlorenz/redeyed/blob/master/examples/replace-log.js)\n\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/thlorenz/redeyed/issues" + }, + "homepage": "https://github.com/thlorenz/redeyed", + "_id": "redeyed@0.4.4", + "_from": "redeyed@>=0.4.0 <0.5.0" +} diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/redeyed.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/redeyed.js new file mode 100644 index 0000000..7a326cb --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/redeyed.js @@ -0,0 +1,291 @@ +;(function () { + +'use strict'; +/*jshint laxbreak: true, browser:true */ +/*global define*/ + +var esprima + , exportFn + , toString = Object.prototype.toString + ; + +if (typeof module === 'object' && typeof module.exports === 'object' && typeof require === 'function') { + // server side + esprima = require('esprima'); + exportFn = function (redeyed) { module.exports = redeyed; }; + bootstrap(esprima, exportFn); +} else if (typeof define === 'function' && define.amd) { + // client side + // amd + define(['esprima'], function (esprima) { + return bootstrap(esprima); + }); +} else if (typeof window === 'object') { + // no amd -> attach to window if it exists + // Note that this requires 'esprima' to be defined on the window, so that script has to be loaded first + window.redeyed = bootstrap(window.esprima); +} + +function bootstrap(esprima, exportFn) { + + function isFunction (obj) { + return toString.call(obj) === '[object Function]'; + } + + function isString (obj) { + return toString.call(obj) === '[object String]'; + } + + function isNumber (obj) { + return toString.call(obj) === '[object Number]'; + } + + function isObject (obj) { + return toString.call(obj) === '[object Object]'; + } + + function surroundWith (before, after) { + return function (s) { return before + s + after; }; + } + + function isNonCircular(key) { + return key !== '_parent'; + } + + function objectizeString (value) { + var vals = value.split(':'); + + if (0 === vals.length || vals.length > 2) + throw new Error( + 'illegal string config: ' + value + + '\nShould be of format "before:after"' + ); + + if (vals.length === 1 || vals[1].length === 0) { + return vals.indexOf(':') < 0 ? { _before: vals[0] } : { _after: vals[0] }; + } else { + return { _before: vals[0], _after: vals[1] }; + } + } + + function objectize (node) { + + // Converts 'bef:aft' to { _before: bef, _after: aft } + // and resolves undefined before/after from parent or root + + function resolve (value, key) { + // resolve before/after from root or parent if it isn't present on the current node + if (!value._parent) return undefined; + + // Immediate parent + if (value._parent._default && value._parent._default[key]) return value._parent._default[key]; + + // Root + var root = value._parent._parent; + if (!root) return undefined; + + return root._default ? root._default[key] : undefined; + } + + function process (key) { + var value = node[key]; + + if (!value) return; + if (isFunction(value)) return; + + // normalize all strings to objects + if (isString(value)) { + node[key] = value = objectizeString(value); + } + + value._parent = node; + if (isObject(value)) { + if (!value._before && !value._after) return objectize (value); + + // resolve missing _before or _after from parent(s) + // in case we only have either one on this node + value._before = value._before || resolve(value, '_before'); + value._after = value._after || resolve(value, '_after'); + + return; + } + + throw new Error('nodes need to be either {String}, {Object} or {Function}.' + value + ' is neither.'); + } + + // Process _default ones first so children can resolve missing before/after from them + if (node._default) process('_default'); + + Object.keys(node) + .filter(function (key) { + return isNonCircular(key) + && node.hasOwnProperty(key) + && key !== '_before' + && key !== '_after' + && key !== '_default'; + }) + .forEach(process); + } + + function functionize (node) { + Object.keys(node) + .filter(function (key) { + return isNonCircular(key) && node.hasOwnProperty(key); + }) + .forEach(function (key) { + var value = node[key]; + + if (isFunction(value)) return; + + if (isObject(value)) { + + if (!value._before && !value._after) return functionize(value); + + // at this point before/after were "inherited" from the parent or root + // (see objectize) + var before = value._before || ''; + var after = value._after || ''; + + node[key] = surroundWith (before, after); + return node[key]; + } + }); + } + + function normalize (root) { + objectize(root); + functionize(root); + } + + function mergeTokensAndComments(tokens, comments) { + var all = {}; + + function addToAllByRangeStart(t) { all[ t.range[0] ] = t; } + + tokens.forEach(addToAllByRangeStart); + comments.forEach(addToAllByRangeStart); + + // keys are sorted automatically + return Object.keys(all) + .map(function (k) { return all[k]; }); + } + + function redeyed (code, config, opts) { + opts = opts || {}; + + // remove shebang + code = code.replace(/^\#\!.*/, ''); + + var ast = esprima.parse(code, { tokens: true, comment: true, range: true, tolerant: true }) + , tokens = ast.tokens + , comments = ast.comments + , lastSplitEnd = 0 + , splits = [] + , transformedCode + , all + , info + ; + + normalize(config); + + function tokenIndex(tokens, tkn, start) { + var current + , rangeStart = tkn.range[0]; + + for (current = start; current < tokens.length; current++) { + if (tokens[current].range[0] === rangeStart) return current; + } + + throw new Error('Token %s not found at or after index: %d', tkn, start); + } + + function process(surround) { + var result + , currentIndex + , nextIndex + , skip = 0 + , splitEnd + ; + + result = surround(code.slice(start, end), info); + if (isObject(result)) { + splits.push(result.replacement); + + currentIndex = info.tokenIndex; + nextIndex = tokenIndex(info.tokens, result.skipPastToken, currentIndex); + skip = nextIndex - currentIndex; + splitEnd = skip > 0 ? tokens[nextIndex - 1].range[1] : end; + } else { + splits.push(result); + splitEnd = end; + } + + return { skip: skip, splitEnd: splitEnd }; + } + + function addSplit (start, end, surround, info) { + var result + , nextIndex + , skip = 0 + ; + + if (start >= end) return; + if (surround) { + result = process(surround); + skip = result.skip; + lastSplitEnd = result.splitEnd; + } else { + splits.push(code.slice(start, end)); + lastSplitEnd = end; + } + + return skip; + } + + all = mergeTokensAndComments(tokens, comments); + for (var tokenIdx = 0; tokenIdx < all.length; tokenIdx++) { + var token = all[tokenIdx] + , surroundForType = config[token.type] + , surround + , start + , end; + + // At least the type (e.g., 'Keyword') needs to be specified for the token to be surrounded + if (surroundForType) { + + // root defaults are only taken into account while resolving before/after otherwise + // a root default would apply to everything, even if no type default was specified + surround = surroundForType + && surroundForType.hasOwnProperty(token.value) + && surroundForType[token.value] + && isFunction(surroundForType[token.value]) + ? surroundForType[token.value] + : surroundForType._default; + + start = token.range[0]; + end = token.range[1]; + + addSplit(lastSplitEnd, start); + info = { tokenIndex: tokenIdx, tokens: all, ast: ast, code: code }; + tokenIdx += addSplit(start, end, surround, info); + } + } + + if (lastSplitEnd < code.length) { + addSplit(lastSplitEnd, code.length); + } + + transformedCode = opts.nojoin ? undefined : splits.join(''); + + return { + ast : ast + , tokens : tokens + , comments : comments + , splits : splits + , code : transformedCode + }; + } + + return exportFn ? exportFn(redeyed) : redeyed; +} +})(); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-before-after-config.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-before-after-config.js new file mode 100644 index 0000000..d0f8284 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-before-after-config.js @@ -0,0 +1,54 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var result = redeyed(code, opts).code + this.equals(result, expected, inspect(code) + ' => ' + inspect(expected)) + return this; + } + + t.end() +}) +test('\nbefore/after config, keywords', function (t) { + + var opts001 = { Keyword: { _default: { _before: '*', _after: '&' } } }; + t.test('\n# ' + inspect(opts001), function (t) { + t.assertSurrounds('this', opts001, '*this&') + t.assertSurrounds('if (a == 1) return', opts001, '*if& (a == 1) *return&') + t.assertSurrounds('var n = new Test();', opts001, '*var& n = *new& Test();') + t.end() + }) + + var opts002 = { + Keyword: { + 'function': { _before: '^' } + , 'return': { _before: '(', _after: ')' } + , _default: { _before: '*' , _after: '&' } + } + }; + + t.test('\n# ' + inspect(opts002), function (t) { + t.assertSurrounds( + [ 'function foo (bar) {' + , ' var a = 3;' + , ' return bar + a;' + , '}' + ].join('\n') + , opts002 + , [ '^function& foo (bar) {' + , ' *var& a = 3;' + , ' (return) bar + a;' + , '}' + ].join('\n')) + t.end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-browser.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-browser.js new file mode 100644 index 0000000..ddb25ce --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-browser.js @@ -0,0 +1,69 @@ +'use strict' +/*jshint asi: true, browser: true*/ +/*global define window */ + +var test = require('tap').test + , util = require('util') + , redeyedExport = require('..') + , redeyedkey = require.resolve('..') + , esprima = require('esprima') + +function setup() { + // remove redeyed from require cache to force re-require for each test + delete require.cache[redeyedkey]; + + // remove globals + delete global.window; + delete global.define; +} + +// TODO: need to run in vm in order to properly simulate require and module not being present +return; +test('define and window exist', function (t) { + var defineCb + , deps + + setup() + + // declare browser globals + global.window = { } + + global.define = function (deps_, cb) { + deps_ = deps + defineCb = cb + } + + define.amd = true + + var redeyed = require('..') + , definedredeyed = defineCb(esprima) + + t.equal(window.redeyed, undefined, 'redeyed is not attached to window') + t.notEqual(redeyed.toString(), redeyedExport.toString(), 'redeyed is not exported') + t.equal(definedredeyed.toString(), redeyedExport.toString(), 'redeyed is defined') + + t.end() +}) + +test('window exists, but define doesn\'t', function (t) { + setup() + + // declare browser globals + global.window = { esprima: esprima } + + var redeyed = require('..') + + t.equal(window.redeyed.toString(), redeyedExport.toString(), 'redeyed is attached to window') + t.notEqual(redeyed.toString(), redeyedExport.toString(), 'redeyed is not exported') + t.end() +}) + +test('neither window nor define exist', function (t) { + setup() + + var redeyed = require('..') + + t.equal(redeyed.toString(), redeyedExport.toString(), 'redeyed is exported') + t.end() +}) + diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-comments.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-comments.js new file mode 100644 index 0000000..09392cc --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-comments.js @@ -0,0 +1,71 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var result = redeyed(code, opts) + this.equals(result.code, expected, inspect(code) + ' => ' + inspect(expected)) + return this; + } + + t.end() +}) + +test('\nstring config, Line comments', function (t) { + var opts = { Line: { _default: '*:&' } }; + t.test('\n# ' + inspect(opts), function (t) { + + t.assertSurrounds( + '// a comment' + , opts + , '*// a comment&' + ) + t.assertSurrounds( + '// comment then new line\nif (a == 1) return' + , opts + , '*// comment then new line&\nif (a == 1) return' + ) + t.assertSurrounds( + 'var n = new Test();// some comment after\n//more comment\nvar s = 3;' + , opts + , 'var n = new Test();*// some comment after&\n*//more comment&\nvar s = 3;' + ) + t.end() + }) +}) + +test('\nstring config, Block comments', function (t) { + var opts = { Block: { _default: '_:-' } }; + t.test('\n# ' + inspect(opts), function (t) { + + t.assertSurrounds( + '/* a comment */' + , opts + , '_/* a comment */-' + ) + t.assertSurrounds( + '/* comment then new line*/\nif (a == 1) /* inline */ return' + , opts + , '_/* comment then new line*/-\nif (a == 1) _/* inline */- return' + ) + t.assertSurrounds( + 'var n = new Test();/* some comment after*/\n/*more comment*/\nvar s = 3;' + , opts + , 'var n = new Test();_/* some comment after*/-\n_/*more comment*/-\nvar s = 3;' + ) + t.assertSurrounds( + 'var a = 4;\n/* Multi line comment\n * Next line\n * and another\n*/ var morecode = "here";' + , opts + , 'var a = 4;\n_/* Multi line comment\n * Next line\n * and another\n*/- var morecode = "here";' + ) + t.end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-config-with-undefineds.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-config-with-undefineds.js new file mode 100644 index 0000000..5ddc40d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-config-with-undefineds.js @@ -0,0 +1,60 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var optsi = inspect(opts); + var result = redeyed(code, opts).code + + this.equals( result + , expected + , util.format('%s: %s => %s', optsi, inspect(code), inspect(expected)) + ) + return this; + } + + t.end() +}) + +test('\n undefineds only', function (t) { + t.assertSurrounds('1 + 2', { Numeric: { _default: undefined } }, '1 + 2') + t.assertSurrounds('1 + 2', { Numeric: { _default: undefined }, _default: undefined }, '1 + 2') + + t.assertSurrounds( + 'return true' + , { 'Boolean': { 'true': undefined, 'false': undefined, _default: undefined } , _default: undefined } + , 'return true' + ) + + t.end() +}) + +test('\n mixed', function (t) { + t.assertSurrounds( + 'return true || false' + , { 'Boolean': { 'true': '&:', 'false': undefined, _default: undefined } , _default: undefined } + , 'return &true || false' + ) + + t.assertSurrounds( + 'return true || false' + , { 'Boolean': { 'true': '&:', 'false': undefined, _default: ':?' } , _default: undefined } + , 'return &true? || false?' + ) + + t.assertSurrounds( + 'return true || false' + , { 'Boolean': { 'true': '&:', 'false': undefined, _default: undefined } , _default: ':?' } + , 'return &true? || false' + ) + + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-extra-params.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-extra-params.js new file mode 100644 index 0000000..f962b7c --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-extra-params.js @@ -0,0 +1,57 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('function - config passing idx and tokens', function (t) { + + var args = [] + , opts001 = { + Boolean: { + _default: identity + } + , Keyword: { + _default: identity + } + , Identifier: { + _default: identity + } + , Punctuator: { + _default: identity + } + } + , code = 'var fn = function () { return true; }' + + function identity (s, info) { + args.push( { value: s, idx: info.tokenIndex, tokens: info.tokens, code: info.code }) + // returning unchanged string will keep the splits be equal to the original tokens + return s + } + + function tokenValue (t) { return t.value; } + + t.test(inspect(opts001) + ' -- ' + code, function (t) { + + var result = redeyed(code, opts001, { splits: true }) + , tokens = result.tokens + + t.equals(args.length, tokens.length, 'called with all tokens') + + for (var i = 0; i < tokens.length; i++) { + var token = tokens[i] + , arg = args[i] + + t.equals(arg.value, token.value, 'passes correct value: ' + inspect([ arg.value, token.value ])) + t.equals(arg.idx, i, 'passes correct index') + t.equals(arg.code, code, 'passes code') + t.deepEquals(arg.tokens, tokens, 'passes all tokens') + } + t.end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-skipping-tokens.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-skipping-tokens.js new file mode 100644 index 0000000..ff14273 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config-skipping-tokens.js @@ -0,0 +1,89 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + + +test('given i skip 2 more tokens after each semicolon', function (t) { + var calls = 0 + , opts = { + Punctuator: { + ';': function identity (s, info) { + // tell it to skip past second to last token that is 2 ahead of the current one + calls++ + var skipToken = info.tokens[info.tokenIndex + 2] + return skipToken ? { replacement: s, skipPastToken: skipToken } : s; + } + } + } + ; + + [ { code: ';;;' , expectedCalls: 1 } + , { code: ';;;;' , expectedCalls: 2 } + , { code: '; ; ; ;' , expectedCalls: 2 } + , { code: ';;; ;;; ;;; ;' , expectedCalls: 4 } + , { code: ';;; ;;; ;;; ;;; ;' , expectedCalls: 5 } + , { code: ';;; ;;; ;;; ;;; ;;;' , expectedCalls: 5 } + , { code: ';;; ;;; ;;; ;;; ;;; ;' , expectedCalls: 6 } + ].forEach(function (x) { + calls = 0 + redeyed(x.code, opts); + t.equals(calls, x.expectedCalls, 'calls ' + x.expectedCalls + ' times for ' + x.code) + }); + t.end() +}) + +test('replace log', function (t) { + var kinds = [ 'info', 'warn', 'error' ] + , opts = { + Identifier: { + console: function replaceLog(s, info) { + var code = info.code + , idx = info.tokenIndex + , tokens = info.tokens + , kind = tokens[idx + 2].value + , openParen = tokens[idx + 3].value + , firstArgTkn = tokens[idx + 4] + , argIdx = idx + 3 + , open + , tkn + ; + + open = 1; + while (open) { + tkn = tokens[++argIdx]; + + if (tkn.value === '(') open++; + if (tkn.value === ')') open--; + } + + var argsIncludingClosingParen = code.slice(firstArgTkn.range[0], tkn.range[1]) + , result = 'log.' + kind + '("main-logger", ' + argsIncludingClosingParen; + + return { replacement: result, skipPastToken: tkn }; + } + } + } + + , origCode = [ + 'console.info("info ", 1);' + , 'console.warn("warn ", 3);' + , 'console.error("error ", new Error("oh my!"));' + ].join('\n') + + , expectedCode = [ + 'log.info("main-logger", "info ", 1));' + , 'log.warn("main-logger", "warn ", 3));' + , 'log.error("main-logger", "error ", new Error("oh my!")));' + ].join('\n') + , code = redeyed(origCode, opts).code + + t.equals(code, expectedCode, 'transforms all log statements') + t.end() +}); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config.js new file mode 100644 index 0000000..6c5ed29 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-function-config.js @@ -0,0 +1,142 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var result = redeyed(code, opts).code + this.equals(result, expected, inspect(code) + ' => ' + inspect(expected)) + return this; + } + + t.end() +}) + +test('\nfunction config, keywords', function (t) { + + var opts001 = { Keyword: { _default: function (s) { return '*' + s + '&'; } } }; + t.test('\n# ' + inspect(opts001), function (t) { + t.assertSurrounds('this', opts001, '*this&') + + t.assertSurrounds('this ', opts001, '*this& ') + t.assertSurrounds(' this', opts001, ' *this&') + t.assertSurrounds(' this ', opts001, ' *this& ') + t.assertSurrounds('if (a == 1) return', opts001, '*if& (a == 1) *return&') + t.assertSurrounds('var n = new Test();', opts001, '*var& n = *new& Test();') + t.assertSurrounds( + [ 'function foo (bar) {' + , ' var a = 3;' + , ' return bar + a;' + , '}' + ].join('\n') + , opts001 + , [ '*function& foo (bar) {' + , ' *var& a = 3;' + , ' *return& bar + a;' + , '}' + ].join('\n')) + t.end() + }) + + var opts002 = { + Keyword: { + 'function': function (s) { return '^' + s + '&' } + , 'return': function (s) { return '(' + s + ')' } + , _default: function (s) { return '*' + s + '&' } + } + }; + + t.test('\n# ' + inspect(opts002), function (t) { + t.assertSurrounds( + [ 'function foo (bar) {' + , ' var a = 3;' + , ' return bar + a;' + , '}' + ].join('\n') + , opts002 + , [ '^function& foo (bar) {' + , ' *var& a = 3;' + , ' (return) bar + a;' + , '}' + ].join('\n')) + t.end() + }) +}) + +test('#\n functin config - resolving', function (t) { + var opts001 = { + Keyword: { + 'var': function (s) { return '^' + s + '&' } + } + , _default: function (s) { return '*' + s + '&' } + }; + t.test('\n# specific but no type default and root default - root default not applied' + inspect(opts001), function (t) { + t.assertSurrounds('var n = new Test();', opts001, '^var& n = new Test();').end(); + }) + + var opts002 = { + Keyword: { + 'var': function (s) { return '^' + s + '&' } + , _default: function (s) { return '*' + s + '&' } + } + , _default: function (s) { return '(' + s + ')' } + }; + t.test('\n# no type default but root default' + inspect(opts002), function (t) { + t.assertSurrounds('var n = new Test();', opts002, '^var& n = *new& Test();').end(); + }) +}) + +test('#\n function config - replacing', function (t) { + var opts001 = { + Keyword: { + 'var': function () { return 'const' } + } + }; + t.test('\n# type default and root default (type wins)' + inspect(opts001), function (t) { + t.assertSurrounds('var n = new Test();', opts001, 'const n = new Test();').end(); + }) + + var opts002 = { + Keyword: { + _default: function () { return 'const' } + } + }; + t.test('\n# type default' + inspect(opts002), function (t) { + t.assertSurrounds('var n = new Test();', opts002, 'const n = const Test();').end(); + }) + + var opts003 = { + Keyword: { + 'new': function () { return 'NEW'; } + , _default: function () { return 'const' } + } + }; + t.test('\n# specific and type default' + inspect(opts003), function (t) { + t.assertSurrounds('var n = new Test();', opts003, 'const n = NEW Test();').end(); + }) + + var opts004 = { + Keyword: { + _default: function (s) { return s.toUpperCase() } + } + , _default: function (s) { return 'not applied'; } + }; + t.test('\n# type default and root default (type wins)' + inspect(opts004), function (t) { + t.assertSurrounds('var n = new Test();', opts004, 'VAR n = NEW Test();').end(); + }) + + var opts005 = { + Keyword: { } + , _default: function (s) { return s.toUpperCase() } + }; + t.test('\n# no type default only root default - not applied' + inspect(opts005), function (t) { + t.assertSurrounds('var n = new Test();', opts005, 'var n = new Test();').end(); + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-mixed.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-mixed.js new file mode 100644 index 0000000..2346ba9 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-mixed.js @@ -0,0 +1,46 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var result = redeyed(code, opts).code + this.equals(result, expected, inspect(code) + ' => ' + inspect(expected)) + return this; + } + + t.end() +}) + +test('\nmixed config, keywords', function (t) { + var opts001 = { + Keyword: { + 'this': function (s) { return '_' + s; } + , 'if': { _before: '^' } + , _default: '*:&' + } + }; + t.test('\n# ' + inspect(opts001), function (t) { + t.assertSurrounds('if (this.hello) return "world";', opts001, '^if& (_this.hello) *return& "world";').end() + }) + + var opts002 = { + Keyword: { + 'this': function (s) { return '_' + s; } + , 'if': { _before: '^' } + , 'return': ':)' + , _default: ':&' + } + , _default: '*:&' + }; + t.test('\n# ' + inspect(opts002), function (t) { + t.assertSurrounds('if (this.hello) return "world";', opts002, '^if& (_this.hello) *return) "world";').end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-result.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-result.js new file mode 100644 index 0000000..9a138dc --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-result.js @@ -0,0 +1,48 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + , esprima = require('esprima') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('redeyed result has esprima ast, tokens, comments and splits and transformed code', function (t) { + var code = '// a comment\nvar a = 3;' + , conf = { Keyword: { _default: '_:-' } } + + , ast = esprima.parse(code, { tokens: true, comment: true, range: true, tolerant: true }) + , tokens = ast.tokens + , comments = ast.comments + + , result = redeyed(code, conf) + + console.log(ast) + t.deepEquals(result.ast, ast, 'ast') + t.deepEquals(result.tokens, tokens, 'tokens') + t.deepEquals(result.comments, comments, 'comments') + t.notEquals(result.code, undefined, 'code') + + t.end() +}); + +test('redeyed result - { nojoin } has esprima ast, tokens, comments and splits but no transformed code', function (t) { + var code = '// a comment\nvar a = 3;' + , conf = { Keyword: { _default: '_:-' } } + + , ast = esprima.parse(code, { tokens: true, comment: true, range: true, tolerant: true }) + , tokens = ast.tokens + , comments = ast.comments + + , result = redeyed(code, conf, { nojoin: true }) + + t.deepEquals(result.ast, ast, 'ast') + t.deepEquals(result.tokens, tokens, 'tokens') + t.deepEquals(result.comments, comments, 'comments') + t.equals(result.code, undefined, 'code') + + t.end() +}); diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-script-level-return.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-script-level-return.js new file mode 100644 index 0000000..bbdbbb7 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-script-level-return.js @@ -0,0 +1,22 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('properly handles script level return -- no blow up', function (t) { + var code = [ + , 'return 1;' + ].join('\n') + , opts = { Keyword: { 'return': '%:^' } } + , expected = '\n%return^ 1;' + , res = redeyed(code, opts).code + + t.equals(res, expected, inspect(code) + ' opts: ' + inspect(opts) + ' => ' + inspect(expected)) + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-shebang.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-shebang.js new file mode 100644 index 0000000..f94ee39 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-shebang.js @@ -0,0 +1,23 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('removes shebang from the code before parsing it', function (t) { + var code = [ + '#!/usr/bin/env node' + , 'var util = require("util");' + ].join('\n') + , opts = { Keyword: { 'var': '%:^' } } + , expected = '\n%var^ util = require("util");' + , res = redeyed(code, opts).code + + t.equals(res, expected, inspect(code) + ' opts: ' + inspect(opts) + ' => ' + inspect(expected)) + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-smoke.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-smoke.js new file mode 100644 index 0000000..cf6c81b --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-smoke.js @@ -0,0 +1,57 @@ +'use strict'; +/*jshint asi: true*/ + +// applying redeyed to a bunch of files of contained libraries as a smoke test +var test = require('tap').test + , path = require('path') + , fs = require('fs') + , readdirp = require('readdirp') + , redeyed = require('..') + , node_modules = path.join(__dirname, '..', 'node_modules') + , tapdir = path.join(node_modules, 'tap') + , esprimadir = path.join(node_modules, 'esprima') + +test('tap', function (t) { + var invalidTapFiles = [ + 'async-map-ordered.js' + , 'prof.js' + ] + + readdirp({ root: tapdir, fileFilter: '*.js' }) + .on('data', function (entry) { + + if (~invalidTapFiles.indexOf(entry.name)) return + + var code = fs.readFileSync(entry.fullPath, 'utf-8') + , result = redeyed(code, { Keyword: { 'var': '+:-' } }).code + + t.assert(~result.indexOf('+var-') || !(~result.indexOf('var ')), 'redeyed ' + entry.path) + }) + .on('end', t.end.bind(t)) +}) + +test('esprima', function (t) { + + readdirp({ root: esprimadir, fileFilter: '*.js' }) + .on('data', function (entry) { + + var code = fs.readFileSync(entry.fullPath, 'utf-8') + , result = redeyed(code, { Keyword: { 'var': '+:-' } }).code + + t.assert(~result.indexOf('+var-') || !(~result.indexOf('var ')), 'redeyed ' + entry.path) + }) + .on('end', t.end.bind(t)) +}) + +test('redeyed', function (t) { + + readdirp({ root: path.join(__dirname, '..'), fileFilter: '*.js', directoryFilter: ['!.git', '!node_modules' ] }) + .on('data', function (entry) { + + var code = fs.readFileSync(entry.fullPath, 'utf-8') + , result = redeyed(code, { Keyword: { 'var': '+:-' } }).code + + t.assert(~result.indexOf('+var-') || !(~result.indexOf('var ')), 'redeyed ' + entry.path) + }) + .on('end', t.end.bind(t)) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-string-config.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-string-config.js new file mode 100644 index 0000000..25a8953 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-string-config.js @@ -0,0 +1,124 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var result = redeyed(code, opts).code + this.equals(result, expected, inspect(code) + ' => ' + inspect(expected)) + return this; + } + + t.end() +}) + +test('\nstring config, keywords', function (t) { + + var opts001 = { Keyword: { _default: '*:&' } }; + t.test('\n# ' + inspect(opts001), function (t) { + t.assertSurrounds('this', opts001, '*this&') + t.assertSurrounds('if (a == 1) return', opts001, '*if& (a == 1) *return&') + t.assertSurrounds('var n = new Test();', opts001, '*var& n = *new& Test();') + t.end() + }) + + var opts002 = { + Keyword: { + 'function': '^:' + , 'return': '(:)' + , _default: '*:&' + } + }; + + t.test('\n# ' + inspect(opts002), function (t) { + t.assertSurrounds( + [ 'function foo (bar) {' + , ' var a = 3;' + , ' return bar + a;' + , '}' + ].join('\n') + , opts002 + , [ '^function& foo (bar) {' + , ' *var& a = 3;' + , ' (return) bar + a;' + , '}' + ].join('\n')) + t.end() + }) +}) + +test('\nstring configs resolve from type and root', function (t) { + var code = 'var a = new Test();' + + function run(t, conf, expected, code_) { + t.test('\n# ' + inspect(conf), function (t) { + t.assertSurrounds(code_ || code, conf, expected); + t.end() + }) + } + + // at least the token kind has to be configured in order for the root_default to be applied + // otherwise a root._default would affect all tokens, even the ones we want to leave unchanged + run(t, { _default: '*:' }, 'var a = new Test();') + + t.test('\n\n# only before or after specified, but no root._default', function (t) { + run(t, { Keyword: { _default: '*:' } }, '*var a = *new Test();') + run(t, { Keyword: { _default: ':-' } }, 'var- a = new- Test();') + t.end() + }) + + t.test('\n\n# resolve missing from root._default', function (t) { + run(t, { Keyword: { _default: '*:' }, _default: '(:-' }, '*var- a = *new- Test();') + run(t, { Keyword: { _default: ':-' }, _default: '*:)' }, '*var- a = *new- Test();') + t.end() + }) + + t.test('\n\n# no resolve if all specified', function (t) { + run(t, { Keyword: { _default: '+:-' }, _default: '*:)' }, '+var- a = +new- Test();') + run(t, { Keyword: { _default: ':-' }, _default: ':)' }, 'var- a = new- Test();') + t.end() + }) + + t.test('\n\n# resolve specific token no defaults', function (t) { + run(t, { Keyword: { 'var': '*:' } }, '*var a = new Test();') + run(t, { Keyword: { 'var': ':-' } }, 'var- a = new Test();') + t.end() + }) + + t.test('\n\n# resolve specific token with type defaults', function (t) { + run(t, { Keyword: { 'var': '*:', _default: ':-' } }, '*var- a = new- Test();') + run(t, { Keyword: { 'var': '*:', _default: '(:-' } }, '*var- a = (new- Test();') + run(t, { Keyword: { 'var': ':-', _default: '*:' } }, '*var- a = *new Test();') + run(t, { Keyword: { 'var': ':-', _default: '*:)' } }, '*var- a = *new) Test();') + run(t, { Keyword: { 'var': ':-', 'new': ':&', _default: '*:' } }, '*var- a = *new& Test();') + t.end() + }) + + t.test( + '\n\n# resolve specific token with root defaults, but no type default - root default not applied to unspecified tokens' + , function (t) { + run(t, { Keyword: { 'var': '*:' }, _default: ':-' }, '*var- a = new Test();') + run(t, { Keyword: { 'var': ':-' }, _default: '*:' }, '*var- a = new Test();') + t.end() + } + ) + + t.test('\n\n# resolve specific token with type and root defaults', function (t) { + run(t, { Keyword: { 'var': '*:', _default: '+:-' }, _default: ':)' }, '*var- a = +new- Test();') + run(t, { Keyword: { 'var': ':-', _default: '*:+' }, _default: '(:' }, '*var- a = *new+ Test();') + t.end() + }) + + t.test('all exact tokens undefined, but type default', function (t) { + run(t, { 'Boolean': { 'true': undefined, 'false': undefined, _default: '+:-' } }, 'return +true- || +false-;', 'return true || false;') + }) + + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-types.js b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-types.js new file mode 100644 index 0000000..ca4837d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/node_modules/redeyed/test/redeyed-types.js @@ -0,0 +1,71 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , redeyed = require('..') + +function inspect (obj) { + return util.inspect(obj, false, 5, true) +} + +test('adding custom asserts ... ', function (t) { + t.constructor.prototype.assertSurrounds = function (code, opts, expected) { + var optsi = inspect(opts); + var result = redeyed(code, opts).code + + this.equals( result + , expected + , util.format('%s: %s => %s', optsi, inspect(code), inspect(expected)) + ) + return this; + } + + t.end() +}) + +test('types', function (t) { + t.test('\n# Boolean', function (t) { + t.assertSurrounds('return true;', { 'Boolean': { _default: '$:%' } }, 'return $true%;') + t.assertSurrounds( 'return true; return false;' + , { 'Boolean': { 'false': '#:', _default: '$:%' } } + , 'return $true%; return #false%;') + t.end() + }) + + t.test('\n# Identifier', function (t) { + t.assertSurrounds('var a = 1;', { 'Identifier': { _default: '$:%' } }, 'var $a% = 1;') + t.assertSurrounds( 'var a = 1; const b = 2;' + , { 'Identifier': { 'b': '#:', _default: '$:%' } } + , 'var $a% = 1; const #b% = 2;') + t.end() + }) + + t.test('\n# Null', function (t) { + t.assertSurrounds('return null;', { 'Null': { _default: '$:%' } }, 'return $null%;').end() + }) + + t.test('\n# Numeric', function (t) { + t.assertSurrounds('return 1;', { 'Numeric': { _default: '$:%' } }, 'return $1%;') + t.assertSurrounds( 'return 1; return 2;' + , { 'Numeric': { '2': '#:', _default: '$:%' } } + , 'return $1%; return #2%;') + t.end() + }) + + t.test('\n# Punctuator', function (t) { + t.assertSurrounds('return 2 * 2;', { 'Punctuator': { _default: '$:%' } }, 'return 2 $*% 2$;%') + t.assertSurrounds( 'return 2 * 2;' + , { 'Punctuator': {'*': '#:', _default: '$:%' } } + , 'return 2 #*% 2$;%') + t.end() + }) + + t.test('\n# String', function (t) { + t.assertSurrounds('return "hello";', { 'String': { _default: '$:%' } }, 'return $"hello"%;') + t.assertSurrounds( 'return "hello"; return "world";' + , { 'String': { '"world"': '#:', _default: '$:%' } } + , 'return $"hello"%; return #"world"%;') + t.end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/package.json b/node_modules/mysql2/node_modules/cardinal/package.json new file mode 100644 index 0000000..43166c5 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/package.json @@ -0,0 +1,50 @@ +{ + "name": "cardinal", + "version": "0.4.4", + "description": "Syntax highlights JavaScript code with ANSI colors to be printed to the terminal.", + "main": "cardinal.js", + "scripts": { + "test": "tap ./test/*.js", + "demo": "node examples/highlight-string.js; node examples/highlight-self; node examples/highlight-self-hide-semicolons;" + }, + "bin": { + "cdl": "./bin/cdl.js" + }, + "repository": { + "type": "git", + "url": "git://github.com/thlorenz/cardinal.git" + }, + "keywords": [ + "syntax", + "highlight", + "theme", + "javascript", + "json", + "terminal", + "console", + "print", + "output" + ], + "author": { + "name": "Thorsten Lorenz", + "email": "thlorenz@gmx.de", + "url": "thlorenz.com" + }, + "license": "MIT", + "dependencies": { + "redeyed": "~0.4.0", + "ansicolors": "~0.2.1" + }, + "devDependencies": { + "tap": "~0.3.1", + "readdirp": "~0.2.1" + }, + "readme": "# cardinal [![Build Status](https://secure.travis-ci.org/thlorenz/cardinal.png)](http://travis-ci.org/thlorenz/cardinal)\n\n[![NPM](https://nodei.co/npm/cardinal.png?downloads=true&stars=true)](https://nodei.co/npm/cardinal/)\n\n**car·di·nal** *(kärdn-l, kärdnl)* - crested thick-billed North American finch having bright red plumage in the male.\n\n![screenshot](https://github.com/thlorenz/cardinal/raw/master/assets/screen-shot.png)\n\n## Features\n\n- highlights JavaScript code with ANSI colors to improve terminal output\n- theming support, see [custom color themes](https://github.com/thlorenz/cardinal/tree/master/themes)\n- optionally print line numbers\n- API and command line interface (`cdl`)\n- `.cardinalrc` config to customize settings\n- supports UNIX pipes\n\n***\n\n**Table of Contents** *generated with [DocToc](http://doctoc.herokuapp.com/)*\n\n- [Installation](#installation)\n - [As library](#as-library)\n - [As Commandline Tool](#as-commandline-tool)\n- [Commandline](#commandline)\n - [Highlight a file](#highlight-a-file)\n - [As part of a UNIX pipe](#as-part-of-a-unix-pipe)\n - [Theme](#theme)\n- [API](#api)\n - [*highlight(code[, opts])*](#highlightcode-opts)\n - [*highlightFileSync(fullPath[, opts])*](#highlightfilesyncfullpath-opts)\n - [*highlightFile(fullPath[, opts], callback)*](#highlightfilefullpath-opts-callback)\n - [opts](#opts)\n- [Examples ([*browse*](https://github.com/thlorenz/cardinal/tree/master/examples))](#examples-[browse]https://githubcom/thlorenz/cardinal/tree/master/examples)\n\n\n## Installation\n\n### As library\n\n npm install cardinal\n\n### As Commandline Tool\n\n [sudo] npm install -g cardinal\n\n**Note:** \n\nWhen installed globally, cardinal exposes itself as the `cdl` command.\n\n## Commandline\n\n### Highlight a file\n\n cdl [options]\n\n**options**:\n - `--nonum`: turns off line number printing (relevant if it is turned on inside `~/.cardinalrc`\n\n### As part of a UNIX pipe\n\n cat file.js | grep console | cdl\n\n**Note:**\n\nNot all code lines may be parsable JavaScript. In these cases the line is printed to the terminal without\nhighlighting it.\n\n### Theme\n\nThe default theme will be used for highlighting.\n\nTo use a different theme, include a `.cardinalrc` file in your `HOME` directory.\n\nThis is a JSON file of the following form:\n\n```json\n{\n \"theme\": \"hide-semicolons\",\n \"linenos\": true|false\n}\n```\n\n- `theme` can be the name of any of the [built-in themes](https://github.com/thlorenz/cardinal/tree/master/themes) or the\nfull path to a custom theme anywhere on your computer.\n- linenos toggles line number printing\n\n## API\n\n### *highlight(code[, opts])*\n\n- returns the highlighted version of the passed code ({String}) or throws an error if it was not able to parse it\n- opts (see below)\n\n### *highlightFileSync(fullPath[, opts])*\n\n- returns the highlighted version of the file whose fullPath ({String}) was passed or throws an error if it was not able\n to parse it\n- opts (see below)\n\n### *highlightFile(fullPath[, opts], callback)*\n\n- calls back with the highlighted version of the file whose fullPath ({String}) was passed or with an error if it was not able\n to parse it\n- opts (see below)\n- `callback` ({Function}) has the following signature: `function (err, highlighted) { .. }`\n\n### opts\n\nopts is an {Object} with the following properties:\n\n- `theme` {Object} is used to optionally override the theme used to highlight\n- `linenos` {Boolean} if `true` line numbers are included in the highlighted code\n- `firstline` {Integer} sets line number of the first line when line numbers are printed\n- `json` {Boolean} if `true` highlights JSON in addition to JavaScript (`true` by default if file extension is `.json`)\n\n## Examples ([*browse*](https://github.com/thlorenz/cardinal/tree/master/examples))\n\n- [sample .cardinalrc](https://github.com/thlorenz/cardinal/blob/master/examples/.cardinalrc)\n- [highlighting a code snippet](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-string.js) via\n ***highlight()***\n- [file that highlights itself](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-self.js) via\n ***highlightFile()*** including line numbers\n- [file that highlights itself hiding all\n semicolons](https://github.com/thlorenz/cardinal/blob/master/examples/highlight-self-hide-semicolons.js) via\n ***highlightFileSync()***\n\n\n\n\n[![Bitdeli Badge](https://d2weczhvl823v0.cloudfront.net/thlorenz/cardinal/trend.png)](https://bitdeli.com/free \"Bitdeli Badge\")\n\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/thlorenz/cardinal/issues" + }, + "homepage": "https://github.com/thlorenz/cardinal", + "_id": "cardinal@0.4.4", + "_from": "cardinal@>=0.4.4 <0.5.0" +} diff --git a/node_modules/mysql2/node_modules/cardinal/settings.js b/node_modules/mysql2/node_modules/cardinal/settings.js new file mode 100644 index 0000000..f31817a --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/settings.js @@ -0,0 +1,51 @@ +var path = require('path') + , util = require('util') + , fs = require('fs') + , utl = require('./utl') + , home = process.env.HOME + , settings; + +function getSettings (home_) { + if (settings) return settings; + try { + settingsJson = fs.readFileSync(path.join(home_ || home, '.cardinalrc'), 'utf-8'); + } catch (_) { + // no .cardinalrc found - not a problem + return undefined; + } + try { + return JSON.parse(settingsJson); + } catch (e) { + // Have a .cardinalrc, but something about it is wrong - warn the user + // Coudn't parse the contained JSON + console.error(e); + return undefined; + } +} + +// home_ mainly to be used during tests +// Resolves the preferred theme from the .cardinalrc found in the HOME directory +// If it couldn't be resolved, undefined is returned +function resolveTheme (home_) { + var themePath + , settings = getSettings(home_); + + if (!settings || !settings.theme) return undefined; + + try { + // allow specifying just the name of a built-in theme or a full path to a custom theme + themePath = utl.isPath(settings.theme) ? settings.theme : path.join(__dirname, 'themes', settings.theme); + + return require(themePath); + } catch (e) { + // Specified theme path is invalid + console.error(e); + return undefined; + } +} + +module.exports = { + resolveTheme: resolveTheme + , getSettings: getSettings +}; + diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-block-comment.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-block-comment.js new file mode 100644 index 0000000..6b99a1b --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-block-comment.js @@ -0,0 +1,25 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , fs = require('fs') + , customTheme = require('./fixtures/custom') + , cardinal = require('..') + +function inspect(obj, depth) { + console.log(require('util').inspect(obj, false, depth || 5, true)); +} + +test('\nhighlighting a block comment without line numbers', function (t) { + var code = fs.readFileSync(__dirname + '/fixtures/block-comment.js', 'utf8'); + var highlighted = cardinal.highlight(code, { theme: customTheme }); + t.equal(highlighted, '\n\u001b[90m/**\n * This is a meaningless block jsdoc for a meaningless function.\n * Joins two strings, separating them to appear on two lines.\n * \n * @name foo\n * @function\n * @param uno {String} first string\n * @param dos {String} second string\n * @return {String} result of the join\n */\u001b[39m\n\u001b[96mmodule\u001b[39m\u001b[32m.\u001b[39m\u001b[96mexports\u001b[39m \u001b[93m=\u001b[39m \u001b[94mfunction\u001b[39m \u001b[96mfoo\u001b[39m \u001b[90m(\u001b[39m\u001b[96muno\u001b[39m\u001b[32m,\u001b[39m \u001b[96mdos\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m\n \u001b[31mreturn\u001b[39m \u001b[96muno\u001b[39m \u001b[93m+\u001b[39m \u001b[92m\'\\n\'\u001b[39m \u001b[93m+\u001b[39m \u001b[96mdos\u001b[39m\u001b[90m;\u001b[39m\n\u001b[33m}\u001b[39m\n') + t.end() +}) + +test('\nhighlighting a block comment with line numbers', function (t) { + var code = fs.readFileSync(__dirname + '/fixtures/block-comment.js', 'utf8'); + var highlighted = cardinal.highlight(code, { theme: customTheme, linenos: true }); + t.equal(highlighted, '\u001b[90m 1: \n\u001b[90m 2: \u001b[90m/**\n\u001b[90m 3: * This is a meaningless block jsdoc for a meaningless function.\n\u001b[90m 4: * Joins two strings, separating them to appear on two lines.\n\u001b[90m 5: * \n\u001b[90m 6: * @name foo\n\u001b[90m 7: * @function\n\u001b[90m 8: * @param uno {String} first string\n\u001b[90m 9: * @param dos {String} second string\n\u001b[90m10: * @return {String} result of the join\n\u001b[90m11: */\u001b[39m\n\u001b[90m12: \u001b[96mmodule\u001b[39m\u001b[32m.\u001b[39m\u001b[96mexports\u001b[39m \u001b[93m=\u001b[39m \u001b[94mfunction\u001b[39m \u001b[96mfoo\u001b[39m \u001b[90m(\u001b[39m\u001b[96muno\u001b[39m\u001b[32m,\u001b[39m \u001b[96mdos\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m\n\u001b[90m13: \u001b[31mreturn\u001b[39m \u001b[96muno\u001b[39m \u001b[93m+\u001b[39m \u001b[92m\'\\n\'\u001b[39m \u001b[93m+\u001b[39m \u001b[96mdos\u001b[39m\u001b[90m;\u001b[39m\n\u001b[90m14: \u001b[33m}\u001b[39m') + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-diff-spike.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-diff-spike.js new file mode 100644 index 0000000..eec5317 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-diff-spike.js @@ -0,0 +1,95 @@ +/*jshint asi:true */ +'use strict'; + +var fs = require('fs') + , path = require('path') + , utl = require('../utl') + , highlighter = require('..') + , colors = require('ansicolors') + , diffFile = path.join(__dirname, 'fixtures', 'git-diff.txt') + , diff = fs.readFileSync(diffFile, 'utf-8') + + +// @@ is not a valid js token, so when we see it, we can be sure that we are dealing with a git or svn diff +var diffRegex = /^@@[^@]+@@$/m; +var diffIndRegex = /^(@@[^@]+@@)(.*)$/; +var addRemRegex = /^[+\-]/; +var lines = diff.split('\n'); + +function isDiff(lines) { + return !!lines + .filter(function (line) { + return diffRegex.test(line); + }) + .length; +} + +var diff = isDiff(lines); + +function tryHighlight(code) { + + // TODO: need to remove symbols added to get valid code + // this should be done by getting the splits instead of the actual code from the highlighter + // now we can remove first / last one after highlighting completed + function tryAppending(appended, tryNext) { + try { + return highlighter.highlight(code + appended); + } catch (e) { + return tryNext(code); + } + } + + function tryRemoveLeadingComma(tryNext) { + var success; + try { + success = highlighter.highlight(code.replace(/^( +),(.+)$/, '$1 $2')); + return success; + } catch (e) { + return tryNext(code); + } + } + + function tryPlain() { + try { + return highlighter.highlight(code); + } catch (e) { + return tryCloseMustache(); + } + } + + function tryCloseMustache() { return tryAppending('}', tryCloseParen); } + + function tryCloseParen() { return tryAppending('\\)', tryCloseMustacheParen); } + + function tryCloseMustacheParen() { return tryAppending('})', tryRemovingCommas);} + + function tryRemovingCommas() { return tryRemoveLeadingComma(giveUp); } + + function giveUp() { return code; } + + return tryPlain(); +} + +function highlightDiffInd(line, matches) { + var highlighted = colors.brightBlue(matches[1]) + , code = matches[2]; + return code ? highlighted + tryHighlight(code) : highlighted; +} + +function colorsAddRemove(c) { + return addRemRegex.test(c) ? colors.yellow(c) : c; +} + +function highlightDiff(line) { + var diffIndMatches = diffIndRegex.exec(line); + + return diffIndMatches + ? highlightDiffInd(line, diffIndMatches) + : colorsAddRemove(line[0]) + tryHighlight(line.slice(1)); +} + +var highlightFn = diff ? highlightDiff : tryHighlight; +var highlightedLines = lines.map(highlightFn); + +console.log(highlightedLines.join('\n')); + diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-async.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-async.js new file mode 100644 index 0000000..02b8d96 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-async.js @@ -0,0 +1,48 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , fs = require('fs') + , path = require('path') + , customTheme = require('./fixtures/custom') + , cardinal = require('..') + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var file = path.join(__dirname, 'fixtures/foo.js') + , fileWithErrors = path.join(__dirname, 'fixtures/foo-with-errors.js') + +test('supplying custom theme', function (t) { + cardinal.highlightFile(file, { theme: customTheme }, function (err, highlighted) { + + t.equals(null, err, 'no error') + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[96mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \n \u001b[32mvar\u001b[39m \u001b[96ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[96ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[31mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \n\u001b[33m}\u001b[39m\n') + t.end() + }) +}) + +test('not supplying custom theme', function (t) { + cardinal.highlightFile(file, function (err, highlighted) { + + t.equals(null, err, 'no error') + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \n \u001b[32mvar\u001b[39m \u001b[37ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[37ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[91mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \n\u001b[33m}\u001b[39m\n') + t.end() + }) +}) + +test('errornous code', function (t) { + cardinal.highlightFile(fileWithErrors, function (err, highlighted) { + t.similar(err.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token [(]/) + t.end() + }) +}) + +test('non existing file', function (t) { + cardinal.highlightFile('./not/existing', function (err, highlighted) { + t.similar(err.message, /ENOENT, .*not.existing/) + t.end() + }) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-sync.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-sync.js new file mode 100644 index 0000000..7b16e4e --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-file-sync.js @@ -0,0 +1,48 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , fs = require('fs') + , path = require('path') + , customTheme = require('./fixtures/custom') + , cardinal = require('..') + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var file = path.join(__dirname, 'fixtures/foo.js') + , fileWithErrors = path.join(__dirname, 'fixtures/foo-with-errors.js') + +test('supplying custom theme', function (t) { + var highlighted = cardinal.highlightFileSync(file, { theme: customTheme }); + + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[96mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \n \u001b[32mvar\u001b[39m \u001b[96ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[96ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[31mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \n\u001b[33m}\u001b[39m\n') + t.end() +}) + +test('not supplying custom theme', function (t) { + var highlighted = cardinal.highlightFileSync(file); + + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \n \u001b[32mvar\u001b[39m \u001b[37ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[37ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[91mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \n\u001b[33m}\u001b[39m\n') + t.end() +}) + +test('errornous code', function (t) { + try { + cardinal.highlightFileSync(fileWithErrors); + } catch (e) { + t.similar(e.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token [(]/) + t.end() + } +}) + +test('non existing file', function (t) { + try { + cardinal.highlightFileSync('./not/existing'); + } catch (e) { + t.similar(e.message, /ENOENT, .*not.existing/) + t.end() + } +}) diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-git-diff.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-git-diff.js new file mode 100644 index 0000000..9f7482d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-git-diff.js @@ -0,0 +1,3 @@ + +// Test Cases +// highlightDiff('@@ -25,22 +31,47 @@ function resolveTheme (config) { }') diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-async.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-async.js new file mode 100644 index 0000000..54fd169 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-async.js @@ -0,0 +1,31 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , path = require('path') + , cardinal = require('..') + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var file = path.join(__dirname, 'fixtures/json.json'); + +test('json option set from extension', function (t) { + cardinal.highlightFile(file, function (err, highlighted) { + + t.equals(null, err, 'no error'); + t.equals(highlighted, '\u001b[33m{\u001b[39m\u001b[32m"foo"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"bar"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"baz"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"quux"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"bam"\u001b[39m\u001b[93m:\u001b[39m\u001b[90mnull\u001b[39m\u001b[33m}\u001b[39m'); + t.end(); + }); +}); + +test('json option respected if false', function (t) { + cardinal.highlightFile(file, { json: false }, function (err, highlighted) { + + t.similar(err.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token /); + t.end(); + + }); +}); diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-sync.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-sync.js new file mode 100644 index 0000000..0f75077 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json-file-sync.js @@ -0,0 +1,29 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , path = require('path') + , cardinal = require('..') + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var file = path.join(__dirname, 'fixtures/json.json'); + +test('json option set from extension', function (t) { + var highlighted = cardinal.highlightFileSync(file); + + t.equals(highlighted, '\u001b[33m{\u001b[39m\u001b[32m"foo"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"bar"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"baz"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"quux"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"bam"\u001b[39m\u001b[93m:\u001b[39m\u001b[90mnull\u001b[39m\u001b[33m}\u001b[39m'); + t.end(); +}); + +test('json option respected if false', function (t) { + try { + var highlighted = cardinal.highlightFileSync(file, { json: false }); + } catch (e) { + t.similar(e.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token /); + t.end(); + } +}); diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json.js new file mode 100644 index 0000000..bbbe27d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-json.js @@ -0,0 +1,41 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , customTheme = require('./fixtures/custom') + , cardinal = require('..') + + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var json = JSON.stringify({ + foo: 'bar', + baz: 'quux', + bam: null +}); + +test('supplying custom theme', function (t) { + var highlighted = cardinal.highlight(json, { json: true, theme: customTheme }); + + t.equals(highlighted, '\u001b[33m{\u001b[39m\u001b[92m"foo"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"bar"\u001b[39m\u001b[32m,\u001b[39m\u001b[92m"baz"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"quux"\u001b[39m\u001b[32m,\u001b[39m\u001b[92m"bam"\u001b[39m\u001b[93m:\u001b[39m\u001b[90mnull\u001b[39m\u001b[33m}\u001b[39m') + t.end(); +}); + +test('not supplying custom theme', function (t) { + var highlighted = cardinal.highlight(json, { json: true }); + + t.equals(highlighted, '\u001b[33m{\u001b[39m\u001b[32m"foo"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"bar"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"baz"\u001b[39m\u001b[93m:\u001b[39m\u001b[92m"quux"\u001b[39m\u001b[32m,\u001b[39m\u001b[32m"bam"\u001b[39m\u001b[93m:\u001b[39m\u001b[90mnull\u001b[39m\u001b[33m}\u001b[39m') + t.end(); +}); + +test('without json option', function (t) { + try { + cardinal.highlight(json); + } catch (e) { + t.similar(e.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token /) + t.end(); + } +}); diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-string.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-string.js new file mode 100644 index 0000000..beefe0d --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-highlight-string.js @@ -0,0 +1,70 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , util = require('util') + , fs = require('fs') + , customTheme = require('./fixtures/custom') + , cardinal = require('..') + +function inspect (obj) { + return console.log(util.inspect(obj, false, 5, false)) +} + +var code = 'function foo() { var a = 3; return a > 2 ? true : false; }' + , codeWithErrors = 'function () { var a = 3; return a > 2 ? true : false; }'; + +test('supplying custom theme', function (t) { + var highlighted = cardinal.highlight(code, { theme: customTheme }); + + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[96mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \u001b[32mvar\u001b[39m \u001b[96ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[96ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[31mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \u001b[33m}\u001b[39m') + t.end() +}) + +test('not supplying custom theme', function (t) { + var highlighted = cardinal.highlight(code); + + t.equals(highlighted, '\u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \u001b[32mvar\u001b[39m \u001b[37ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[37ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[91mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \u001b[33m}\u001b[39m') + t.end() +}) + +test('errornous code', function (t) { + try { + cardinal.highlight(codeWithErrors); + } catch (e) { + t.similar(e.message, /Unable to perform highlight. The code contained syntax errors.* Line 1: Unexpected token [(]/) + t.end() + } +}) + +test('line numbers no firstline given', function (t) { + var highlighted = cardinal.highlight(code, { linenos: true }); + t.equals(highlighted, '\u001b[90m1: \u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \u001b[32mvar\u001b[39m \u001b[37ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[37ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[91mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \u001b[33m}\u001b[39m') + t.end() +}) + +test('line numbers firstline 99', function (t) { + var highlighted = cardinal.highlight(code, { linenos: true, firstline: 99 }); + t.equals(highlighted, '\u001b[90m99: \u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m \u001b[32mvar\u001b[39m \u001b[37ma\u001b[39m \u001b[93m=\u001b[39m \u001b[34m3\u001b[39m\u001b[90m;\u001b[39m \u001b[31mreturn\u001b[39m \u001b[37ma\u001b[39m \u001b[93m>\u001b[39m \u001b[34m2\u001b[39m \u001b[93m?\u001b[39m \u001b[91mtrue\u001b[39m \u001b[93m:\u001b[39m \u001b[91mfalse\u001b[39m\u001b[90m;\u001b[39m \u001b[33m}\u001b[39m') + t.end() +}) + +test('line numbers multi line no first line given', function (t) { + var multilineCode = '' + + function foo () { + return 1; + }; + var highlighted = cardinal.highlight(multilineCode, { linenos: true }); + t.equals(highlighted,'\u001b[90m1: \u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m\n\u001b[90m2: \u001b[31mreturn\u001b[39m \u001b[34m1\u001b[39m\u001b[90m;\u001b[39m\n\u001b[90m3: \u001b[33m}\u001b[39m') + t.end() +}) + +test('line numbers multi line first line 99', function (t) { + var multilineCode = '' + + function foo () { + return 1; + }; + var highlighted = cardinal.highlight(multilineCode, { linenos: true, firstline: 99 }); + t.equals(highlighted,'\u001b[90m 99: \u001b[94mfunction\u001b[39m \u001b[37mfoo\u001b[39m\u001b[90m(\u001b[39m\u001b[90m)\u001b[39m \u001b[33m{\u001b[39m\n\u001b[90m100: \u001b[31mreturn\u001b[39m \u001b[34m1\u001b[39m\u001b[90m;\u001b[39m\n\u001b[90m101: \u001b[33m}\u001b[39m') + t.end() +}) diff --git a/node_modules/mysql2/node_modules/cardinal/test/cardinal-smoke.js b/node_modules/mysql2/node_modules/cardinal/test/cardinal-smoke.js new file mode 100644 index 0000000..f2d0e18 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/cardinal-smoke.js @@ -0,0 +1,44 @@ +'use strict'; +/*jshint asi: true*/ + +// applying esprima to a bunch of files of contained libraries as a smoke test +var test = require('tap').test + , path = require('path') + , fs = require('fs') + , readdirp = require('readdirp') + , cardinal = require('..') + , node_modules = path.join(__dirname, '..', 'node_modules') + , tapdir = path.join(node_modules, 'tap') + , redeyeddir = path.join(node_modules, 'redeyed') + + +test('tap', function (t) { + var invalidTapFiles = [ + 'async-map-ordered.js' + , 'prof.js' + ] + + readdirp({ root: tapdir, fileFilter: '*.js' }) + .on('data', function (entry) { + + if (~invalidTapFiles.indexOf(entry.name)) return + + var code = fs.readFileSync(entry.fullPath, 'utf-8') + , result = cardinal.highlight(code); + + t.assert(~result.indexOf('[32mvar\u001b[39m') || !(~result.indexOf('var ')), 'highlighted ' + entry.path) + }) + .on('end', t.end.bind(t)) +}) + +test('redeyed', function (t) { + readdirp({ root: redeyeddir, fileFilter: 'redeyed.js' }) + .on('data', function (entry) { + + var code = fs.readFileSync(entry.fullPath, 'utf-8') + , result = cardinal.highlight(code); + + t.assert(~result.indexOf('[32mvar\u001b[39m') || !(~result.indexOf('var ')), 'highlighted ' + entry.path) + }) + .on('end', t.end.bind(t)) +}) diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/block-comment.js b/node_modules/mysql2/node_modules/cardinal/test/fixtures/block-comment.js new file mode 100644 index 0000000..597bc69 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/block-comment.js @@ -0,0 +1,14 @@ + +/** + * This is a meaningless block jsdoc for a meaningless function. + * Joins two strings, separating them to appear on two lines. + * + * @name foo + * @function + * @param uno {String} first string + * @param dos {String} second string + * @return {String} result of the join + */ +module.exports = function foo (uno, dos) { + return uno + '\n' + dos; +} diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/custom.js b/node_modules/mysql2/node_modules/cardinal/test/fixtures/custom.js new file mode 100644 index 0000000..fc369fc --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/custom.js @@ -0,0 +1,144 @@ +var colors = require('ansicolors'); + +// Change the below definitions in order to tweak the color theme. +module.exports = { + + 'Boolean': { + // changed from default + 'true' : colors.red + + , 'false' : undefined + , _default : colors.brightRed + } + + , 'Identifier': { + 'undefined' : colors.brightBlack + , 'self' : colors.brightRed + , 'console' : colors.blue + , 'log' : colors.blue + , 'warn' : colors.red + , 'error' : colors.brightRed + // + // changed from default + , _default : colors.brightCyan + } + + , 'Null': { + _default: colors.brightBlack + } + + , 'Numeric': { + _default: colors.blue + } + + , 'String': { + _default: colors.brightGreen + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : colors.cyan + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : colors.red + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : colors.cyan + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : colors.red + , 'return' : colors.red + , 'switch' : undefined + + , 'this' : colors.brightRed + , 'throw' : undefined + , 'try' : colors.cyan + , 'typeof' : undefined + + , 'var' : colors.green + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : colors.brightBlue + } + , 'Punctuator': { + ';': colors.brightBlack + , '.': colors.green + , ',': colors.green + + , '{': colors.yellow + , '}': colors.yellow + , '(': colors.brightBlack + , ')': colors.brightBlack + , '[': colors.yellow + , ']': colors.yellow + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: colors.brightYellow + } + + // line comment + , Line: { + _default: colors.brightBlack + } + + /* block comment */ + , Block: { + _default: colors.brightBlack + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo-with-errors.js b/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo-with-errors.js new file mode 100644 index 0000000..fefebe2 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo-with-errors.js @@ -0,0 +1,3 @@ +function () { + var a = 3; return a > 2 ? true : false; +}; diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo.js b/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo.js new file mode 100644 index 0000000..bd9a3e0 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/foo.js @@ -0,0 +1,3 @@ +function foo() { + var a = 3; return a > 2 ? true : false; +} diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/git-diff.txt b/node_modules/mysql2/node_modules/cardinal/test/fixtures/git-diff.txt new file mode 100644 index 0000000..e324b67 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/git-diff.txt @@ -0,0 +1,78 @@ +diff --git a/test/settings.js b/test/settings.js +index 7b28d66..642688f 100644 +--- a/test/settings.js ++++ b/test/settings.js +@@ -1,14 +1,20 @@ + 'use strict'; + /*jshint asi: true*/ + +-var test = require('tap').test +- , path = require('path') +- , fs = require('fs') +- , settings = require('../settings') +- , existsSync = fs.existsSync || path.existsSync ++var test = require('tap').test ++ , path = require('path') ++ , fs = require('fs') + , hideSemicolonsTheme = require('../themes/hide-semicolons') + , home = path.join(__dirname, 'fixtures', 'home') + , rcpath = path.join(home, '.cardinalrc') ++ , existsSync = fs.existsSync || path.existsSync ++ , settingsResolve = require.resolve('../settings') ++ , settings ++ ++function setup () { ++ delete require.cache[settingsResolve] ++ settings = require(settingsResolve) ++} + + function writerc(config) { + fs.writeFileSync(rcpath, JSON.stringify(config), 'utf-8') +@@ -25,22 +31,47 @@ function resolveTheme (config) { + return result; + } + ++function getSettings (config) { ++ writerc(config) ++ var result = settings.getSettings(home) ++ removerc() ++ return result; ++} ++ + if (!existsSync(home)) fs.mkdirSync(home); + + test('no .cardinalrc in home', function (t) { ++ setup() + var theme = settings.resolveTheme(home) + t.equals(theme, undefined, 'resolves no theme') + t.end() + }) + + test('.cardinalrc with theme "hide-semicolons" in home', function (t) { ++ setup() + var theme = resolveTheme({ theme: "hide-semicolons" }) + t.deepEquals(theme, hideSemicolonsTheme, 'resolves hide-semicolons theme') + t.end() + }) + + test('.cardinalrc with full path to "hide-semicolons.js" in home', function (t) { ++ setup() + var theme = resolveTheme({ theme: path.join(__dirname, '..', 'themes', 'hide-semicolons.js') }) + t.deepEquals(theme, hideSemicolonsTheme, 'resolves hide-semicolons theme') + t.end() + }) ++ ++test('.cardinalrc with linenos: true', function (t) { ++ setup() ++ var opts = { linenos: true } ++ t.deepEquals(getSettings(opts), opts) ++ t.end() ++}) ++ ++test('.cardinalrc with linenos: true and theme', function (t) { ++ setup() ++ var opts = { linenos: true, theme: 'some theme' } ++ t.deepEquals(getSettings(opts), opts) ++ t.end() ++}) ++ diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/json.json b/node_modules/mysql2/node_modules/cardinal/test/fixtures/json.json new file mode 100644 index 0000000..0c39df4 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/json.json @@ -0,0 +1 @@ +{"foo":"bar","baz":"quux","bam":null} \ No newline at end of file diff --git a/node_modules/mysql2/node_modules/cardinal/test/fixtures/svn-diff.txt b/node_modules/mysql2/node_modules/cardinal/test/fixtures/svn-diff.txt new file mode 100644 index 0000000..635b056 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/fixtures/svn-diff.txt @@ -0,0 +1,23 @@ +Index: grunt.js +=================================================================== +--- grunt.js (revision 31200) ++++ grunt.js (working copy) +@@ -12,6 +12,7 @@ + + module.exports = function (grunt) { + ++ console.log('hello world'); + // Project configuration. + grunt.initConfig({ + lint: { +@@ -19,10 +20,6 @@ + 'packages/services.web/{!(test)/**/,}*.js', + 'packages/error/**/*.js' + ], +- scripts: [ +- 'grunt.js', +- 'db/**/*.js' +- ], + browser: [ + 'packages/web/server.js', + 'packages/web/server/**/*.js', diff --git a/node_modules/mysql2/node_modules/cardinal/test/settings.js b/node_modules/mysql2/node_modules/cardinal/test/settings.js new file mode 100644 index 0000000..642688f --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/settings.js @@ -0,0 +1,77 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , path = require('path') + , fs = require('fs') + , hideSemicolonsTheme = require('../themes/hide-semicolons') + , home = path.join(__dirname, 'fixtures', 'home') + , rcpath = path.join(home, '.cardinalrc') + , existsSync = fs.existsSync || path.existsSync + , settingsResolve = require.resolve('../settings') + , settings + +function setup () { + delete require.cache[settingsResolve] + settings = require(settingsResolve) +} + +function writerc(config) { + fs.writeFileSync(rcpath, JSON.stringify(config), 'utf-8') +} + +function removerc () { + fs.unlinkSync(rcpath) +} + +function resolveTheme (config) { + writerc(config) + var result = settings.resolveTheme(home) + removerc() + return result; +} + +function getSettings (config) { + writerc(config) + var result = settings.getSettings(home) + removerc() + return result; +} + +if (!existsSync(home)) fs.mkdirSync(home); + +test('no .cardinalrc in home', function (t) { + setup() + var theme = settings.resolveTheme(home) + t.equals(theme, undefined, 'resolves no theme') + t.end() +}) + +test('.cardinalrc with theme "hide-semicolons" in home', function (t) { + setup() + var theme = resolveTheme({ theme: "hide-semicolons" }) + t.deepEquals(theme, hideSemicolonsTheme, 'resolves hide-semicolons theme') + t.end() +}) + +test('.cardinalrc with full path to "hide-semicolons.js" in home', function (t) { + setup() + var theme = resolveTheme({ theme: path.join(__dirname, '..', 'themes', 'hide-semicolons.js') }) + t.deepEquals(theme, hideSemicolonsTheme, 'resolves hide-semicolons theme') + t.end() +}) + +test('.cardinalrc with linenos: true', function (t) { + setup() + var opts = { linenos: true } + t.deepEquals(getSettings(opts), opts) + t.end() +}) + +test('.cardinalrc with linenos: true and theme', function (t) { + setup() + var opts = { linenos: true, theme: 'some theme' } + t.deepEquals(getSettings(opts), opts) + t.end() +}) + diff --git a/node_modules/mysql2/node_modules/cardinal/test/themes.js b/node_modules/mysql2/node_modules/cardinal/test/themes.js new file mode 100644 index 0000000..590cdca --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/test/themes.js @@ -0,0 +1,22 @@ +'use strict'; +/*jshint asi: true*/ + +var test = require('tap').test + , path = require('path') + , fs = require('fs') + , themesdir = path.join(__dirname, '..', 'themes') + , allFiles = fs.readdirSync(themesdir) + +test('validate themes by requiring all of them', function (t) { + allFiles + .filter(function (file) { return path.extname(file) === '.js'; }) + .forEach(function (theme) { + try { + t.ok(require(path.join(themesdir, theme)), theme + ' is valid') + } catch (e) { + t.fail('theme: ' + theme + ' is invalid! ' + e.message) + } + }) + t.end() +}) + diff --git a/node_modules/mysql2/node_modules/cardinal/themes/README.md b/node_modules/mysql2/node_modules/cardinal/themes/README.md new file mode 100644 index 0000000..fe2a443 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/themes/README.md @@ -0,0 +1,31 @@ +# cardinal themes + +These are the built in themes that come with cardinal. + +You can create more themes by copying and then editing the [empty +theme](https://github.com/thlorenz/cardinal/blob/master/themes/empty.js) which is provided for that purpose. + +The [hide semicolons theme](https://github.com/thlorenz/cardinal/blob/master/themes/hide-semicolons.js) has the added +benefit of making all semicolons invisible. This makes code more readable at times. + +Find out how to change the theme used by cardinal [here](https://github.com/thlorenz/cardinal#theme). + +# sharing themes + +To add your theme to the cardinal built-in themes, follow the below steps: + +1. fork the cardinal repository +2. add your theme to the themes folder and commit your changes +3. create a pull request + +If you believe that your theme is better than the current default theme, let me know by creating an issue. + +This will allow others to cast their vote. If enough people agree, your theme will be promoted to be the default. + +## Contributed Themes + +### tomorrow night + +[![tomorrow-night](https://github.com/thlorenz/cardinal/raw/master/assets/theme-tomorrow-night.png)](https://github.com/thlorenz/cardinal/blob/master/themes/tomorrow-night.js) + +*by [firede](https://github.com/firede)* diff --git a/node_modules/mysql2/node_modules/cardinal/themes/default.js b/node_modules/mysql2/node_modules/cardinal/themes/default.js new file mode 100644 index 0000000..86ee59a --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/themes/default.js @@ -0,0 +1,147 @@ +var colors = require('ansicolors'); + +// Change the below definitions in order to tweak the color theme. +module.exports = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : colors.brightRed + } + + , 'Identifier': { + 'undefined' : colors.brightBlack + , 'self' : colors.brightRed + , 'console' : colors.blue + , 'log' : colors.blue + , 'warn' : colors.red + , 'error' : colors.brightRed + , _default : colors.white + } + + , 'Null': { + _default: colors.brightBlack + } + + , 'Numeric': { + _default: colors.blue + } + + , 'String': { + _default: function (s, info) { + var nextToken = info.tokens[info.tokenIndex + 1]; + + // show keys of object literals and json in different color + return (nextToken && nextToken.type === 'Punctuator' && nextToken.value === ':') + ? colors.green(s) + : colors.brightGreen(s); + } + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : colors.cyan + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : colors.red + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : colors.cyan + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : colors.red + , 'return' : colors.red + , 'switch' : undefined + + , 'this' : colors.brightRed + , 'throw' : undefined + , 'try' : colors.cyan + , 'typeof' : undefined + + , 'var' : colors.green + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : colors.brightBlue + } + , 'Punctuator': { + ';': colors.brightBlack + , '.': colors.green + , ',': colors.green + + , '{': colors.yellow + , '}': colors.yellow + , '(': colors.brightBlack + , ')': colors.brightBlack + , '[': colors.yellow + , ']': colors.yellow + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: colors.brightYellow + } + + // line comment + , Line: { + _default: colors.brightBlack + } + + /* block comment */ + , Block: { + _default: colors.brightBlack + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/themes/empty.js b/node_modules/mysql2/node_modules/cardinal/themes/empty.js new file mode 100644 index 0000000..3203aac --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/themes/empty.js @@ -0,0 +1,140 @@ +/* + * Copy this file and use it as a starting point for your custom cardinal color theme. + * Just fill in or change the entries for the tokens you want to color + * Keep in mind that more specific configurations override less specific ones. + */ + +var colors = require('ansicolors'); + +// Change the below definitions in order to tweak the color theme. +module.exports = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : undefined + } + + , 'Identifier': { + _default: undefined + } + + , 'Null': { + _default: undefined + } + + , 'Numeric': { + _default: undefined + } + + , 'String': { + _default: undefined + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : undefined + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : undefined + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : undefined + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : undefined + , 'return' : undefined + , 'switch' : undefined + + , 'this' : undefined + , 'throw' : undefined + , 'try' : undefined + , 'typeof' : undefined + + , 'var' : undefined + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : undefined + } + , 'Punctuator': { + ';': undefined + , '.': undefined + , ',': undefined + + , '{': undefined + , '}': undefined + , '(': undefined + , ')': undefined + , '[': undefined + , ']': undefined + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: undefined + } + + // line comment + , Line: { + _default: undefined + } + + /* block comment */ + , Block: { + _default: undefined + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/themes/hide-semicolons.js b/node_modules/mysql2/node_modules/cardinal/themes/hide-semicolons.js new file mode 100644 index 0000000..c1871ee --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/themes/hide-semicolons.js @@ -0,0 +1,149 @@ +var colors = require('ansicolors'); + +// Change the below definitions in order to tweak the color theme. +module.exports = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : colors.brightRed + } + + , 'Identifier': { + 'undefined' : colors.brightBlack + , 'self' : colors.brightRed + , 'console' : colors.blue + , 'log' : colors.blue + , 'warn' : colors.red + , 'error' : colors.brightRed + , _default : colors.white + } + + , 'Null': { + _default: colors.brightBlack + } + + , 'Numeric': { + _default: colors.blue + } + + , 'String': { + _default: function (s, info) { + var nextToken = info.tokens[info.tokenIndex + 1]; + + // show keys of object literals and json in different color + return (nextToken && nextToken.type === 'Punctuator' && nextToken.value === ':') + ? colors.green(s) + : colors.brightGreen(s); + } + } + + , 'Keyword': { + 'break' : undefined + + , 'case' : undefined + , 'catch' : colors.cyan + , 'continue' : undefined + + , 'debugger' : undefined + , 'default' : undefined + , 'delete' : colors.red + , 'do' : undefined + + , 'else' : undefined + + , 'finally' : colors.cyan + , 'for' : undefined + , 'function' : undefined + + , 'if' : undefined + , 'in' : undefined + , 'instanceof' : undefined + + , 'new' : colors.red + , 'return' : colors.red + , 'switch' : undefined + + , 'this' : colors.brightRed + , 'throw' : undefined + , 'try' : colors.cyan + , 'typeof' : undefined + + , 'var' : colors.green + , 'void' : undefined + + , 'while' : undefined + , 'with' : undefined + , _default : colors.brightBlue + } + , 'Punctuator': { + // setting semicolon's color to the same as the terminal background makes it invisible + ';': colors.black + + , '.': colors.green + , ',': colors.green + + , '{': colors.yellow + , '}': colors.yellow + , '(': colors.brightBlack + , ')': colors.brightBlack + , '[': colors.yellow + , ']': colors.yellow + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': undefined + , '^': undefined + , '!': undefined + , '~': undefined + , '?': undefined + , ':': undefined + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: colors.brightYellow + } + + // line comment + , Line: { + _default: colors.brightBlack + } + + /* block comment */ + , Block: { + _default: colors.brightBlack + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/themes/tomorrow-night.js b/node_modules/mysql2/node_modules/cardinal/themes/tomorrow-night.js new file mode 100644 index 0000000..9e0fc58 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/themes/tomorrow-night.js @@ -0,0 +1,161 @@ +var colors = require('ansicolors'); + +// Change the below definitions in order to tweak the color theme. +module.exports = { + + 'Boolean': { + 'true' : undefined + , 'false' : undefined + , _default : colors.yellow + } + + , 'Identifier': { + 'undefined' : colors.yellow + , 'self' : colors.yellow + , 'type' : colors.yellow + , 'value' : colors.yellow + , 'console' : undefined + , 'log' : colors.blue + , 'warn' : colors.blue + , 'error' : colors.blue + , 'join' : colors.blue + , _default : function (s, info) { + var prevToken = info.tokens[info.tokenIndex - 1]; + var nextToken = info.tokens[info.tokenIndex + 1]; + + return (nextToken + && nextToken.type === 'Punctuator' + && nextToken.value === '(' + && prevToken + && prevToken.type === 'Keyword' + && prevToken.value === 'function' + ) ? colors.blue(s) : colors.white(s); + } + } + + , 'Null': { + _default: colors.yellow + } + + , 'Numeric': { + _default: colors.yellow + } + + , 'String': { + _default: function (s, info) { + var nextToken = info.tokens[info.tokenIndex + 1]; + + // show keys of object literals and json in different color + return (nextToken && nextToken.type === 'Punctuator' && nextToken.value === ':') + ? colors.green(s) + : colors.brightGreen(s); + } + } + + , 'Keyword': { + 'break' : colors.magenta + + , 'case' : colors.magenta + , 'catch' : colors.magenta + , 'continue' : colors.magenta + + , 'debugger' : colors.magenta + , 'default' : colors.magenta + , 'delete' : colors.red + , 'do' : colors.magenta + + , 'else' : colors.magenta + + , 'finally' : colors.magenta + , 'for' : colors.magenta + , 'function' : colors.magenta + + , 'if' : colors.magenta + , 'in' : colors.cyan + , 'instanceof' : colors.cyan + + , 'new' : colors.cyan + , 'return' : colors.magenta + , 'switch' : colors.magenta + + , 'this' : colors.red + , 'throw' : colors.magenta + , 'try' : colors.magenta + , 'typeof' : colors.cyan + + , 'var' : colors.magenta + , 'void' : colors.magenta + + , 'while' : colors.magenta + , 'with' : colors.cyan + , _default : colors.white + } + , 'Punctuator': { + ';': colors.white + , '.': colors.white + , ',': colors.white + + , '{': colors.white + , '}': colors.white + , '(': colors.white + , ')': colors.white + , '[': colors.white + , ']': colors.white + + , '<': undefined + , '>': undefined + , '+': undefined + , '-': undefined + , '*': undefined + , '%': undefined + , '&': undefined + , '|': colors.white + , '^': undefined + , '!': undefined + , '~': undefined + , '?': colors.white + , ':': colors.white + , '=': undefined + + , '<=': undefined + , '>=': undefined + , '==': undefined + , '!=': undefined + , '++': undefined + , '--': undefined + , '<<': undefined + , '>>': undefined + , '&&': undefined + , '||': undefined + , '+=': undefined + , '-=': undefined + , '*=': undefined + , '%=': undefined + , '&=': undefined + , '|=': undefined + , '^=': undefined + , '/=': undefined + + , '===': undefined + , '!==': undefined + , '>>>': undefined + , '<<=': undefined + , '>>=': undefined + + , '>>>=': undefined + + , _default: colors.cyan + } + + // line comment + , Line: { + _default: colors.brightBlack + } + + /* block comment */ + , Block: { + _default: colors.brightBlack + } + + , _default: undefined +}; diff --git a/node_modules/mysql2/node_modules/cardinal/utl.js b/node_modules/mysql2/node_modules/cardinal/utl.js new file mode 100644 index 0000000..0f36e40 --- /dev/null +++ b/node_modules/mysql2/node_modules/cardinal/utl.js @@ -0,0 +1,11 @@ +var util = require('util'); + +module.exports.isPath = function (s) { + return (/[\/\\]/).test(s); +}; + +module.exports.inspect = function(obj, depth) { + console.log(util.inspect(obj, false, depth || 5, true)); +}; + + diff --git a/node_modules/mysql2/node_modules/fastqueue/README.md b/node_modules/mysql2/node_modules/fastqueue/README.md new file mode 100644 index 0000000..c3e8c69 --- /dev/null +++ b/node_modules/mysql2/node_modules/fastqueue/README.md @@ -0,0 +1,26 @@ +# Fast Queue + +While normal JavaScript arrays can be used as FIFO queues, the `.shift()` call is very slow if the queue gets large because it has to reindex all the remaining items on every shift. + +This library is a fast queue that only implements `.push(item)`, `.shift()`, `.unshift(item)` and `.length` from the Array interface. + +Internally it uses two arrays and cycles them and uses counters so that the `.shift()` calls are still fast. + +## Usage + +```js +var Queue = require('fastqueue'); + +var q = new Queue; +q.push(1); +q.push(2); +q.push(3); +var i = 4; +while (q.length > 0) { + console.log(q.length, q.shift()); + q.unshift(i++); + console.log(q.length, q.shift()); + q.push(i++); + console.log(q.length, q.shift()); +} +``` diff --git a/node_modules/mysql2/node_modules/fastqueue/package.json b/node_modules/mysql2/node_modules/fastqueue/package.json new file mode 100644 index 0000000..ed13b08 --- /dev/null +++ b/node_modules/mysql2/node_modules/fastqueue/package.json @@ -0,0 +1,28 @@ +{ + "name": "fastqueue", + "version": "0.1.0", + "description": "A fast push/shift sync queue", + "main": "queue.js", + "readme": "# Fast Queue\n\nWhile normal JavaScript arrays can be used as FIFO queues, the `.shift()` call is very slow if the queue gets large because it has to reindex all the remaining items on every shift.\n\nThis library is a fast queue that only implements `.push(item)`, `.shift()`, `.unshift(item)` and `.length` from the Array interface.\n\nInternally it uses two arrays and cycles them and uses counters so that the `.shift()` calls are still fast.\n\n## Usage\n\n```js\nvar Queue = require('fastqueue');\n\nvar q = new Queue;\nq.push(1);\nq.push(2);\nq.push(3);\nvar i = 4;\nwhile (q.length > 0) {\n console.log(q.length, q.shift());\n q.unshift(i++);\n console.log(q.length, q.shift());\n q.push(i++);\n console.log(q.length, q.shift());\n}\n```\n", + "readmeFilename": "README.md", + "_id": "fastqueue@0.1.0", + "dist": { + "shasum": "6c691016b3806186476eeb05a717babb8f633c19", + "tarball": "http://registry.npmjs.org/fastqueue/-/fastqueue-0.1.0.tgz" + }, + "_from": "fastqueue@>=0.1.0 <0.2.0", + "_npmVersion": "1.2.15", + "_npmUser": { + "name": "creationix", + "email": "tim@creationix.com" + }, + "maintainers": [ + { + "name": "creationix", + "email": "tim@creationix.com" + } + ], + "directories": {}, + "_shasum": "6c691016b3806186476eeb05a717babb8f633c19", + "_resolved": "https://registry.npmjs.org/fastqueue/-/fastqueue-0.1.0.tgz" +} diff --git a/node_modules/mysql2/node_modules/fastqueue/queue.js b/node_modules/mysql2/node_modules/fastqueue/queue.js new file mode 100644 index 0000000..5c4f9ab --- /dev/null +++ b/node_modules/mysql2/node_modules/fastqueue/queue.js @@ -0,0 +1,67 @@ +module.exports = Queue; + +function Queue() { + this.head = []; + this.tail = []; + this.index = 0; + this.headLength = 0; + this.length = 0; +} + +// Get an item from the front of the queue. +Queue.prototype.shift = function () { + if (this.index >= this.headLength) { + // When the head is empty, swap it with the tail to get fresh items. + var t = this.head; + t.length = 0; + this.head = this.tail; + this.tail = t; + this.index = 0; + this.headLength = this.head.length; + if (!this.headLength) { + return; + } + } + + // There was an item in the head, let's pull it out. + var value = this.head[this.index]; + // And remove it from the head + if (this.index < 0) { + delete this.head[this.index++]; + } + else { + this.head[this.index++] = undefined; + } + this.length--; + return value; +}; + +// Insert a new item at the front of the queue. +Queue.prototype.unshift = function (item) { + this.head[--this.index] = item; + this.length++; + return this; +}; + +// Push a new item on the end of the queue. +Queue.prototype.push = function (item) { + // Pushes always go to the write-only tail + this.length++; + this.tail.push(item); + return this; +}; + +/* +var q = new Queue; +q.push(1); +q.push(2); +q.push(3); +var i = 4; +while (q.length > 0) { + console.log(q.length, q.shift()); + q.unshift(i++); + console.log(q.length, q.shift()); + q.push(i++); + console.log(q.length, q.shift()); +} +*/ diff --git a/node_modules/mysql2/package.json b/node_modules/mysql2/package.json new file mode 100644 index 0000000..b57b6bc --- /dev/null +++ b/node_modules/mysql2/package.json @@ -0,0 +1,61 @@ +{ + "name": "mysql2", + "version": "0.12.5", + "description": "fast mysql driver. Implements core protocol, prepared statements, ssl and compression in native JS", + "main": "index.js", + "directories": { + "example": "examples" + }, + "scripts": { + "test": "./test/run.js" + }, + "repository": { + "type": "git", + "url": "https://github.com/sidorares/node-mysql2" + }, + "keywords": [ + "mysql", + "client", + "server" + ], + "author": { + "name": "Andrey Sidorov", + "email": "sidorares@yandex.ru" + }, + "license": "MIT", + "dependencies": { + "bn.js": "0.11.7", + "cardinal": "^0.4.4", + "fastqueue": "~0.1.0" + }, + "devDependencies": { + "urun": "0.0.6" + }, + "bugs": { + "url": "https://github.com/sidorares/node-mysql2/issues" + }, + "homepage": "https://github.com/sidorares/node-mysql2", + "_id": "mysql2@0.12.5", + "_shasum": "b2d527d276da40490d89d66ae2c0f44c1b9cdcaf", + "_from": "mysql2@*", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "sidorares", + "email": "sidorares@yandex.com" + }, + "maintainers": [ + { + "name": "sidorares", + "email": "sidorares@yandex.com" + }, + { + "name": "iarna", + "email": "me@re-becca.org" + } + ], + "dist": { + "shasum": "b2d527d276da40490d89d66ae2c0f44c1b9cdcaf", + "tarball": "http://registry.npmjs.org/mysql2/-/mysql2-0.12.5.tgz" + }, + "_resolved": "https://registry.npmjs.org/mysql2/-/mysql2-0.12.5.tgz" +} diff --git a/node_modules/mysql2/test/common.js b/node_modules/mysql2/test/common.js new file mode 100644 index 0000000..02c71a9 --- /dev/null +++ b/node_modules/mysql2/test/common.js @@ -0,0 +1,116 @@ +var config = { + host: process.env.MYSQL_HOST || '127.0.0.1', + user: process.env.MYSQL_USER || 'root', + password: process.env.CI ? null : process.env.MYSQL_PASSWORD || 'test', + database: process.env.MYSQL_DATABASE || 'test', + port: process.env.MYSQL_PORT || 3306 +} + +module.exports.createConnection = function(args, callback) { + // hrtime polyfill for old node versions: + if (!process.hrtime) + process.hrtime = function(start) { + start = [0, 0] || start; + var timestamp = Date.now(); + var seconds = Math.ceil(timestamp/1000); + return [seconds - start[0], (timestamp-seconds*1000)*1000 - start[1]]; + }; + + if (process.env.BENCHMARK_MARIA) { + var Client = require('mariasql'); + var c = new Client(); + c.connect({ + host: config.host, + user: config.user, + password: config.password, + db: config.database + }); + //c.on('connect', function() { + // + //}); + setTimeout( function() { + console.log('altering client...'); + c.oldQuery = c.query; + c.query = function(sql, callback) { + var rows = []; + var q = c.oldQuery(sql); + q.on('result', function(res) { + res.on('row', function(row) { rows.push(row) }); + res.on('end', function() { + callback(null, rows); + }); + }); + }; + }, 1000); + return c; + } + + var driver = require('../index.js'); + if (process.env.BENCHMARK_MYSQL1) + driver = require('mysql'); + + return driver.createConnection({ + host: config.host, + user: config.user, + password: config.password, + database: config.database, + multipleStatements: args ? args.multipleStatements : false, + port: (args && args.port) || config.port, + dateStrings: args && args.dateStrings + }); +}; + +module.exports.createPool = function(callback) { + var driver = require('../index.js'); + if (process.env.BENCHMARK_MYSQL1) + driver = require('mysql'); + + return driver.createPool(config); +}; + +module.exports.createTemplate = function() { + var jade = require('jade'); + var template = require('fs').readFileSync(__dirname + '/template.jade', 'ascii'); + return jade.compile(template); +}; + +module.exports.createServer = function(cb) { + var server = require('../index.js').createServer(); + server.on('connection', function(conn) { + conn.on('error', function() { + // we are here when client drops connection + }); + conn.serverHandshake({ + protocolVersion: 10, + serverVersion: 'node.js rocks', + connectionId: 1234, + statusFlags: 2, + characterSet: 8, + capabilityFlags: 0xffffff + }); + conn.on('query', function(sql) { + conn.writeTextResult([ { '1': '1' } ], [ { catalog: 'def', + schema: '', + table: '', + orgTable: '', + name: '1', + orgName: '', + characterSet: 63, + columnLength: 1, + columnType: 8, + flags: 129, + decimals: 0 } ]); + }); + //conn.on('end', ); + }); + server.listen(3307, undefined, undefined, cb); + return server; +} + +module.exports.useTestDb = function(cb) { + // no-op in my setup, need it for compatibility with node-mysql tests +} + +module.exports.hrdiff = function(t1, t2) { + return t2[1] - t1[1] + (t2[0] - t1[0])*1e9; +}; diff --git a/node_modules/mysql2/test/create-500k-random-ints-doubles-table.sql b/node_modules/mysql2/test/create-500k-random-ints-doubles-table.sql new file mode 100644 index 0000000..ee4bcc7 --- /dev/null +++ b/node_modules/mysql2/test/create-500k-random-ints-doubles-table.sql @@ -0,0 +1,32 @@ +-- from http://sixarm.com/about/mysql-create-random-data-text-strings.html + +drop table if exists ints; +drop procedure if exists randomize_nums; + +CREATE TABLE ints ( + id int(11) NOT NULL AUTO_INCREMENT, + val1 int(11), + val2 double, + PRIMARY KEY (id) + ); + +delimiter $$ +create procedure randomize_nums() + begin + declare i int Default 0 ; + declare random int(20); + declare random1 double; + myloop: loop + set random=floor(rand() * 99999); + set random1=rand() * 99999 ; + insert into ints VALUES (i+1,random, random1) ; + set i=i+1; + if i=500000 then + leave myloop; + end if; + end loop myloop; + end $$ +delimiter ; + +call randomize_nums; + diff --git a/node_modules/mysql2/test/create-500k-random-rows-table.sql b/node_modules/mysql2/test/create-500k-random-rows-table.sql new file mode 100644 index 0000000..2f6a419 --- /dev/null +++ b/node_modules/mysql2/test/create-500k-random-rows-table.sql @@ -0,0 +1,29 @@ +-- from http://sixarm.com/about/mysql-create-random-data-text-strings.html + +drop table if exists foos; +drop procedure if exists randomizer; + +CREATE TABLE foos ( + id int(11) NOT NULL AUTO_INCREMENT, + name char(20), + PRIMARY KEY (id) + ); + +delimiter $$ +create procedure randomizer() + begin + declare i int Default 0 ; + declare random char(20); + myloop: loop + set random=conv(floor(rand() * 99999999999999), 20, 36) ; + insert into `foos` (`id`, `name`) VALUES (i+1,random) ; + set i=i+1; + if i=500000 then + leave myloop; + end if; + end loop myloop; + end $$ +delimiter ; + +call randomizer; + diff --git a/node_modules/mysql2/test/integration/connection/test-binary-charset-string.js b/node_modules/mysql2/test/integration/connection/test-binary-charset-string.js new file mode 100644 index 0000000..403011d --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-binary-charset-string.js @@ -0,0 +1,78 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; +var rows1 = undefined; +var fields1 = undefined; +var rows2 = undefined; +var fields2 = undefined; +var rows3 = undefined; +var fields3 = undefined; + +var rows4 = undefined; +var fields4 = undefined; +var rows5 = undefined; +var fields5 = undefined; + +var query = "SELECT x'010203'"; +var query1 = "SELECT '010203'"; + +connection.query(query, function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.query(query, function(err, _rows, _fields) { + if (err) throw err; + rows5 = _rows; + fields5 = _fields; +}); + +connection.query(query1, function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; + fields1 = _fields; +}); + +connection.execute(query, [], function(err, _rows, _fields) { + if (err) throw err; + rows2 = _rows; + fields2 = _fields; +}); + +// repeat same query - test cached fields and parser +connection.execute(query, [], function(err, _rows, _fields) { + if (err) throw err; + rows4 = _rows; + fields4 = _fields; +}); + +connection.execute(query1, [], function(err, _rows, _fields) { + if (err) throw err; + rows3 = _rows; + fields3 = _fields; +}); + +connection.end(); + + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{"x'010203'": Buffer([1, 2, 3])}]); + assert.equal(fields[0].name, "x'010203'"); + assert.deepEqual(rows1, [{'010203': '010203'}]); + assert.equal(fields1[0].name, "010203"); + assert.deepEqual(rows2, [{"x'010203'": Buffer([1, 2, 3])}]); + assert.equal(fields2[0].name, "x'010203'"); + assert.deepEqual(rows3, [{'010203': '010203'}]); + assert.equal(fields3[0].name, "010203"); + + assert.deepEqual(rows4, [{"x'010203'": Buffer([1, 2, 3])}]); + assert.equal(fields4[0].name, "x'010203'"); + assert.deepEqual(rows5, [{"x'010203'": Buffer([1, 2, 3])}]); + assert.equal(fields5[0].name, "x'010203'"); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-buffer-params.js b/node_modules/mysql2/test/integration/connection/test-buffer-params.js new file mode 100644 index 0000000..59a0950 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-buffer-params.js @@ -0,0 +1,28 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var rows1 = undefined; +var fields = undefined; +var fields1 = undefined; + +var buf = Buffer([0x80, 0x90, 1, 2, 3, 4, 5, 6, 7, 8, 9, 100, 100, 255, 255]); +connection.execute('SELECT HEX(?) as buf', [buf], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.query('SELECT HEX(?) as buf', [buf], function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; + fields1 = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{buf: buf.toString('hex').toUpperCase()}]); + assert.deepEqual(rows1, [{buf: buf.toString('hex').toUpperCase()}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-custom-date-parameter.js b/node_modules/mysql2/test/integration/connection/test-custom-date-parameter.js new file mode 100644 index 0000000..dae6fa7 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-custom-date-parameter.js @@ -0,0 +1,25 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; + +Date = function() { + var NativeDate = Date; + function CustomDate(str) { + return new NativeDate(str); + } + return CustomDate; +}(); + +connection.execute('SELECT UNIX_TIMESTAMP(?) t', [new Date('1990-08-08 UTC')], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + console.log(_rows, _fields); +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{t: 650073600}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-date-parameter.js b/node_modules/mysql2/test/integration/connection/test-date-parameter.js new file mode 100644 index 0000000..e2b1ddb --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-date-parameter.js @@ -0,0 +1,17 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; + +connection.execute('SELECT UNIX_TIMESTAMP(?) t', [new Date('1990-01-01 UTC')], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + console.log(_rows, _fields); +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{t: 631152000}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-datetime.js b/node_modules/mysql2/test/integration/connection/test-datetime.js new file mode 100644 index 0000000..a608db6 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-datetime.js @@ -0,0 +1,73 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var connection1 = common.createConnection({ dateStrings: true }); +var assert = require('assert'); + +var rows, rows1, rows2, rows3, rows4, rows5; + +var date = new Date('1990-01-01 08:15:11 UTC'); +var date1 = new Date('2000-03-03 08:15:11 UTC'); +var date2 = '2010-12-10 14:12:09.019473'; +connection.query('CREATE TEMPORARY TABLE t (d1 DATE)'); +connection.query('INSERT INTO t set d1=?', [date]); + +connection1.query('CREATE TEMPORARY TABLE t (d1 DATE, d2 TIMESTAMP, d3 DATETIME)'); +connection1.query('INSERT INTO t set d1=?, d2=?, d3=?', [date, date1, date2]); + +var dateAsStringExpected = [ + { d1: '1990-01-01', + d2: '2000-03-03 08:15:11', + d3: '2010-12-10 14:12:09' } ]; + + +connection.execute('select from_unixtime(?) t', [(+date).valueOf()/1000], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; +}); + +connection.query('select from_unixtime(631152000) t', function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; +}); + +connection.query('select * from t', function(err, _rows, _fields) { + if (err) throw err; + rows2 = _rows; +}); + +connection.execute('select * from t', function(err, _rows, _fields) { + if (err) throw err; + rows3 = _rows; +}); + +connection1.query('select * from t', function(err, _rows, _fields) { + console.log(_rows); + if (err) throw err; + rows4 = _rows; +}); + +connection1.execute('select * from t', function(err, _rows, _fields) { + console.log(_rows); + if (err) throw err; + rows5 = _rows; +}); + +connection.end(); +connection1.end(); + +process.on('exit', function() { + assert.equal(rows[0].t.constructor, Date); + assert.equal(rows[0].t.getDate(), date.getDate()); + assert.equal(rows[0].t.getHours(), date.getHours()); + assert.equal(rows[0].t.getMinutes(), date.getMinutes()); + assert.equal(rows[0].t.getSeconds(), date.getSeconds()); + + assert.equal(rows1[0].t.constructor, Date); + assert.equal(rows1[0].t - new Date('Mon Jan 01 1990 11:00:00 GMT+1100 (EST)'), 0); + + assert.equal(rows2[0].d1.getDate(), date.getDate()); + assert.equal(rows3[0].d1.getDate(), date.getDate()); + + assert.deepEqual(rows4, dateAsStringExpected); + assert.deepEqual(rows5, dateAsStringExpected); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-disconnects.js b/node_modules/mysql2/test/integration/connection/test-disconnects.js new file mode 100644 index 0000000..ed84064 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-disconnects.js @@ -0,0 +1,38 @@ +var common = require('../../common'); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; +var err; +var server; + +function test() { + var connection = common.createConnection({port: 3307}); + //var connection = require('mysql').createConnection({port: 3307}); + connection.query('SELECT 123', function(err, _rows, _fields) { + if (err) throw err; + + rows = _rows; + fields = _fields; + connection.on('error', function(_err) { + err = _err; + }); + server.connections.forEach(function(conn) { conn.stream.end() } ); + server._server.close(function() { + assert.equal(err.code, 'PROTOCOL_CONNECTION_LOST'); + }); + + // TODO: tests for 'commands after close' behavior + // connection.query('SELECT 123', function(err, a, b) { + // console.log(err, a, b); + // }); + }); + + // TODO: test connection.end() etc where we expect disconnect to happen +} +server = common.createServer(test); + +process.on('exit', function() { + assert.deepEqual(rows, [{1: 1}]); + assert.equal(fields[0].name, '1'); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-domains.js b/node_modules/mysql2/test/integration/connection/test-domains.js new file mode 100644 index 0000000..f7ee8b4 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-domains.js @@ -0,0 +1,60 @@ +var assert = require('assert'); +var domain = require('domain'); +var d1 = domain.create(); +var d2 = domain.create(); +var d3 = domain.create(); +var d4 = domain.create(); +var err1, err2, err3, err4; + +d1.run(function() { + var common = require('../../common'); + var connection = common.createConnection(); + var assert = require('assert'); + + d2.run(function() { + connection.query('SELECT 1', function(err, _rows, _fields) { + if (err) throw err; + throw new Error('inside domain 2'); + }); + }); + + d3.run(function() { + connection.execute('SELECT 1', function(err, _rows, _fields) { + if (err) throw err; + throw new Error('inside domain 3'); + }); + }); + + d4.run(function() { + connection.ping(function() { + throw new Error('inside domain 4'); + }); + }); + + connection.end(); + setTimeout(function() { + throw new Error('inside domain 1'); + }, 100); + + d2.on('error', function(err) { + err2 = err; + }); + d3.on('error', function(err) { + err3 = err; + }); + d4.on('error', function(err) { + err4 = err; + }); + +}); + +d1.on('error', function(err) { + err1 = err; +}); + +process.on('exit', function() { + assert.equal(''+err1, 'Error: inside domain 1') + assert.equal(''+err2, 'Error: inside domain 2') + assert.equal(''+err3, 'Error: inside domain 3') + assert.equal(''+err4, 'Error: inside domain 4') +}); diff --git a/node_modules/mysql2/test/integration/connection/test-errors.js b/node_modules/mysql2/test/integration/connection/test-errors.js new file mode 100644 index 0000000..999f273 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-errors.js @@ -0,0 +1,42 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var onExecuteResultError = undefined; +var onQueryResultError = undefined; +var onExecuteErrorEvent = undefined; +var onQueryErrorEvent = undefined; +var onExecuteErrorEvent1 = undefined; +var onQueryErrorEvent1 = undefined; + +connection.execute('error in execute', [], function(err, _rows, _fields) { + if (err) { + onExecuteResultError = true; + } +}).on('error', function() { + onExecuteErrorEvent = true; +}); +connection.query('error in query', [], function(err, _rows, _fields) { + if (err) { + onQueryResultError = true; + } +}).on('error', function() { + onQueryErrorEvent = true; +}); +connection.execute('error in execute 1', []).on('error', function() { + onExecuteErrorEvent1 = true; +}); +connection.query('error in query 1').on('error', function() { + onQueryErrorEvent1 = true; +}); + +connection.end(); + +process.on('exit', function() { + assert.equal(onExecuteResultError, true); + assert.equal(onQueryResultError, true); + assert.equal(onExecuteErrorEvent, undefined); + assert.equal(onQueryErrorEvent, undefined); + assert.equal(onExecuteErrorEvent1, true); + assert.equal(onQueryErrorEvent1, true); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-execute-1.js b/node_modules/mysql2/test/integration/connection/test-execute-1.js new file mode 100644 index 0000000..47c4255 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-execute-1.js @@ -0,0 +1,54 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var rows1 = undefined; +var fields = undefined; + +connection.query([ + 'CREATE TEMPORARY TABLE `announcements` (', + '`id` int(11) NOT NULL AUTO_INCREMENT,', + '`title` varchar(255) DEFAULT NULL,', + '`text` varchar(255) DEFAULT NULL,', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n'), function(err) { + if (err) throw err; +}); + +connection.execute('SELECT 1+? as test', [123], function(err, _rows, _fields) { + if (err) throw err; + + rows = _rows; + fields = _fields; +}); +connection.execute('SELECT 1 as test', function(err, _rows, _fields) { + if (err) throw err; + + rows1 = _rows; + fields = _fields; +}); + +connection.execute('INSERT INTO announcements(title, text) VALUES(?, ?)', ['Есть место, где заканчивается тротуар', 'Расти борода, расти'], function(err) { + if (err) throw err; +}); +connection.execute('INSERT INTO announcements(title, text) VALUES(?, ?)', ['Граждане Российской Федерации имеют право собираться мирно без оружия', 'проводить собрания, митинги и демонстрации, шествия и пикетирование'], function(err) { + if (err) throw err; +}); +connection.execute('SELECT * FROM announcements', function (err, rows) { + if (err) throw err; + assert.equal(rows.length, 2); + assert.equal(rows[0].title, 'Есть место, где заканчивается тротуар'); + assert.equal(rows[0].text, 'Расти борода, расти'); + assert.equal(rows[1].title, 'Граждане Российской Федерации имеют право собираться мирно без оружия'); + assert.equal(rows[1].text, 'проводить собрания, митинги и демонстрации, шествия и пикетирование'); +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{'test': 124}]); + assert.deepEqual(rows1, [{'test': 1}]); + assert.equal(fields[0].name, 'test'); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-execute-newdecimal.js b/node_modules/mysql2/test/integration/connection/test-execute-newdecimal.js new file mode 100644 index 0000000..7b317b1 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-execute-newdecimal.js @@ -0,0 +1,19 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +connection.query('CREATE TEMPORARY TABLE t (f DECIMAL(19,4))'); +connection.query('INSERT INTO t VALUES(12345.67)'); + +var rows, fields; +connection.execute('SELECT f FROM t', function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{'f': '12345.6700'}]); + assert.equal(fields[0].name, 'f'); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-execute-null-bitmap.js b/node_modules/mysql2/test/integration/connection/test-execute-null-bitmap.js new file mode 100644 index 0000000..4f03916 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-execute-null-bitmap.js @@ -0,0 +1,22 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var params = [1, 2]; +var query = 'select ? + ?'; + +function dotest() { + connection.execute(query + ' as t', params, function(err, _rows, _fields) { + assert.equal(err, null); + if (params.length < 50) { + assert.equal(_rows[0].t, params.reduce(function(x,y) {return x+y;})); + query += ' + ?'; + params.push(params.length); + dotest(); + } else { + connection.end(); + } + }); +} + +dotest(); diff --git a/node_modules/mysql2/test/integration/connection/test-execute-signed.js b/node_modules/mysql2/test/integration/connection/test-execute-signed.js new file mode 100644 index 0000000..1caef2a --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-execute-signed.js @@ -0,0 +1,31 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; + +connection.query([ + 'CREATE TEMPORARY TABLE `test_table` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`num` int(15),', + '`l` long,', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +connection.query('insert into test_table(num,l) values(?, 3)', [1]); +connection.query('insert into test_table(num,l) values(3-?, -10)', [5]); +connection.query('insert into test_table(num,l) values(4+?, 4000000-?)', [-5, 8000000]); + +connection.execute('SELECT * from test_table', [], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{"id":1,"num":1,"l": 3},{"id":2,"num":-2,"l":-10},{"id":3,"num":-1,"l":-4000000}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-execute-type-casting.js b/node_modules/mysql2/test/integration/connection/test-execute-type-casting.js new file mode 100644 index 0000000..d0eb809 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-execute-type-casting.js @@ -0,0 +1,72 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var tests = require('./type-casting-tests')(connection); + +var table = 'type_casting'; + +var schema = []; +var inserts = []; + +tests.forEach(function(test, index) { + var escaped = test.insertRaw || connection.escape(test.insert); + + test.columnName = test.type + '_' + index; + + schema.push('`' + test.columnName + '` ' + test.type + ','); + inserts.push('`' + test.columnName + '` = ' + escaped); +}); + +var createTable = [ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,' + ].concat(schema).concat([ + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +]).join('\n'); + +connection.query(createTable); + +connection.query('INSERT INTO ' + table + ' SET' + inserts.join(',\n')); + +var row; +connection.execute('SELECT * FROM ' + table + ' WHERE id = ?;', [1], function(err, rows) { + if (err) throw err; + + row = rows[0]; +}); + +connection.end(); + +process.on('exit', function() { + tests.forEach(function(test) { + var expected = test.expect || test.insert; + var got = row[test.columnName]; + var message; + + if (expected instanceof Date) { + assert.equal(got instanceof Date, true, test.type); + + expected = String(expected); + got = String(got); + } else if (Buffer.isBuffer(expected)) { + assert.equal(Buffer.isBuffer(got), true, test.type); + + expected = String(Array.prototype.slice.call(expected)); + got = String(Array.prototype.slice.call(got)); + } + + if (test.deep) { + message = 'got: "' + JSON.stringify(got) + '" expected: "' + JSON.stringify(expected) + + '" test: ' + test.type + ''; + assert.deepEqual(expected, got, message); + } else { + message = 'got: "' + got + '" (' + (typeof got) + ') expected: "' + expected + + '" (' + (typeof expected) + ') test: ' + test.type + ''; + assert.strictEqual(expected, got, message); + } + }); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-handshake-errors.js b/node_modules/mysql2/test/integration/connection/test-handshake-errors.js new file mode 100644 index 0000000..364d8ef --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-handshake-errors.js @@ -0,0 +1,24 @@ +var common = require('../../common'); +var assert = require('assert'); + +var conns = []; + +function spawn() { + var c = common.createConnection(); + c.ping(spawn); + conns.push(c); + + c.on('error', function(err) { + conns.forEach(function(c) { if (c) c.end(); }) + }); +} + +spawn(); + +process.on('uncaughtException', function(e) { + assert(false, 'should not have uncaught exceptions'); +}); + +process.on('exit', function() { + assert(conns.length > 0); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-insert-bigint.js b/node_modules/mysql2/test/integration/connection/test-insert-bigint.js new file mode 100644 index 0000000..885c797 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-insert-bigint.js @@ -0,0 +1,46 @@ +var common = require('../../common'); +var connection = common.createConnection({ bigNumberString: true }); +var assert = require('assert'); +var bn = require('bn.js'); + +var table = 'insert_test'; +connection.query([ + 'CREATE TEMPORARY TABLE `bigs` (', + '`id` bigint NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +var result, result2; +connection.query("INSERT INTO bigs SET title='test', id=123"); +connection.query("INSERT INTO bigs SET title='test1'", function(err, result) { + if (err) throw err; + assert.strictEqual(result.insertId, 124); + // > 24 bits + connection.query("INSERT INTO bigs SET title='test', id=123456789"); + connection.query("INSERT INTO bigs SET title='test2'", function(err, result) { + assert.strictEqual(result.insertId, 123456790); + // big int + connection.query("INSERT INTO bigs SET title='test', id=9007199254740992"); + connection.query("INSERT INTO bigs SET title='test3'", function(err, result) { + assert.strictEqual((new bn("9007199254740993")).cmp(result.insertId), 0); + connection.query("INSERT INTO bigs SET title='test', id=90071992547409924"); + connection.config.bigNumberStrings = true; + connection.query("INSERT INTO bigs SET title='test4'", function(err, result) { + assert.strictEqual(result.insertId, "90071992547409925"); + connection.query("select * from bigs", function(err, result) { + assert.strictEqual(result[0].id, 123); + assert.strictEqual(result[1].id, 124); + assert.strictEqual(result[2].id, 123456789); + assert.strictEqual(result[3].id, 123456790); + assert.strictEqual(result[4].id, 9007199254740992); + assert.strictEqual(result[5].id, "9007199254740993"); + assert.strictEqual(result[6].id, "90071992547409924"); + assert.strictEqual(result[7].id, "90071992547409925"); + connection.end(); + }); + }); + }); + }); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-insert-results.js b/node_modules/mysql2/test/integration/connection/test-insert-results.js new file mode 100644 index 0000000..4fa7fe2 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-insert-results.js @@ -0,0 +1,34 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +//common.useTestDb(connection); + +var table = 'insert_test'; +//var text = "本日は晴天なり"; +var text = " test test test "; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +var result, result2; +connection.query('INSERT INTO ' + table + ' SET title="' + text + '"', function(err, _result) { + if (err) throw err; + result = _result; + connection.query('SELECT * FROM ' + table + ' WHERE id = ' + result.insertId, function(err, _result2) { + result2 = _result2; + connection.end(); + }); +}); + +process.on('exit', function() { + assert.strictEqual(result.insertId, 1); + assert.strictEqual(result2.length, 1); + // TODO: type conversions + assert.equal(result2[0].id, String(result.insertId)); + assert.equal(result2[0].title, text); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-invalid-date-result.js b/node_modules/mysql2/test/integration/connection/test-invalid-date-result.js new file mode 100644 index 0000000..26d38a5 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-invalid-date-result.js @@ -0,0 +1,21 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; + +connection.execute('SELECT TIMESTAMP(0000-00-00) t', [], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; +}); + +connection.end(); + +function isInvalidTime(t) { + return isNaN(t.getTime()); +} + +process.on('exit', function() { + assert.deepEqual(Object.prototype.toString.call(rows[0].t), "[object Date]"); + assert.deepEqual(isInvalidTime(rows[0].t), true); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-multiple-results.js b/node_modules/mysql2/test/integration/connection/test-multiple-results.js new file mode 100644 index 0000000..5637acb --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-multiple-results.js @@ -0,0 +1,142 @@ +var mysql = require('../../common').createConnection({multipleStatements: true}); +var assert = require('assert'); +mysql.query('CREATE TEMPORARY TABLE no_rows (test int)'); +mysql.query('CREATE TEMPORARY TABLE some_rows (test int)'); +mysql.query('INSERT INTO some_rows values(0)'); +mysql.query('INSERT INTO some_rows values(42)'); +mysql.query('INSERT INTO some_rows values(314149)'); + +var clone = function(obj) { return JSON.parse(JSON.stringify(obj)); }; + +var rs1 = { + affectedRows: 0, + fieldCount: 0, + insertId: 0, + serverStatus: 10, + warningStatus: 0 +}; +var rs2 = clone(rs1); +rs2.serverStatus = 2; + +var twoInsertResult = [[rs1, rs2], [undefined, undefined], 2]; +var select1 = [{"1":"1"}]; +var select2 = [{"2":"2"}]; +var fields1 = [{ + catalog: "def", + characterSet: 63, + columnLength: 1, + columnType: 8, + decimals: 0, + flags: 129, + name: "1", + orgName: "", + orgTable: "", + schema: "", + table: "" +}]; +var nr_fields = [{ + catalog: "def", + characterSet: 63, + columnLength: 11, + columnType: 3, + decimals: 0, + flags: 0, + name: "test", + orgName: "test", + orgTable: "no_rows", + schema: "test", + table: "no_rows" +}]; +var sr_fields = clone(nr_fields); +sr_fields[0].orgTable = "some_rows"; +sr_fields[0].table = "some_rows"; +var select3 = [{"test":0},{"test":42},{"test":314149}]; + +var fields2 = clone(fields1); +fields2[0].name = "2"; + +var tests = [ + ["select * from some_rows", [select3,sr_fields,1]], // select 3 rows + ["SET @OLD_CHARACTER_SET_CLIENT=@@CHARACTER_SET_CLIENT; SET @OLD_CHARACTER_SET_RESULTS=@@CHARACTER_SET_RESULTS;", twoInsertResult], + ["/*!40101 SET @OLD_CHARACTER_SET_CLIENT=@@CHARACTER_SET_CLIENT */;/*!40101 SET @OLD_CHARACTER_SET_RESULTS=@@CHARACTER_SET_RESULTS */;", twoInsertResult], // issue #26 + ["set @a = 1", [rs2, undefined, 1]], // one insert result + ["set @a = 1; set @b = 2", twoInsertResult], + ["select 1; select 2", [[select1,select2],[fields1,fields2], 2]], + ["set @a = 1; select 1", [[rs1, select1], [undefined, fields1], 2]], + ["select 1; set @a = 1", [[select1, rs2], [fields1, undefined], 2]], + ["select * from no_rows", [[], nr_fields, 1]], // select 0 rows" + ["set @a = 1; select * from no_rows", [[rs1, []], [undefined, nr_fields], 2]], // insert + select 0 rows + ["select * from no_rows; set @a = 1", [[[], rs2], [nr_fields, undefined], 2]], // select 0 rows + insert + ["set @a = 1; select * from some_rows", [[rs1, select3],[undefined,sr_fields],2]], // insert + select 3 rows + ["select * from some_rows; set @a = 1", [[select3,rs2],[sr_fields,undefined],2]] // select 3 rows + insert +]; + +// TODO: tests with error in the query with different index +// TODO: multiple results from single query + +function do_test(testIndex) { + var entry = tests[testIndex]; + var sql = entry[0]; + var expectation = entry[1]; + mysql.query(sql, function(err, _rows, _columns) { + var _numResults = 0; + if (_rows.constructor.name == 'ResultSetHeader') + _numResults = 1; + else if (_rows.length === 0) { + // empty select + _numResults = 1; + } + else if (_rows.length > 0) { + if (_rows.constructor.name == 'Array' && _rows[0].constructor.name == 'TextRow') + _numResults = 1; + if (_rows.constructor.name == 'Array' && + (_rows[0].constructor.name == 'Array' || _rows[0].constructor.name =='ResultSetHeader')) + _numResults = _rows.length + } + if (err) { + console.log(err); + process.exit(-1); + } + assert.deepEqual(expectation, [_rows, _columns, _numResults]); + var q = mysql.query(sql); + var resIndex = 0; + var rowIndex = 0; + function checkRow(row, index) { + if (_numResults == 1) { + assert.equal(index, 0); + if (row.constructor.name == 'ResultSetHeader') + assert.deepEqual(_rows, row); + else + assert.deepEqual(_rows[rowIndex], row); + } else { + if (resIndex != index) { + rowIndex = 0; + resIndex = index; + } + if (row.constructor.name == 'ResultSetHeader') + assert.deepEqual(_rows[index], row); + else + assert.deepEqual(_rows[index][rowIndex], row); + } + rowIndex++; + } + function checkFields(fields, index) { + if (_numResults == 1) { + assert.equal(index, 0); + assert.deepEqual(_columns, fields); + } + else + assert.deepEqual(_columns[index], fields); + } + q.on('result', checkRow); + q.on('fields', checkFields); + q.on('end', function() { + if (testIndex + 1 < tests.length) + do_test(testIndex + 1); + else { + mysql.end(); + } + }); + }); +} +do_test(0); diff --git a/node_modules/mysql2/test/integration/connection/test-nested-tables-query.js b/node_modules/mysql2/test/integration/connection/test-nested-tables-query.js new file mode 100644 index 0000000..c6315e9 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-nested-tables-query.js @@ -0,0 +1,86 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var table = 'nested_test'; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +connection.query('INSERT INTO ' + table + ' SET ?', {title: 'test'}); + +var options1 = { + nestTables: true, + sql: 'SELECT * FROM ' + table +}; +var options2 = { + nestTables: '_', + sql: 'SELECT * FROM ' + table +}; +var options3 = { + rowsAsArray: true, + sql: 'SELECT * FROM ' + table +}; +var rows1, rows2, rows3, rows1e, rows2e, rows3e; + +connection.query(options1, function(err, _rows) { + if (err) throw err; + + rows1 = _rows; +}); + +connection.query(options2, function(err, _rows) { + if (err) throw err; + + rows2 = _rows; +}); + +connection.query(options3, function(err, _rows) { + if (err) throw err; + + rows3 = _rows; +}); + +connection.execute(options1, function(err, _rows) { + if (err) throw err; + + rows1e = _rows; +}); + +connection.execute(options2, function(err, _rows) { + if (err) throw err; + + rows2e = _rows; +}); + +connection.execute(options3, function(err, _rows) { + if (err) throw err; + + rows3e = _rows; +}); + +connection.end(); + +process.on('exit', function() { + assert.equal(rows1.length, 1); + assert.equal(rows1[0].nested_test.id, 1); + assert.equal(rows1[0].nested_test.title, 'test'); + + assert.equal(rows2.length, 1); + assert.equal(rows2[0].nested_test_id, 1); + assert.equal(rows2[0].nested_test_title, 'test'); + + assert.equal(Array.isArray(rows3[0]), true); + assert.equal(rows3[0][0], 1); + assert.equal(rows3[0][1], 'test'); + + assert.deepEqual(rows1, rows1e); + assert.deepEqual(rows2, rows2e); + assert.deepEqual(rows3, rows3e); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-null-double.js b/node_modules/mysql2/test/integration/connection/test-null-double.js new file mode 100644 index 0000000..3fa1eeb --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-null-double.js @@ -0,0 +1,21 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows; + +connection.query('CREATE TEMPORARY TABLE t (i int)'); +connection.query('INSERT INTO t VALUES(null)'); +connection.query('INSERT INTO t VALUES(123)'); + +connection.query('SELECT * from t', function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows[0], {i: null}); + assert.deepEqual(rows[1], {i: 123}); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-null-int.js b/node_modules/mysql2/test/integration/connection/test-null-int.js new file mode 100644 index 0000000..3fa1eeb --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-null-int.js @@ -0,0 +1,21 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows; + +connection.query('CREATE TEMPORARY TABLE t (i int)'); +connection.query('INSERT INTO t VALUES(null)'); +connection.query('INSERT INTO t VALUES(123)'); + +connection.query('SELECT * from t', function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows[0], {i: null}); + assert.deepEqual(rows[1], {i: 123}); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-null.js b/node_modules/mysql2/test/integration/connection/test-null.js new file mode 100644 index 0000000..1ea2b9e --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-null.js @@ -0,0 +1,28 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows, rows1; +var fields, fields1; + +connection.query('CREATE TEMPORARY TABLE t (i int)'); +connection.query('INSERT INTO t VALUES(null)'); +connection.query('SELECT cast(NULL AS CHAR)', function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); +connection.query('SELECT * from t', function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; + fields1 = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{'cast(NULL AS CHAR)': null}]); + assert.equal(fields[0].columnType, 253); + assert.deepEqual(rows1, [{'i': null}]); + assert.equal(fields1[0].columnType, 3); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-select-1.js b/node_modules/mysql2/test/integration/connection/test-select-1.js new file mode 100644 index 0000000..cc59619 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-select-1.js @@ -0,0 +1,19 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; +connection.query('SELECT 1', function(err, _rows, _fields) { + if (err) throw err; + + rows = _rows; + fields = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{1: 1}]); + assert.equal(fields[0].name, '1'); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-select-empty-string.js b/node_modules/mysql2/test/integration/connection/test-select-empty-string.js new file mode 100644 index 0000000..8e10ce7 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-select-empty-string.js @@ -0,0 +1,16 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows; +connection.query('SELECT ""', function(err, _rows) { + if (err) throw err; + + rows = _rows; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{'': ''}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-select-negative.js b/node_modules/mysql2/test/integration/connection/test-select-negative.js new file mode 100644 index 0000000..9442988 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-select-negative.js @@ -0,0 +1,27 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var rows1 = undefined; +var fields = undefined; +var fields1 = undefined; + +connection.execute('SELECT -1 v', [], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.query('SELECT -1 v', function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; + fields1 = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{v: -1}]); + assert.deepEqual(rows1, [{v: -1}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-select-utf8.js b/node_modules/mysql2/test/integration/connection/test-select-utf8.js new file mode 100644 index 0000000..54b5fc7 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-select-utf8.js @@ -0,0 +1,19 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; +var multibyteText = '本日は晴天なり'; +connection.query("SELECT '" + multibyteText + "'", function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.equal(rows[0][multibyteText], multibyteText); + assert.equal(fields[0].name, multibyteText); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-select-utf8mb4.js b/node_modules/mysql2/test/integration/connection/test-select-utf8mb4.js new file mode 100644 index 0000000..e26342d --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-select-utf8mb4.js @@ -0,0 +1,19 @@ +var common = require('../../common'); +var connection = common.createConnection({charset: 'UTF8MB4_GENERAL_CI'}); +var assert = require('assert'); + +var rows = undefined; +var fields = undefined; +var multibyteText = '𠜎 𠜱 𠝹 𠱓 𠱸 𠲖 𠳏 𠳕 𠴕 𠵼 𠵿 𠸎 𠸏 𠹷 𠺝 𠺢 '; +connection.query("SELECT '" + multibyteText + "'", function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); + +connection.end(); + +process.on('exit', function() { + assert.equal(rows[0][multibyteText], multibyteText); + assert.equal(fields[0].name, multibyteText); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-signed-tinyint.js b/node_modules/mysql2/test/integration/connection/test-signed-tinyint.js new file mode 100644 index 0000000..19fba63 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-signed-tinyint.js @@ -0,0 +1,20 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +var rows = undefined; + +connection.query('CREATE TEMPORARY TABLE signed_ints (b11 tinyint NOT NULL, b12 tinyint NOT NULL, b21 smallint NOT NULL)'); +connection.query('INSERT INTO signed_ints values (-3, -120, 500)'); +connection.query('INSERT INTO signed_ints values (3, -110, -500)'); + +connection.execute('SELECT * from signed_ints', [5], function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; +}); + +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows, [{"b11":-3,"b12":-120,"b21":500},{"b11":3,"b12":-110,"b21":-500}]); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-timestamp.js b/node_modules/mysql2/test/integration/connection/test-timestamp.js new file mode 100644 index 0000000..1773ed9 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-timestamp.js @@ -0,0 +1,36 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +connection.query('CREATE TEMPORARY TABLE t (f TIMESTAMP)'); +connection.query('INSERT INTO t VALUES(\'0000-00-00 00:00:00\')'); +connection.query('INSERT INTO t VALUES(\'2013-01-22 01:02:03\')'); + +var rows, fields; +var rows1, fields1; +connection.query('SELECT f FROM t', function(err, _rows, _fields) { + if (err) throw err; + rows = _rows; + fields = _fields; +}); +connection.execute('SELECT f FROM t', function(err, _rows, _fields) { + if (err) throw err; + rows1 = _rows; + fields1 = _fields; +}); +connection.end(); + +process.on('exit', function() { + assert.deepEqual(rows[0].f.toString(), 'Invalid Date'); + assert(rows[0].f instanceof Date); + assert(rows[1].f instanceof Date); + assert.equal(rows[1].f.getYear(), 113); + assert.equal(rows[1].f.getMonth(), 0); + assert.equal(rows[1].f.getDate(), 22); + assert.equal(rows[1].f.getHours(), 1); + assert.equal(rows[1].f.getMinutes(), 2); + assert.equal(rows[1].f.getSeconds(), 3); + assert.equal(fields[0].name, 'f'); + assert.deepEqual(rows[1], rows1[1]); + assert.deepEqual(fields, fields1); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-transaction-commit.js b/node_modules/mysql2/test/integration/connection/test-transaction-commit.js new file mode 100644 index 0000000..88386a9 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-transaction-commit.js @@ -0,0 +1,37 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var table = 'transaction_test'; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' + ].join('\n')); + +connection.beginTransaction(function (err) { + assert.ifError(err); + + var row = { + id: 1, + title: 'Test row' + }; + + connection.query('INSERT INTO ' + table + ' SET ?', row, function(err) { + assert.ifError(err); + + connection.commit(function(err) { + assert.ifError(err); + + connection.query('SELECT * FROM ' + table, function(err, rows) { + assert.ifError(err); + connection.end(); + assert.equal(rows.length, 1); + }); + }); + }); +}); \ No newline at end of file diff --git a/node_modules/mysql2/test/integration/connection/test-transaction-rollback.js b/node_modules/mysql2/test/integration/connection/test-transaction-rollback.js new file mode 100644 index 0000000..7cbae39 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-transaction-rollback.js @@ -0,0 +1,37 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var table = 'transaction_test'; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`title` varchar(255),', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' + ].join('\n')); + +connection.beginTransaction(function (err) { + assert.ifError(err); + + var row = { + id: 1, + title: 'Test row' + }; + + connection.query('INSERT INTO ' + table + ' SET ?', row, function(err) { + assert.ifError(err); + + connection.rollback(function(err) { + assert.ifError(err); + + connection.query('SELECT * FROM ' + table, function(err, rows) { + assert.ifError(err); + connection.end(); + assert.equal(rows.length, 0); + }); + }); + }); +}); \ No newline at end of file diff --git a/node_modules/mysql2/test/integration/connection/test-type-cast-null-fields.js b/node_modules/mysql2/test/integration/connection/test-type-cast-null-fields.js new file mode 100644 index 0000000..f5718f4 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-type-cast-null-fields.js @@ -0,0 +1,34 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var table = 'insert_test'; +connection.query([ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,', + '`date` DATETIME NULL,', + '`number` INT NULL,', + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +].join('\n')); + +connection.query('INSERT INTO ' + table + ' SET ?', { + date : null, + number : null, +}); + +var results; +connection.query('SELECT * FROM ' + table, function(err, _results) { + if (err) throw err; + + results = _results; +}); + +connection.end(); + +process.on('exit', function() { + assert.strictEqual(results[0].date, null); + assert.strictEqual(results[0].number, null); +}); diff --git a/node_modules/mysql2/test/integration/connection/test-type-casting.js b/node_modules/mysql2/test/integration/connection/test-type-casting.js new file mode 100644 index 0000000..5ad7761 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/test-type-casting.js @@ -0,0 +1,72 @@ +var common = require('../../common'); +var connection = common.createConnection(); +var assert = require('assert'); + +common.useTestDb(connection); + +var tests = require('./type-casting-tests')(connection); + +var table = 'type_casting'; + +var schema = []; +var inserts = []; + +tests.forEach(function(test, index) { + var escaped = test.insertRaw || connection.escape(test.insert); + + test.columnName = test.type + '_' + index; + + schema.push('`' + test.columnName + '` ' + test.type + ','); + inserts.push('`' + test.columnName + '` = ' + escaped); +}); + +var createTable = [ + 'CREATE TEMPORARY TABLE `' + table + '` (', + '`id` int(11) unsigned NOT NULL AUTO_INCREMENT,' + ].concat(schema).concat([ + 'PRIMARY KEY (`id`)', + ') ENGINE=InnoDB DEFAULT CHARSET=utf8' +]).join('\n'); + +connection.query(createTable); + +connection.query('INSERT INTO ' + table + ' SET' + inserts.join(',\n')); + +var row; +connection.query('SELECT * FROM type_casting', function(err, rows) { + if (err) throw err; + + row = rows[0]; +}); + +connection.end(); + +process.on('exit', function() { + tests.forEach(function(test) { + var expected = test.expect || test.insert; + var got = row[test.columnName]; + var message; + + if (expected instanceof Date) { + assert.equal(got instanceof Date, true, test.type); + + expected = String(expected); + got = String(got); + } else if (Buffer.isBuffer(expected)) { + assert.equal(Buffer.isBuffer(got), true, test.type); + + expected = String(Array.prototype.slice.call(expected)); + got = String(Array.prototype.slice.call(got)); + } + + if (test.deep) { + message = 'got: "' + JSON.stringify(got) + '" expected: "' + JSON.stringify(expected) + + '" test: ' + test.type + ''; + assert.deepEqual(expected, got, message); + } else { + message = 'got: "' + got + '" (' + (typeof got) + ') expected: "' + expected + + '" (' + (typeof expected) + ') test: ' + test.type + ''; + assert.strictEqual(expected, got, message); + } + }); +}); diff --git a/node_modules/mysql2/test/integration/connection/type-casting-tests.js b/node_modules/mysql2/test/integration/connection/type-casting-tests.js new file mode 100644 index 0000000..66f8173 --- /dev/null +++ b/node_modules/mysql2/test/integration/connection/type-casting-tests.js @@ -0,0 +1,53 @@ +module.exports = function(connection){ + return [ + {type: 'decimal(4,3)', insert: '1.234'}, +// {type: 'decimal(3,3)', insert: 0.33}, + {type: 'tinyint', insert: 1}, + {type: 'smallint', insert: 2}, + {type: 'int', insert: 3}, + {type: 'float', insert: 4.5}, + {type: 'double', insert: 5.5}, + {type: 'bigint', insert: '6', expect: 6}, + {type: 'bigint', insert: 6}, + {type: 'mediumint', insert: 7}, + {type: 'year', insert: 2012}, + {type: 'timestamp', insert: new Date('2012-05-12 11:00:23')}, + {type: 'datetime', insert: new Date('2012-05-12 12:00:23')}, + {type: 'date', insert: new Date('2012-05-12 00:00:00')}, + {type: 'time', insert: '13:13:23'}, + {type: 'time', insert: '-13:13:23'}, + {type: 'time', insert: '413:13:23'}, + {type: 'time', insert: '-413:13:23'}, + {type: 'binary(4)', insert: new Buffer([0, 1, 254, 255])}, + {type: 'varbinary(4)', insert: new Buffer([0, 1, 254, 255])}, + {type: 'tinyblob', insert: new Buffer([0, 1, 254, 255])}, + {type: 'mediumblob', insert: new Buffer([0, 1, 254, 255])}, + {type: 'longblob', insert: new Buffer([0, 1, 254, 255])}, + {type: 'blob', insert: new Buffer([0, 1, 254, 255])}, + {type: 'bit(32)', insert: new Buffer([0, 1, 254, 255])}, + {type: 'char(5)', insert: 'Hello'}, + {type: 'varchar(5)', insert: 'Hello'}, + {type: 'varchar(3) character set utf8 collate utf8_bin', insert: 'bin'}, + {type: 'tinytext', insert: 'Hello World'}, + {type: 'mediumtext', insert: 'Hello World'}, + {type: 'longtext', insert: 'Hello World'}, + {type: 'text', insert: 'Hello World'}, + {type: 'point', insertRaw: 'POINT(1.2,-3.4)', expect: {x:1.2, y:-3.4}, deep: true}, + {type: 'point', insertRaw: (function() { + var buffer = new Buffer(21); + buffer.writeUInt8(1, 0); + buffer.writeUInt32LE(1, 1); + buffer.writeDoubleLE(-5.6, 5); + buffer.writeDoubleLE(10.23, 13); + return 'GeomFromWKB(' + connection.escape(buffer) + ')'; + })(), expect: {x:-5.6, y:10.23}, deep: true}, + {type: 'point', insertRaw: '', insert: null, expect: null}, + {type: 'linestring', insertRaw: 'LINESTRING(POINT(1.2,-3.4),POINT(-5.6,10.23),POINT(0.2,0.7))', expect: [{x:1.2, y:-3.4}, {x:-5.6, y:10.23}, {x:0.2, y:0.7}], deep: true}, + {type: 'polygon', insertRaw: "GeomFromText('POLYGON((0 0,10 0,10 10,0 10,0 0),(5 5,7 5,7 7,5 7, 5 5))')", expect: [[{x:0,y:0},{x:10,y:0},{x:10,y:10},{x:0,y:10},{x:0,y:0}],[{x:5,y:5},{x:7,y:5},{x:7,y:7},{x:5,y:7},{x:5,y:5}]], deep: true}, + {type: 'geometry', insertRaw: 'POINT(1.2,-3.4)', expect: {x:1.2, y:-3.4}, deep: true}, + {type: 'multipoint', insertRaw: "GeomFromText('MULTIPOINT(0 0, 20 20, 60 60)')", expect: [{x:0, y:0}, {x:20, y:20}, {x:60, y:60}], deep: true}, + {type: 'multilinestring', insertRaw: "GeomFromText('MULTILINESTRING((10 10, 20 20), (15 15, 30 15))')", expect: [[{x:10,y:10},{x:20,y:20}],[{x:15,y:15},{x:30,y:15}]], deep: true}, + {type: 'multipolygon', insertRaw: "GeomFromText('MULTIPOLYGON(((0 0,10 0,10 10,0 10,0 0)),((5 5,7 5,7 7,5 7, 5 5)))')", expect: [[[{x:0,y:0},{x:10,y:0},{x:10,y:10},{x:0,y:10},{x:0,y:0}]],[[{x:5,y:5},{x:7,y:5},{x:7,y:7},{x:5,y:7},{x:5,y:5}]]], deep: true}, + {type: 'geometrycollection', insertRaw: "GeomFromText('GEOMETRYCOLLECTION(POINT(11 10), POINT(31 30), LINESTRING(15 15, 20 20))')", expect: [{x:11,y:10},{x:31,y:30},[{x:15,y:15},{x:20,y:20}]], deep: true} + ]; +}; diff --git a/node_modules/mysql2/test/run.js b/node_modules/mysql2/test/run.js new file mode 100755 index 0000000..42fdee2 --- /dev/null +++ b/node_modules/mysql2/test/run.js @@ -0,0 +1,8 @@ +#!/usr/bin/env node + +var options = {}; + +if (process.env.FILTER) { + options.include = new RegExp(process.env.FILTER + '.*\\.js$'); +} +require('urun')(__dirname, options); diff --git a/node_modules/mysql2/test/template.jade b/node_modules/mysql2/test/template.jade new file mode 100644 index 0000000..a475e51 --- /dev/null +++ b/node_modules/mysql2/test/template.jade @@ -0,0 +1,5 @@ +html + body + ul#users + each record in records + li(class='user-' + record.id) #{record.name} diff --git a/node_modules/mysql2/test/unit/packets/test-ok-autoinc.js b/node_modules/mysql2/test/unit/packets/test-ok-autoinc.js new file mode 100644 index 0000000..74bbda5 --- /dev/null +++ b/node_modules/mysql2/test/unit/packets/test-ok-autoinc.js @@ -0,0 +1,9 @@ +var assert = require('assert'); +var packets = require('../../../lib/packets/index.js'); + +var packet = packets.OK.toPacket({affectedRows: 0, insertId: 1}); + +// 5 bytes for an OK packet, plus one byte to store affectedRows plus one byte to store the insertId +assert.equal( packet.length(), 7, + 'OK packets with 0 affectedRows and a minimal insertId should be '+ + '7 bytes long, got '+packet.length()+' byte(s)' ); diff --git a/node_modules/mysql2/ttt.js b/node_modules/mysql2/ttt.js new file mode 100644 index 0000000..fc1b3e2 --- /dev/null +++ b/node_modules/mysql2/ttt.js @@ -0,0 +1,17 @@ +var fs = require('fs'); +var mysql = require('./index.js'); +var conn = mysql.createConnection({ + user: 'root', + password: '', + database: 'test', + host: '127.0.0.1', + port: '3307', + debug: true, + compress: 1, + }); + +setTimeout(function() { +conn.query('select * from mil limit 1000', function(err, res) { + console.log(res); +}); +}, 10); diff --git a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/lru-cache/package.json b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/lru-cache/package.json index 4472725..0acc7b8 100644 --- a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/lru-cache/package.json +++ b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/lru-cache/package.json @@ -29,5 +29,5 @@ }, "homepage": "https://github.com/isaacs/node-lru-cache", "_id": "lru-cache@2.5.0", - "_from": "lru-cache@2" + "_from": "lru-cache@>=2.0.0 <3.0.0" } diff --git a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/sigmund/package.json b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/sigmund/package.json index cb7e2bd..94b6453 100644 --- a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/sigmund/package.json +++ b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/node_modules/sigmund/package.json @@ -38,5 +38,5 @@ }, "homepage": "https://github.com/isaacs/sigmund", "_id": "sigmund@1.0.0", - "_from": "sigmund@~1.0.0" + "_from": "sigmund@>=1.0.0 <1.1.0" } diff --git a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/package.json b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/package.json index 0fe147d..b0691e5 100644 --- a/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/package.json +++ b/node_modules/nodeunit/node_modules/tap/node_modules/glob/node_modules/minimatch/package.json @@ -35,7 +35,7 @@ "homepage": "https://github.com/isaacs/minimatch", "_id": "minimatch@0.3.0", "_shasum": "275d8edaac4f1bb3326472089e7949c8394699dd", - "_from": "minimatch@0.3", + "_from": "minimatch@>=0.3.0 <0.4.0", "_npmVersion": "1.4.10", "_npmUser": { "name": "isaacs", diff --git a/node_modules/nodeunit/node_modules/tap/node_modules/nopt/node_modules/abbrev/package.json b/node_modules/nodeunit/node_modules/tap/node_modules/nopt/node_modules/abbrev/package.json index 1dad5f2..a4127b6 100644 --- a/node_modules/nodeunit/node_modules/tap/node_modules/nopt/node_modules/abbrev/package.json +++ b/node_modules/nodeunit/node_modules/tap/node_modules/nopt/node_modules/abbrev/package.json @@ -24,7 +24,7 @@ "homepage": "https://github.com/isaacs/abbrev-js", "_id": "abbrev@1.0.5", "_shasum": "5d8257bd9ebe435e698b2fa431afde4fe7b10b03", - "_from": "abbrev@1", + "_from": "abbrev@>=1.0.0 <2.0.0", "_npmVersion": "1.4.7", "_npmUser": { "name": "isaacs", diff --git a/node_modules/serve-favicon/node_modules/etag/node_modules/crc/package.json b/node_modules/serve-favicon/node_modules/etag/node_modules/crc/package.json index 5d8586f..712dbd8 100644 --- a/node_modules/serve-favicon/node_modules/etag/node_modules/crc/package.json +++ b/node_modules/serve-favicon/node_modules/etag/node_modules/crc/package.json @@ -53,5 +53,6 @@ "tarball": "http://registry.npmjs.org/crc/-/crc-3.0.0.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/crc/-/crc-3.0.0.tgz" + "_resolved": "https://registry.npmjs.org/crc/-/crc-3.0.0.tgz", + "readme": "ERROR: No README data found!" } diff --git a/node_modules/serve-favicon/node_modules/etag/package.json b/node_modules/serve-favicon/node_modules/etag/package.json index c33c203..63ab888 100644 --- a/node_modules/serve-favicon/node_modules/etag/package.json +++ b/node_modules/serve-favicon/node_modules/etag/package.json @@ -53,7 +53,7 @@ "homepage": "https://github.com/jshttp/etag", "_id": "etag@1.3.1", "_shasum": "e51925728688a32dc4eea1cfa9ab4f734d055567", - "_from": "etag@~1.3.1", + "_from": "etag@1.3.1", "_npmVersion": "1.4.21", "_npmUser": { "name": "dougwilson", @@ -70,5 +70,6 @@ "tarball": "http://registry.npmjs.org/etag/-/etag-1.3.1.tgz" }, "directories": {}, - "_resolved": "https://registry.npmjs.org/etag/-/etag-1.3.1.tgz" + "_resolved": "https://registry.npmjs.org/etag/-/etag-1.3.1.tgz", + "readme": "ERROR: No README data found!" }